diff --git a/.buildinfo b/.buildinfo new file mode 100644 index 00000000..dba1e600 --- /dev/null +++ b/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: da875f307eedd0d9bc7af72daeda205d +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/.doctrees/about/changelog.doctree b/.doctrees/about/changelog.doctree new file mode 100644 index 00000000..841befaa Binary files /dev/null and b/.doctrees/about/changelog.doctree differ diff --git a/.doctrees/about/license.doctree b/.doctrees/about/license.doctree new file mode 100644 index 00000000..e0dda466 Binary files /dev/null and b/.doctrees/about/license.doctree differ diff --git a/.doctrees/dev/contributing.doctree b/.doctrees/dev/contributing.doctree new file mode 100644 index 00000000..5a140d64 Binary files /dev/null and b/.doctrees/dev/contributing.doctree differ diff --git a/.doctrees/dev/dev_installation.doctree b/.doctrees/dev/dev_installation.doctree new file mode 100644 index 00000000..6004178e Binary files /dev/null and b/.doctrees/dev/dev_installation.doctree differ diff --git a/.doctrees/environment.pickle b/.doctrees/environment.pickle new file mode 100644 index 00000000..47b31c79 Binary files /dev/null and b/.doctrees/environment.pickle differ diff --git a/.doctrees/fundamentals/index.doctree b/.doctrees/fundamentals/index.doctree new file mode 100644 index 00000000..55c67e82 Binary files /dev/null and b/.doctrees/fundamentals/index.doctree differ diff --git a/.doctrees/index.doctree b/.doctrees/index.doctree new file mode 100644 index 00000000..7332304d Binary files /dev/null and b/.doctrees/index.doctree differ diff --git a/.doctrees/installation/index.doctree b/.doctrees/installation/index.doctree new file mode 100644 index 00000000..4fb7f83b Binary files /dev/null and b/.doctrees/installation/index.doctree differ diff --git a/.doctrees/reference/cli.doctree b/.doctrees/reference/cli.doctree new file mode 100644 index 00000000..48ed98d7 Binary files /dev/null and b/.doctrees/reference/cli.doctree differ diff --git a/.doctrees/reference/cli_subcommands/createinputs.doctree b/.doctrees/reference/cli_subcommands/createinputs.doctree new file mode 100644 index 00000000..b8363b22 Binary files /dev/null and b/.doctrees/reference/cli_subcommands/createinputs.doctree differ diff --git a/.doctrees/reference/cli_subcommands/description.doctree b/.doctrees/reference/cli_subcommands/description.doctree new file mode 100644 index 00000000..56656ac2 Binary files /dev/null and b/.doctrees/reference/cli_subcommands/description.doctree differ diff --git a/.doctrees/reference/cli_subcommands/descriptionquality.doctree b/.doctrees/reference/cli_subcommands/descriptionquality.doctree new file mode 100644 index 00000000..f1acc412 Binary files /dev/null and b/.doctrees/reference/cli_subcommands/descriptionquality.doctree differ diff --git a/.doctrees/reference/cli_subcommands/plot.doctree b/.doctrees/reference/cli_subcommands/plot.doctree new file mode 100644 index 00000000..88542d53 Binary files /dev/null and b/.doctrees/reference/cli_subcommands/plot.doctree differ diff --git a/.doctrees/reference/cli_subcommands/plotauto.doctree b/.doctrees/reference/cli_subcommands/plotauto.doctree new file mode 100644 index 00000000..4dffad15 Binary files /dev/null and b/.doctrees/reference/cli_subcommands/plotauto.doctree differ diff --git a/.doctrees/reference/cli_subcommands/plotautoia.doctree b/.doctrees/reference/cli_subcommands/plotautoia.doctree new file mode 100644 index 00000000..b4a43c8a Binary files /dev/null and b/.doctrees/reference/cli_subcommands/plotautoia.doctree differ diff --git a/.doctrees/reference/cli_subcommands/plotdos.doctree b/.doctrees/reference/cli_subcommands/plotdos.doctree new file mode 100644 index 00000000..168a0740 Binary files /dev/null and b/.doctrees/reference/cli_subcommands/plotdos.doctree differ diff --git a/.doctrees/reference/cli_subcommands/ploticohpdistance.doctree b/.doctrees/reference/cli_subcommands/ploticohpdistance.doctree new file mode 100644 index 00000000..45b7edbf Binary files /dev/null and b/.doctrees/reference/cli_subcommands/ploticohpdistance.doctree differ diff --git a/.doctrees/reference/index.doctree b/.doctrees/reference/index.doctree new file mode 100644 index 00000000..433c04e3 Binary files /dev/null and b/.doctrees/reference/index.doctree differ diff --git a/.doctrees/reference/lobsterpy.cohp.analyze.Analysis.doctree b/.doctrees/reference/lobsterpy.cohp.analyze.Analysis.doctree new file mode 100644 index 00000000..ca2a2105 Binary files /dev/null and b/.doctrees/reference/lobsterpy.cohp.analyze.Analysis.doctree differ diff --git a/.doctrees/reference/lobsterpy.cohp.analyze.doctree b/.doctrees/reference/lobsterpy.cohp.analyze.doctree new file mode 100644 index 00000000..142b7f44 Binary files /dev/null and b/.doctrees/reference/lobsterpy.cohp.analyze.doctree differ diff --git a/.doctrees/reference/lobsterpy.cohp.describe.Description.doctree b/.doctrees/reference/lobsterpy.cohp.describe.Description.doctree new file mode 100644 index 00000000..35288a9d Binary files /dev/null and b/.doctrees/reference/lobsterpy.cohp.describe.Description.doctree differ diff --git a/.doctrees/reference/lobsterpy.cohp.describe.doctree b/.doctrees/reference/lobsterpy.cohp.describe.doctree new file mode 100644 index 00000000..ee01fbc0 Binary files /dev/null and b/.doctrees/reference/lobsterpy.cohp.describe.doctree differ diff --git a/.doctrees/reference/lobsterpy.cohp.doctree b/.doctrees/reference/lobsterpy.cohp.doctree new file mode 100644 index 00000000..c11ea207 Binary files /dev/null and b/.doctrees/reference/lobsterpy.cohp.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.batch.BatchCoxxFingerprint.doctree b/.doctrees/reference/lobsterpy.featurize.batch.BatchCoxxFingerprint.doctree new file mode 100644 index 00000000..a03cc808 Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.batch.BatchCoxxFingerprint.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.batch.BatchDosFeaturizer.doctree b/.doctrees/reference/lobsterpy.featurize.batch.BatchDosFeaturizer.doctree new file mode 100644 index 00000000..5c43857c Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.batch.BatchDosFeaturizer.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.batch.BatchStructureGraphs.doctree b/.doctrees/reference/lobsterpy.featurize.batch.BatchStructureGraphs.doctree new file mode 100644 index 00000000..36b38b6e Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.batch.BatchStructureGraphs.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.batch.BatchSummaryFeaturizer.doctree b/.doctrees/reference/lobsterpy.featurize.batch.BatchSummaryFeaturizer.doctree new file mode 100644 index 00000000..32ef8775 Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.batch.BatchSummaryFeaturizer.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.batch.doctree b/.doctrees/reference/lobsterpy.featurize.batch.doctree new file mode 100644 index 00000000..96a61cad Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.batch.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.core.CoxxFingerprint.doctree b/.doctrees/reference/lobsterpy.featurize.core.CoxxFingerprint.doctree new file mode 100644 index 00000000..1038de6b Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.core.CoxxFingerprint.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.core.DosFingerprint.doctree b/.doctrees/reference/lobsterpy.featurize.core.DosFingerprint.doctree new file mode 100644 index 00000000..a8f18e16 Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.core.DosFingerprint.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.core.FeaturizeCOXX.doctree b/.doctrees/reference/lobsterpy.featurize.core.FeaturizeCOXX.doctree new file mode 100644 index 00000000..e929a360 Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.core.FeaturizeCOXX.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.core.FeaturizeCharges.doctree b/.doctrees/reference/lobsterpy.featurize.core.FeaturizeCharges.doctree new file mode 100644 index 00000000..7f8a372c Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.core.FeaturizeCharges.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.core.FeaturizeDoscar.doctree b/.doctrees/reference/lobsterpy.featurize.core.FeaturizeDoscar.doctree new file mode 100644 index 00000000..19276bb4 Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.core.FeaturizeDoscar.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.core.FeaturizeLobsterpy.doctree b/.doctrees/reference/lobsterpy.featurize.core.FeaturizeLobsterpy.doctree new file mode 100644 index 00000000..a7c89574 Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.core.FeaturizeLobsterpy.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.core.doctree b/.doctrees/reference/lobsterpy.featurize.core.doctree new file mode 100644 index 00000000..bc0a5306 Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.core.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.doctree b/.doctrees/reference/lobsterpy.featurize.doctree new file mode 100644 index 00000000..a0a672ec Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.utils.doctree b/.doctrees/reference/lobsterpy.featurize.utils.doctree new file mode 100644 index 00000000..d0ff6946 Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.utils.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.utils.get_file_paths.doctree b/.doctrees/reference/lobsterpy.featurize.utils.get_file_paths.doctree new file mode 100644 index 00000000..ff6a1a2f Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.utils.get_file_paths.doctree differ diff --git a/.doctrees/reference/lobsterpy.featurize.utils.get_structure_path.doctree b/.doctrees/reference/lobsterpy.featurize.utils.get_structure_path.doctree new file mode 100644 index 00000000..0e8c66ef Binary files /dev/null and b/.doctrees/reference/lobsterpy.featurize.utils.get_structure_path.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.IcohpDistancePlotter.doctree b/.doctrees/reference/lobsterpy.plotting.IcohpDistancePlotter.doctree new file mode 100644 index 00000000..24a4c90d Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.IcohpDistancePlotter.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.InteractiveCohpPlotter.doctree b/.doctrees/reference/lobsterpy.plotting.InteractiveCohpPlotter.doctree new file mode 100644 index 00000000..124f916f Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.InteractiveCohpPlotter.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.PlainCohpPlotter.doctree b/.doctrees/reference/lobsterpy.plotting.PlainCohpPlotter.doctree new file mode 100644 index 00000000..67465ae5 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.PlainCohpPlotter.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.PlainDosPlotter.doctree b/.doctrees/reference/lobsterpy.plotting.PlainDosPlotter.doctree new file mode 100644 index 00000000..a77dad10 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.PlainDosPlotter.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.TYPE_CHECKING.doctree b/.doctrees/reference/lobsterpy.plotting.TYPE_CHECKING.doctree new file mode 100644 index 00000000..90855f7d Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.TYPE_CHECKING.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.doctree b/.doctrees/reference/lobsterpy.plotting.doctree new file mode 100644 index 00000000..bad420f5 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.get_style_list.doctree b/.doctrees/reference/lobsterpy.plotting.get_style_list.doctree new file mode 100644 index 00000000..1e921ac0 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.get_style_list.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.layout_dicts.cohp_axis_style_dict.doctree b/.doctrees/reference/lobsterpy.plotting.layout_dicts.cohp_axis_style_dict.doctree new file mode 100644 index 00000000..c508dba6 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.layout_dicts.cohp_axis_style_dict.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.layout_dicts.doctree b/.doctrees/reference/lobsterpy.plotting.layout_dicts.doctree new file mode 100644 index 00000000..18d6c789 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.layout_dicts.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.layout_dicts.energy_axis_style_dict.doctree b/.doctrees/reference/lobsterpy.plotting.layout_dicts.energy_axis_style_dict.doctree new file mode 100644 index 00000000..17cbcb8d Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.layout_dicts.energy_axis_style_dict.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.layout_dicts.layout_dict.doctree b/.doctrees/reference/lobsterpy.plotting.layout_dicts.layout_dict.doctree new file mode 100644 index 00000000..37891b96 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.layout_dicts.layout_dict.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.layout_dicts.legend_style_dict.doctree b/.doctrees/reference/lobsterpy.plotting.layout_dicts.legend_style_dict.doctree new file mode 100644 index 00000000..e4890925 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.layout_dicts.legend_style_dict.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.layout_dicts.spin_down_trace_style_dict.doctree b/.doctrees/reference/lobsterpy.plotting.layout_dicts.spin_down_trace_style_dict.doctree new file mode 100644 index 00000000..51c937d0 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.layout_dicts.spin_down_trace_style_dict.doctree differ diff --git a/.doctrees/reference/lobsterpy.plotting.layout_dicts.spin_up_trace_style_dict.doctree b/.doctrees/reference/lobsterpy.plotting.layout_dicts.spin_up_trace_style_dict.doctree new file mode 100644 index 00000000..a4c85ba5 Binary files /dev/null and b/.doctrees/reference/lobsterpy.plotting.layout_dicts.spin_up_trace_style_dict.doctree differ diff --git a/.doctrees/reference/lobsterpy.structuregraph.doctree b/.doctrees/reference/lobsterpy.structuregraph.doctree new file mode 100644 index 00000000..9b31558c Binary files /dev/null and b/.doctrees/reference/lobsterpy.structuregraph.doctree differ diff --git a/.doctrees/reference/lobsterpy.structuregraph.graph.LobsterGraph.doctree b/.doctrees/reference/lobsterpy.structuregraph.graph.LobsterGraph.doctree new file mode 100644 index 00000000..b7ce937e Binary files /dev/null and b/.doctrees/reference/lobsterpy.structuregraph.graph.LobsterGraph.doctree differ diff --git a/.doctrees/reference/lobsterpy.structuregraph.graph.TYPE_CHECKING.doctree b/.doctrees/reference/lobsterpy.structuregraph.graph.TYPE_CHECKING.doctree new file mode 100644 index 00000000..0cff2273 Binary files /dev/null and b/.doctrees/reference/lobsterpy.structuregraph.graph.TYPE_CHECKING.doctree differ diff --git a/.doctrees/reference/lobsterpy.structuregraph.graph.doctree b/.doctrees/reference/lobsterpy.structuregraph.graph.doctree new file mode 100644 index 00000000..d4864c69 Binary files /dev/null and b/.doctrees/reference/lobsterpy.structuregraph.graph.doctree differ diff --git a/.doctrees/tutorial/atomateauto.doctree b/.doctrees/tutorial/atomateauto.doctree new file mode 100644 index 00000000..3b993a9d Binary files /dev/null and b/.doctrees/tutorial/atomateauto.doctree differ diff --git a/.doctrees/tutorial/commandlineinterface.doctree b/.doctrees/tutorial/commandlineinterface.doctree new file mode 100644 index 00000000..6a13f231 Binary files /dev/null and b/.doctrees/tutorial/commandlineinterface.doctree differ diff --git a/.doctrees/tutorial/computingtimes.doctree b/.doctrees/tutorial/computingtimes.doctree new file mode 100644 index 00000000..345007d9 Binary files /dev/null and b/.doctrees/tutorial/computingtimes.doctree differ diff --git a/.doctrees/tutorial/index.doctree b/.doctrees/tutorial/index.doctree new file mode 100644 index 00000000..77563cd9 Binary files /dev/null and b/.doctrees/tutorial/index.doctree differ diff --git a/.doctrees/tutorial/tutorial.doctree b/.doctrees/tutorial/tutorial.doctree new file mode 100644 index 00000000..e869ded2 Binary files /dev/null and b/.doctrees/tutorial/tutorial.doctree differ diff --git a/.nojekyll b/.nojekyll new file mode 100644 index 00000000..e69de29b diff --git a/_downloads/8f717a44707c0b40f1d30cb8055189c3/CdF2.html b/_downloads/8f717a44707c0b40f1d30cb8055189c3/CdF2.html new file mode 100644 index 00000000..fb28558c --- /dev/null +++ b/_downloads/8f717a44707c0b40f1d30cb8055189c3/CdF2.html @@ -0,0 +1,14 @@ + + + +
+
+ + \ No newline at end of file diff --git a/_downloads/bdff33f4f22a5d2dc65348c72950861a/CdF2_orb.html b/_downloads/bdff33f4f22a5d2dc65348c72950861a/CdF2_orb.html new file mode 100644 index 00000000..8bc21ffa --- /dev/null +++ b/_downloads/bdff33f4f22a5d2dc65348c72950861a/CdF2_orb.html @@ -0,0 +1,14 @@ + + + +
+
+ + \ No newline at end of file diff --git a/_images/1d07e5140d0d75de580740e07277e4561d46cc0a4f1ec6c6c704ed194f7aebc4.png b/_images/1d07e5140d0d75de580740e07277e4561d46cc0a4f1ec6c6c704ed194f7aebc4.png new file mode 100644 index 00000000..dec6167c Binary files /dev/null and b/_images/1d07e5140d0d75de580740e07277e4561d46cc0a4f1ec6c6c704ed194f7aebc4.png differ diff --git a/_images/2d54735f5044a57c6567b1c4002b4b29f964bf6d3302d951c35b97ec72a2507c.png b/_images/2d54735f5044a57c6567b1c4002b4b29f964bf6d3302d951c35b97ec72a2507c.png new file mode 100644 index 00000000..da18f195 Binary files /dev/null and b/_images/2d54735f5044a57c6567b1c4002b4b29f964bf6d3302d951c35b97ec72a2507c.png differ diff --git a/_images/COHP.png b/_images/COHP.png new file mode 100644 index 00000000..f18a9f4c Binary files /dev/null and b/_images/COHP.png differ diff --git a/_images/COHP_330.png b/_images/COHP_330.png new file mode 100644 index 00000000..b34c7674 Binary files /dev/null and b/_images/COHP_330.png differ diff --git a/_images/COOP_330.png b/_images/COOP_330.png new file mode 100644 index 00000000..678ca0ce Binary files /dev/null and b/_images/COOP_330.png differ diff --git a/_images/DOS_example.png b/_images/DOS_example.png new file mode 100644 index 00000000..a9f9f5ae Binary files /dev/null and b/_images/DOS_example.png differ diff --git a/_images/ICOHP.png b/_images/ICOHP.png new file mode 100644 index 00000000..72f307da Binary files /dev/null and b/_images/ICOHP.png differ diff --git a/_images/ICOHPs_distance_example.png b/_images/ICOHPs_distance_example.png new file mode 100644 index 00000000..eac2140c Binary files /dev/null and b/_images/ICOHPs_distance_example.png differ diff --git a/_images/LobsterEnv_schema.png b/_images/LobsterEnv_schema.png new file mode 100644 index 00000000..2ec580ae Binary files /dev/null and b/_images/LobsterEnv_schema.png differ diff --git a/_images/afbd6a6bc5a11efdd2703acad2b6427c0eb83e2368678112ce1135dca1862655.png b/_images/afbd6a6bc5a11efdd2703acad2b6427c0eb83e2368678112ce1135dca1862655.png new file mode 100644 index 00000000..ef270779 Binary files /dev/null and b/_images/afbd6a6bc5a11efdd2703acad2b6427c0eb83e2368678112ce1135dca1862655.png differ diff --git a/_images/bonding_percentage.png b/_images/bonding_percentage.png new file mode 100644 index 00000000..27ed6106 Binary files /dev/null and b/_images/bonding_percentage.png differ diff --git a/_images/ddf3a24eabac3b28102f693621a09761a81e70343cbcc73bb10a45e66ce52741.png b/_images/ddf3a24eabac3b28102f693621a09761a81e70343cbcc73bb10a45e66ce52741.png new file mode 100644 index 00000000..bd392b9d Binary files /dev/null and b/_images/ddf3a24eabac3b28102f693621a09761a81e70343cbcc73bb10a45e66ce52741.png differ diff --git a/_images/e2165a70b41c507ecff8d1c22b970f58a6804dd98d8b7c83a4c95ae31a628e1f.png b/_images/e2165a70b41c507ecff8d1c22b970f58a6804dd98d8b7c83a4c95ae31a628e1f.png new file mode 100644 index 00000000..d075d164 Binary files /dev/null and b/_images/e2165a70b41c507ecff8d1c22b970f58a6804dd98d8b7c83a4c95ae31a628e1f.png differ diff --git a/_images/orbital_wise_illustration.png b/_images/orbital_wise_illustration.png new file mode 100644 index 00000000..f188542f Binary files /dev/null and b/_images/orbital_wise_illustration.png differ diff --git a/_modules/index.html b/_modules/index.html new file mode 100644 index 00000000..13af875e --- /dev/null +++ b/_modules/index.html @@ -0,0 +1,487 @@ + + + + + + + + + + Overview: module code — lobsterpy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + + + + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/lobsterpy/cohp/analyze.html b/_modules/lobsterpy/cohp/analyze.html new file mode 100644 index 00000000..2c82438f --- /dev/null +++ b/_modules/lobsterpy/cohp/analyze.html @@ -0,0 +1,2236 @@ + + + + + + + + + + lobsterpy.cohp.analyze — lobsterpy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for lobsterpy.cohp.analyze

+# Copyright (c) lobsterpy development team
+# Distributed under the terms of a BSD 3-Clause "New" or "Revised" License
+
+"""This module defines classes to analyze the COHPs automatically."""
+
+from __future__ import annotations
+
+import warnings
+from collections import Counter
+from itertools import combinations_with_replacement, permutations
+from pathlib import Path
+
+import numpy as np
+from pymatgen.analysis.bond_valence import BVAnalyzer
+from pymatgen.core.structure import Structure
+from pymatgen.electronic_structure.cohp import CompleteCohp
+from pymatgen.electronic_structure.core import Spin
+from pymatgen.electronic_structure.dos import LobsterCompleteDos
+from pymatgen.io.lobster import (
+    Bandoverlaps,
+    Charge,
+    Doscar,
+    Icohplist,
+    Lobsterin,
+    Lobsterout,
+    MadelungEnergies,
+)
+from pymatgen.io.lobster.lobsterenv import LobsterNeighbors
+from pymatgen.io.vasp.outputs import Vasprun
+from pymatgen.symmetry.analyzer import SpacegroupAnalyzer
+
+
+
+[docs] +class Analysis: + """ + Class to automatically analyze COHP/COOP/COBI populations from Lobster. + + :param are_cobis: bool indicating if file contains COBI/ICOBI data + :param are_coops: bool indicating if file contains COOP/ICOOP data + :param cutoff_icohp: Cutoff in percentage for evaluating neighbors based on ICOHP values. + cutoff_icohp*max_icohp limits the number of considered neighbours for evaluating environments. + :param path_to_cohpcar: path to `COHPCAR.lobster` or `COBICAR.lobster` or `COOPCAR.lobster` . + :param path_to_charge: path to `CHARGE.lobster`. + :param path_to_icohplist: path to `ICOHPLIST.lobster` or `ICOBILIST.lobster` or `ICOOPLIST.lobster`. + :param path_to_poscar: path to structure (e.g., `POSCAR` or `POSCAR.lobster`) + :param path_to_madelung: path to `MadelungEnergies.lobster`. + :param charge_obj: pymatgen lobster.io.charge object + :param completecohp_obj: pymatgen.electronic_structure.cohp.CompleteCohp object + :param icohplist_obj: pymatgen lobster.io.Icohplist object + :param madelung_obj: pymatgen lobster.io.MadelungEnergies object + :param noise_cutoff: Sets the lower limit tolerance for ICOHPs or ICOOPs or ICOBIs considered + in analysis. + :param orbital_cutoff: Sets the minimum percentage for the orbital contribution considered to be + relevant in orbital resolved analysis. (Affects only when orbital_resolved argument is set to True) + Set it to 0 to get results of all orbitals in the detected relevant bonds. Default is to 0.05 i.e. + only analyzes if orbital contribution is 5 % or more. + :param orbital_resolved: bool indicating whether orbital wise analysis is performed + :param type_charge: If no path_to_charge is given, Valences will be used. Otherwise, Mulliken charges. + Löwdin charges cannot be selected at the moment. + :param which_bonds: Selects kinds of bonds that are analyzed. `cation-anion` is the default. + Alternatively, `all` bonds can also be selected. Support to other kinds of bonds will be + added soon. + :param summed_spins: if True, COHP `Spin.up` and `Spin.down` populations will be summed + :param start: sets the lower limit of energy for evaluation of bonding and antibonding + percentages below efermi. Defaults to None (i.e., all populations below efermi are included) + + Attributes: + - condensed_bonding_analysis: dict including a summary of the most important bonding properties + - final_dict_bonds: dict including information on ICOHPs per bond type + - final_dict_ions: dict including information on environments of cations + - chemenv: pymatgen.io.lobster.lobsterenv.LobsterNeighbors object + - lse: LightStructureEnvironment from pymatgen + - anion_types: Set of Element objects from pymatgen + - list_equivalent_sites: list of site indices of sites that indicate which sites are equivalent + e.g., [0 1 2 2 2] where site 0, 1, 2 indicate sites that are independent from each other + - seq_cohps: list of cohps + - seq_coord_ions: list of co-ordination environment strings for each cation + - seq_equivalent_sites: seq of inequivalent sites + - seq_ineq_ions: seq of inequivalent cations/sites in the structure + - seq_infos_bonds (list): information on cation anion bonds (lists + of pymatgen.io.lobster.lobsterenv.ICOHPNeighborsInfo) + - spg: space group information + - structure: Structure object + + """ + + def __init__( + self, + path_to_poscar: str | Path | None, + path_to_icohplist: str | Path | None, + path_to_cohpcar: str | Path | None, + path_to_charge: str | Path | None = None, + path_to_madelung: str | Path | None = None, + icohplist_obj: Icohplist | None = None, + completecohp_obj: CompleteCohp | None = None, + charge_obj: Charge | None = None, + madelung_obj: MadelungEnergies | None = None, + are_cobis: bool = False, + are_coops: bool = False, + cutoff_icohp: float = 0.1, + noise_cutoff: float = 0.1, + orbital_cutoff: float = 0.05, + orbital_resolved: bool = False, + start: float | None = None, + summed_spins: bool = True, + type_charge: str | None = None, + which_bonds: str = "cation-anion", + ): + """ + Initialize automatic bonding analysis. + + :param are_cobis: bool indicating if file contains COBI/ICOBI data + :param are_coops: bool indicating if file contains COOP/ICOOP data + :param cutoff_icohp: Cutoff in percentage for evaluating neighbors based on ICOHP values. + cutoff_icohp*max_icohp limits the number of considered neighbours for evaluating environments. + :param path_to_cohpcar: path to `COHPCAR.lobster` or `COBICAR.lobster` or `COOPCAR.lobster` . + :param path_to_charge: path to `CHARGE.lobster`. + :param path_to_icohplist: path to `ICOHPLIST.lobster` or `ICOBILIST.lobster` or `ICOOPLIST.lobster`. + :param path_to_poscar: path to structure (e.g., `POSCAR` or `POSCAR.lobster`) + :param path_to_madelung: path to `MadelungEnergies.lobster`. + :param charge_obj: pymatgen lobster.io.charge object (Optional) + :param completecohp_obj: pymatgen.electronic_structure.cohp.CompleteCohp object + :param icohplist_obj: pymatgen lobster.io.Icohplist object + :param madelung_obj: pymatgen lobster.io.MadelungEnergies object + :param noise_cutoff: Sets the lower limit tolerance for ICOHPs or ICOOPs or ICOBIs considered + in analysis. + :param orbital_cutoff: Sets the minimum percentage for the orbital contribution considered to be + relevant in orbital resolved analysis. (Affects only when orbital_resolved argument is set to True) + Set it to 0 to get results of all orbitals in the detected relevant bonds. Default is to 0.05 i.e. + only analyzes if orbital contribution is 5 % or more. + :param orbital_resolved: bool indicating whether orbital wise analysis is performed + :param type_charge: If no path_to_charge is given, Valences will be used. Otherwise, Mulliken charges. + Löwdin charges cannot be selected at the moment. + :param which_bonds: Selects kinds of bonds that are analyzed. `cation-anion` is the default. + Alternatively, `all` bonds can also be selected. Support to other kinds of bonds will be + added soon. + :param summed_spins: if True, COHP `Spin.up` and `Spin.down` populations will be summed + :param start: sets the lower limit of energy for evaluation of bonding and antibonding + percentages below efermi. Defaults to None (i.e., all populations below efermi are included) + + """ + self.start = start + self.completecohp_obj = completecohp_obj + self.icohplist_obj = icohplist_obj + # checks to ensure LobsterEnv inputs are not duplicated in case users provide both path and obj + if self.completecohp_obj is not None and self.icohplist_obj is not None: + self.path_to_poscar = None + self.path_to_cohpcar = None + self.path_to_icohplist = None + else: + self.path_to_poscar = path_to_poscar + self.path_to_icohplist = path_to_icohplist + self.path_to_cohpcar = path_to_cohpcar + self.which_bonds = which_bonds + self.cutoff_icohp = cutoff_icohp + self.orbital_cutoff = orbital_cutoff + self.path_to_charge = path_to_charge + self.charge_obj = charge_obj + self.path_to_madelung = path_to_madelung + self.madelung_obj = madelung_obj + self.are_cobis = are_cobis + self.are_coops = are_coops + self.noise_cutoff = noise_cutoff + self.setup_env() + self.get_information_all_bonds(summed_spins=summed_spins) + self.orbital_resolved = orbital_resolved + + # This determines how cations and anions + if path_to_charge is None and charge_obj is None: + self.type_charge = "Valences" + else: + if type_charge is None: + self.type_charge = "Mulliken" + elif type_charge == "Mulliken": + self.type_charge = "Mulliken" + elif type_charge == "Löwdin": + raise ValueError("Only Mulliken charges can be used here at the moment. Implementation will follow.") + else: + self.type_charge = "Valences" + print("type_charge cannot be read! Please use Mulliken/Löwdin. Now, we will use valences") + + self.set_condensed_bonding_analysis() + self.set_summary_dicts() + self.path_to_madelung = path_to_madelung + +
+[docs] + def setup_env(self): + """ + Set up the light structure environments based on COHPs using this method. + + Returns: + None + + """ + self.structure = ( + Structure.from_file(self.path_to_poscar) if self.path_to_poscar else self.completecohp_obj.structure + ) + sga = SpacegroupAnalyzer(structure=self.structure) + symmetry_dataset = sga.get_symmetry_dataset() + equivalent_sites = symmetry_dataset["equivalent_atoms"] + self.list_equivalent_sites = equivalent_sites + self.seq_equivalent_sites = list(set(equivalent_sites)) + self.spg = symmetry_dataset["international"] + + if self.which_bonds == "cation-anion": + try: + self.chemenv = LobsterNeighbors( + filename_icohp=self.path_to_icohplist, + obj_icohp=self.icohplist_obj, + structure=self.structure, + additional_condition=1, + perc_strength_icohp=self.cutoff_icohp, + filename_charge=self.path_to_charge, + obj_charge=self.charge_obj, + valences=None, + valences_from_charges=True, + adapt_extremum_to_add_cond=True, + are_cobis=self.are_cobis, + are_coops=self.are_coops, + noise_cutoff=self.noise_cutoff, + ) + except ValueError as err: + if ( + str(err) == "min() arg is an empty sequence" + or str(err) == "All valences are equal to 0, additional_conditions 1, 3, 5 and 6 will not work" + ): + raise ValueError( + "Consider switching to an analysis of all bonds and not only cation-anion bonds." + " It looks like no cations are detected." + ) + raise err + elif self.which_bonds == "all": + # raise ValueError("only cation anion bonds implemented so far") + self.chemenv = LobsterNeighbors( + filename_icohp=self.path_to_icohplist, + obj_icohp=self.icohplist_obj, + structure=self.structure, + additional_condition=0, + perc_strength_icohp=self.cutoff_icohp, + filename_charge=self.path_to_charge, + obj_charge=self.charge_obj, + valences_from_charges=True, + adapt_extremum_to_add_cond=True, + are_cobis=self.are_cobis, + are_coops=self.are_coops, + noise_cutoff=self.noise_cutoff, + ) + + else: + raise ValueError("only cation anion and all bonds implemented so far") + + # determine cations and anions + try: + if self.which_bonds == "cation-anion": + self.lse = self.chemenv.get_light_structure_environment(only_cation_environments=True) + elif self.which_bonds == "all": + self.lse = self.chemenv.get_light_structure_environment(only_cation_environments=False) + except ValueError: + + class Lse: + """Test class when error was raised.""" + + def __init__(self, chemenv, valences=None): + """ + Test class when error was raised. + + :param chemenv: LobsterNeighbors object + :param valences: list of valences + + """ + if valences is None: + self.coordination_environments = [] + for coord in chemenv: + if len(coord) > 0: + self.coordination_environments.append([{"ce_symbol": str(len(coord))}]) + else: + self.coordination_environments.append([{"ce_symbol": None}]) + else: + self.coordination_environments = [] + + for val, coord in zip(valences, chemenv): + if val >= 0.0 and len(coord) > 0: + self.coordination_environments.append([{"ce_symbol": str(len(coord))}]) + else: + self.coordination_environments.append([{"ce_symbol": None}]) + + if self.which_bonds == "all": + self.lse = Lse(self.chemenv.list_coords) + elif self.which_bonds == "cation-anion": + # make a new list + self.lse = Lse(self.chemenv.list_coords, self.chemenv.valences)
+ + +
+[docs] + def get_information_all_bonds(self, summed_spins: bool = True): + """ + Gather all information on the bonds within the compound with this method. + + Returns: + None + + """ + if self.which_bonds == "cation-anion": + # this will only analyze cation anion bonds which simplifies the analysis + self.seq_ineq_ions = [] + self.seq_coord_ions = [] + self.seq_infos_bonds = [] + self.seq_labels_cohps = [] + self.seq_cohps = [] + # only_bonds_to + + self.anion_types = self.chemenv.anion_types + for ice, ce in enumerate(self.lse.coordination_environments): + # only look at inequivalent sites (use of symmetry to speed everything up!)! + # only look at those cations that have cation-anion bonds + if ice in self.seq_equivalent_sites and ce[0]["ce_symbol"] is not None: + self.seq_ineq_ions.append(ice) + + self.seq_coord_ions.append(ce[0]["ce_symbol"]) + self.seq_infos_bonds.append(self.chemenv.get_info_icohps_to_neighbors([ice])) + + aniontype_labels = [] + aniontype_cohps = [] + + # go through all anions in the structure! + for anion in self.anion_types: + # get labels and summed cohp objects + labels, summedcohps = self.chemenv.get_info_cohps_to_neighbors( + path_to_cohpcar=self.path_to_cohpcar, + obj_cohpcar=self.completecohp_obj, + isites=[ice], + summed_spin_channels=summed_spins, + per_bond=False, + only_bonds_to=[str(anion)], + ) + + aniontype_labels.append(labels) + aniontype_cohps.append(summedcohps) + + self.seq_labels_cohps.append(aniontype_labels) + self.seq_cohps.append(aniontype_cohps) + + elif self.which_bonds == "all": + # this will only analyze all bonds + + self.seq_ineq_ions = [] + self.seq_coord_ions = [] + self.seq_infos_bonds = [] + self.seq_labels_cohps = [] + self.seq_cohps = [] + # only_bonds_to + self.elements = self.structure.composition.elements + # self.anion_types = self.chemenv.get_anion_types() + for ice, ce in enumerate(self.lse.coordination_environments): + # only look at inequivalent sites (use of symmetry to speed everything up!)! + # only look at those cations that have cation-anion bonds + if ice in self.seq_equivalent_sites and ce[0]["ce_symbol"] is not None: + self.seq_ineq_ions.append(ice) + self.seq_coord_ions.append(ce[0]["ce_symbol"]) + self.seq_infos_bonds.append(self.chemenv.get_info_icohps_to_neighbors([ice])) + + type_labels = [] + type_cohps = [] + + for element in self.elements: + # get labels and summed cohp objects + labels, summedcohps = self.chemenv.get_info_cohps_to_neighbors( + path_to_cohpcar=self.path_to_cohpcar, + obj_cohpcar=self.completecohp_obj, + isites=[ice], + onlycation_isites=False, + summed_spin_channels=summed_spins, + per_bond=False, + only_bonds_to=[str(element)], + ) + + type_labels.append(labels) + type_cohps.append(summedcohps) + + self.seq_labels_cohps.append(type_labels) + self.seq_cohps.append(type_cohps)
+ + +
+[docs] + def get_site_bond_resolved_labels(self): + """ + Return relevant bond labels for each symmetrically independent site. + + Returns: + dict with bond labels for each site, e.g. + {'Na1: Na-Cl': ['21', '23', '24', '27', '28', '30']} + + """ + bonds = [[] for _ in range(len(self.seq_infos_bonds))] # type: ignore + labels = [[] for _ in range(len(self.seq_infos_bonds))] # type: ignore + for inx, bond_info in enumerate(self.seq_infos_bonds): + for ixx, val in enumerate(bond_info.atoms): + label_srt = sorted(val.copy()) + bonds[inx].append( + self.structure.sites[bond_info.central_isites[0]].species_string + + str(bond_info.central_isites[0] + 1) + + ": " + + label_srt[0].strip("0123456789") + + "-" + + label_srt[1].strip("0123456789") + ) + labels[inx].append(bond_info.labels[ixx]) + + label_data = {} + for indx, atom_pairs in enumerate(bonds): + searched_atom_pairs = set(atom_pairs) + for search_item in searched_atom_pairs: + indices = [i for i, pair in enumerate(atom_pairs) if pair == search_item] + filtered_bond_label_list = [labels[indx][i] for i in indices] + label_data.update({search_item: filtered_bond_label_list}) + + return label_data
+ + + def _get_orbital_resolved_data( + self, + nameion: str, + iion: int, + labels: list[str], + bond_resolved_labels: dict[str, list[str]], + type_pop: str, + ): + """ + Retrieve orbital-wise analysis data. + + :param nameion: name of symmetrically relevant cation or anion + :param iion: index of symmetrically relevant cation or anion + :param labels: list of bond label names + :param bond_resolved_labels: dict of bond labels from ICOHPLIST resolved for each bond + :param type_pop: population type analyzed. e.g. COHP or COOP or COBI + + Returns: + dict consisting of relevant orbitals (contribution > 5 % to overall ICOHP or ICOBI or ICOOP), + bonding and antibonding percentages with bond label names as keys. + """ + orb_resolved_bond_info = {} + for label in labels: + if label is not None: + bond_resolved_label_key = nameion + str(iion + 1) + ":" + label.split("x")[-1] + bond_labels = bond_resolved_labels[bond_resolved_label_key] + orb_combinations = self._get_orb_combinations() + grouped_orb_pairs = self._group_orb_pairs(bond_label=bond_labels[0], orb_combinations=orb_combinations) + # available_orbitals = list(self.chemenv.completecohp.orb_res_cohp[bond_labels[0]].keys()) + # initialize empty list to store orb paris for bonding, + # antibonding integrals and percentages + bndg_orb_pair_list = [] + bndg_orb_integral_list = [] + bndg_orb_perc_list = [] + bndg_orb_icohp_list = [] + antibndg_orb_integral_list = [] + antibndg_orb_perc_list = [] + antibndg_orb_pair_list = [] + antibndg_orb_icohp_list = [] + + # get total summed cohps using label list + cohp_summed = self.chemenv.completecohp.get_summed_cohp_by_label_list(label_list=bond_labels) + if type_pop.lower() == "cohp": + ( + antibndg_tot, + per_anti_tot, + bndg_tot, + per_bndg_tot, + ) = self._integrate_antbdstates_below_efermi(cohp=cohp_summed, start=self.start) + else: + ( + bndg_tot, + per_bndg_tot, + antibndg_tot, + per_anti_tot, + ) = self._integrate_antbdstates_below_efermi(cohp=cohp_summed, start=self.start) + + orb_bonding_dict_data = {} # type: ignore + # For each orbital collect the contributions of summed bonding + # and antibonding interactions separately + for orb in grouped_orb_pairs: + mapped_bond_labels = self._get_bond_orb_label_mapped_list( + bond_labels=bond_labels, orb_pair=grouped_orb_pairs, root_orb_pair=orb + ) + # for orb in available_orbitals: + cohp_summed_orb = self.chemenv.completecohp.get_summed_cohp_by_label_and_orbital_list( + label_list=mapped_bond_labels, orbital_list=grouped_orb_pairs[orb] * len(bond_labels) + ) + + if type_pop.lower() == "cohp": + ( + antibndg_orb, + per_anti_orb, + bndg_orb, + per_bndg_orb, + ) = self._integrate_antbdstates_below_efermi(cohp=cohp_summed_orb, start=self.start) + else: + ( + bndg_orb, + per_bndg_orb, + antibndg_orb, + per_anti_orb, + ) = self._integrate_antbdstates_below_efermi(cohp=cohp_summed_orb, start=self.start) + + # replace nan values with zero (tackle numerical integration issues) + bndg_orb = bndg_orb if not np.isnan(bndg_orb) else 0 + per_bndg_orb = per_bndg_orb if not np.isnan(per_bndg_orb) else 0 + bndg_tot = bndg_tot if not np.isnan(bndg_tot) else 0 + per_bndg_tot = per_bndg_tot if not np.isnan(per_bndg_tot) else 0 + # skip collecting orb contributions if no summed bonding contribution exists + if bndg_tot > 0: + orb_icohps_bndg = [] + for bond_label in bond_labels: + for sub_orb in grouped_orb_pairs[orb]: + orb_icohp_bn = self.chemenv.Icohpcollection.get_icohp_by_label( + label=bond_label, orbitals=sub_orb + ) + orb_icohps_bndg.append(orb_icohp_bn) + bndg_orb_pair_list.append(orb) + bndg_orb_icohp_list.append(orb_icohps_bndg) + bndg_orb_integral_list.append(bndg_orb) + bndg_orb_perc_list.append(per_bndg_orb) + + # replace nan values with zero (tackle numerical integration issues) + antibndg_orb = antibndg_orb if not np.isnan(antibndg_orb) else 0 + per_anti_orb = per_anti_orb if not np.isnan(per_anti_orb) else 0 + antibndg_tot = antibndg_tot if not np.isnan(antibndg_tot) else 0 + per_anti_tot = per_anti_tot if not np.isnan(per_anti_tot) else 0 + # skip collecting orb contributions if no summed antibonding contribution exists + if antibndg_tot > 0: + orb_icohps_anti = [] + for bond_label in bond_labels: + for sub_orb in grouped_orb_pairs[orb]: + orb_icohp_an = self.chemenv.Icohpcollection.get_icohp_by_label( + label=bond_label, orbitals=sub_orb + ) + orb_icohps_anti.append(orb_icohp_an) + + antibndg_orb_pair_list.append(orb) + antibndg_orb_icohp_list.append(orb_icohps_anti) + antibndg_orb_integral_list.append(antibndg_orb) + antibndg_orb_perc_list.append(per_anti_orb) + + # Populate the dictionary with relevant orbitals for bonding interactions + for inx, bndg_orb_pair in enumerate(bndg_orb_pair_list): + bndg_contri_perc = round(bndg_orb_integral_list[inx] / sum(bndg_orb_integral_list), 2) + # filter out very small bonding interactions (<self.orbital_cutoff) + if bndg_contri_perc > self.orbital_cutoff: + if bndg_orb_pair in orb_bonding_dict_data: + orb_bonding_dict_data[bndg_orb_pair].update( + { + "orb_contribution_perc_bonding": bndg_contri_perc, + "bonding": { + "integral": bndg_orb_integral_list[inx], + "perc": bndg_orb_perc_list[inx], + }, + } + ) + else: + orb_bonding_dict_data[bndg_orb_pair] = { + f"I{type_pop}_mean": round(np.mean(bndg_orb_icohp_list[inx]), 4), + f"I{type_pop}_sum": round(np.sum(bndg_orb_icohp_list[inx]), 4), + "orb_contribution_perc_bonding": round( + bndg_orb_integral_list[inx] / sum(bndg_orb_integral_list), + 2, + ), + "bonding": { + "integral": bndg_orb_integral_list[inx], + "perc": bndg_orb_perc_list[inx], + }, + "relevant_sub_orbitals": grouped_orb_pairs[bndg_orb_pair], + } + + # Populate the dictionary with relevant orbitals for antibonding interactions + for inx, antibndg_orb_pair in enumerate(antibndg_orb_pair_list): + antibndg_contri_perc = round( + antibndg_orb_integral_list[inx] / sum(antibndg_orb_integral_list), + 2, + ) + # filter out very small antibonding interactions (<self.orbital_cutoff) + if antibndg_contri_perc > self.orbital_cutoff: + if antibndg_orb_pair in orb_bonding_dict_data: + orb_bonding_dict_data[antibndg_orb_pair].update( + { + "orb_contribution_perc_antibonding": round( + antibndg_orb_integral_list[inx] / sum(antibndg_orb_integral_list), + 2, + ), + "antibonding": { + "integral": antibndg_orb_integral_list[inx], + "perc": antibndg_orb_perc_list[inx], + }, + } + ) + else: + orb_bonding_dict_data[antibndg_orb_pair] = { + f"I{type_pop}_mean": round(np.mean(antibndg_orb_icohp_list[inx]), 4), + f"I{type_pop}_sum": round(np.sum(antibndg_orb_icohp_list[inx]), 4), + "orb_contribution_perc_antibonding": round( + antibndg_orb_integral_list[inx] / sum(antibndg_orb_integral_list), + 2, + ), + "antibonding": { + "integral": antibndg_orb_integral_list[inx], + "perc": antibndg_orb_perc_list[inx], + }, + "relevant_sub_orbitals": grouped_orb_pairs[antibndg_orb_pair], + } + + orb_bonding_dict_data["relevant_bonds"] = bond_labels # type: ignore + + orb_resolved_bond_info[bond_resolved_label_key] = orb_bonding_dict_data + + return orb_resolved_bond_info + + def _get_bond_resolved_data_stats(self, orb_resolved_bond_data: dict): + """ + Retrieve the maximum bonding and anti-bonding orbital contributions. + + :param orb_resolved_bond_data: A dictionary with orbital names as keys and corresponding bonding data + + Returns: + dict with orbital data stats the site for relevant orbitals, e.g. + {'orbital_summary_stats': {'max_bonding_contribution': {'3p-3p': 0.41}, + 'max_antibonding_contribution': {'3s-3p': 0.39}}} + + """ + # get max orbital bonding and contribution for the site + orb_pairs_bndg = [] + orb_pairs_antibndg = [] + orb_contri_bndg = [] + orb_contri_antibndg = [] + orbital_summary_stats = {"orbital_summary_stats": {}} # type: ignore + if orb_resolved_bond_data: + for orb_pair, data in orb_resolved_bond_data.items(): + if "orb_contribution_perc_bonding" in data: + orb_pairs_bndg.append(orb_pair) + orb_contri_bndg.append(data["orb_contribution_perc_bonding"]) + + if "orb_contribution_perc_antibonding" in data: + orb_pairs_antibndg.append(orb_pair) + orb_contri_antibndg.append(data["orb_contribution_perc_antibonding"]) + + if orb_contri_bndg: + max_orb_contri_bndg = max(orb_contri_bndg) + max_orb_contri_bndg_inxs = [ + inx for inx, orb_contri in enumerate(orb_contri_bndg) if orb_contri == max_orb_contri_bndg + ] + max_orb_contri_bndg_dict = {} + for inx in max_orb_contri_bndg_inxs: + max_orb_contri_bndg_dict[orb_pairs_bndg[inx]] = orb_contri_bndg[inx] + orbital_summary_stats["orbital_summary_stats"]["max_bonding_contribution"] = max_orb_contri_bndg_dict + if orb_contri_antibndg: + max_orb_contri_antibndg = max(orb_contri_antibndg) + max_antibndg_contri_inxs = [ + inx + for inx, orb_anti_per in enumerate(orb_contri_antibndg) + if orb_anti_per == max_orb_contri_antibndg + ] + max_antibndg_contri_dict = {} + for inx in max_antibndg_contri_inxs: + max_antibndg_contri_dict[orb_pairs_antibndg[inx]] = orb_contri_antibndg[inx] + orbital_summary_stats["orbital_summary_stats"]["max_antibonding_contribution"] = ( + max_antibndg_contri_dict + ) + + return orbital_summary_stats + +
+[docs] + def get_site_orbital_resolved_labels(self): + """ + Return relevant orbitals and bond labels for each symmetrically independent site. + + Returns: + dict with bond labels for each site for relevant orbitals, e.g. + {'Na1: Na-Cl': {'3p-3s': {'bond_labels': ['21', '23', '24', '27', '28', '30'], + 'relevant_sub_orbitals': ['3py-3s', '3pz-3s', '3px-3s']}} + """ + site_bond_labels = self.get_site_bond_resolved_labels() + orb_plot_data = {atom_pair: {} for atom_pair in site_bond_labels} + if self.orbital_resolved: + for site_index, cba_data in self.condensed_bonding_analysis["sites"].items(): + for atom in cba_data["bonds"]: + for orb_pair in cba_data["bonds"][atom]["orbital_data"]: + if orb_pair not in ("orbital_summary_stats", "relevant_bonds"): + atom_pair = [cba_data["ion"], atom] + atom_pair.sort() + key = ( + self.structure.sites[site_index].species_string + + str(site_index + 1) + + ": " + + "-".join(atom_pair) + ) + label_list = site_bond_labels[key] + relevant_sub_orbitals = cba_data["bonds"][atom]["orbital_data"][orb_pair][ + "relevant_sub_orbitals" + ] + orb_plot_data[key].update( + {orb_pair: {"bond_labels": label_list, "relevant_sub_orbitals": relevant_sub_orbitals}} + ) + else: + print("Please set orbital_resolved to True when instantiating Analysis object, to get this data") + + return orb_plot_data
+ + + @staticmethod + def _get_strenghts_for_each_bond(pairs: list[list[str]], strengths: list[float], nameion: str | None = None): + """ + Return a dictionary of bond strengths. + + :param pairs: list of list including labels for the atoms, e.g., [['O3', 'Cu1'], ['O3', 'Cu1']] + :param strengths: list that gives the icohp strengths as a float, [-1.86287, -1.86288] + :param nameion: string including the name of the cation in the list, e.g Cu1 + + Returns: + dict including inormation on icohps for each bond type, e.g. + {'Yb-Sb': [-1.59769, -2.14723, -1.7925, -1.60773, -1.80149, -2.14335]} + + + """ + dict_strenghts = {} # type: ignore + + for pair, strength in zip(pairs, strengths): + if nameion is not None: + new = [ + LobsterNeighbors._split_string(pair[0])[0], + LobsterNeighbors._split_string(pair[1])[0], + ] + new = Analysis._sort_name(new, nameion) + string_here = new[0] + "-" + new[1] + else: + new = sorted( + [ + LobsterNeighbors._split_string(pair[0])[0], + LobsterNeighbors._split_string(pair[1])[0], + ] + ) + string_here = new[0] + "-" + new[1] + + if string_here not in dict_strenghts: + dict_strenghts[string_here] = [] + dict_strenghts[string_here].append(strength) + return dict_strenghts + + @staticmethod + def _sort_name(pair: list[str], nameion: str | None = None): + """ + Place the cation first in a list of name strings. + + :param pair: ["O","Cu"] + :param nameion: "Cu" + + Returns: + will return list of str, e.g. ["Cu", "O"] + + """ + if nameion is not None: + new = [] + if pair[0] == nameion: + new.append(pair[0]) + new.append(pair[1]) + + elif pair[1] == nameion: + new.append(pair[1]) + new.append(pair[0]) + + return new + + @staticmethod + def _sort_orbital_atom_pair( + atom_pair: list[str], + label: str, + complete_cohp: CompleteCohp, + orb_pair: str, + ): + """ + Place the cation first in a list of name strings and add the associated orbital name alongside the atom name. + + :param atom_pair: list of atom pair with cation first eg., ["Cl","Na"] + :param label: LOBSTER relevant bond label eg ., "3" + :param complete_cohp: pymatgen CompleteCohp object + :param orb_pair: relevant orbital pair eg., "2p-3s" + + Returns: + will return list of str, e.g. ["Na(2p)", "Cl(3s)"] + + """ + orb_atom = {} # type: ignore + orb_pair_list = orb_pair.split("-") + # get orbital associated to the atom and store in a dict + for _inx, (site, site_orb) in enumerate(zip(complete_cohp.bonds[label]["sites"], orb_pair_list)): + if site.species_string in orb_atom: # check necessary for bonds between same atoms + orb_atom[site.species_string].append(site_orb) + else: + orb_atom[site.species_string] = [site_orb] + + orb_atom_list = [] + # add orbital name next to atom_pair + for inx, atom in enumerate(atom_pair): + # check to ensure getting 2nd orbital if bond is between same atomic species + if inx == 1 and len(orb_atom.get(atom)) > 1: # type: ignore + atom_with_orb_name = f"{atom}({orb_atom.get(atom)[1]})" # type: ignore + else: + atom_with_orb_name = f"{atom}({orb_atom.get(atom)[0]})" # type: ignore + orb_atom_list.append(atom_with_orb_name) + + return orb_atom_list + + def _get_antibdg_states(self, cohps, labels: list[str], nameion: str | None = None, limit=0.01): + """ + Return a dictionary containing information on anti-bonding states. + + e.g., similar to: {'Cu-O': True, 'Cu-F': True} + + :param cohps: list of pymatgen.electronic_structure.cohp.Cohp objects + :param labels: ['2 x Cu-O', '4 x Cu-F'] + :param nameion: string of the cation name, e.g. "Cu" + :param limit: limit to detect antibonding states + + Returns: + dict including in formation on whether antibonding interactions exist, + e.g., {'Cu-O': True, 'Cu-F': True} + + + """ + dict_antibd = {} + for label, cohp in zip(labels, cohps): + if label is not None: + if nameion is not None: + new = label.split(" ")[2].split("-") + sorted_new = self._sort_name(new, nameion) + new_label = sorted_new[0] + "-" + sorted_new[1] + else: + new = label.split(" ")[2].split("-") + sorted_new = sorted(new.copy()) + new_label = sorted_new[0] + "-" + sorted_new[1] + + antbd = cohp.has_antibnd_states_below_efermi(limit=limit) + if Spin.down in antbd: + dict_antibd[new_label] = antbd[Spin.up] or antbd[Spin.down] + else: + dict_antibd[new_label] = antbd[Spin.up] + + return dict_antibd + + def _integrate_antbdstates_below_efermi_for_set_cohps(self, labels: list[str], cohps, nameion: str): + """ + Return a dictionary containing information on antibonding states. + + .. warning:: NEEDS MORE TESTS + + It is important to note that only the energy range that has been computed can be considered + (i.e., this might not be all) + + e.g. output: {'Cu-O': {'integral': 4.24374775705, 'perc': 5.7437713186999995}, + 'Cu-F': {'integral': 3.07098300965, 'perc': 4.25800841445}} + + :param cohps: list of pymatgen.electronic_structure.cohp.Cohp objects + :param labels: ['2 x Cu-O', '4 x Cu-F'] + :param nameion: string of the cation name, e.g. "Cu" + + Returns: + dict including in formation on whether antibonding interactions exist, + e.g., {'Cu-O': {'integral': 4.24374775705, 'perc': 5.7437713186999995}, + 'Cu-F': {'integral': 3.07098300965, 'perc': 4.25800841445}}} + """ + dict_bd_antibd = {} + for label, cohp in zip(labels, cohps): + if label is not None: + new = label.split(" ")[2].split("-") + sorted_new = self._sort_name(new, nameion) + new_label = sorted_new[0] + "-" + sorted_new[1] + if not self.are_cobis and not self.are_coops: + ( + integral, + perc, + integral2, + perc2, + ) = self._integrate_antbdstates_below_efermi(cohp, start=self.start) + else: + ( + integral2, + perc2, + integral, + perc, + ) = self._integrate_antbdstates_below_efermi(cohp, start=self.start) + + if integral == 0 and integral2 != 0.0: + dict_bd_antibd[new_label] = { + "bonding": {"integral": integral2, "perc": perc2}, + "antibonding": {"integral": integral, "perc": 0.0}, + } + elif integral2 == 0.0 and integral != 0.0: + dict_bd_antibd[new_label] = { + "bonding": {"integral": integral2, "perc": 0.0}, + "antibonding": {"integral": integral, "perc": perc}, + } + elif integral == 0.0 and integral2 == 0.0: + dict_bd_antibd[new_label] = { + "bonding": {"integral": integral2, "perc": 0.0}, + "antibonding": {"integral": integral, "perc": 0.0}, + } + else: + dict_bd_antibd[new_label] = { + "bonding": {"integral": integral2, "perc": perc2}, + "antibonding": {"integral": integral, "perc": perc}, + } + + return dict_bd_antibd + + def _integrate_antbdstates_below_efermi(self, cohp, start: float | None): + """ + Integrate the cohp data to compute bonding and anti-bonding contribution below efermi. + + .. warning:: NEEDS MORE TESTS + + This integrates the whole COHP curve that has been computed. + The energy range is very important. + At present the energy range considered is dependent on COHPstartEnergy + set during lobster runs. The bonding / antibonding integral values are sensitive to this parameter. + If COHPstartEnergy value does not cover entire range of VASP calculations then + absolute value of ICOHP_sum might not be equivalent to (bonding- antibonding) integral values. + + :param cohp: cohp object + :param start: integration start energy in eV , eg start = -15 + + Returns: + absolute value of antibonding, percentage value of antibonding, + absolute value of bonding and percentage value of bonding interactions + """ + warnings.warn( + "The bonding, antibonding integral/percent values are numerical estimate." + " These values are sensitive to COHPstartEnergy parameter." + " If COHPstartEnergy value does not cover entire range of VASP calculations then" + " absolute value of ICOHP_sum might not be equivalent to (bonding- antibonding) integral values.", + stacklevel=2, + ) + + from scipy.integrate import trapezoid + + def integrate_positive(y, x): + """ + Integrate only bonding interactions of COHPs. + + :param y: COHP values + :param x: Energy values + + Returns: + integrated value of bonding interactions + """ + y = np.asanyarray(y) + x = np.asanyarray(x) + + bonding = trapezoid(y, x) + + return np.round(bonding, 2) + + def integrate_negative(y, x): + """ + Integrate only anti-bonding interactions of COHPs. + + :param y: COHP values + :param x: Energy values + + Returns: + integrated value of anti-bonding interactions + """ + y = np.asanyarray(y) + x = np.asanyarray(x) + antibonding = trapezoid(y, x) + + return np.round(antibonding, 2) + + # will integrate spin.up and spin.down only below efermi + energies_corrected = cohp.energies - cohp.efermi + summedcohp = cohp.cohp[Spin.up] + cohp.cohp[Spin.down] if Spin.down in cohp.cohp else cohp.cohp[Spin.up] + + cohp_bf = [] + en_bf = [] + + for i, en in enumerate(energies_corrected): + if (start is None) and en <= 0: + en_bf.append(en) + cohp_bf.append(-1 * summedcohp[i]) + if (start is not None) and 0 >= en >= start: + en_bf.append(en) + cohp_bf.append(-1 * summedcohp[i]) + + # Separate the bonding and antibonding COHP values in separate lists + pos = [] + en_pos = [] + neg = [] + en_neg = [] + + for i, scohp in enumerate(cohp_bf): + if scohp >= 0: + pos.append(scohp) + en_pos.append(energies_corrected[i]) + + for i, scohp in enumerate(cohp_bf): + if scohp <= 0: + neg.append(-1 * scohp) + en_neg.append(energies_corrected[i]) + + antibonding = integrate_negative(y=neg, x=en_neg) + + bonding = integrate_positive(y=pos, x=en_pos) + + return ( + antibonding, + np.round(abs(antibonding) / (abs(bonding) + abs(antibonding)), 5), + bonding, + np.round(abs(bonding) / (abs(bonding) + abs(antibonding)), 5), + ) + + def _get_pop_type(self): + """ + Return the type of the input population file. + + Returns: + A String of analysed population can be COOP/COBI/COHP + """ + if self.are_cobis: + type_pop = "COBI" + elif self.are_coops: + type_pop = "COOP" + else: + type_pop = "COHP" + + return type_pop + + @staticmethod + def _get_bond_dict( + bond_strength_dict: dict, + small_antbd_dict: dict, + nameion: str | None = None, + large_antbd_dict: dict | None = None, + type_pop: str | None = None, + ): + """ + Return a bond_dict that contains information for each site. + + :param bond_strength_dict: dict with bond names as key and lists of bond strengths as items + :param small_antbd_dict: dict including if there are antibonding interactions, {'Yb-Sb': False} + :param nameion: name of the cation, e.g. Yb + :param large_antbd_dict: will be implemented later + :param type_pop: population type analyzed. eg. COHP + + Returns: + Eg., if type_pop == 'COHP', will return + dict including information on the anion (as label) and the ICOHPs in the item of the dict + ICOHP_mean refers to the mean ICOHP in eV + ICOHP_sum refers to the sum of the ICOHPs in eV + has_antibdg_states_below_Efermi is True if there are antibonding interactions below Efermi + "number_of_bonds" will count the numbers of bonds to the cation + + Example: + {'Sb': {'ICOHP_mean': '-1.85', 'ICOHP_sum': '-11.09', + 'has_antibdg_states_below_Efermi': False, 'number_of_bonds': 6}} + + """ + bond_dict = {} + + for key, item in bond_strength_dict.items(): + if nameion is not None: + a = key.split("-")[0] + b = key.split("-")[1] + if a == nameion: + key_here = b + elif b == nameion: + key_here = a + + if large_antbd_dict is None: + bond_dict[key_here] = { + f"I{type_pop}_mean": str(round(np.mean(item), 2)), + f"I{type_pop}_sum": str(round(np.sum(item), 2)), + "has_antibdg_states_below_Efermi": small_antbd_dict[key], + "number_of_bonds": len(item), + } + else: + bond_dict[key_here] = { + f"I{type_pop}_mean": str(round(np.mean(item), 2)), + f"I{type_pop}_sum": str(round(np.sum(item), 2)), + "has_antibdg_states_below_Efermi": small_antbd_dict[key], + "number_of_bonds": len(item), + "perc_antibdg_states_below_Efermi": large_antbd_dict[key], + } + + return bond_dict + + @staticmethod + def _get_orb_combinations(): + """ + Get a list of unique 2-length permutations and combinations. + + Generates 2-length permutations and combinations with replacement from the set ['s', 'p', 'd', 'f'] + + Returns: + list[tuple[str, str]]: A list of tuples, each containing two elements. + """ + list_orbs_comb: list[tuple[str, str]] = [] # type: ignore + + # Add all 2-length permutations + for perm in permutations(["s", "p", "d", "f"], 2): + list_orbs_comb.append(perm) # noqa : PERF402 + + # Add 2-length combinations with replacement, ensuring no duplicates + for comb in combinations_with_replacement(["s", "p", "d", "f"], 2): + if comb not in list_orbs_comb: + list_orbs_comb.append(comb) + + return list_orbs_comb + + def _group_orb_pairs(self, bond_label: str, orb_combinations: list[tuple[str, str]]) -> dict[str, list[str]]: + """ + Group orbital pairs based on the provided bond label. + + :param bond_label: The bond label to filter the orbitals. + :param orb_combinations: A list of tuples containing orbital combinations. + + Returns: + dict[str, List[str]]: A dictionary where the keys are top level orbital pairs and the values are lists of + sub orbitals associated to the bond label. + """ + orb_pair = {} # type: ignore + bond_label_int = int(bond_label) - 1 # convert label to int to access orbital data from icohpcollection + for sub_orb, data in self.chemenv.Icohpcollection._list_orb_icohp[bond_label_int].items(): + for orb1, orb2 in orb_combinations: + if orb1 in data["orbitals"][0][1].name and orb2 in data["orbitals"][1][1].name: + root_orb_pair = f"{data['orbitals'][0][0]}{orb1}-{data['orbitals'][1][0]}{orb2}" + if root_orb_pair not in orb_pair: + orb_pair[root_orb_pair] = [] + orb_pair[root_orb_pair].append(sub_orb) + return orb_pair + + @staticmethod + def _get_bond_orb_label_mapped_list(orb_pair: dict[str, list[str]], bond_labels: list[str], root_orb_pair: str): + """ + Get a lists of bond labels mapped to the corresponding orbital pair. + + :param orb_pair: A dictionary containing orbital pairs as keys and lists of + sub orbitals as values. + :param bond_labels: A list of bond labels. + :param root_orb_pair: The root key in orb_pair use to map bond labels list. + + Returns: + list: A list where the items of bond_labels are repeated based on the + length of orb_pair[root_orb_pair]. + """ + return [item for item in bond_labels for _ in range(len(orb_pair[root_orb_pair]))] + +
+[docs] + def set_condensed_bonding_analysis(self): + """ + Condense the bonding analysis into a summary dictionary. + + Returns: + None + + """ + self.condensed_bonding_analysis = {} + # which icohps are considered + if self.which_bonds == "cation-anion": + limit_icohps = self.chemenv._get_limit_from_extremum( + self.chemenv.Icohpcollection, + self.cutoff_icohp, + adapt_extremum_to_add_cond=True, + additional_condition=1, + ) + elif self.which_bonds == "all": + limit_icohps = self.chemenv._get_limit_from_extremum( + self.chemenv.Icohpcollection, + self.cutoff_icohp, + adapt_extremum_to_add_cond=True, + additional_condition=0, + ) + # formula of the compound + formula = str(self.structure.composition.reduced_formula) + # set population type + type_pop = self._get_pop_type() + # how many inequivalent cations are in the structure + if self.which_bonds == "cation-anion": + number_considered_ions = len(self.seq_ineq_ions) + elif self.which_bonds == "all": + number_considered_ions = len(self.seq_ineq_ions) + + # what was the maximum bond lengths that was considered + max_bond_lengths = max(self.chemenv.Icohpcollection._list_length) + + # what are the charges for the cations in the structure + charge_list = self.chemenv.valences + + # dictionary including bonding information for each site + site_dict = {} + if self.which_bonds == "cation-anion": + for ication, ce, cation_anion_infos, labels, cohps in zip( + self.seq_ineq_ions, + self.seq_coord_ions, + self.seq_infos_bonds, + self.seq_labels_cohps, + self.seq_cohps, + ): + namecation = str(self.structure[ication].specie) + + # This will compute the mean strengths of ICOHPs + mean_icohps = self._get_strenghts_for_each_bond( + pairs=cation_anion_infos[4], + strengths=cation_anion_infos[1], + nameion=namecation, + ) + # pairs, strengths, nameion + # will collect if there are antibonding states present + antbdg = self._get_antibdg_states(cohps, labels, namecation) + dict_antibonding = self._integrate_antbdstates_below_efermi_for_set_cohps( + labels, cohps, nameion=namecation + ) + bond_dict = self._get_bond_dict(mean_icohps, antbdg, namecation, type_pop=type_pop) + bond_resolved_labels = self.get_site_bond_resolved_labels() + + for cation_name, icohp_data in bond_dict.items(): + for atom_pair, bonding_data in dict_antibonding.items(): + if namecation == atom_pair.split("-")[0] and cation_name == atom_pair.split("-")[1]: + icohp_data["bonding"] = bonding_data["bonding"] + icohp_data["antibonding"] = bonding_data["antibonding"] + if self.orbital_resolved: + # get orb resolved data to be added + orb_resolved_bond_info = self._get_orbital_resolved_data( + nameion=namecation, + iion=ication, + labels=labels, + bond_resolved_labels=bond_resolved_labels, + type_pop=type_pop, + ) + # match the dict key in bond_dict and get corresponding orbital data + for ion_atom_pair_orb in orb_resolved_bond_info: + orb_data_atom_pair = ion_atom_pair_orb.split(": ")[-1] + atom_pair_here = atom_pair.split("-") + atom_pair_here.sort() + if ( + orb_data_atom_pair == "-".join(atom_pair_here) + and (namecation + str(ication + 1) + ":") in ion_atom_pair_orb + ): + icohp_data["orbital_data"] = orb_resolved_bond_info[ion_atom_pair_orb] + + orb_data_stats = self._get_bond_resolved_data_stats( + orb_resolved_bond_data=orb_resolved_bond_info[ion_atom_pair_orb], + ) + + icohp_data["orbital_data"].update(orb_data_stats) + + site_dict[ication] = { + "env": ce, + "bonds": bond_dict, + "ion": namecation, + "charge": charge_list[ication], + "relevant_bonds": cation_anion_infos[3], + } + elif self.which_bonds == "all": + for iion, ce, bond_infos, labels, cohps in zip( + self.seq_ineq_ions, + self.seq_coord_ions, + self.seq_infos_bonds, + self.seq_labels_cohps, + self.seq_cohps, + ): + nameion = str(self.structure[iion].specie) + + # This will compute the mean strengths of ICOHPs + mean_icohps = self._get_strenghts_for_each_bond( + pairs=bond_infos[4], strengths=bond_infos[1], nameion=None + ) + # pairs, strengths, nameion + # will collect if there are antibonding states present + antbdg = self._get_antibdg_states(cohps, labels, nameion=None) + + dict_antibonding = self._integrate_antbdstates_below_efermi_for_set_cohps(labels, cohps, nameion) + + bond_dict = self._get_bond_dict(mean_icohps, antbdg, nameion=nameion, type_pop=type_pop) + bond_resolved_labels = self.get_site_bond_resolved_labels() + + for cation_name, icohp_data in bond_dict.items(): + for atom_pair, bonding_data in dict_antibonding.items(): + if nameion == atom_pair.split("-")[0] and cation_name == atom_pair.split("-")[1]: + icohp_data["bonding"] = bonding_data["bonding"] + icohp_data["antibonding"] = bonding_data["antibonding"] + if self.orbital_resolved: + # get orb resolved data to be added + orb_resolved_bond_info = self._get_orbital_resolved_data( + nameion=nameion, + iion=iion, + labels=labels, + bond_resolved_labels=bond_resolved_labels, + type_pop=type_pop, + ) + # match the dict key in bond_dict and get corresponding orbital data + for ion_atom_pair_orb in orb_resolved_bond_info: + orb_data_atom_pair = ion_atom_pair_orb.split(": ")[-1] + atom_pair_here = atom_pair.split("-") + atom_pair_here.sort() + if ( + orb_data_atom_pair == "-".join(atom_pair_here) + and (nameion + str(iion + 1) + ":") in ion_atom_pair_orb + ): + icohp_data["orbital_data"] = orb_resolved_bond_info[ion_atom_pair_orb] + + orb_data_stats = self._get_bond_resolved_data_stats( + orb_resolved_bond_data=orb_resolved_bond_info[ion_atom_pair_orb], + ) + + icohp_data["orbital_data"].update(orb_data_stats) + + site_dict[iion] = { + "env": ce, + "bonds": bond_dict, + "ion": nameion, + "charge": charge_list[iion], + "relevant_bonds": bond_infos[3], + } + + if self.path_to_madelung is None and self.madelung_obj is None: + if self.which_bonds == "cation-anion": + # This sets the dictionary including the most important information on the compound + self.condensed_bonding_analysis = { + "formula": formula, + "max_considered_bond_length": max_bond_lengths, + f"limit_i{type_pop.lower()}": limit_icohps, + "number_of_considered_ions": number_considered_ions, + "sites": site_dict, + "type_charges": self.type_charge, + } + elif self.which_bonds == "all": + self.condensed_bonding_analysis = { + "formula": formula, + "max_considered_bond_length": max_bond_lengths, + f"limit_i{type_pop.lower()}": limit_icohps, + "number_of_considered_ions": number_considered_ions, + "sites": site_dict, + "type_charges": self.type_charge, + } + else: + madelung = MadelungEnergies(self.path_to_madelung) if self.path_to_madelung else self.madelung_obj + if self.type_charge == "Mulliken": + madelung_energy = madelung.madelungenergies_mulliken + elif self.type_charge == "Löwdin": + madelung_energy = madelung.madelungenergies_loewdin + else: + madelung_energy = None + # This sets the dictionary including the most important information on the compound + if self.which_bonds == "cation-anion": + self.condensed_bonding_analysis = { + "formula": formula, + "max_considered_bond_length": max_bond_lengths, + f"limit_i{type_pop.lower()}": limit_icohps, + "number_of_considered_ions": number_considered_ions, + "sites": site_dict, + "type_charges": self.type_charge, + "madelung_energy": madelung_energy, + } + elif self.which_bonds == "all": + self.condensed_bonding_analysis = { + "formula": formula, + "max_considered_bond_length": max_bond_lengths, + f"limit_i{type_pop.lower()}": limit_icohps, + "number_of_considered_ions": number_considered_ions, + "sites": site_dict, + "type_charges": self.type_charge, + "madelung_energy": madelung_energy, + }
+ + +
+[docs] + def set_summary_dicts(self): + """ + Set summary dict that can be used for correlations. + + bond_dict that includes information on each bond + + "has_antbd" tells if there are antbonding states + "ICOHP_mean" shows the mean of all ICOHPs in EV + + {'Yb-Sb': { 'has_antbdg': False, 'ICOHP_mean': -1.7448}, + 'Mn-Sb': { 'has_antbdg': True, 'ICOHP_mean': -1.525}} + + a cation dict that includes all different coordination environments and counts for them + {'Na': {'T:4': 4, 'A:2': 4}, 'Si': {'T:6': 4, 'PP:6': 4}} + + Returns: + None + + """ + relevant_ion_ids = [isite for isite in self.list_equivalent_sites if isite in self.seq_ineq_ions] + # set population type + type_pop = self._get_pop_type() + + final_dict_bonds = {} + for key in relevant_ion_ids: + item = self.condensed_bonding_analysis["sites"][key] + for type, properties in item["bonds"].items(): + label_list = [item["ion"], str(type)] + new_label = sorted(label_list.copy()) + label = str(new_label[0]) + "-" + str(new_label[1]) + + if label not in final_dict_bonds: + final_dict_bonds[label] = { + "number_of_bonds": int(properties["number_of_bonds"]), + f"I{type_pop}_sum": float(properties[f"I{type_pop}_sum"]), + "has_antbdg": properties["has_antibdg_states_below_Efermi"], + } + else: + final_dict_bonds[label]["number_of_bonds"] += int(properties["number_of_bonds"]) + final_dict_bonds[label][f"I{type_pop}_sum"] += float(properties[f"I{type_pop}_sum"]) + final_dict_bonds[label]["has_antbdg"] = ( + final_dict_bonds[label]["has_antbdg"] or properties["has_antibdg_states_below_Efermi"] + ) + self.final_dict_bonds = {} + for key, item in final_dict_bonds.items(): + self.final_dict_bonds[key] = {} + self.final_dict_bonds[key][f"I{type_pop}_mean"] = item[f"I{type_pop}_sum"] / (item["number_of_bonds"]) + self.final_dict_bonds[key]["has_antbdg"] = item["has_antbdg"] + + # rework, add all environments! + final_dict_ions = {} + for key in relevant_ion_ids: + if self.condensed_bonding_analysis["sites"][key]["ion"] not in final_dict_ions: + final_dict_ions[self.condensed_bonding_analysis["sites"][key]["ion"]] = [ + self.condensed_bonding_analysis["sites"][key]["env"] + ] + else: + final_dict_ions[self.condensed_bonding_analysis["sites"][key]["ion"]].append( + self.condensed_bonding_analysis["sites"][key]["env"] + ) + + self.final_dict_ions = {} + for key, item in final_dict_ions.items(): + self.final_dict_ions[key] = dict(Counter(item))
+ + +
+[docs] + @staticmethod + def get_lobster_calc_quality_summary( + path_to_poscar: str | None = None, + path_to_lobsterout: str | None = None, + path_to_lobsterin: str | None = None, + path_to_potcar: str | None = None, + potcar_symbols: list | None = None, + path_to_charge: str | None = None, + path_to_bandoverlaps: str | None = None, + path_to_doscar: str | None = None, + path_to_vasprun: str | None = None, + structure_obj: Structure | None = None, + lobsterin_obj: Lobsterin | None = None, + lobsterout_obj: Lobsterout | None = None, + charge_obj: Charge | None = None, + bandoverlaps_obj: Bandoverlaps | None = None, + lobster_completedos_obj: LobsterCompleteDos | None = None, + vasprun_obj: Vasprun | None = None, + dos_comparison: bool = False, + e_range: list = [-5, 0], + n_bins: int | None = None, + bva_comp: bool = False, + ) -> dict: + """ + Analyze LOBSTER calculation quality. + + :param path_to_poscar: path to structure file + :param path_to_lobsterout: path to lobsterout file + :param path_to_lobsterin: path to lobsterin file + :param path_to_potcar: path to VASP potcar file + :param potcar_symbols: list of potcar symbols from potcar file (can be used if no potcar available) + :param path_to_charge: path to CHARGE.lobster file + :param path_to_bandoverlaps: path to bandOverlaps.lobster file + :param path_to_doscar: path to DOSCAR.lobster or DOSCAR.LSO.lobster file + :param path_to_vasprun: path to vasprun.xml file + :param structure_obj: pymatgen pymatgen.core.structure.Structure object + :param lobsterin_obj: pymatgen.lobster.io.Lobsterin object + :param lobsterout_obj: pymatgen lobster.io.Lobsterout object + :param charge_obj: pymatgen lobster.io.Charge object + :param bandoverlaps_obj: pymatgen lobster.io.BandOverlaps object + :param lobster_completedos_obj: pymatgen.electronic_structure.dos.LobsterCompleteDos object + :param vasprun_obj: pymatgen vasp.io.Vasprun object + :param dos_comparison: will compare DOS from VASP and LOBSTER and return tanimoto index + :param e_range: energy range for DOS comparisons + :param n_bins: number of bins to discretize DOS for comparisons + :param bva_comp: Compares LOBSTER charge signs with Bond valence charge signs + + Returns: + A dict of summary of LOBSTER calculation quality by analyzing basis set used, + charge spilling from lobsterout/ PDOS comparisons of VASP and LOBSTER / + BVA charge comparisons + + """ + quality_dict = {} + + if path_to_potcar and not potcar_symbols and not path_to_vasprun and not vasprun_obj: + potcar_names = Lobsterin._get_potcar_symbols(POTCAR_input=path_to_potcar) + elif not path_to_potcar and not path_to_vasprun and not vasprun_obj and potcar_symbols: + potcar_names = potcar_symbols + elif path_to_vasprun and not vasprun_obj: + vasprun = Vasprun(path_to_vasprun, parse_potcar_file=False, parse_eigen=False) + potcar_names = [potcar.split(" ")[1] for potcar in vasprun.potcar_symbols] + elif vasprun_obj and not path_to_vasprun: + potcar_names = [potcar.split(" ")[1] for potcar in vasprun_obj.potcar_symbols] + else: + raise ValueError( + "Please provide either path_to_potcar or list of " + "potcar_symbols or path to vasprun.xml or vasprun object. " + "Crucial to identify basis used for projections" + ) + + if path_to_poscar: + struct = Structure.from_file(path_to_poscar) + elif structure_obj: + struct = structure_obj + else: + raise ValueError("Please provide path_to_poscar or structure_obj") + + ref_bases = Lobsterin.get_all_possible_basis_functions(structure=struct, potcar_symbols=potcar_names) + + if path_to_lobsterin: + lobs_in = Lobsterin.from_file(path_to_lobsterin) + elif lobsterin_obj: + lobs_in = lobsterin_obj + else: + raise ValueError("Please provide path_to_lobsterin or lobsterin_obj") + + calc_basis = [] + for basis in lobs_in["basisfunctions"]: + basis_sep = basis.split()[1:] + basis_comb = " ".join(basis_sep) + calc_basis.append(basis_comb) + + if calc_basis == list(ref_bases[0].values()): + quality_dict["minimal_basis"] = True # type: ignore + else: + quality_dict["minimal_basis"] = False # type: ignore + warnings.warn( + "Consider rerunning the calc with the minimum basis as well. Choosing is " + "larger basis set is recommended if you see a significant improvement of " + "the charge spilling and material has non-zero band gap.", + stacklevel=2, + ) + + if path_to_lobsterout: + lob_out = Lobsterout(path_to_lobsterout) + elif lobsterout_obj: + lob_out = lobsterout_obj + else: + raise ValueError("Please provide path_to_lobsterout or lobsterout_obj") + + quality_dict["charge_spilling"] = { + "abs_charge_spilling": round((sum(lob_out.charge_spilling) / 2) * 100, 4), + "abs_total_spilling": round((sum(lob_out.total_spilling) / 2) * 100, 4), + } # type: ignore + + if path_to_bandoverlaps is not None and not bandoverlaps_obj: + band_overlaps = Bandoverlaps(filename=path_to_bandoverlaps) if Path(path_to_bandoverlaps).exists() else None + elif path_to_bandoverlaps is None and bandoverlaps_obj: + band_overlaps = bandoverlaps_obj + else: + band_overlaps = None + + if band_overlaps is not None: + for line in lob_out.warning_lines: + if "k-points could not be orthonormalized" in line: + total_kpoints = int(line.split(" ")[2]) + + # store actual number of devations above pymatgen default limit of 0.1 + dev_val = [] + for dev in band_overlaps.max_deviation: + if dev > 0.1: + dev_val.append(dev) + + quality_dict["band_overlaps_analysis"] = { # type: ignore + "file_exists": True, + "limit_maxDeviation": 0.1, + "has_good_quality_maxDeviation": band_overlaps.has_good_quality_maxDeviation(limit_maxDeviation=0.1), + "max_deviation": round(max(band_overlaps.max_deviation), 4), + "percent_kpoints_abv_limit": round((len(dev_val) / total_kpoints) * 100, 4), + } + + else: + quality_dict["band_overlaps_analysis"] = { # type: ignore + "file_exists": False, + "limit_maxDeviation": None, + "has_good_quality_maxDeviation": True, + "max_deviation": None, + "percent_kpoints_abv_limit": None, + } + + if bva_comp: + try: + bond_valence = BVAnalyzer() + + bva_oxi = [] + if path_to_charge and not charge_obj: + lobs_charge = Charge(filename=path_to_charge) + elif not path_to_charge and charge_obj: + lobs_charge = charge_obj + else: + raise Exception("BVA comparison is requested, thus please provide path_to_charge or charge_obj") + for i in bond_valence.get_valences(structure=struct): + if i >= 0: + bva_oxi.append("POS") + else: + bva_oxi.append("NEG") + + mull_oxi = [] + for i in lobs_charge.Mulliken: + if i >= 0: + mull_oxi.append("POS") + else: + mull_oxi.append("NEG") + + loew_oxi = [] + for i in lobs_charge.Loewdin: + if i >= 0: + loew_oxi.append("POS") + else: + loew_oxi.append("NEG") + + quality_dict["charge_comparisons"] = {} # type: ignore + if mull_oxi == bva_oxi: + quality_dict["charge_comparisons"]["bva_mulliken_agree"] = True # type: ignore + else: + quality_dict["charge_comparisons"]["bva_mulliken_agree"] = False # type: ignore + + if mull_oxi == bva_oxi: + quality_dict["charge_comparisons"]["bva_loewdin_agree"] = True # type: ignore + else: + quality_dict["charge_comparisons"]["bva_loewdin_agree"] = False # type: ignore + + except ValueError: + quality_dict["charge_comparisons"] = {} # type: ignore + warnings.warn( + "Oxidation states from BVA analyzer cannot be determined. " + "Thus BVA charge comparison will be skipped", + stacklevel=2, + ) + if dos_comparison: + if "LSO" not in str(path_to_doscar).split("."): + warnings.warn( + "Consider using DOSCAR.LSO.lobster, as non LSO DOS from LOBSTER can have negative DOS values", + stacklevel=2, + ) + if path_to_doscar: + doscar_lobster = Doscar( + doscar=path_to_doscar, + structure_file=path_to_poscar, + structure=structure_obj, + ) + + dos_lobster = doscar_lobster.completedos + elif lobster_completedos_obj: + dos_lobster = lobster_completedos_obj + else: + raise ValueError( + "Dos comparison is requested, so please provide either path_to_doscar or lobster_completedos_obj" + ) + + if path_to_vasprun: + vasprun = Vasprun(path_to_vasprun, parse_potcar_file=False, parse_eigen=False) + elif vasprun_obj: + vasprun = vasprun_obj + else: + raise ValueError( + "Dos comparison is requested, so please provide either path to vasprun.xml or vasprun_obj" + ) + dos_vasp = vasprun.complete_dos + + quality_dict["dos_comparisons"] = {} # type: ignore + + for orb in dos_lobster.get_spd_dos(): + if e_range[0] >= min(dos_vasp.energies) and e_range[0] >= min(dos_lobster.energies): + min_e = e_range[0] + else: + warnings.warn( + "Minimum energy range requested for DOS comparisons is not available " + "in VASP or LOBSTER calculation. Thus, setting min_e to -5 eV", + stacklevel=2, + ) + min_e = -5 + + if e_range[-1] <= max(dos_vasp.energies) and e_range[-1] <= max(dos_lobster.energies): + max_e = e_range[-1] + else: + warnings.warn( + "Maximum energy range requested for DOS comparisons is not available " + "in VASP or LOBSTER calculation. Thus, setting max_e to 0 eV", + stacklevel=2, + ) + max_e = 0 + + if np.diff(dos_vasp.energies)[0] >= 0.1 or np.diff(dos_lobster.energies)[0] >= 0.1: + warnings.warn( + "Input DOS files have very few points in the energy interval and thus " + "comparisons will not be reliable. Please rerun the calculations with " + "higher number of DOS points. Set NEDOS and COHPSteps tags to >= 2000 in VASP and LOBSTER " + "calculations, respectively.", + stacklevel=2, + ) + + if not n_bins: + n_bins = 56 + + fp_lobster_orb = dos_lobster.get_dos_fp( + min_e=min_e, + max_e=max_e, + n_bins=n_bins, + normalize=True, + type=orb.name, + ) + fp_vasp_orb = dos_vasp.get_dos_fp( + min_e=min_e, + max_e=max_e, + n_bins=n_bins, + normalize=True, + type=orb.name, + ) + + tani_orb = round( + dos_vasp.get_dos_fp_similarity(fp_lobster_orb, fp_vasp_orb, tanimoto=True), + 4, + ) + quality_dict["dos_comparisons"][f"tanimoto_orb_{orb.name}"] = tani_orb # type: ignore + + fp_lobster = dos_lobster.get_dos_fp( + min_e=min_e, + max_e=max_e, + n_bins=n_bins, + normalize=True, + type="summed_pdos", + ) + fp_vasp = dos_vasp.get_dos_fp( + min_e=min_e, + max_e=max_e, + n_bins=n_bins, + normalize=True, + type="summed_pdos", + ) + + tanimoto_summed = round(dos_vasp.get_dos_fp_similarity(fp_lobster, fp_vasp, tanimoto=True), 4) + quality_dict["dos_comparisons"]["tanimoto_summed"] = tanimoto_summed # type: ignore + quality_dict["dos_comparisons"]["e_range"] = [min_e, max_e] # type: ignore + quality_dict["dos_comparisons"]["n_bins"] = n_bins # type: ignore + + return quality_dict
+
+ +
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/lobsterpy/cohp/describe.html b/_modules/lobsterpy/cohp/describe.html new file mode 100644 index 00000000..f323585d --- /dev/null +++ b/_modules/lobsterpy/cohp/describe.html @@ -0,0 +1,1358 @@ + + + + + + + + + + lobsterpy.cohp.describe — lobsterpy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for lobsterpy.cohp.describe

+# Copyright (c) lobsterpy development team
+# Distributed under the terms of a BSD 3-Clause "New" or "Revised" License
+
+"""This module defines classes to describe the COHPs automatically."""
+
+from __future__ import annotations
+
+import warnings
+from pathlib import Path
+
+from lobsterpy.plotting import InteractiveCohpPlotter, PlainCohpPlotter
+
+
+
+[docs] +class Description: + """ + Base class that will write generate a text description for all relevant bonds. + + It analyses all relevant coordination environments in the system based on electronic structure theory. + + """ + + def __init__(self, analysis_object): + """ + Generate a text description for all relevant bonds. + + :param analysis_object: Analysis object from lobsterpy.analysis + """ + self.analysis_object = analysis_object + self.set_description() + +
+[docs] + def set_description(self): + """ + Set the descriptions of the structures using the cation names, starting with numbers at 1. + + Uses the cation names from the lobster files. + + Returns: + None + + """ + self.condensed_bonding_analysis = self.analysis_object.condensed_bonding_analysis + # set type of population analyzed + type_pop = self.analysis_object._get_pop_type() + # set units for populations + units = " eV" if type_pop == "COHP" else "" + if self.analysis_object.which_bonds == "cation-anion": + relevant_cations = ", ".join( + [ + str(site.specie) + str(isite + 1) + for isite, site in enumerate(self.analysis_object.structure) + if isite in self.analysis_object.seq_ineq_ions + ] + ) + self.text = [] + self.text.append( + "The compound " + + str(self.condensed_bonding_analysis["formula"]) + + " has " + + str(self.condensed_bonding_analysis["number_of_considered_ions"]) + + " symmetry-independent cation(s) with relevant cation-anion interactions: " + + str(relevant_cations) + + "." + ) + + for key, item in self.condensed_bonding_analysis["sites"].items(): + # It has 3 Ta-N (mean ICOHP: -4.78 eV, antibonding interactions below EFermi), + bond_info = [] + orb_info = [] + for type, properties in item["bonds"].items(): + if not properties["has_antibdg_states_below_Efermi"]: + bond_info.append( + str(properties["number_of_bonds"]) + + " " + + item["ion"] + + "-" + + str(type) + + f" (mean I{type_pop}: " + "" + + properties[f"I{type_pop}_mean"] + + f"{units}, 0.0 percent antibonding interaction below EFermi)" + ) + if self.analysis_object.orbital_resolved: + text_orbital = self._generate_orbital_resolved_analysis_text( + orbital_resolved_data=properties, + type_pop=type_pop, + atom_name=str(type), + ion=item["ion"], + ) + orb_info.extend(text_orbital) + else: + bond_info.append( + str(properties["number_of_bonds"]) + + " " + + item["ion"] + + "-" + + str(type) + + f" (mean I{type_pop}: " + "" + + properties[f"I{type_pop}_mean"] + + f"{units}, " + + str(round(properties["antibonding"]["perc"] * 100, 3)) + + " percent antibonding interaction below EFermi)" + ) + if self.analysis_object.orbital_resolved: + text_orbital = self._generate_orbital_resolved_analysis_text( + orbital_resolved_data=properties, + type_pop=type_pop, + atom_name=str(type), + ion=item["ion"], + ) + orb_info.extend(text_orbital) + + bonds = ",".join(bond_info[0:-1]) + ", and " + bond_info[-1] if len(bond_info) > 1 else bond_info[0] + + if len(orb_info) > 1: + orb_bonds = "".join(orb_info).replace(".In", ". In") + else: + orb_bonds = orb_info[0] if orb_info else "" + if item["env"] == "O:6": + self.text.append( + str(item["ion"]) + + str(key + 1) + + " has an " + + str(self._coordination_environment_to_text(item["env"])) + + " coordination environment. It has " + + str(bonds) + + " bonds." + ) + if orb_bonds: + self.text.append(orb_bonds) + else: + self.text.append( + str(item["ion"]) + + str(key + 1) + + " has a " + + str(self._coordination_environment_to_text(item["env"])) + + " coordination environment. It has " + + str(bonds) + + " bonds." + ) + if orb_bonds: + self.text.append(orb_bonds) + + elif self.analysis_object.which_bonds == "all": + relevant_ions = ", ".join( + [ + str(site.specie) + str(isite + 1) + for isite, site in enumerate(self.analysis_object.structure) + if isite in self.analysis_object.seq_ineq_ions + ] + ) + self.text = [] + self.text.append( + "The compound " + + str(self.condensed_bonding_analysis["formula"]) + + " has " + + str(self.condensed_bonding_analysis["number_of_considered_ions"]) + + " symmetry-independent atoms(s) with relevant bonds: " + + str(relevant_ions) + + "." + ) + + for key, item in self.condensed_bonding_analysis["sites"].items(): + # It has 3 Ta-N (mean ICOHP: -4.78 eV, antibonding interactions below EFermi), + bond_info = [] + orb_info = [] + for type, properties in item["bonds"].items(): + if not properties["has_antibdg_states_below_Efermi"]: + bond_info.append( + str(properties["number_of_bonds"]) + + " " + + item["ion"] + + "-" + + str(type) + + f" (mean I{type_pop}: " + "" + + properties[f"I{type_pop}_mean"] + + f"{units}, 0.0 percent antibonding interaction below EFermi)" + ) + if self.analysis_object.orbital_resolved: + text_orbital = self._generate_orbital_resolved_analysis_text( + orbital_resolved_data=properties, + type_pop=type_pop, + atom_name=str(type), + ion=item["ion"], + ) + orb_info.extend(text_orbital) + else: + bond_info.append( + str(properties["number_of_bonds"]) + + " " + + item["ion"] + + "-" + + str(type) + + f" (mean I{type_pop}: " + "" + + properties[f"I{type_pop}_mean"] + + f"{units}, " + + str(round(properties["antibonding"]["perc"] * 100, 3)) + + " percent antibonding interaction below EFermi)" + ) + + if self.analysis_object.orbital_resolved: + text_orbital = self._generate_orbital_resolved_analysis_text( + orbital_resolved_data=properties, + type_pop=type_pop, + atom_name=str(type), + ion=item["ion"], + ) + orb_info.extend(text_orbital) + + bonds = ",".join(bond_info[0:-1]) + ", and " + bond_info[-1] if len(bond_info) > 1 else bond_info[0] + + if len(orb_info) > 1: + orb_bonds = "".join(orb_info).replace(".In", ". In") + else: + orb_bonds = orb_info[0] if orb_info else "" + if item["env"] == "O:6": + self.text.append( + str(item["ion"]) + + str(key + 1) + + " has an " + + str(self._coordination_environment_to_text(item["env"])) + + " coordination environment. It has " + + str(bonds) + + " bonds." + ) + if orb_bonds: + self.text.append(orb_bonds) + else: + self.text.append( + str(item["ion"]) + + str(key + 1) + + " has a " + + str(self._coordination_environment_to_text(item["env"])) + + " coordination environment. It has " + + str(bonds) + + " bonds." + ) + if orb_bonds: + self.text.append(orb_bonds) + + if ( + "madelung_energy" in self.analysis_object.condensed_bonding_analysis + and self.analysis_object.condensed_bonding_analysis["madelung_energy"] is not None + ): + self.text.append( + "The Madelung energy of this crystal structure per unit cell is: " + + str(self.analysis_object.condensed_bonding_analysis["madelung_energy"]) + + " eV." + )
+ + + def _generate_orbital_resolved_analysis_text( + self, + orbital_resolved_data: dict, + ion: str, + atom_name: str, + type_pop: str, + ): + """ + Generate text from orbital-resolved analysis data of the most relevant COHP, COOP, or COBI. + + :param orbital_resolved_data: dict of orbital data from condensed bonding analysis object + :param ion: name of ion at the site + :param atom_name: name of atomic speice to which ion is bonded + :param type_pop: population type analysed could be "COHP" or "COOP" or "COBI" + + Returns: + A python list with text describing the orbital which contributes + the most to the bonding and antibonding in the bond at site + """ + orb_info = [] + if orbital_resolved_data["orbital_data"]["orbital_summary_stats"]: + orb_names = [] + orb_contri = [] + # get atom-pair list with ion placed first + atom_pair = self.analysis_object._sort_name([ion, atom_name], nameion=ion) + if "max_bonding_contribution" in orbital_resolved_data["orbital_data"]["orbital_summary_stats"]: + for orb, data in orbital_resolved_data["orbital_data"]["orbital_summary_stats"][ + "max_bonding_contribution" + ].items(): + atom_pair_with_orb_name = self.analysis_object._sort_orbital_atom_pair( + atom_pair=atom_pair, + complete_cohp=self.analysis_object.chemenv.completecohp, + label=orbital_resolved_data["orbital_data"]["relevant_bonds"][0], + orb_pair=orb, + ) + orb_names.append("-".join(atom_pair_with_orb_name)) + orb_contri.append( + str( + round( + data * 100, + 3, + ) + ) + ) + orb_names_anti = [] + orb_antibonding = [] + if "max_antibonding_contribution" in orbital_resolved_data["orbital_data"]["orbital_summary_stats"]: + for orb, data in orbital_resolved_data["orbital_data"]["orbital_summary_stats"][ + "max_antibonding_contribution" + ].items(): + atom_pair_with_orb_name = self.analysis_object._sort_orbital_atom_pair( + atom_pair=atom_pair, + complete_cohp=self.analysis_object.chemenv.completecohp, + label=orbital_resolved_data["orbital_data"]["relevant_bonds"][0], + orb_pair=orb, + ) + orb_names_anti.append("-".join(atom_pair_with_orb_name)) + orb_antibonding.append( + str( + round( + data * 100, + 3, + ) + ) + ) + if len(orb_contri) > 1: + orb_name_contri = "" + for inx, name in enumerate(orb_names): + if len(orb_contri) == 2 and inx + 1 != len(orb_contri): + orb_name_contri += f"{name} " + elif 2 < len(orb_contri) != inx + 1: + orb_name_contri += f"{name}, " + else: + orb_name_contri += f"and {name}" + + orb_name_contri += " orbitals, contributing " + for inx, contribution in enumerate(orb_contri): + if len(orb_contri) == 2 and inx + 1 != len(orb_contri): + orb_name_contri += f"{contribution} " + elif 2 < len(orb_contri) != inx + 1: + orb_name_contri += f"{contribution}, " + else: + orb_name_contri += f"and {contribution} percent, respectively" + num_bonds = len(orbital_resolved_data["orbital_data"]["relevant_bonds"]) + bonds = "bonds" if num_bonds > 1 else "bond" + orb_info.append( + f"In the {num_bonds} " + + "-".join(atom_pair) + + f" {bonds}, relative to the summed I{type_pop}s, " + + "the maximum bonding contribution is from " + + orb_name_contri + ) + elif not orb_contri: + num_bonds = len(orbital_resolved_data["orbital_data"]["relevant_bonds"]) + bonds = "bonds" if num_bonds > 1 else "bond" + orb_info.append( + f"In the {num_bonds} " + + "-".join(atom_pair) + + f" {bonds}, relative to the summed I{type_pop}s, " + + f"no orbital has a bonding contribution greater than " + f"{self.analysis_object.orbital_cutoff*100} percent" + ) + else: + num_bonds = len(orbital_resolved_data["orbital_data"]["relevant_bonds"]) + bonds = "bonds" if num_bonds > 1 else "bond" + orb_info.append( + f"In the {num_bonds} " + + "-".join(atom_pair) + + f" {bonds}, relative to the summed I{type_pop}s, " + + "the maximum bonding contribution is from the " + + f"{orb_names[0]}" + + f" orbital, contributing {orb_contri[0]} percent" + ) + + if len(orb_antibonding) > 1: + orb_anti = "" + for inx, name in enumerate(orb_names_anti): + if len(orb_names_anti) == 2 and inx + 1 != len(orb_names_anti): + orb_anti += f"{name} " + elif 2 < len(orb_antibonding) != inx + 1: + orb_anti += f"{name}, " + else: + orb_anti += f"and {name}" + + orb_anti += " orbitals, contributing " + for inx, contribution in enumerate(orb_antibonding): + if len(orb_names_anti) == 2 and inx + 1 != len(orb_names_anti): + orb_anti += f"{contribution} " + elif 2 < len(orb_antibonding) != inx + 1: + orb_anti += f"{contribution}, " + else: + orb_anti += f"and {contribution} percent, respectively." + orb_info.append(f", whereas the maximum antibonding contribution is from {orb_anti}") + elif not orb_antibonding: + orb_info.append(", whereas no significant antibonding contribution is found in this bond.") + else: + orb_info.append( + f", whereas the maximum antibonding contribution is from the " + f"{orb_names_anti[0]} orbital, contributing {orb_antibonding[0]} percent." + ) + else: + # get atom-pair list with ion placed first + atom_pair = self.analysis_object._sort_name([ion, atom_name], nameion=ion) + percentage_cutoff = round(self.analysis_object.orbital_cutoff * 100, 2) + orb_info.append( + f"No individual orbital interactions detected above {percentage_cutoff} percent" + f" with summed I{type_pop} as reference for the " + "-".join(atom_pair) + " bond." + ) + + return orb_info + +
+[docs] + def plot_cohps( + self, + xlim: list[float] | None = None, + ylim: list[float] | None = [-4, 2], + integrated: bool = False, + title: str = "", + save: bool = False, + filename: str | None = None, + sigma: float | None = None, + hide: bool = False, + ): + """ + Automatically generate plots of the most relevant COHPs, COOPs, or COBIs. + + :param save: will save the plot to a file + :param filename: name of the file to save the plot. + :param ylim: energy scale that is shown in plot (eV) + :param xlim: energy range for COHPs in eV + :param integrated: if True, integrated COHPs will be shown + :param sigma: Standard deviation of Gaussian broadening applied to + population data. If None, no broadening will be added. + :param title: sets the title of figure generated + :param hide: if True, the plot will not be shown. + + Returns: + A matplotlib object. + + """ + seq_cohps = self.analysis_object.seq_cohps + if self.analysis_object.which_bonds == "cation-anion": + seq_ineq_cations = self.analysis_object.seq_ineq_ions + elif self.analysis_object.which_bonds == "all": + seq_ineq_cations = self.analysis_object.seq_ineq_ions + seq_labels = self.analysis_object.seq_labels_cohps + structure = self.analysis_object.structure + + if len(seq_ineq_cations) >= 20: + warnings.warn( + "We will switch of displaying all plots " + "as there are more than 20 inequivalent ions. " + "We will instead save them in files called " + "'automatic-analysis-*.png'.", + stacklevel=2, + ) + hide = True + save = True + if filename is None: + filename = "./automatic_analysis.png" + + for iplot, (ication, labels, cohps) in enumerate(zip(seq_ineq_cations, seq_labels, seq_cohps)): + namecation = str(structure[ication].specie) + + cp = PlainCohpPlotter( + are_coops=self.analysis_object.are_coops, + are_cobis=self.analysis_object.are_cobis, + ) + for label, cohp in zip(labels, cohps): + if label is not None: + cp.add_cohp(namecation + str(ication + 1) + ": " + label, cohp) + + plot = cp.get_plot(integrated=integrated, sigma=sigma) + plot.ylim(ylim) + if xlim is not None: + plot.xlim(xlim) + + plot.title(title) + if save: + if len(seq_ineq_cations) > 1: + if isinstance(filename, str): + filename = Path(filename) # type: ignore + filename_new = ( + filename.parent / f"{filename.stem}-{iplot}{filename.suffix}" # type: ignore + ) + else: + filename_new = filename + plot.savefig(filename_new) + if hide: + plot.close() + if not hide: + plot.show()
+ + +
+[docs] + def plot_interactive_cohps( + self, + ylim: list[float] | None = None, + xlim: list[float] | None = None, + save_as_html: bool = False, + filename: str | None = None, + integrated: bool = False, + title: str = "", + sigma: float | None = None, + label_resolved: bool = False, + orbital_resolved: bool = False, + hide: bool = False, + ): + """ + Automatically generate interactive plots of the most relevant COHPs, COBIs or COOPs. + + :param save_as_html: will save the plot to a html file + :param filename: name of the file to save the plot. + :param ylim: energy scale that is shown in plot (eV) + :param xlim: energy range for COHPs in eV + :param integrated: if True, integrated COHPs will be shown + :param sigma: Standard deviation of Gaussian broadening applied to + population data. If None, no broadening will be added. + :param label_resolved: if true, relevant cohp curves will be further resolved based on band labels + :param orbital_resolved: if true, relevant orbital interactions in cohp curves will be added to figure + :param title: Title of the interactive plot + :param hide: if True, the plot will not be shown. + + Returns: + A plotly.graph_objects.Figure object. + """ + cba_cohp_plot_data = {} # Initialize dict to store plot data + set_cohps = self.analysis_object.seq_cohps + set_labels_cohps = self.analysis_object.seq_labels_cohps + set_inequivalent_cations = self.analysis_object.seq_ineq_ions + structure = self.analysis_object.structure + + for _iplot, (ication, labels, cohps) in enumerate(zip(set_inequivalent_cations, set_labels_cohps, set_cohps)): + label_str = f"{structure[ication].specie!s}{ication + 1!s}: " + for label, cohp in zip(labels, cohps): + if label is not None: + cba_cohp_plot_data[label_str + label] = cohp + + ip = InteractiveCohpPlotter( + are_coops=self.analysis_object.are_coops, + are_cobis=self.analysis_object.are_cobis, + ) + if label_resolved or orbital_resolved: + ip.add_all_relevant_cohps( + analyse=self.analysis_object, + label_resolved=label_resolved, + orbital_resolved=orbital_resolved, + ) + else: + ip.add_cohps_from_plot_data(plot_data_dict=cba_cohp_plot_data) + + plot = ip.get_plot(integrated=integrated, xlim=xlim, ylim=ylim, sigma=sigma) + + plot.update_layout(title_text=title) + if save_as_html: + plot.write_html(filename, include_mathjax="cdn") + if not hide: + return plot.show() + + return plot
+ + + @staticmethod + def _coordination_environment_to_text(ce: str): + """ + Convert a coordination environment string into a text description of the environment. + + :param ce: output from ChemEnv package (e.g., "O:6") + + Returns: + A text description of coordination environment + """ + if ce == "S:1": + return "single (CN=1)" + if ce == "L:2": + return "linear (CN=2)" + if ce == "A:2": + return "angular (CN=2)" + if ce == "TL:3": + return "trigonal planar (CN=3)" + if ce == "TY:3": + return "triangular non-coplanar (CN=3)" + if ce == "TS:3": + return "t-shaped (CN=3)" + if ce == "T:4": + return "tetrahedral (CN=4)" + if ce == "S:4": + return "square planar (CN=4)" + if ce == "SY:4": + return "square non-coplanar (CN=4)" + if ce == "SS:4": + return "see-saw like (CN=4)" + if ce == "PP:5": + return "pentagonal (CN=5)" + if ce == "S:5": + return "square pyramidal (CN=5)" + if ce == "T:5": + return "trigonal bipyramidal (CN=5)" + if ce == "O:6": + return "octahedral (CN=6)" + if ce == "T:6": + return "trigonal prismatic (CN=6)" + if ce == "PP:6": + return "pentagonal pyramidal (CN=6)" + if ce == "PB:7": + return "pentagonal bipyramidal (CN=7)" + if ce == "ST:7": + return "square-face capped trigonal prismatic (CN=7)" + if ce == "ET:7": + return "end-trigonal-face capped trigonal prismatic (CN=7)" + if ce == "FO:7": + return "face-capped octahedron (CN=7)" + if ce == "C:8": + return "cubic (CN=8)" + if ce == "SA:8": + return "square antiprismatic (CN=8)" + if ce == "SBT:8": + return "square-face bicapped trigonal prismatic (CN=8)" + if ce == "TBT:8": + return "triangular-face bicapped trigonal prismatic (CN=8)" + if ce == "DD:8": + return "dodecahedronal (with triangular faces) (CN=8)" + if ce == "DDPN:8": + return "dodecahedronal (with triangular faces - p2345 plane normalized) (CN=8)" + if ce == "HB:8": + return "hexagonal bipyramidal (CN=8)" + if ce == "BO_1:8": + return "bicapped octahedral (opposed cap faces) (CN=8)" + if ce == "BO_2:8": + return "bicapped octahedral (cap faces with one atom in common) (CN=8)" + if ce == "BO_3:8": + return "bicapped octahedral (cap faces with one edge in common) (CN=8)" + if ce == "TC:9": + return "triangular cupola (CN=9)" + if ce == "TT_1:9": + return "Tricapped triangular prismatic (three square - face caps) (CN=9)" + if ce == "TT_2:9": + return "Tricapped triangular prismatic (two square - face caps and one triangular - face cap) (CN=9)" + if ce == "TT_3:9": + return "Tricapped triangular prism (one square - face cap and two triangular - face caps) (CN=9)" + if ce == "HD:9": + return "Heptagonal dipyramidal (CN=9)" + if ce == "TI:9": + return "tridiminished icosohedral (CN=9)" + if ce == "SMA:9": + return "Square-face monocapped antiprism (CN=9)" + if ce == "SS:9": + return "Square-face capped square prismatic (CN=9)" + if ce == "TO_1:9": + return "Tricapped octahedral (all 3 cap faces share one atom) (CN=9)" + if ce == "TO_2:9": + return "Tricapped octahedral (cap faces are aligned) (CN=9)" + if ce == "TO_3:9": + return "Tricapped octahedron (all 3 cap faces are sharing one edge of a face) (CN=9)" + if ce == "PP:10": + return "Pentagonal prismatic (CN=10)" + if ce == "PA:10": + return "Pentagonal antiprismatic (CN=10)" + if ce == "SBSA:10": + return "Square-face bicapped square antiprismatic (CN=10)" + if ce == "MI:10": + return "Metabidiminished icosahedral (CN=10)" + if ce == "S:10": + return "sphenocoronal (CN=10)" + if ce == "H:10": + return "Hexadecahedral (CN=10)" + if ce == "BS_1:10": + return "Bicapped square prismatic (opposite faces) (CN=10)" + if ce == "BS_1:10": + return "Bicapped square prismatic (opposite faces) (CN=10)" + if ce == "BS_2:10": + return "Bicapped square prism(adjacent faces) (CN=10)" + if ce == "TBSA:10": + return "Trigonal-face bicapped square antiprismatic (CN=10)" + if ce == "PCPA:11": + return "Pentagonal - face capped pentagonal antiprismatic (CN=11)" + if ce == "H:11": + return "Hendecahedral (CN=11)" + if ce == "SH:11": + return "Sphenoid hendecahedral (CN=11)" + if ce == "CO:11": + return "Cs - octahedral (CN=11)" + if ce == "DI:11": + return "Diminished icosahedral (CN=12)" + if ce == "I:12": + return "Icosahedral (CN=12)" + if ce == "PBP: 12": + return "Pentagonal - face bicapped pentagonal prismatic (CN=12)" + if ce == "TT:12": + return "Truncated tetrahedral (CN=12)" + if ce == "C:12": + return "Cuboctahedral (CN=12)" + if ce == "AC:12": + return "Anticuboctahedral (CN=12)" + if ce == "SC:12": + return "Square cupola (CN=12)" + if ce == "S:12": + return "Sphenomegacorona (CN=12)" + if ce == "HP:12": + return "Hexagonal prismatic (CN=12)" + if ce == "HA:12": + return "Hexagonal antiprismatic (CN=12)" + if ce == "SH:13": + return "Square-face capped hexagonal prismatic (CN=13)" + if ce == "1": + return "1-fold" + if ce == "2": + return "2-fold" + if ce == "3": + return "3-fold" + if ce == "4": + return "4-fold" + if ce == "5": + return "5-fold" + if ce == "6": + return "6-fold" + if ce == "7": + return "7-fold" + if ce == "8": + return "8-fold" + if ce == "9": + return "9-fold" + if ce == "10": + return "10-fold" + if ce == "11": + return "11-fold" + if ce == "12": + return "12-fold" + if ce == "13": + return "13-fold" + if ce == "14": + return "14-fold" + if ce == "15": + return "15-fold" + if ce == "16": + return "16-fold" + if ce == "17": + return "17-fold" + if ce == "18": + return "18-fold" + if ce == "19": + return "19-fold" + if ce == "20": + return "20-fold" + if ce == "21": + return "21-fold" + if ce == "22": + return "22-fold" + if ce == "23": + return "23-fold" + if ce == "24": + return "24-fold" + if ce == "25": + return "25-fold" + if ce == "26": + return "26-fold" + if ce == "27": + return "27-fold" + if ce == "28": + return "28-fold" + if ce == "29": + return "29-fold" + if ce == "30": + return "30-fold" + return ce + +
+[docs] + def write_description(self): + """Print the description of the COHPs or COBIs or COOPs to the screen.""" + for textpart in self.text: + print(textpart)
+ + +
+[docs] + @staticmethod + def get_calc_quality_description(quality_dict): + """ + Generate a text description of the LOBSTER calculation quality. + + :param quality_dict: python dictionary from lobsterpy.analysis.get_lobster_calc_quality_summary + """ + text_des = [] + + for key, val in quality_dict.items(): + if key == "minimal_basis": + if val: + text_des.append("The LOBSTER calculation used minimal basis.") + if not val: + text_des.append( + "Consider rerunning the calculation with the minimum basis as well. Choosing a " + "larger basis set is only recommended if you see a significant improvement of " + "the charge spilling." + ) + + elif key == "charge_spilling": + text_des.append( + "The absolute and total charge spilling for the calculation is {} and {} %, " + "respectively.".format( + quality_dict[key]["abs_charge_spilling"], + quality_dict[key]["abs_total_spilling"], + ) + ) + elif key == "band_overlaps_analysis": + if quality_dict[key]["file_exists"]: + if quality_dict[key]["has_good_quality_maxDeviation"]: + text_des.append( + "The bandOverlaps.lobster file is generated during the LOBSTER run. This " + "indicates that the projected wave function is not completely orthonormalized; " + "however, the maximal deviation values observed compared to the identity matrix " + "is below the threshold of 0.1." + ) + else: + text_des.append( + "The bandOverlaps.lobster file is generated during the LOBSTER run. This " + "indicates that the projected wave function is not completely orthonormalized. " + "The maximal deviation value from the identity matrix is {}, and there are " + "{} percent k-points above the deviation threshold of 0.1. Please check the " + "results of other quality checks like dos comparisons, charges, " + "charge spillings before using the results for further " + "analysis.".format( + quality_dict[key]["max_deviation"], + quality_dict[key]["percent_kpoints_abv_limit"], + ) + ) + else: + text_des.append( + "The projected wave function is completely orthonormalized as no " + "bandOverlaps.lobster file is generated during the LOBSTER run." + ) + + elif key == "charge_comparisons": + if val: + for charge in ["mulliken", "loewdin"]: + if val[f"bva_{charge}_agree"]: + text_des.append( + f"The atomic charge signs from {charge.capitalize()} population analysis " + f"agree with the bond valence analysis." + ) + if not val[f"bva_{charge}_agree"]: + text_des.append( + f"The atomic charge signs from {charge.capitalize()} population analysis " + f"do not agree with the bond valence analysis." + ) + else: + text_des.append( + "Oxidation states from BVA analyzer cannot be determined. " + "Thus BVA charge comparison is not conducted." + ) + + elif key == "dos_comparisons": + comp_types = [] + tani_index = [] + for orb in val: + if orb.split("_")[-1] in ["s", "p", "d", "f", "summed"]: + comp_types.append(orb.split("_")[-1]) + tani_index.append(str(val[orb])) + text_des.append( + "The Tanimoto index from DOS comparisons in the energy range between {}, {} eV " + "for {} orbitals are: {}.".format( + val["e_range"][0], + val["e_range"][1], + ", ".join(comp_types), + ", ".join(tani_index), + ) + ) + + return text_des
+ + +
+[docs] + @staticmethod + def write_calc_quality_description(calc_quality_text): + """Print the calculation quality description to the screen.""" + print(" ".join(calc_quality_text))
+
+ +
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/lobsterpy/featurize/batch.html b/_modules/lobsterpy/featurize/batch.html new file mode 100644 index 00000000..33583028 --- /dev/null +++ b/_modules/lobsterpy/featurize/batch.html @@ -0,0 +1,1345 @@ + + + + + + + + + + lobsterpy.featurize.batch — lobsterpy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for lobsterpy.featurize.batch

+# Copyright (c) lobsterpy development team
+# Distributed under the terms of a BSD 3-Clause "New" or "Revised" License
+
+"""This module defines wrapper classes to quickly obtain similarity matrix of input fingerprint objects."""
+
+from __future__ import annotations
+
+import multiprocessing as mp
+import os
+import warnings
+from pathlib import Path
+
+import numpy as np
+import pandas as pd
+from tqdm.autonotebook import tqdm
+
+from lobsterpy.featurize.core import (
+    CoxxFingerprint,
+    FeaturizeCharges,
+    FeaturizeCOXX,
+    FeaturizeDoscar,
+    FeaturizeLobsterpy,
+)
+from lobsterpy.structuregraph.graph import LobsterGraph
+
+from . import get_file_paths
+
+warnings.filterwarnings("ignore")
+
+
+
+[docs] +class BatchSummaryFeaturizer: + """ + Batch Featurizer sets that generates summary features from lobster data. + + :param path_to_lobster_calcs: path to root directory consisting of all lobster calc + :param path_to_jsons: path to root directory consisting of all lobster lightweight jsons + :param feature_type: set the feature type for moment features. + Possible options are `bonding`, `antibonding` or `overall` + :param charge_type: set charge type used for computing ionicity. Possible options are + `mulliken`, `loewdin` or `both`. + :param bonds: `all_bonds` or `cation_anion_bonds` + :param orbital_resolved: bool indicating whether LobsterPy analysis is performed orbital wise + :param include_cobi_data: bool stating to include COBICAR.lobster features + :param include_coop_data: bool stating to include COOPCAR.lobster features + :param e_range: range of energy relative to fermi for which moment features needs to be computed + :param n_jobs: parallel processes to run + """ + + def __init__( + self, + path_to_lobster_calcs: str | Path, + path_to_jsons: str | Path | None = None, + feature_type: str = "antibonding", + charge_type: str = "both", + bonds: str = "all", + orbital_resolved: bool = False, + include_cobi_data: bool = False, + include_coop_data: bool = False, + e_range: list[float] = [-5.0, 0.0], + n_jobs: int = 4, + ): + """ + Featurize lobster data via multiprocessing for large number of compounds. + + :param path_to_lobster_calcs: path to root directory consisting of all lobster calc + :param path_to_jsons: path to root directory consisting of all lobster lightweight jsons + :param feature_type: set the feature type for moment features. + Possible options are `bonding`, `antibonding` or `overall` + :param charge_type: set charge type used for computing ionicity. Possible options are + `mulliken`, `loewdin` or `both`. + :param bonds: `all` or `cation-anion` bonds + :param orbital_resolved: bool indicating whether LobsterPy analysis is performed orbital wise + :param include_cobi_data: bool stating to include COBICAR.lobster features + :param include_coop_data: bool stating to include COOPCAR.lobster features + :param e_range: range of energy relative to fermi for which moment features needs to be computed + :param n_jobs: parallel processes to run + """ + # Check for valid parameters of string type + allowed_str_inputs = { + "charge_type": ["mulliken", "loewdin", "both"], + "bonds": ["all", "cation-anion"], + "feature_type": ["bonding", "antibonding", "overall"], + } + for param, param_string in zip([charge_type, bonds, feature_type], ["charge_type", "bonds", "feature_type"]): + if param not in allowed_str_inputs[param_string]: + raise ValueError( + f"Parameter {param_string} set to {param} but must be in " + f"{list(allowed_str_inputs[param_string])}." + ) + + self.path_to_lobster_calcs = path_to_lobster_calcs + self.path_to_jsons = path_to_jsons + self.feature_type = feature_type + self.charge_type = charge_type + self.bonds = bonds + self.orbital_resolved = orbital_resolved + self.include_cobi_data = include_cobi_data + self.include_coop_data = include_coop_data + self.e_range = e_range + self.n_jobs = n_jobs + + def _featurizelobsterpy(self, file_name_or_path: str | Path) -> pd.DataFrame: + """ + Featurize Lobsterpy condensed bonding analysis data. + + if lightweight json file exists loads that or invokes LobsterPy Analysis class. + + :param file_name_or_path: path to the LOBSTER calc directory or + lightweight condensed bonding analysis json file name. + + Returns: + A pandas dataframe with ICOHP stats like mean, min, max of relevant bonds and + madelung energies + + """ + if Path(file_name_or_path).is_file(): + featurize_lobsterpy = FeaturizeLobsterpy( + path_to_json=file_name_or_path, + bonds=self.bonds, + ) + + else: + featurize_lobsterpy = FeaturizeLobsterpy( + path_to_lobster_calc=file_name_or_path, + bonds=self.bonds, + orbital_resolved=self.orbital_resolved, + ) + + return featurize_lobsterpy.get_df() + + def _featurizecoxx(self, path_to_lobster_calc: str | Path) -> pd.DataFrame: + """ + Featurize COHP/COBI/COOPCAR data using FeaturizeCOXX. + + :param path_to_lobster_calc: path to root LOBSTER calc directory + + Returns: + A pandas dataframe with COHP summary stats data mainly weighted ICOHP/ICOOP/ICOBI, + Effective interaction number and moment features (center, width, skewness and kurtosis) + + """ + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, requested_files=["structure", "cohpcar", "icohplist"] + ) + structure_path = file_paths.get("structure") + + coxx = FeaturizeCOXX( + path_to_coxxcar=str(file_paths.get("cohpcar")), + path_to_icoxxlist=str(file_paths.get("icohplist")), + path_to_structure=str(structure_path), + feature_type=self.feature_type, + e_range=self.e_range, + ) + + df = coxx.get_summarized_coxx_df() + del coxx + + if self.include_cobi_data: + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, requested_files=["cobicar", "icobilist"] + ) + + coxx = FeaturizeCOXX( + path_to_coxxcar=str(file_paths.get("cobicar")), + path_to_icoxxlist=str(file_paths.get("icobilist")), + path_to_structure=str(structure_path), + feature_type=self.feature_type, + e_range=self.e_range, + are_cobis=True, + ) + + df_cobi = coxx.get_summarized_coxx_df() + df = pd.concat([df, df_cobi], axis=1) + del coxx + + if self.include_coop_data: + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, requested_files=["coopcar", "icooplist"] + ) + + coxx = FeaturizeCOXX( + path_to_coxxcar=str(file_paths.get("coopcar")), + path_to_icoxxlist=str(file_paths.get("icooplist")), + path_to_structure=str(structure_path), + feature_type=self.feature_type, + e_range=self.e_range, + are_coops=True, + ) + + df_coop = coxx.get_summarized_coxx_df() + df = pd.concat([df, df_coop], axis=1) + del coxx + + return df + + def _featurizecharges(self, path_to_lobster_calc: str | Path) -> pd.DataFrame: + """ + Featurize CHARGE.lobster.gz data that using FeaturizeCharges. + + :param path_to_lobster_calc: path to root LOBSTER calc directory + + Returns: + A pandas dataframe with computed ionicity for the structure + + """ + file_paths = get_file_paths(path_to_lobster_calc=path_to_lobster_calc, requested_files=["structure", "charge"]) + + if self.charge_type == "mulliken": + charge_mull = FeaturizeCharges( + path_to_charge=str(file_paths.get("charge")), + path_to_structure=str(file_paths.get("structure")), + charge_type="mulliken", + ) + df = charge_mull.get_df() + elif self.charge_type == "loewdin": + charge_loew = FeaturizeCharges( + path_to_charge=str(file_paths.get("charge")), + path_to_structure=str(file_paths.get("structure")), + charge_type="loewdin", + ) + df = charge_loew.get_df() + else: + charge_mull = FeaturizeCharges( + path_to_charge=str(file_paths.get("charge")), + path_to_structure=str(file_paths.get("structure")), + charge_type="mulliken", + ) + df_mull = charge_mull.get_df() + + charge_loew = FeaturizeCharges( + path_to_charge=str(file_paths.get("charge")), + path_to_structure=str(file_paths.get("structure")), + charge_type="loewdin", + ) + df_loew = charge_loew.get_df() + + df = pd.concat([df_mull, df_loew], axis=1) + + return df + +
+[docs] + def get_df(self) -> pd.DataFrame: + """ + Generate a pandas dataframe with summary features extracted from LOBSTER files. + + Uses multiprocessing to speed up the process. + + Returns: + Returns a pandas dataframe + + """ + if self.path_to_jsons: + file_name_or_path = [ + os.path.join(self.path_to_jsons, f) + for f in os.listdir(self.path_to_jsons) + if not f.startswith("t") and not f.startswith(".") and not os.path.isdir(f) + ] + + elif self.path_to_lobster_calcs and not self.path_to_jsons: + file_name_or_path = [ + os.path.join(self.path_to_lobster_calcs, f) + for f in os.listdir(self.path_to_lobster_calcs) + if not f.startswith("t") + and not f.startswith(".") + and os.path.isdir(os.path.join(self.path_to_lobster_calcs, f)) + ] + + row = [] + with ( + mp.Pool(processes=self.n_jobs, maxtasksperchild=1) as pool, + tqdm(total=len(file_name_or_path), desc="Generating LobsterPy summary stats") as pbar, + ): + for _, result in enumerate(pool.imap_unordered(self._featurizelobsterpy, file_name_or_path, chunksize=1)): + pbar.update() + row.append(result) + + df_lobsterpy = pd.concat(row) + df_lobsterpy.sort_index(inplace=True) # noqa: PD002 + + paths = [ + os.path.join(self.path_to_lobster_calcs, f) + for f in os.listdir(self.path_to_lobster_calcs) + if not f.startswith("t") + and not f.startswith(".") + and os.path.isdir(os.path.join(self.path_to_lobster_calcs, f)) + ] + + row = [] + with ( + mp.Pool(processes=self.n_jobs, maxtasksperchild=1) as pool, + tqdm(total=len(paths), desc="Generating COHP/COOP/COBI summary stats") as pbar, + ): + for _, result in enumerate(pool.imap_unordered(self._featurizecoxx, paths, chunksize=1)): + pbar.update() + row.append(result) + + df_coxx = pd.concat(row) + df_coxx.sort_index(inplace=True) # noqa: PD002 + + row = [] + with ( + mp.Pool(processes=self.n_jobs, maxtasksperchild=1) as pool, + tqdm(total=len(paths), desc="Generating charge based features") as pbar, + ): + for _, result in enumerate(pool.imap_unordered(self._featurizecharges, paths, chunksize=1)): + pbar.update() + row.append(result) + + df_charges = pd.concat(row) + df_charges.sort_index(inplace=True) # noqa: PD002 + + return pd.concat([df_lobsterpy, df_coxx, df_charges], axis=1)
+
+ + + +
+[docs] +class BatchCoxxFingerprint: + """ + BatchFeaturizer to generate COHP/COOP/COBI fingerprints and Tanimoto index similarity matrix. + + :param path_to_lobster_calcs: path to root directory consisting of all lobster calc + :param feature_type: set the feature type for moment features. + Possible options are `bonding`, `antibonding` or `overall` + :param label_list: bond labels list for which fingerprints needs to be generated. + :param tanimoto: bool to state to compute tanimoto index between fingerprint objects + :param normalize: bool to state to normalize the fingerprint data + :param spin_type: can be `summed` or `up` or `down`. + :param n_bins: sets number for bins for fingerprint objects + :param e_range: range of energy relative to fermi for which moment features needs to be computed + :param n_jobs: number of parallel processes to run + :param fingerprint_for: Possible options are `cohp` or `cobi` or `coop`. + Based on this fingerprints will be computed for COHPCAR/COOBICAR/COOPCAR.lobster files + + Attributes: + fingerprint_df: A pandas dataframe with fingerprint objects + """ + + def __init__( + self, + path_to_lobster_calcs: str | Path, + feature_type: str = "overall", + label_list: list[str] | None = None, + tanimoto: bool = True, + normalize: bool = True, + spin_type: str = "summed", + n_bins: int = 56, + e_range: list[float] = [-15.0, 0.0], + n_jobs=4, + fingerprint_for: str = "cohp", + ): + """ + Generate COHP/COOP/COBI fingerprints and pair-wise Tanimoto index similarity matrix. + + :param path_to_lobster_calcs: path to root directory consisting of all lobster calc + :param feature_type: set the feature type for moment features. + Possible options are `bonding`, `antibonding` or `overall` + :param label_list: bond labels list for which fingerprints needs to be generated. + :param tanimoto: bool to state to compute tanimoto index between fingerprint objects + :param normalize: bool to state to normalize the fingerprint data + :param spin_type: can be `summed` or `up` or `down`. + :param n_bins: sets number for bins for fingerprint objects + :param e_range: range of energy relative to fermi for which moment features needs to be computed + :param n_jobs: number of parallel processes to run + :param fingerprint_for: Possible options are `cohp` or `cobi` or `coop`. + Based on this fingerprints will be computed for COHPCAR/COOBICAR/COOPCAR.lobster files + """ + self.path_to_lobster_calcs = path_to_lobster_calcs + self.feature_type = feature_type + self.tanimoto = tanimoto + self.normalize = normalize + self.label_list = label_list + self.spin_type = spin_type + self.n_bins = n_bins + self.e_range = e_range + self.n_jobs = n_jobs + self.fingerprint_for = fingerprint_for + + self.fingerprint_df = self._get_fingerprints_df() + +
+[docs] + def get_similarity_matrix_df(self) -> pd.DataFrame: + """ + Compute pairwise similarity index for each fingerprint object in input dataframe. + + Returns: + A Pandas dataframe + """ + matrix = np.full((self.fingerprint_df.shape[0], self.fingerprint_df.shape[0]), np.nan) + for i, (_, col) in enumerate(self.fingerprint_df.iterrows()): + for j, (_, col1) in enumerate(self.fingerprint_df.iterrows()): + if self.tanimoto: + simi = self._get_fp_similarity( + col["COXX_FP"], + col1["COXX_FP"], + tanimoto=self.tanimoto, + normalize=False, + ) + else: + simi = self._get_fp_similarity( + col["COXX_FP"], + col1["COXX_FP"], + tanimoto=False, + normalize=True, + ) + matrix[i][j] = simi + + return pd.DataFrame( + matrix, + index=list(self.fingerprint_df.index), + columns=list(self.fingerprint_df.index), + )
+ + + @staticmethod + def _fp_to_dict(fp: CoxxFingerprint) -> dict: + """ + Convert a fingerprint obj into a dictionary. + + :param fp: The fingerprint to be converted into a dictionary + + Returns: + dict: A dict of the fingerprint Keys=type, Values=np.ndarray(energies, cohp) + """ + fp_dict = {} + fp_dict[fp[2]] = np.array([fp[0], fp[1]], dtype="object").T + + return fp_dict + + @staticmethod + def _get_fp_similarity( + fp1: CoxxFingerprint, + fp2: CoxxFingerprint, + col: int = 1, + pt: int | str = "All", + normalize: bool = False, + tanimoto: bool = True, + ) -> float: + """ + Calculate the similarity index (dot product) of two fingerprints. + + :param fp1 The 1st CoxxFingerprint object + :param fp2: The 2nd CoxxFingerprint object + :param col: The item in the fingerprints (0:energies,1: coxxs) to take the dot product of (default is 1) + :param pt: The index of the point that the dot product is to be taken (default is All) + :param normalize: If True normalize the scalar product to 1 (default is False) + :param tanimoto: If True will compute Tanimoto index (default is False) + + Raises: + ValueError: If both tanimoto and normalize are set to True. + + Returns: + Similarity index (float): The value of dot product + + """ + fp1_dict = BatchCoxxFingerprint._fp_to_dict(fp1) if not isinstance(fp1, dict) else fp1 + + fp2_dict = BatchCoxxFingerprint._fp_to_dict(fp2) if not isinstance(fp2, dict) else fp2 + + if pt == "All": + vec1 = np.array([pt[col] for pt in fp1_dict.values()]).flatten() + vec2 = np.array([pt[col] for pt in fp2_dict.values()]).flatten() + else: + vec1 = fp1_dict[fp1[2][pt]][col] # type: ignore + vec2 = fp2_dict[fp2[2][pt]][col] # type: ignore + + if not normalize and tanimoto: + rescale = np.linalg.norm(vec1) ** 2 + np.linalg.norm(vec2) ** 2 - np.dot(vec1, vec2) + + elif not tanimoto and normalize: + rescale = np.linalg.norm(vec1) * np.linalg.norm(vec2) + + elif not tanimoto and not normalize: + rescale = 1.0 + + else: + raise ValueError( + "Cannot compute similarity index. Please set either normalize=True or tanimoto=True or both to False." + ) + return np.dot(vec1, vec2) / rescale + + def _fingerprint_df(self, path_to_lobster_calc: str | Path) -> pd.DataFrame: + """ + Get fingerprint object dataframe via FeaturizeCOXX.get_coxx_fingerprint_df. + + Also helps to generate the data used for fingerprint generation. + + :param path_to_lobster_calc: path to root LOBSTER calculation directory. + + Returns: + A pandas dataframe with COXX fingerprint object + + """ + if self.fingerprint_for.upper() == "COBI": + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, requested_files=["structure", "cobicar", "icobilist"] + ) + + coxxcar_path = file_paths.get("cobicar") + icoxxlist_path = file_paths.get("icobilist") + are_cobis = True + are_coops = False + + elif self.fingerprint_for.upper() == "COOP": + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, requested_files=["structure", "coopcar", "icooplist"] + ) + + coxxcar_path = file_paths.get("coopcar") + icoxxlist_path = file_paths.get("icooplist") + are_cobis = False + are_coops = True + + else: + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, requested_files=["structure", "cohpcar", "icohplist"] + ) + + coxxcar_path = file_paths.get("cohpcar") + icoxxlist_path = file_paths.get("icohplist") + are_cobis = False + are_coops = False + + coxx = FeaturizeCOXX( + path_to_coxxcar=str(coxxcar_path), + path_to_icoxxlist=str(icoxxlist_path), + path_to_structure=str(file_paths.get("structure")), + feature_type=self.feature_type, + e_range=self.e_range, + are_coops=are_coops, + are_cobis=are_cobis, + ) + + return coxx.get_coxx_fingerprint_df( + spin_type=self.spin_type, + n_bins=self.n_bins, + normalize=self.normalize, + label_list=self.label_list, + ) + + def _get_fingerprints_df(self) -> pd.DataFrame: + """ + Generate fingerprint objects dataframe using BatchCoxxFingerprint._fingerprint_df. + + Returns: + A pandas dataframe with COXX fingerprint objects + + """ + paths = [ + os.path.join(self.path_to_lobster_calcs, f) + for f in os.listdir(self.path_to_lobster_calcs) + if not f.startswith("t") + and not f.startswith(".") + and os.path.isdir(os.path.join(self.path_to_lobster_calcs, f)) + ] + + row = [] + with ( + mp.Pool(processes=self.n_jobs, maxtasksperchild=1) as pool, + tqdm( + total=len(paths), + desc=f"Generating {self.fingerprint_for.upper()} fingerprints", + ) as pbar, + ): + for _, result in enumerate(pool.imap_unordered(self._fingerprint_df, paths, chunksize=1)): + pbar.update() + row.append(result) + + df = pd.concat(row) + df.sort_index(inplace=True) # noqa: PD002 + + return df
+ + + +
+[docs] +class BatchStructureGraphs: + """ + Batch Featurizer that generates structure graphs with lobster data. + + :param path_to_lobster_calcs: path to root directory consisting of all lobster calc + :param add_additional_data_sg: bool indicating whether to include `icoop` and `icobi` data as edge properties + :param which_bonds: selects which kind of bonds are analyzed. "all" is the default + :param cutoff_icohp: only bonds that are stronger than cutoff_icohp * strongest ICOHP will be considered. + :param noise_cutoff: if provided hardcodes the lower limit of icohps considered. + :param start: start energy for bonding antibonding percent integration + :param n_jobs: parallel processes to run + + """ + + def __init__( + self, + path_to_lobster_calcs: str | Path, + add_additional_data_sg: bool = True, + which_bonds: str = "all", + cutoff_icohp: float = 0.10, + noise_cutoff: float = 0.1, + start: float | None = None, + n_jobs: int = 4, + ): + """ + Generate structure graphs with LOBSTER data via multiprocessing. + + :param path_to_lobster_calcs: path to root directory consisting of all lobster calc + :param add_additional_data_sg: bool indicating whether to include `icoop` and `icobi` data as edge properties + :param which_bonds: selects which kind of bonds are analyzed. "all" is the default + :param cutoff_icohp: only bonds that are stronger than cutoff_icohp * strongest ICOHP will be considered. + :param noise_cutoff: if provided hardcodes the lower limit of icohps considered. + :param start: start energy for bonding antibonding percent integration + :param n_jobs: parallel processes to run + + """ + self.path_to_lobster_calcs = path_to_lobster_calcs + self.add_additional_data_sg = add_additional_data_sg + self.which_bonds = which_bonds + self.cutff_icohp = cutoff_icohp + self.noise_cutoff = noise_cutoff + self.start = start + self.n_jobs = n_jobs + + def _get_sg_df(self, path_to_lobster_calc: str | Path) -> pd.DataFrame: + """ + Generate a structure graph with LOBSTER data bonding analysis data. + + :param path_to_lobster_calc: path to root LOBSTER calculation directory + + Returns: + A structure graph with LOBSTER data as edge and node properties in structure graph objects + """ + dir_name = Path(path_to_lobster_calc) + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, + requested_files=["charge", "cohpcar", "icohplist", "icooplist", "icobilist", "madelung", "structure"], + ) + + graph = LobsterGraph( + path_to_poscar=str(file_paths.get("structure")), + path_to_charge=str(file_paths.get("charge")), + path_to_cohpcar=str(file_paths.get("cohpcar")), + path_to_icohplist=str(file_paths.get("icohplist")), + add_additional_data_sg=self.add_additional_data_sg, + path_to_icooplist=str(file_paths.get("icooplist")), + path_to_icobilist=str(file_paths.get("icobilist")), + path_to_madelung=str(file_paths.get("madelung")), + which_bonds=self.which_bonds, + cutoff_icohp=self.cutff_icohp, + noise_cutoff=self.noise_cutoff, + start=self.start, + ) + + ids = dir_name.name + + df = pd.DataFrame(index=[ids]) + + df.loc[ids, "structure_graph"] = graph.sg + + return df + +
+[docs] + def get_df(self) -> pd.DataFrame: + """ + Generate a pandas dataframe with structure graph with LOBSTER data. + + Uses multiprocessing to speed up the process. + + Returns: + Returns a pandas dataframe + + """ + paths = [ + os.path.join(self.path_to_lobster_calcs, f) + for f in os.listdir(self.path_to_lobster_calcs) + if not f.startswith("t") + and not f.startswith(".") + and os.path.isdir(os.path.join(self.path_to_lobster_calcs, f)) + ] + row = [] + with ( + mp.Pool(processes=self.n_jobs, maxtasksperchild=1) as pool, + tqdm(total=len(paths), desc="Generating Structure Graphs") as pbar, + ): + for _, result in enumerate(pool.imap_unordered(self._get_sg_df, paths, chunksize=1)): + pbar.update() + row.append(result) + + df_sg = pd.concat(row) + df_sg.sort_index(inplace=True) # noqa: PD002 + + return df_sg
+
+ + + +
+[docs] +class BatchDosFeaturizer: + """ + BatchFeaturizer to generate Lobster DOS moment features and fingerprints. + + :param path_to_lobster_calcs: path to root directory consisting of all lobster calc + :param add_element_dos_moments: add element dos moment features alongside orbital dos + :param normalize: bool to state to normalize the fingerprint data + :param n_bins: sets number for bins for fingerprint objects + :param e_range: range of energy relative to fermi for which moment features needs to be computed + :param n_jobs: number of parallel processes to run + :param fingerprint_type: Specify fingerprint type to compute, can accept `{s/p/d/f/}summed_{pdos/tdos}` + (default is summed_pdos) + :param use_lso_dos: Will force featurizer to use DOSCAR.LSO.lobster instead of DOSCAR.lobster + + """ + + def __init__( + self, + path_to_lobster_calcs: str | Path, + add_element_dos_moments: bool = False, + fingerprint_type: str = "summed_pdos", + normalize: bool = True, + n_bins: int = 56, + e_range: list[float] = [-15.0, 0.0], + n_jobs=4, + use_lso_dos: bool = True, + ): + """ + Initialize BatchDosFeaturizer. + + :param path_to_lobster_calcs: path to root directory consisting of all lobster calc + :param add_element_dos_moments: add element dos moment features alongside orbital dos + :param normalize: bool to state to normalize the fingerprint data + :param n_bins: sets number for bins for fingerprint objects + :param e_range: range of energy relative to fermi for which moment features needs to be computed + :param n_jobs: number of parallel processes to run + :param fingerprint_type: Specify fingerprint type to compute, can accept `{s/p/d/f/}summed_{pdos/tdos}` + (default is summed_pdos) + :param use_lso_dos: Will force featurizer to use DOSCAR.LSO.lobster instead of DOSCAR.lobster + """ + self.path_to_lobster_calcs = path_to_lobster_calcs + self.add_element_dos_moments = add_element_dos_moments + self.fingerprint_type = fingerprint_type + self.e_range = e_range + self.normalize = normalize + self.n_jobs = n_jobs + self.n_bins = n_bins + self.use_lso_dos = use_lso_dos + + def _get_dos_moments_df(self, path_to_lobster_calc: str | Path) -> pd.DataFrame: + """ + Featurize DOSCAR.lobster data using FeaturizeDOSCAR. + + Returns: + A pandas dataframe with computed PDOS moment features + """ + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, + requested_files=["structure", "doscar"], + use_lso_dos=self.use_lso_dos, + ) + + featurize_dos = FeaturizeDoscar( + path_to_doscar=str(file_paths.get("doscar")), + path_to_structure=str(file_paths.get("structure")), + add_element_dos_moments=self.add_element_dos_moments, + e_range=self.e_range, + ) + + return featurize_dos.get_df() + + def _get_dos_fingerprints_df(self, path_to_lobster_calc: str | Path) -> pd.DataFrame: + """ + Featurize DOSCAR.lobster data into fingerprints using FeaturizeDOSCAR. + + :param path_to_lobster_calc: path to root LOBSTER calculation directory. + + Returns: + A pandas dataframe with DOS fingerprint objects + """ + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, + requested_files=["structure", "doscar"], + use_lso_dos=self.use_lso_dos, + ) + + featurize_dos = FeaturizeDoscar( + path_to_doscar=str(file_paths.get("doscar")), + path_to_structure=str(file_paths.get("structure")), + e_range=self.e_range, + ) + + return featurize_dos.get_fingerprint_df( + fp_type=self.fingerprint_type, + normalize=self.normalize, + n_bins=self.n_bins, + ) + +
+[docs] + def get_df(self) -> pd.DataFrame: + """ + Generate a pandas dataframe with all moment features. + + Moment features are PDOS (optional: element dos) center, width, skewness, kurtosis + and upper band edge. + + Returns: + A pandas dataframe with moment features + """ + paths = [ + os.path.join(self.path_to_lobster_calcs, f) + for f in os.listdir(self.path_to_lobster_calcs) + if not f.startswith("t") + and not f.startswith(".") + and os.path.isdir(os.path.join(self.path_to_lobster_calcs, f)) + ] + row = [] + with ( + mp.Pool(processes=self.n_jobs, maxtasksperchild=1) as pool, + tqdm(total=len(paths), desc="Generating PDOS moment features") as pbar, + ): + for _, result in enumerate(pool.imap_unordered(self._get_dos_moments_df, paths, chunksize=1)): + pbar.update() + row.append(result) + + df_dos = pd.concat(row) + df_dos.sort_index(inplace=True) # noqa: PD002 + + return df_dos
+ + +
+[docs] + def get_fingerprints_df(self) -> pd.DataFrame: + """ + Generate a pandas dataframe with DOS fingerprints. + + Returns: + A pandas dataframe with fingerprint objects + """ + paths = [ + os.path.join(self.path_to_lobster_calcs, f) + for f in os.listdir(self.path_to_lobster_calcs) + if not f.startswith("t") + and not f.startswith(".") + and os.path.isdir(os.path.join(self.path_to_lobster_calcs, f)) + ] + row = [] + with ( + mp.Pool(processes=self.n_jobs, maxtasksperchild=1) as pool, + tqdm(total=len(paths), desc="Generating DOS fingerprints") as pbar, + ): + for _, result in enumerate(pool.imap_unordered(self._get_dos_fingerprints_df, paths, chunksize=1)): + pbar.update() + row.append(result) + + df_dos_fp = pd.concat(row) + df_dos_fp.sort_index(inplace=True) # noqa: PD002 + + return df_dos_fp
+
+ +
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/lobsterpy/featurize/core.html b/_modules/lobsterpy/featurize/core.html new file mode 100644 index 00000000..23525cda --- /dev/null +++ b/_modules/lobsterpy/featurize/core.html @@ -0,0 +1,1700 @@ + + + + + + + + + + lobsterpy.featurize.core — lobsterpy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for lobsterpy.featurize.core

+# Copyright (c) lobsterpy development team
+# Distributed under the terms of a BSD 3-Clause "New" or "Revised" License
+
+"""This module defines classes to featurize Lobster data ready to be used for ML studies."""
+
+from __future__ import annotations
+
+import gzip
+import json
+import warnings
+from pathlib import Path
+from typing import NamedTuple
+
+import numpy as np
+import pandas as pd
+from mendeleev import element
+from numpy import ndarray
+from pymatgen.core.structure import Structure
+from pymatgen.electronic_structure.cohp import CompleteCohp
+from pymatgen.electronic_structure.core import Spin
+from pymatgen.io.lobster import Charge, Doscar, Icohplist, MadelungEnergies
+from scipy.integrate import trapezoid
+from scipy.signal import hilbert
+
+from lobsterpy.cohp.analyze import Analysis
+
+from . import get_file_paths
+
+warnings.filterwarnings("ignore")
+
+
+
+[docs] +class FeaturizeLobsterpy: + """ + Class to featurize lobsterpy data. + + :param path_to_lobster_calc: path to parent directory containing lobster calc outputs + :param path_to_json: path to lobster lightweight json + :param bonds: "all" or "cation-anion" bonds + :param orbital_resolved: bool indicating whether LobsterPy analysis is performed orbital wise + """ + + def __init__( + self, + path_to_lobster_calc: str | Path | None = None, + path_to_json: str | Path | None = None, + orbital_resolved: bool = False, + bonds: str = "all", + ): + """Initialize featurizer.""" + self.path_to_json = path_to_json + self.path_to_lobster_calc = path_to_lobster_calc + self.orbital_resolved = orbital_resolved + self.bonds = bonds + +
+[docs] + def get_df(self, ids: str | None = None) -> pd.DataFrame: + """ + Featurize LobsterPy condensed bonding analysis data. + + :param ids: set index name in the pandas dataframe. Default is None. + When None, LOBSTER calc directory name is used as index name. + + Returns: + Returns a pandas dataframe with lobsterpy icohp statistics + """ + if self.path_to_json and not self.path_to_lobster_calc: + # read the lightweight lobster json files using read_lobster_lightweight_json method + data = FeaturizeLobsterpy.read_lobster_lightweight_json(path_to_json=self.path_to_json) + if not ids: + ids = Path(self.path_to_json).name.split(".")[0] + + elif self.path_to_lobster_calc and not self.path_to_json: + # get lobsterpy condensed bonding analysis data using get_lobsterpy_cba_dict method + data = FeaturizeLobsterpy.get_lobsterpy_cba_dict( + path_to_lobster_calc=self.path_to_lobster_calc, + bonds=self.bonds, + orbital_resolved=self.orbital_resolved, + ) + + if not ids: + ids = Path(self.path_to_lobster_calc).name + + else: + raise ValueError("Please provide either path to lightweight lobster jsons or path to lobster calc") + # define a pandas dataframe + df = pd.DataFrame(index=[ids]) + + icohp_mean = [] + icohp_sum = [] + icohp_mean_orb_bndg = [] + icohp_sum_orb_bndg = [] + icohp_mean_orb_antibndg = [] + icohp_sum_orb_antibndg = [] + bond_orb = [] + antibond_orb = [] + bond = [] + antibond = [] + + # extract lobsterpy icohp related data for bond type specified + + # Results will differ for "all" and "cation-anion" mode. + + # In "all" bonds mode, the bonds will come up twice, also + # cation-cation, anion-anion bonds will also be considered + + if self.bonds == "all": + bond_type = "all_bonds" + elif self.bonds == "cation-anion": + bond_type = "cation_anion_bonds" + + if bond_type == "cation_anion_bonds" and ( + not data[bond_type] + or not data[bond_type]["lobsterpy_data"] + or not data[bond_type]["lobsterpy_data"]["sites"] + ): + raise Exception(f"No {self.bonds} bonds detected for {ids} structure. Please switch to `all` bonds mode") + + if data[bond_type]["lobsterpy_data"]: + for site_data in data[bond_type]["lobsterpy_data"]["sites"].values(): + if site_data["bonds"]: + for bond_data in site_data["bonds"].values(): + icohp_mean.append(float(bond_data["ICOHP_mean"])) + icohp_sum.append(float(bond_data["ICOHP_sum"])) + bond.append(bond_data["bonding"]["perc"]) + antibond.append(bond_data["antibonding"]["perc"]) + if self.orbital_resolved: + if ( + bond_data["orbital_data"]["orbital_summary_stats"] + and "max_bonding_contribution" in bond_data["orbital_data"]["orbital_summary_stats"] + ): + for orb_pair in bond_data["orbital_data"]["orbital_summary_stats"][ + "max_bonding_contribution" + ]: + icohp_mean_orb_bndg.append(bond_data["orbital_data"][orb_pair]["ICOHP_mean"]) + icohp_sum_orb_bndg.append(bond_data["orbital_data"][orb_pair]["ICOHP_sum"]) + bond_orb.append( + bond_data["orbital_data"][orb_pair]["orb_contribution_perc_bonding"] + ) + if ( + bond_data["orbital_data"]["orbital_summary_stats"] + and "max_antibonding_contribution" in bond_data["orbital_data"]["orbital_summary_stats"] + ): + for orb_pair in bond_data["orbital_data"]["orbital_summary_stats"][ + "max_antibonding_contribution" + ]: + icohp_mean_orb_antibndg.append(bond_data["orbital_data"][orb_pair]["ICOHP_mean"]) + icohp_sum_orb_antibndg.append(bond_data["orbital_data"][orb_pair]["ICOHP_sum"]) + antibond_orb.append( + bond_data["orbital_data"][orb_pair]["orb_contribution_perc_antibonding"] + ) + + # add ICOHP stats data (mean, min, max, standard deviation) as columns to the dataframe + + df.loc[ids, "Icohp_mean_avg"] = 0 if len(icohp_mean) == 0 else np.mean(icohp_mean) + df.loc[ids, "Icohp_mean_max"] = 0 if len(icohp_mean) == 0 else np.max(icohp_mean) + df.loc[ids, "Icohp_mean_min"] = 0 if len(icohp_mean) == 0 else np.min(icohp_mean) + df.loc[ids, "Icohp_mean_std"] = 0 if len(icohp_mean) == 0 else np.std(icohp_mean) + + df.loc[ids, "Icohp_sum_avg"] = 0 if len(icohp_sum) == 0 else np.mean(icohp_sum) + df.loc[ids, "Icohp_sum_max"] = 0 if len(icohp_sum) == 0 else np.max(icohp_sum) + df.loc[ids, "Icohp_sum_min"] = 0 if len(icohp_sum) == 0 else np.min(icohp_sum) + df.loc[ids, "Icohp_sum_std"] = 0 if len(icohp_sum) == 0 else np.std(icohp_sum) + + df.loc[ids, "bonding_perc_avg"] = 0 if len(bond) == 0 else np.mean(bond) + df.loc[ids, "bonding_perc_max"] = 0 if len(bond) == 0 else np.max(bond) + df.loc[ids, "bonding_perc_min"] = 0 if len(bond) == 0 else np.min(bond) + df.loc[ids, "bonding_perc_std"] = 0 if len(bond) == 0 else np.std(bond) + + df.loc[ids, "antibonding_perc_avg"] = 0 if len(antibond) == 0 else np.mean(antibond) + df.loc[ids, "antibonding_perc_min"] = 0 if len(antibond) == 0 else np.min(antibond) + df.loc[ids, "antibonding_perc_max"] = 0 if len(antibond) == 0 else np.max(antibond) + df.loc[ids, "antibonding_perc_std"] = 0 if len(antibond) == 0 else np.std(antibond) + + if self.orbital_resolved: + # bonding orbital + df.loc[ids, "Icohp_bndg_orb_mean_avg"] = ( + 0 if len(icohp_mean_orb_bndg) == 0 else np.mean(icohp_mean_orb_bndg) + ) + df.loc[ids, "Icohp_bndg_orb_mean_max"] = 0 if len(icohp_mean_orb_bndg) == 0 else np.max(icohp_mean_orb_bndg) + df.loc[ids, "Icohp_bndg_orb_mean_min"] = 0 if len(icohp_mean_orb_bndg) == 0 else np.min(icohp_mean_orb_bndg) + df.loc[ids, "Icohp_bndg_orb_mean_std"] = 0 if len(icohp_mean_orb_bndg) == 0 else np.std(icohp_mean_orb_bndg) + + df.loc[ids, "Icohp_bndg_orb_sum_avg"] = 0 if len(icohp_sum_orb_bndg) == 0 else np.mean(icohp_sum_orb_bndg) + df.loc[ids, "Icohp_bndg_orb_sum_max"] = 0 if len(icohp_sum_orb_bndg) == 0 else np.max(icohp_sum_orb_bndg) + df.loc[ids, "Icohp_bndg_orb_sum_min"] = 0 if len(icohp_sum_orb_bndg) == 0 else np.min(icohp_sum_orb_bndg) + df.loc[ids, "Icohp_bndg_orb_sum_std"] = 0 if len(icohp_sum_orb_bndg) == 0 else np.std(icohp_sum_orb_bndg) + + df.loc[ids, "bonding_orb_perc_avg"] = 0 if len(bond_orb) == 0 else np.mean(bond_orb) + df.loc[ids, "bonding_orb_perc_max"] = 0 if len(bond_orb) == 0 else np.max(bond_orb) + df.loc[ids, "bonding_orb_perc_min"] = 0 if len(bond_orb) == 0 else np.min(bond_orb) + df.loc[ids, "bonding_orb_perc_std"] = 0 if len(bond_orb) == 0 else np.std(bond_orb) + + # anti-bonding orbital + df.loc[ids, "Icohp_antibndg_orb_mean_avg"] = ( + 0 if len(icohp_mean_orb_antibndg) == 0 else np.mean(icohp_mean_orb_antibndg) + ) + df.loc[ids, "Icohp_antibndg_orb_mean_max"] = ( + 0 if len(icohp_mean_orb_antibndg) == 0 else np.max(icohp_mean_orb_antibndg) + ) + df.loc[ids, "Icohp_antibndg_orb_mean_min"] = ( + 0 if len(icohp_mean_orb_antibndg) == 0 else np.min(icohp_mean_orb_antibndg) + ) + df.loc[ids, "Icohp_antibndg_orb_mean_std"] = ( + 0 if len(icohp_mean_orb_antibndg) == 0 else np.std(icohp_mean_orb_antibndg) + ) + + df.loc[ids, "Icohp_antibndg_orb_sum_avg"] = ( + 0 if len(icohp_sum_orb_antibndg) == 0 else np.mean(icohp_sum_orb_antibndg) + ) + df.loc[ids, "Icohp_antibndg_orb_sum_max"] = ( + 0 if len(icohp_sum_orb_antibndg) == 0 else np.max(icohp_sum_orb_antibndg) + ) + df.loc[ids, "Icohp_antibndg_orb_sum_min"] = ( + 0 if len(icohp_sum_orb_antibndg) == 0 else np.min(icohp_sum_orb_antibndg) + ) + df.loc[ids, "Icohp_antibndg_orb_sum_std"] = ( + 0 if len(icohp_sum_orb_antibndg) == 0 else np.std(icohp_sum_orb_antibndg) + ) + + df.loc[ids, "antibonding_orb_perc_avg"] = 0 if len(antibond_orb) == 0 else np.mean(antibond_orb) + df.loc[ids, "antibonding_orb_perc_max"] = 0 if len(antibond_orb) == 0 else np.max(antibond_orb) + df.loc[ids, "antibonding_orb_perc_min"] = 0 if len(antibond_orb) == 0 else np.min(antibond_orb) + df.loc[ids, "antibonding_orb_perc_std"] = 0 if len(antibond_orb) == 0 else np.std(antibond_orb) + + # add madelung energies for the structure + df.loc[ids, "Madelung_Mull"] = data["madelung_energies"]["Mulliken"] + df.loc[ids, "Madelung_Loew"] = data["madelung_energies"]["Loewdin"] + + return df
+ + +
+[docs] + @staticmethod + def read_lobster_lightweight_json(path_to_json: str | Path) -> dict: + """ + Read the lightweight JSON.gz files and return a Python dictionary object. + + :param path_to_json: path to lobsterpy lightweight json file + + Returns: + Returns a dictionary with lobster summarized bonding analysis data + + """ + with gzip.open(str(path_to_json), "rb") as f: + data = json.loads(f.read().decode("utf-8")) + + lobster_data = {} + for item in data: + for key in item: + # check applicable only for updated cba jsons from atomate2 + try: + if (key == "cation_anion_bonds" or key == "all_bonds") and ( + "sites" in item[key]["lobsterpy_data"]["sites"] + ): + item[key]["lobsterpy_data"]["sites"] = item[key]["lobsterpy_data"]["sites"]["sites"] + except KeyError: + pass + lobster_data.update(item) + + return lobster_data
+ + +
+[docs] + @staticmethod + def get_lobsterpy_cba_dict(path_to_lobster_calc: str | Path, bonds: str, orbital_resolved: bool) -> dict: + """ + Generate a Python dictionary object using the Analysis class with condensed bonding analysis data. + + :param path_to_lobster_calc: path to lobsterpy lightweight json file + :param bonds: "all" or "cation-anion" bonds + :param orbital_resolved: bool indicating whether analysis is performed orbital wise + + Returns: + Returns a dictionary with lobster summarized bonding analysis data + + """ + file_paths = get_file_paths( + path_to_lobster_calc=path_to_lobster_calc, requested_files=["structure", "cohpcar", "icohplist", "charge"] + ) + + which_bonds = bonds.replace("-", "_") + bond_type = f"{which_bonds}_bonds" + + try: + analyse = Analysis( + path_to_poscar=str(file_paths.get("structure")), + path_to_icohplist=str(file_paths.get("icohplist")), + path_to_cohpcar=str(file_paths.get("cohpcar")), + path_to_charge=str(file_paths.get("charge")), + summed_spins=False, # we will always use spin polarization here + cutoff_icohp=0.10, + which_bonds=which_bonds, + orbital_resolved=orbital_resolved, + ) + + data = {bond_type: {"lobsterpy_data": analyse.condensed_bonding_analysis}} + except ValueError: + data = {bond_type: {"lobsterpy_data": {}}} + + try: + madelung_path = get_file_paths(path_to_lobster_calc=path_to_lobster_calc, requested_files=["madelung"]) + madelung_obj = MadelungEnergies(filename=str(madelung_path.get("madelung"))) + + madelung_energies = { + "Mulliken": madelung_obj.madelungenergies_Mulliken, + "Loewdin": madelung_obj.madelungenergies_Loewdin, + "Ewald_splitting": madelung_obj.ewald_splitting, + } + data["madelung_energies"] = madelung_energies + except Exception: + warnings.warn( + "MadelungEnergies.lobster file not found in Lobster calc directory provided" + " Will set Madelung Energies for crystal structure values to NaN", + stacklevel=2, + ) + madelung_energies = { + "Mulliken": np.nan, + "Loewdin": np.nan, + "Ewald_splitting": np.nan, + } + + data["madelung_energies"] = madelung_energies + + return data
+
+ + + +
+[docs] +class CoxxFingerprint(NamedTuple): + """ + Represents a Coxx fingerprint. + + This named tuple is used to store information related to a Coxx fingerprint, which + includes energies, Coxx values, fingerprint type, spin type, number of bins, and bin width. + + :param energies: The energy values associated with the Coxx fingerprint. + :param coxx: The Coxx values corresponding to each energy. + :param fp_type: The type of the Coxx fingerprint. + :param spin_type: The spin type associated with the fingerprint. + :param n_bins: The number of bins used in the Coxx fingerprint. + :param bin_width: The width of each bin in the Coxx fingerprint. + """ + + energies: np.ndarray + coxx: np.ndarray + fp_type: str + spin_type: str + n_bins: int + bin_width: float
+ + + +
+[docs] +class FeaturizeCOXX: + """ + Class to featurize COHPCAR, COBICAR or COOPCAR data. + + :param path_to_coxxcar: path to COXXCAR.lobster (e.g., `COXXCAR.lobster`) + :param path_to_icoxxlist: path to ICOXXLIST.lobster (e.g., `ICOXXLIST.lobster`) + :param path_to_structure: path to structure file (e.g., `POSCAR`) + :param feature_type: set the feature type for moment features and fingerprints. + Possible options are `bonding`, `antibonding` or `overall`. + :param are_cobis: bool indicating if file contains COBI/ICOBI data. + :param are_coops: bool indicating if file contains COOP/ICOOP data. + :param e_range: range of energy relative to fermi for which moment features needs to be computed + """ + + def __init__( + self, + path_to_coxxcar: str | Path, + path_to_icoxxlist: str | Path, + path_to_structure: str | Path, + feature_type: str, + e_range: list[float] = [-10.0, 0.0], + are_cobis: bool = False, + are_coops: bool = False, + ): + """ + Featurize COHPCAR, COBICAR or COOPCAR data. + + :param path_to_coxxcar: path to COXXCAR.lobster (e.g., `COXXCAR.lobster`) + :param path_to_icoxxlist: path to ICOXXLIST.lobster (e.g., `ICOXXLIST.lobster`) + :param path_to_structure: path to structure file (e.g., `POSCAR`) + :param feature_type: set the feature type for moment features and fingerprints. + Possible options are `bonding`, `antibonding` or `overall`. + :param are_cobis: bool indicating if file contains COBI/ICOBI data + :param are_coops: bool indicating if file contains COOP/ICOOP data + :param e_range: range of energy relative to fermi for which moment features needs to be computed + + """ + self.path_to_coxxcar = path_to_coxxcar + self.path_to_icoxxlist = path_to_icoxxlist + self.path_to_structure = path_to_structure + self.feature_type = feature_type + self.e_range = e_range + self.are_cobis = are_cobis + self.are_coops = are_coops + self.icoxxlist = Icohplist( + filename=self.path_to_icoxxlist, + are_cobis=self.are_cobis, + are_coops=self.are_coops, + ) + self.completecoxx = CompleteCohp.from_file( + fmt="LOBSTER", + filename=self.path_to_coxxcar, + structure_file=self.path_to_structure, + are_cobis=self.are_cobis, + are_coops=self.are_coops, + ) + +
+[docs] + def get_coxx_fingerprint_df( + self, + ids: str | None = None, + label_list: list[str] | None = None, + orbital: str | None = None, + per_bond: bool = True, + spin_type: str = "summed", + binning: bool = True, + n_bins: int = 56, + normalize: bool = True, + ) -> pd.DataFrame: + """ + Generate a COXX fingerprints dataframe. + + :param ids: set index name in the pandas dataframe. Default is None. + When None, LOBSTER calc directory name is used as index name. + :param spin_type: Specify spin type. Can accept '{summed/up/down}' + (default is summed) + :param binning: If true coxxs will be binned + :param n_bins: Number of bins to be used in the fingerprint (default is 256) + :param normalize: If true, normalizes the area under fp to equal to 1 (default is True) + :param label_list: Specify bond labels as a list for which cohp fingerprints are needed + :param orbital: Orbital for which fingerprint needs is to be computed. Cannot be used independently. + Always a needs label_list. + :param per_bond: Will scale cohp values by number of bonds i.e. length of label_list arg + (Only affects when label_list is not None) + + Raises: + Exception: If spin_type is not one of the accepted values {summed/up/down}. + ValueError: If feature_type is not one of the accepted values {bonding/antibonding/overall}. + + Returns: + A pandas dataframe with the COXX fingerprint + of format (energies, coxx, fp_type, spin_type, n_bins, bin_width) + + """ + coxxcar_obj = self.completecoxx + + energies = coxxcar_obj.energies - coxxcar_obj.efermi + + min_e = self.e_range[0] + max_e = self.e_range[-1] + + if max_e is None: + max_e = np.max(energies) + + if min_e is None: + min_e = np.min(energies) + + if label_list is not None: + divisor = len(label_list) if per_bond else 1 + if label_list is not None and orbital is None: + coxxcar_obj = coxxcar_obj.get_summed_cohp_by_label_list(label_list, divisor=divisor).get_cohp() + elif label_list and orbital: + coxxcar_obj = coxxcar_obj.get_summed_cohp_by_label_and_orbital_list( + label_list=label_list, + orbital_list=[orbital] * len(label_list), + divisor=divisor, + ).get_cohp() + else: + coxxcar_obj = coxxcar_obj.get_cohp() + + if spin_type == "up": + coxx_all = coxxcar_obj[Spin.up] + elif spin_type == "down": + if Spin.down in coxxcar_obj: + coxx_all = coxxcar_obj[Spin.down] + else: + raise ValueError("LOBSTER calculation is non-spin polarized. Please switch spin_type to `up`") + elif spin_type == "summed": + if Spin.down in coxxcar_obj: + coxx_all = coxxcar_obj[Spin.up] + coxxcar_obj[Spin.down] + else: + coxx_all = coxxcar_obj[Spin.up] + else: + raise Exception("Check the spin_type argument.Possible options are summed/up/down") + + coxx_dict = {} + tol = 1e-6 + if not self.are_cobis and not self.are_coops: + coxx_dict["bonding"] = np.array([scohp if scohp <= tol else 0 for scohp in coxx_all]) + coxx_dict["antibonding"] = np.array([scohp if scohp >= tol else 0 for scohp in coxx_all]) + else: + coxx_dict["antibonding"] = np.array([scohp if scohp <= tol else 0 for scohp in coxx_all]) + coxx_dict["bonding"] = np.array([scohp if scohp >= tol else 0 for scohp in coxx_all]) + + coxx_dict["overall"] = coxx_all + + try: + if ids: + df = pd.DataFrame(index=[ids], columns=["COXX_FP"]) + else: + ids = Path(self.path_to_coxxcar).parent.name + df = pd.DataFrame(index=[ids], columns=["COXX_FP"]) + + coxxs = coxx_dict[self.feature_type] + if len(energies) < n_bins: + inds = np.where((energies >= min_e - tol) & (energies <= max_e + tol)) + fp = CoxxFingerprint( + energies[inds], + coxxs[inds], + self.feature_type, + spin_type, + len(energies), + np.diff(energies)[0], + ) + + df.loc[ids, "COXX_FP"] = fp + + return df + + if binning: + ener_bounds = np.linspace(min_e, max_e, n_bins + 1) + ener = ener_bounds[:-1] + (ener_bounds[1] - ener_bounds[0]) / 2.0 + bin_width = np.diff(ener)[0] + else: + ener_bounds = np.array(energies) + ener = np.append(energies, [energies[-1] + np.abs(energies[-1]) / 10]) + n_bins = len(energies) + bin_width = np.diff(energies)[0] + + coxx_rebin = np.zeros(ener.shape) + + for ii, e1, e2 in zip(range(len(ener)), ener_bounds[0:-1], ener_bounds[1:]): + inds = np.where((energies >= e1) & (energies < e2)) + coxx_rebin[ii] = np.sum(coxxs[inds]) + if normalize: # scale DOS bins to make area under histogram equal 1 + area = np.sum([abs(coxx) * bin_width for coxx in coxx_rebin]) + coxx_rebin_sc = coxx_rebin / area + else: + coxx_rebin_sc = coxx_rebin + + fp = CoxxFingerprint( + np.array([ener]), + coxx_rebin_sc, + self.feature_type, + spin_type, + n_bins, + bin_width, + ) + + df.loc[ids, "COXX_FP"] = fp + + return df + + except KeyError: + raise ValueError( + "Please recheck fingerprint type requested argument. Possible options are bonding/antibonding/overall" + )
+ + + def _calculate_wicoxx_ein(self) -> tuple[float, float, float, float]: + r""" + Calculate weighted ICOXX (xx ==hp,op,bi) and EIN of crystal structure based on work by Nelson et al. + + More details can be found here: https://doi.org/10.1016/B978-0-12-823144-9.00120-5 + + \\[\bar{COHP}(E) = \\sum_{i} \\left( w_{i} \\cdot COHP_{i}(E) \right)\\] + + where: + - \\(w_{i} = \frac{ICOHP_{i}}{ICOHP_{\text{total}}}\\) + + \\[EIN = \frac{{ICOHP_{\text{{total}}}}}{{\\overline{ICOHP}}} \\cdot \frac{2}{{N_{\text{{Atoms}}}}}\\] + + where: + - \\(\\overline{ICOHP}\\) represents the average ICOHP value. + - \\(ICOHP_{\text{{total}}}\\) is the total ICOHP value. + - \\(N_{\text{{Atoms}}}\\) is the number of atoms in the system. + + Returns: + Percent bonding, Percent anti-bonding, weighted icoxx, effective interaction number + + """ + list_labels = list(self.icoxxlist.icohplist.keys()) + # Compute sum of icohps + icoxx_total = self.icoxxlist.icohpcollection.get_summed_icohp_by_label_list(list_labels) + + summed_weighted_coxx = [] + + for lab in list_labels: + for cohp in self.completecoxx.get_cohp_by_label(f"{lab}", summed_spin_channels=True).cohp.values(): + coxx = cohp + icoxx = self.icoxxlist.icohpcollection.get_icohp_by_label(lab, summed_spin_channels=True) + # calculate the weights based on icohp contri to total icohp of the structure + try: + weight = icoxx / icoxx_total + except ZeroDivisionError: + weight = 0 + weighted_coxx = weight * coxx + summed_weighted_coxx.append(weighted_coxx) + + summed = np.sum(summed_weighted_coxx, axis=0) + # below fermi + indices = self.completecoxx.energies <= self.completecoxx.efermi + en_bf = self.completecoxx.energies[indices] + coxx_bf = summed[indices] + + w_icoxx = trapezoid(coxx_bf, en_bf) + + ein = (icoxx_total / w_icoxx) * (2 / self.completecoxx.structure.num_sites) # calc effective interaction number + + # percent bonding-anitbonding + tol = 1e-6 + if not self.icoxxlist.are_cobis and not self.icoxxlist.are_coops: + bonding_indices = coxx_bf <= tol + antibonding_indices = coxx_bf >= tol + bnd = abs(trapezoid(en_bf[bonding_indices], coxx_bf[bonding_indices])) + antibnd = abs(trapezoid(en_bf[antibonding_indices], coxx_bf[antibonding_indices])) + per_bnd = (bnd / (bnd + antibnd)) * 100 + per_antibnd = (antibnd / (bnd + antibnd)) * 100 + + elif self.icoxxlist.are_cobis or self.icoxxlist.are_coops: + bonding_indices = coxx_bf >= tol + antibonding_indices = coxx_bf <= tol + bnd = abs(trapezoid(coxx_bf[bonding_indices], en_bf[bonding_indices])) + antibnd = abs(trapezoid(coxx_bf[antibonding_indices], en_bf[antibonding_indices])) + per_bnd = (bnd / (bnd + antibnd)) * 100 + per_antibnd = (antibnd / (bnd + antibnd)) * 100 + + return per_bnd, per_antibnd, w_icoxx, ein + + @staticmethod + def _calc_moment_features( + complete_coxx_obj: CompleteCohp, + feature_type: str, + e_range: list[float], + label_list: list[str] | None = None, + orbital: str | None = None, + per_bond: bool = True, + ) -> tuple[float, float, float, float, float]: + """ + Calculate band center,width, skewness, and kurtosis of the COXX. + + :param complete_coxx_obj: CompleteCohp object + :param feature_type: feature type for moment features calculation + :param e_range: range of energy relative to fermi for which moment features needs to be computed + :param label_list: List of bond labels + :param orbital: orbital for which moment features need to be calculated. Cannot be used independently. + Always needs a label_list. + :param per_bond: Will scale cohp values by number of bonds i.e. length of label_list arg + (Only affects when label_list is not None) + + Returns: + coxx center, width, skewness, kurtosis, and edge in eV + """ + if label_list is not None: + divisor = len(label_list) if per_bond else 1 + + if label_list and orbital is None: + coxxcar = complete_coxx_obj.get_summed_cohp_by_label_list(label_list, divisor=divisor).get_cohp() + elif label_list and orbital: + coxxcar = complete_coxx_obj.get_summed_cohp_by_label_and_orbital_list( + label_list=label_list, + orbital_list=[orbital] * len(label_list), + divisor=divisor, + summed_spin_channels=False, + ).get_cohp() + else: + coxxcar = complete_coxx_obj.get_cohp() + + coxx_all = coxxcar[Spin.up] + coxxcar[Spin.down] if Spin.down in coxxcar else coxxcar[Spin.up] + energies = complete_coxx_obj.energies - complete_coxx_obj.efermi + + coxx_dict = {} + tol = 1e-6 + if not complete_coxx_obj.are_cobis and not complete_coxx_obj.are_coops: + coxx_dict["bonding"] = np.array([scohp if scohp <= tol else 0 for scohp in coxx_all]) + coxx_dict["antibonding"] = np.array([scohp if scohp >= tol else 0 for scohp in coxx_all]) + coxx_dict["overall"] = coxx_all + else: + coxx_dict["antibonding"] = np.array([scohp if scohp <= tol else 0 for scohp in coxx_all]) + coxx_dict["bonding"] = np.array([scohp if scohp >= tol else 0 for scohp in coxx_all]) + coxx_dict["overall"] = coxx_all + + try: + coxx_center = FeaturizeCOXX.get_coxx_center( + coxx=coxx_dict[feature_type], + energies=energies, + e_range=e_range, + ) + coxx_width = np.sqrt( + FeaturizeCOXX.get_n_moment( + n=2, + coxx=coxx_dict[feature_type], + energies=energies, + e_range=e_range, + ) + ) + coxx_skew = FeaturizeCOXX.get_n_moment( + n=3, + coxx=coxx_dict[feature_type], + energies=energies, + e_range=e_range, + ) / FeaturizeCOXX.get_n_moment( + n=2, + coxx=coxx_dict[feature_type], + energies=energies, + e_range=e_range, + ) ** (3 / 2) + + coxx_kurt = ( + FeaturizeCOXX.get_n_moment( + n=4, + coxx=coxx_dict[feature_type], + energies=energies, + e_range=e_range, + ) + / FeaturizeCOXX.get_n_moment( + n=2, + coxx=coxx_dict[feature_type], + energies=energies, + e_range=e_range, + ) + ** 2 + ) + coxx_edge = FeaturizeCOXX.get_cohp_edge(coxx=coxx_dict[feature_type], energies=energies, e_range=e_range) + except KeyError: + raise ValueError( + "Please recheck feature type requested argument. Possible options are bonding/antibonding/overall" + ) + + return coxx_center, coxx_width, coxx_skew, coxx_kurt, coxx_edge + +
+[docs] + @staticmethod + def get_coxx_center( + coxx: ndarray[np.floating], + energies: ndarray[np.floating], + e_range: list[float], + ) -> float: + """ + Get the bandwidth, defined as the first moment of the COXX. + + :param coxx: COXX array + :param energies: energies corresponding COXX + :param e_range: range of energy to compute coxx center + + Returns: + coxx center in eV + """ + return FeaturizeCOXX.get_n_moment(n=1, coxx=coxx, energies=energies, e_range=e_range, center=False)
+ + +
+[docs] + @staticmethod + def get_n_moment( + n: float, + coxx: ndarray[np.floating], + energies: ndarray[np.floating], + e_range: list[float] | None, + center: bool = True, + ) -> float: + """ + Get the nth moment of COXX. + + :param n: The order for the moment + :param coxx: COXX array + :param energies: energies array + :param e_range: range of energy to compute nth moment + :param center: Take moments with respect to the COXX center + :param e_range: range of energy to compute nth moment + + Returns: + COXX nth moment in eV + """ + if e_range: + min_e = e_range[0] + max_e = e_range[1] + if min_e is None: + min_e = min(energies) + if max_e is None: + max_e = max(energies) + else: + min_e = min(energies) + max_e = max(energies) + + tol = 1e-6 + + mask = (energies >= min_e - tol) & (energies <= max_e + tol) + + coxx = coxx[mask] + energies = energies[mask] + + if center: + coxx_center = FeaturizeCOXX.get_coxx_center(coxx=coxx, energies=energies, e_range=[min_e, max_e]) + p = energies - coxx_center + else: + p = energies + + return np.trapz(p**n * coxx, x=energies) / np.trapz(coxx, x=energies)
+ + +
+[docs] + @staticmethod + def get_cohp_edge( + coxx: ndarray[np.floating], + energies: ndarray[np.floating], + e_range: list[float] | None, + ): + """ + Get the highest peak position of hilbert transformed COXX. + + :param coxx: COXX array + :param energies: energies array + :param e_range: range of energy to coxx edge (max peak position) + + Returns: + COXX edge (max peak position) in eV + """ + if e_range: + min_e = e_range[0] + max_e = e_range[1] + if min_e is None: + min_e = min(energies) + if max_e is None: + max_e = max(energies) + else: + min_e = min(energies) + max_e = max(energies) + + tol = 1e-6 + + mask = (energies >= min_e - tol) & (energies <= max_e + tol) + + coxx = coxx[mask] + energies = energies[mask] + + coxx_transformed = np.imag(hilbert(coxx)) + + return energies[np.argmax(coxx_transformed)]
+ + +
+[docs] + def get_summarized_coxx_df( + self, + ids: str | None = None, + label_list: list[str] | None = None, + per_bond: bool = True, + ) -> pd.DataFrame: + """ + Get a pandas dataframe with COXX features. + + Features consist of weighted ICOXX, effective interaction number and + moment features of COXX in the selected energy range. + + :param ids: set index name in the pandas dataframe. Default is None. + When None, LOBSTER calc directory name is used as index name. + :param label_list: list of bond labels to be used for generating features from + COHPCAR.lobster or COOPCAR.lobster or COBICAR.lobster. Default is None. + When None, all bond labels are used. + :param per_bond: Defaults to True. When True, features are normalized + by total number of bonds in the structure. + + Returns: + Returns a pandas dataframe with cohp/cobi/coop related features as per input file + + """ + if ids: + df = pd.DataFrame(index=[ids]) + else: + ids = Path(self.path_to_coxxcar).parent.name + df = pd.DataFrame(index=[ids]) + + ( + per_bnd_xx, + per_antibnd_xx, + w_icoxx, + ein_xx, + ) = self._calculate_wicoxx_ein() + + if self.are_cobis: + type_pop = "COBI" + elif self.are_coops: + type_pop = "COOP" + else: + type_pop = "COHP" + + cc, cw, cs, ck, ce = FeaturizeCOXX._calc_moment_features( + complete_coxx_obj=self.completecoxx, + label_list=label_list, + per_bond=per_bond, + feature_type=self.feature_type, + e_range=self.e_range, + orbital=None, + ) + df.loc[ids, f"bnd_wI{type_pop}"] = per_bnd_xx + df.loc[ids, f"antibnd_wI{type_pop}"] = per_antibnd_xx + df.loc[ids, f"w_I{type_pop}"] = w_icoxx + df.loc[ids, f"EIN_I{type_pop}"] = ein_xx + df.loc[ids, f"center_{type_pop}"] = cc + df.loc[ids, f"width_{type_pop}"] = cw + df.loc[ids, f"skewness_{type_pop}"] = cs + df.loc[ids, f"kurtosis_{type_pop}"] = ck + df.loc[ids, f"edge_{type_pop}"] = ce + + return df
+
+ + + +
+[docs] +class FeaturizeCharges: + """ + Class to compute ionicity from CHARGE.lobster data. + + :param path_to_structure: path to POSCAR + :param path_to_charge: path to CHARGE.lobster (e.g., `CHARGE.lobster`) + :param charge_type: set charge type used for computing ionicity. + Possible options are `Mulliken` or `Loewdin` + """ + + def __init__( + self, + path_to_structure: str | Path, + path_to_charge: str | Path, + charge_type: str, + ): + """ + Compute the Ionicity of the structure from CHARGE.lobster data. + + :param path_to_structure: path to POSCAR + :param path_to_charge: path to CHARGE.lobster (e.g., `CHARGE.lobster`) + :param charge_type: set charge type used for computing ionicity. + Possible options are `Mulliken` or `Loewdin` + """ + self.path_to_structure = path_to_structure + self.path_to_charge = path_to_charge + self.charge_type = charge_type + + def _calc_ionicity(self) -> float: + r""" + Calculate ionicity of the crystal structure based on quantum chemical charges. + + \\[I_{\text{{Charges}}} = \frac{1}{{N_{\text{{Atoms}}}}}\\sum_{i=1}^{N_{\text{{Atoms}}} } + \\left(\frac{q_i}{v_{\text{{eff}},i}}\right)\\] + + Returns: + Ionicity of the structure + + """ + chargeobj = Charge(filename=self.path_to_charge) + structure = Structure.from_file(self.path_to_structure) + + if self.charge_type.lower() not in ["mulliken", "loewdin"]: + raise ValueError("Please check the requested charge_type. Possible options are `mulliken` or `loewdin`") + + ch_veff = [] + tol = 1e-6 + for i, j in enumerate(getattr(chargeobj, self.charge_type.capitalize())): + if ( + j > tol + and not structure.species[i].is_transition_metal + and (not structure.species[i].is_actinoid and not structure.species[i].is_lanthanoid) + ): + valence_elec = element(structure.species[i].value) + try: + val = j / valence_elec.nvalence() + except ZeroDivisionError: + val = 0 + ch_veff.append(val) + + elif ( + j < tol + and not structure.species[i].is_transition_metal + and (not structure.species[i].is_actinoid and not structure.species[i].is_lanthanoid) + ): + valence_elec = element(structure.species[i].value) + val = j / (valence_elec.nvalence() - 8) if valence_elec.nvalence() != 8 else 0 + ch_veff.append(val) + + elif j > tol and ( + structure.species[i].is_transition_metal + or structure.species[i].is_actinoid + or structure.species[i].is_lanthanoid + ): + val = ( + j / (structure.species[i].max_oxidation_state - 0) + if structure.species[i].max_oxidation_state != tol + else 0 + ) + ch_veff.append(val) + + elif j < tol and ( + structure.species[i].is_transition_metal + or structure.species[i].is_actinoid + or structure.species[i].is_lanthanoid + ): + val = ( + j / (structure.species[i].max_oxidation_state - 8) + if structure.species[i].max_oxidation_state != 8 + else 0 + ) + ch_veff.append(val) + + return sum(ch_veff) / structure.num_sites + +
+[docs] + def get_df(self, ids: str | None = None) -> pd.DataFrame: + """ + Return a pandas dataframe with computed ionicity as columns. + + :param ids: set index name in the pandas dataframe. Default is None. + When None, LOBSTER calc directory name is used as index name. + + Returns: + Returns a pandas dataframe with ionicity + + """ + if ids: + df = pd.DataFrame(index=[ids]) + else: + ids = Path(self.path_to_charge).parent.name + df = pd.DataFrame(index=[ids]) + + if self.charge_type.lower() == "mulliken": + df.loc[ids, "Ionicity_Mull"] = self._calc_ionicity() + else: + df.loc[ids, "Ionicity_Loew"] = self._calc_ionicity() + + return df
+
+ + + +
+[docs] +class DosFingerprint(NamedTuple): + """ + Represents a Density of States (DOS) fingerprint. + + This named tuple is used to store information related to the Density of States (DOS) + in a material. It includes the energies, densities, type, number of bins, and bin width. + + :param energies: The energy values associated with the DOS. + :param densities: The corresponding density values for each energy. + :param type: The type of DOS fingerprint. + :param n_bins: The number of bins used in the fingerprint. + :param bin_width: The width of each bin in the DOS fingerprint. + """ + + energies: np.ndarray + densities: np.ndarray + type: str + n_bins: int + bin_width: float
+ + + +
+[docs] +class FeaturizeDoscar: + """ + Class to compute DOS moments and fingerprints from DOSCAR.lobster / DOSCAR.LSO.lobster. + + :param path_to_structure: path to POSCAR + :param path_to_doscar: path to DOSCAR.lobster or DOSCAR.LSO.lobster + :param e_range: range of energy relative to fermi for which moment features and + features needs to be computed + :param add_element_dos_moments: add element dos moment features alongside orbital dos + """ + + def __init__( + self, + path_to_structure: str | Path, + path_to_doscar: str | Path, + e_range: list[float] | None = [-10.0, 0.0], + add_element_dos_moments: bool = False, + ): + """ + Featurize DOSCAR.lobster or DOSCAR.LSO.lobster data. + + :param path_to_structure: path to POSCAR + :param path_to_doscar: path to DOSCAR.lobster or DOSCAR.LSO.lobster + :param e_range: range of energy relative to fermi for which moment features and + features needs to be computed + :param add_element_dos_moments: add element dos moment features alongside orbital dos + """ + self.path_to_structure = path_to_structure + self.path_to_doscar = path_to_doscar + self.e_range = e_range + self.dos = Doscar(doscar=self.path_to_doscar, structure_file=self.path_to_structure).completedos + self.add_element_dos_moments = add_element_dos_moments + +
+[docs] + def get_df(self, ids: str | None = None) -> pd.DataFrame: + """ + Return a pandas dataframe with computed DOS moment features as columns. + + :param ids: set index name in the pandas dataframe. Default is None. + When None, LOBSTER calc directory name is used as index name. + + Moment features are PDOS center, width, skewness, kurtosis and upper band edge. + + Returns: + A pandas dataframe object + """ + if ids: + df = pd.DataFrame(index=[ids]) + else: + ids = Path(self.path_to_doscar).parent.name + df = pd.DataFrame(index=[ids]) + + spd_dos_lobster = self.dos.get_spd_dos() + + for orbital in spd_dos_lobster: + df.loc[ids, f"{orbital.name}_band_center"] = round( + self.dos.get_band_center(band=orbital, erange=self.e_range), 4 + ) + df.loc[ids, f"{orbital.name}_band_width"] = round( + self.dos.get_band_width(band=orbital, erange=self.e_range), 4 + ) + df.loc[ids, f"{orbital.name}_band_skew"] = round( + self.dos.get_band_skewness(band=orbital, erange=self.e_range), 4 + ) + df.loc[ids, f"{orbital.name}_band_kurtosis"] = round( + self.dos.get_band_kurtosis(band=orbital, erange=self.e_range), 4 + ) + df.loc[ids, f"{orbital.name}_band_upperband_edge"] = round( + self.dos.get_upper_band_edge(band=orbital, erange=self.e_range), 4 + ) + if self.add_element_dos_moments: + elements_list = self.dos.structure.elements + for el in elements_list: + if orbital in self.dos.get_element_spd_dos(el=el.name): + df.loc[ids, f"{el.name}_{orbital.name}_band_center"] = round( + self.dos.get_band_center(band=orbital, elements=[el], erange=self.e_range), + 4, + ) + df.loc[ids, f"{el.name}_{orbital.name}_band_width"] = round( + self.dos.get_band_width(band=orbital, elements=[el], erange=self.e_range), + 4, + ) + df.loc[ids, f"{el.name}_{orbital.name}_band_skew"] = round( + self.dos.get_band_skewness(band=orbital, elements=[el], erange=self.e_range), + 4, + ) + df.loc[ids, f"{el.name}_{orbital.name}_band_kurtosis"] = round( + self.dos.get_band_kurtosis(band=orbital, elements=[el], erange=self.e_range), + 4, + ) + df.loc[ids, f"{el.name}_{orbital.name}_band_upperband_edge"] = round( + self.dos.get_upper_band_edge(band=orbital, elements=[el], erange=self.e_range), + 4, + ) + + return df
+ + +
+[docs] + def get_fingerprint_df( + self, + ids: str | None = None, + fp_type: str = "summed_pdos", + binning: bool = True, + n_bins: int = 256, + normalize: bool = True, + ) -> pd.DataFrame: + """ + Generate a dataframe consisting of DOS fingerprint (fp). + + :param ids: set index name in the pandas dataframe. Default is None. + When None, LOBSTER calc directory name is used as index name. + :param fp_type: Specify fingerprint type to compute, can accept `s/p/d/f/summed_pdos` + (default is summed_pdos) + :param binning: If true, the DOS fingerprint is binned using np.linspace and n_bins. + Default is True. + :param n_bins: Number of bins to be used in the fingerprint (default is 256) + :param normalize: If true, normalizes the area under fp to equal to 1. Default is True. + + Returns: + A pandas dataframe object with DOS fingerprints + """ + if ids: + df = pd.DataFrame(index=[ids], columns=["DOS_FP"]) + else: + ids = Path(self.path_to_doscar).parent.name + df = pd.DataFrame(index=[ids], columns=["DOS_FP"]) + + fp = self.dos.get_dos_fp( + type=fp_type, + normalize=normalize, + n_bins=n_bins, + binning=binning, + max_e=self.e_range[-1] if self.e_range is not None else None, + min_e=self.e_range[0] if self.e_range is not None else None, + )._asdict() + + df.loc[ids, "DOS_FP"] = DosFingerprint(**fp) + + return df
+
+ +
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/lobsterpy/featurize/utils.html b/_modules/lobsterpy/featurize/utils.html new file mode 100644 index 00000000..1d323bbb --- /dev/null +++ b/_modules/lobsterpy/featurize/utils.html @@ -0,0 +1,579 @@ + + + + + + + + + + lobsterpy.featurize.utils — lobsterpy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for lobsterpy.featurize.utils

+# Copyright (c) lobsterpy development team
+# Distributed under the terms of a BSD 3-Clause "New" or "Revised" License
+
+"""This package provides the modules for featurzing Lobster data ready for ML studies."""
+
+from __future__ import annotations
+
+from pathlib import Path
+
+from monty.os.path import zpath
+
+
+
+[docs] +def get_file_paths( + path_to_lobster_calc: str | Path = "", requested_files: list[str] = [], use_lso_dos: bool = True +) -> dict: + """ + Get file paths for LobsterPy featurizations, raise Exception if not all of requested paths exist. + + :param path_to_lobster_calc: path to root LOBSTER calc directory + :param requested_files: files to return paths for. + :param use_lso_dos: solely required for BatchDosFeaturizer. + Will force featurizer to use DOSCAR.LSO.lobster instead of DOSCAR.lobster. + + :return: dict that assigns each item of requested_files its path + + """ + default_values = { + "structure": "POSCAR", + "cohpcar": "COHPCAR.lobster", + "icohplist": "ICOHPLIST.lobster", + "cobicar": "COBICAR.lobster", + "icobilist": "ICOBILIST.lobster", + "coopcar": "COOPCAR.lobster", + "icooplist": "ICOOPLIST.lobster", + "charge": "CHARGE.lobster", + "madelung": "MadelungEnergies.lobster", + "doscar": ("DOSCAR.LSO.lobster" if use_lso_dos else "DOSCAR.lobster"), + "lobsterin": "lobsterin", + "lobsterout": "lobsterout", + "bandoverlaps": "bandOverlaps.lobster", + "potcar": "POTCAR", + "vasprun": "vasprun.xml", + "incar": "INCAR", + } + + lobster_path = Path(path_to_lobster_calc) + file_paths = {} + missing_files = [] + + for file in requested_files: + file_str = default_values.get(file) + file_str = file_str if isinstance(file_str, str) else file + if file == "structure": + try: + file_paths[file] = get_structure_path(lobster_path=lobster_path) + except Exception: + missing_files.append(default_values["structure"]) + else: + file_path = lobster_path / file_str + if file_path.exists(): + file_paths[file] = file_path + else: + gz_file_path = Path(zpath(str(file_path.as_posix()))) + if gz_file_path.exists(): + file_paths[file] = gz_file_path + else: + missing_files.append(default_values[file]) + + if missing_files: + raise Exception(f"Files {missing_files} not found in {lobster_path.name}.") + + return file_paths
+ + + +
+[docs] +def get_structure_path(lobster_path: Path) -> Path: + """ + Search iteratively for (unzipped / zipped) structure file. + + POSCAR is prioritized over POSCAR.lobster. + + :param lobster_path: path to root LOBSTER calc directory + + :return: path to structure file + """ + for filename in ["POSCAR", "POSCAR.lobster"]: + poscar_path = lobster_path / filename + if poscar_path.exists(): + return poscar_path + gz_file_path = Path(zpath(str(poscar_path.as_posix()))) + if gz_file_path.exists(): + return gz_file_path + + raise Exception
+ +
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/lobsterpy/plotting.html b/_modules/lobsterpy/plotting.html new file mode 100644 index 00000000..05c68ec8 --- /dev/null +++ b/_modules/lobsterpy/plotting.html @@ -0,0 +1,1714 @@ + + + + + + + + + + lobsterpy.plotting — lobsterpy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for lobsterpy.plotting

+# Copyright (c) lobsterpy development team
+# Distributed under the terms of a BSD 3-Clause "New" or "Revised" License
+
+"""Here classes and functions to plot Lobster outputs are provided."""
+
+from __future__ import annotations
+
+import typing
+from itertools import cycle
+from pathlib import Path
+from typing import TYPE_CHECKING, Any
+
+import matplotlib as mpl
+import numpy as np
+import plotly.graph_objs as go
+from matplotlib import pyplot as plt
+from pymatgen.core import Structure
+from pymatgen.electronic_structure.cohp import Cohp, CompleteCohp, IcohpCollection
+from pymatgen.electronic_structure.core import Spin
+from pymatgen.electronic_structure.dos import LobsterCompleteDos
+from pymatgen.electronic_structure.plotter import CohpPlotter, DosPlotter
+
+if TYPE_CHECKING:
+    from lobsterpy.cohp.analyze import Analysis
+from lobsterpy.plotting import layout_dicts as ld
+
+
+
+[docs] +def get_style_list( + no_base_style: bool = False, + styles: list[str | dict[str, Any]] | None = None, + **kwargs, +) -> list[str | dict[str, Any]]: + """ + Get args for matplotlib.style from user input. + + Remaining kwargs are collected as a dict and take the highest priority. + + :param no_base_style: If true, do not include lobsterpy_base.mplstyle + :param styles: User-requested styles. These can be paths to mplstyle files, + the names of known (matplotlib-supplied) styles, or dicts of rcParam options. + :param kwargs: matplotlib-style sheet keyword arguments + + """ + base = [] if no_base_style else [str(Path(__file__).absolute().parent / "lobsterpy_base.mplstyle")] + if styles is None: + styles = [] + + return base + styles + [kwargs]
+ + + +
+[docs] +class PlainCohpPlotter(CohpPlotter): + """ + Modified Pymatgen CohpPlotter with styling removed. + + This allows the styling to be manipulated more easily using matplotlib + style sheets. + + :param zero_at_efermi: Shift all populations to have zero + energy at the Fermi level. Defaults to True. + :param are_coops: Bool indicating that populations are COOPs, not COHPs. + Defaults to False for COHPs. + :param are_cobis: Bool indicating that populations are COBIs, not COHPs. + Defaults to False for COHPs. + """ + +
+[docs] + def get_plot( + self, + ax: mpl.axes.Axes | None = None, + xlim: tuple[float, float] | None = None, + ylim: tuple[float, float] | None = None, + plot_negative: bool | None = None, + integrated: bool = False, + invert_axes: bool = True, + sigma: float | None = None, + ): + """ + Get a matplotlib plot showing the COHP. + + :param ax: Existing Matplotlib Axes object to plot to. + :param xlim: Specifies the x-axis limits. Defaults to None for + automatic determination. + :param ylim: Specifies the y-axis limits. Defaults to None for + automatic determination. + :param plot_negative: It is common to plot -COHP(E) so that the + sign means the same for COOPs and COHPs. Defaults to None + for automatic determination: If are_coops is True, this + will be set to False, else it will be set to True. + :param integrated: Switch to plot ICOHPs. Defaults to False. + :param invert_axes: Put the energies onto the y-axis, which is + common in chemistry. + :param sigma: Standard deviation of Gaussian broadening applied to + population data. If this is unset (None) no broadening will be + added. + + Returns: + A matplotlib object. + + """ + if self.are_coops and not self.are_cobis: + cohp_label = "COOP" + elif self.are_cobis and not self.are_coops: + cohp_label = "COBI" + elif self.are_cobis and self.are_coops: + raise ValueError("Plot data should not contain COBI and COOP data at same time") + else: + cohp_label = "COHP" + " (eV)" + + if plot_negative is None: + plot_negative = (not self.are_coops) and (not self.are_cobis) + + if integrated: + cohp_label = "I" + cohp_label + + if plot_negative: + cohp_label = "$-$" + cohp_label + + energy_label = "$E - E_f$ (eV)" if self.zero_at_efermi else "$E$ (eV)" + + colors = mpl.rcParams["axes.prop_cycle"].by_key()["color"] + ncolors = len(colors) + + if ax is None: + _, ax = plt.subplots() + + allpts = [] + keys = self._cohps.keys() + for i, key in enumerate(keys): + energies = self._cohps[key]["energies"] + populations = self._cohps[key]["COHP"] if not integrated else self._cohps[key]["ICOHP"] + for spin in [Spin.up, Spin.down]: + if spin in populations: + if invert_axes: + x = -populations[spin] if plot_negative else populations[spin] + y = energies + x = self._broaden(y, x, sigma=sigma) + else: + x = energies + y = -populations[spin] if plot_negative else populations[spin] + y = self._broaden(x, y, sigma=sigma) + allpts.extend(list(zip(x, y))) + if spin == Spin.up: + ax.plot( + x, + y, + color=colors[i % ncolors], + linestyle="-", + label=str(key), + ) + else: + ax.plot(x, y, color=colors[i % ncolors], linestyle="--") + + if xlim: + ax.set_xlim(xlim) + xlim = ax.get_xlim() + assert isinstance(xlim, tuple) + + if ylim: + ax.set_ylim(ylim) + else: + relevanty = [p[1] for p in allpts if xlim[0] < p[0] < xlim[1]] + if relevanty: + plt.ylim((min(relevanty), max(relevanty))) + + grid_like_line_kwargs = { + "color": mpl.rcParams["grid.color"], + "linewidth": mpl.rcParams["grid.linewidth"], + "linestyle": mpl.rcParams["grid.linestyle"], + "alpha": mpl.rcParams["grid.alpha"], + "zorder": 0, + } + + if not invert_axes: + ax.axhline(**grid_like_line_kwargs) + + if self.zero_at_efermi: + ax.axvline(**grid_like_line_kwargs) + + else: + ax.axvline(self._cohps[key]["efermi"], **grid_like_line_kwargs) + else: + ax.axvline(**grid_like_line_kwargs) + + if self.zero_at_efermi: + ax.axhline(**grid_like_line_kwargs) + else: + ax.axhline(self._cohps[key]["efermi"], **grid_like_line_kwargs) + + if invert_axes: + plt.xlabel(cohp_label) + plt.ylabel(energy_label) + else: + plt.xlabel(energy_label) + plt.ylabel(cohp_label) + + _ = ax.legend() + + return plt
+ + + @staticmethod + def _broaden(energies: np.ndarray, population: np.ndarray, sigma=None, cutoff=4.0): + """ + Broaden the spectrum with a given standard deviation. + + The population is convolved with a normalised Gaussian kernel. This + requires the energy grid to be regularly-spaced. + + :param energies: Regularly-spaced energy series + :param population: Population data for broadening + :param sigma: Standard deviation for Gaussian broadening. If sigma is None + then the input data is returned without any processing. + :param cutoff: Range cutoff for broadening kernel, as a multiple of sigma. + + Return: + Broadened population + + """ + from scipy.signal import convolve + from scipy.stats import norm + + if sigma is None: + return population + + spacing = np.mean(np.diff(energies)) + if not np.allclose(np.diff(energies), spacing, atol=1e-5): + raise ValueError("Energy grid is not regular, cannot broaden with discrete convolution.") + + # Obtain symmetric mesh for broadening kernel, centered on zero + kernel_x = np.arange(0, cutoff * sigma + 0.5 * spacing, spacing) + kernel_x = np.concatenate([-kernel_x[-1:1:-1], kernel_x]) + + kernel = norm.pdf(kernel_x, scale=sigma) + + return convolve(population, kernel, mode="same") / kernel.sum()
+ + + +
+[docs] +class PlainDosPlotter(DosPlotter): + """ + Modified Pymatgen DosPlotter with styling removed. + + This allows the styling to be manipulated more easily using matplotlib + style sheets. It also adds additional functionalities to plotter + + :param zero_at_efermi: Shift all DOS to have zero + energy at the Fermi level. Defaults to True. + :param stack: Bool indicating that plot should be stacked + area graph. + :param sigma: Standard deviation for gaussian smearing. + :param summed: Will plot summed dos spin populations. + Defaults to False. + """ + + def __init__( + self, + zero_at_efermi: bool = True, + stack: bool = False, + summed: bool = False, + sigma: float | None = None, + ) -> None: + """ + Initialize DOS plotter. + + :param zero_at_efermi: Whether to shift all Dos to have zero energy at the + fermi energy. Defaults to True. + :param stack: Whether to plot the DOS as a stacked area graph + :param summed: Whether to plot the summed spins DOS. + :param sigma: Specify a standard deviation for Gaussian smearing + the DOS for nicer looking plots. Defaults to None for no smearing. + + """ + super().__init__(zero_at_efermi, stack, sigma) + self.zero_at_efermi = zero_at_efermi + self.stack = stack + self.sigma = sigma + self.summed = summed + self._norm_val = True + self._doses = {} # type: ignore + +
+[docs] + def add_dos(self, label: str, dos: LobsterCompleteDos) -> None: + """ + Add a dos for plotting. + + :param label: label for the DOS. Must be unique. + :param dos: LobsterCompleteDos object + + """ + if dos.norm_vol is None: + self._norm_val = False + energies = dos.energies + if self.summed: + if self.sigma: + smeared_densities = dos.get_smeared_densities(self.sigma) + if Spin.down in smeared_densities: + added_densities = smeared_densities[Spin.up] + smeared_densities[Spin.down] + densities = {Spin.up: added_densities} + else: + densities = smeared_densities + else: + densities = {Spin.up: dos.get_densities()} + else: + densities = dos.get_smeared_densities(self.sigma) if self.sigma else dos.densities + + efermi = dos.efermi + + self._doses[label] = { + "energies": energies, + "densities": densities, + "efermi": efermi, + }
+ + +
+[docs] + def add_site_orbital_dos(self, dos: LobsterCompleteDos, orbital: str, site_index: int): + """ + Add orbital dos at particular site. + + :param dos: LobsterCompleteDos object + :param orbital: Orbitals name at the site. Must be unique. + :param site_index: site index in the structure + + """ + if dos.norm_vol is None: + self._norm_val = False + site = dos.structure.sites[site_index] + avail_orbs = list(dos.pdos[site]) + if orbital not in avail_orbs and orbital != "all": + str_orbs = ", ".join(avail_orbs) + raise ValueError(f"Requested orbital is not available for this site, available orbitals are {str_orbs}") + + if orbital == "all": + for orb in avail_orbs: + dos_obj = dos.get_site_orbital_dos(site=site, orbital=orb) + label = site.species_string + str(site_index + 1) + f": {orb}" + energies = dos_obj.energies + if self.summed: + if self.sigma: + smeared_densities = dos_obj.get_smeared_densities(self.sigma) + if Spin.down in smeared_densities: + added_densities = smeared_densities[Spin.up] + smeared_densities[Spin.down] + densities = {Spin.up: added_densities} + else: + densities = smeared_densities + else: + densities = {Spin.up: dos_obj.get_densities()} + else: + densities = dos_obj.get_smeared_densities(self.sigma) if self.sigma else dos_obj.densities + + efermi = dos_obj.efermi + + self._doses[label] = { + "energies": energies, + "densities": densities, + "efermi": efermi, + } + else: + dos_obj = dos.get_site_orbital_dos(site=site, orbital=orbital) + label = site.species_string + str(site_index + 1) + f": {orbital}" + + energies = dos_obj.energies + if self.summed: + if self.sigma: + smeared_densities = dos_obj.get_smeared_densities(self.sigma) + if Spin.down in smeared_densities: + added_densities = smeared_densities[Spin.up] + smeared_densities[Spin.down] + densities = {Spin.up: added_densities} + else: + densities = smeared_densities + else: + densities = {Spin.up: dos_obj.get_densities()} + else: + densities = dos_obj.get_smeared_densities(self.sigma) if self.sigma else dos_obj.densities + + efermi = dos_obj.efermi + + self._doses[label] = { + "energies": energies, + "densities": densities, + "efermi": efermi, + }
+ + +
+[docs] + @typing.no_type_check + def get_plot( + self, + ax: mpl.axes.Axes | None = None, + xlim: tuple[float, float] | None = None, + ylim: tuple[float, float] | None = None, + invert_axes: bool = False, + beta_dashed: bool = False, + sigma: float | None = None, + ): + """ + Get a matplotlib plot showing the COHP. + + :param ax: Existing Matplotlib Axes object to plot to. + :param xlim: Specifies the x-axis limits. Defaults to None for + automatic determination. + :param ylim: Specifies the y-axis limits. Defaults to None for + automatic determination. + :param invert_axes: Put the energies onto the y-axis, which is + common in chemistry. + :param beta_dashed: Plots the beta spin channel with a dashed line. Defaults to False + :param sigma: Standard deviation of Gaussian broadening applied to population data. + If this is unset (None) no broadening will be added. + + Returns: + A matplotlib object. + + """ + ys = None + all_densities = [] + all_energies = [] + + colors = mpl.rcParams["axes.prop_cycle"].by_key()["color"] + n_colors = len(colors) + + if ax is None: + _, ax = plt.subplots() + + # Note that this complicated processing of energies is to allow for + # stacked plots in matplotlib. + for dos in self._doses.values(): + energies = dos["energies"] + densities = dos["densities"] + if not ys: + ys = { + Spin.up: np.zeros(energies.shape), + Spin.down: np.zeros(energies.shape), + } + new_dens = {} + for spin in [Spin.up, Spin.down]: + if spin in densities: + if self.stack: + ys[spin] += densities[spin] + new_dens[spin] = ys[spin].copy() + else: + new_dens[spin] = densities[spin] + all_energies.append(energies) + all_densities.append(new_dens) + + keys = list(reversed(self._doses)) + all_densities.reverse() + all_energies.reverse() + all_pts = [] + + for idx, key in enumerate(keys): + for spin in [Spin.up, Spin.down]: + if spin in all_densities[idx]: + energy = all_energies[idx] + densities = list(int(spin) * all_densities[idx][spin]) + if invert_axes: + x = densities + y = energy + else: + x = energy + y = densities + all_pts.extend(list(zip(x, y))) + if self.stack: + ax.fill(x, y, color=colors[idx % n_colors], label=str(key)) + elif spin == Spin.down and beta_dashed: + ax.plot( + x, + y, + color=colors[idx % n_colors], + label=str(key), + linestyle="--", + linewidth=3, + ) + else: + ax.plot( + x, + y, + color=colors[idx % n_colors], + label=str(key), + linewidth=3, + ) + + if xlim: + ax.set_xlim(xlim) + if ylim: + ax.set_ylim(ylim) + elif not invert_axes: + xlim = ax.get_xlim() + relevant_y = [p[1] for p in all_pts if xlim[0] < p[0] < xlim[1]] + ax.set_ylim((min(relevant_y), max(relevant_y))) + if not xlim and invert_axes: + ylim = ax.get_ylim() + relevant_y = [p[0] for p in all_pts if ylim[0] < p[1] < ylim[1]] + ax.set_xlim((min(relevant_y), max(relevant_y))) + + if self.zero_at_efermi: + xlim = ax.get_xlim() + ylim = ax.get_ylim() + (ax.plot(xlim, [0, 0], "k--", linewidth=2) if invert_axes else ax.plot([0, 0], ylim, "k--", linewidth=2)) + + if invert_axes: + ax.set_ylabel("Energies (eV)") + ax.set_xlabel(f"Density of states (states/eV{'/ų' if self._norm_val else ''})") + ax.axvline(x=0, color="k", linestyle="--", linewidth=2) + else: + ax.set_xlabel("Energies (eV)") + if self._norm_val: + ax.set_ylabel("Density of states (states/eV/ų)") + else: + ax.set_ylabel("Density of states (states/eV)") + ax.axhline(y=0, color="k", linestyle="--", linewidth=2) + + # Remove duplicate labels with a dictionary + handles, labels = ax.get_legend_handles_labels() + label_dict = dict(zip(labels, handles)) + ax.legend(label_dict.values(), label_dict.keys()) + legend_text = ax.get_legend().get_texts() # all the text.Text instance in the legend + plt.setp(legend_text, fontsize=30) + plt.tight_layout() + _ = ax.legend() + + return plt
+
+ + + +
+[docs] +class InteractiveCohpPlotter(CohpPlotter): + """Interactive COHP, COBI or COOP plotter to view all relevant bonds in one figure. + + :param zero_at_efermi: Shift all populations to have zero + energy at the Fermi level. Defaults to True. + :param are_coops: Bool indicating that populations are COOPs, not COHPs. + Defaults to False for COHPs. + :param are_cobis: Bool indicating that populations are COBIs, not COHPs. + Defaults to False for COHPs. + """ + + COLOR_PALETTE = [ + "#e41a1c", + "#377eb8", + "#4daf4a", + "#984ea3", + "#ff7f00", + "#ffff33", + "#a65628", + "#f781bf", + "#999999", + ] + +
+[docs] + def add_cohp(self, label: str, cohp: Cohp): + """ + Add COHP object to the plotter. + + :param label: Label for the COHP. Must be unique. + :param cohp: COHP object. + + """ + if "All" not in self._cohps: + self._cohps["All"] = {} + + energies = cohp.energies - cohp.efermi if self.zero_at_efermi else cohp.energies + + if label not in self._cohps["All"]: + self._cohps["All"].update( + { + label: { + "energies": energies, + "COHP": cohp.get_cohp(), + "ICOHP": cohp.get_icohp(), + "efermi": cohp.efermi, + } + } + ) + else: + raise ValueError( + "Please use another label to add the COHP, provided label already exists " + "in the plot data, which will result in overwriting the existing COHP data." + )
+ + +
+[docs] + def add_all_relevant_cohps( + self, + analyse: Analysis, + suffix: str = "", + label_resolved: bool = True, + orbital_resolved: bool = False, + ) -> None: + """ + Add all relevant COHPs from lobsterpy analyse object. + + :param analyse: Analyse object from lobsterpy. + :param suffix: Optional addition to LOBSTER label to avoid key conflicts when plotting multiple + calcs or just for additional legend information. + :param label_resolved: bool indicating to obtain label resolved interactive plots for relevant bonds. + If false, will return summed cohp curves of unique relevant bonds. + :param orbital_resolved: bool indicating to include orbital resolved interactive cohps for relevant bonds. + + """ + complete_cohp = analyse.chemenv.completecohp + + plot_data = analyse.get_site_bond_resolved_labels() + + if "All" not in self._cohps: + self._cohps["All"] = {} + + # iterate and extract the data to be plotted from cohp objects + for bond_key, labels in plot_data.items(): + count = len(labels) + label_with_count = self._insert_number_of_bonds_in_label( + label=bond_key, character=":", number_of_bonds=count + ) + # get summed cohps from the relevant bond label at the site + cohp = complete_cohp.get_summed_cohp_by_label_list(label_list=labels) + energies = cohp.energies - cohp.efermi if self.zero_at_efermi else cohp.energies + drop_down_key = plot_legend = label_with_count + suffix # label for the dropdown menu + self._cohps["All"].update( + { + plot_legend: { + "energies": energies, + "COHP": cohp.get_cohp(), + "ICOHP": cohp.get_icohp(), + "efermi": cohp.efermi, + } + } + ) + if len(plot_data) > 1: + if drop_down_key not in self._cohps: + self._cohps[drop_down_key] = {} + self._cohps[drop_down_key].update( + { + plot_legend: { + "energies": energies, + "COHP": cohp.get_cohp(), + "ICOHP": cohp.get_icohp(), + "efermi": cohp.efermi, + } + } + ) + + # Add cohp data for each relevant bond label iteratively + if label_resolved and not orbital_resolved: + if label_with_count + suffix not in self._cohps: + self._cohps[label_with_count + suffix] = {} + # Get cohp data for each relevant bond label at the site + for label in labels: + cohp = complete_cohp.get_cohp_by_label(label) + energies = cohp.energies - cohp.efermi if self.zero_at_efermi else cohp.energies + drop_down_key = label_with_count + suffix # label for the dropdown menu + plot_legend = self._get_plot_label_for_label_resolved( + structure=analyse.structure, + label_list=[label], + complete_cohp=complete_cohp, + orb_list=[], + label_resolved=True, + orbital_resolved=False, + ) + if len(plot_data) > 1: + self._cohps[drop_down_key].update( + { + plot_legend: { + "energies": energies, + "COHP": cohp.get_cohp(), + "ICOHP": cohp.get_icohp(), + "efermi": cohp.efermi, + } + } + ) + + plot_legend_here = plot_legend + suffix + self._cohps["All"].update( + { + plot_legend_here: { + "energies": energies, + "COHP": cohp.get_cohp(), + "ICOHP": cohp.get_icohp(), + "efermi": cohp.efermi, + } + } + ) + # Adds cohp data for each relevant orbitals and bond label iteratively + if orbital_resolved and label_resolved: + if label_with_count + suffix not in self._cohps: + self._cohps[label_with_count + suffix] = {} + # get relevant orbitals associated with each bond label + plot_data_orb = analyse.get_site_orbital_resolved_labels() + drop_down_key = label_with_count + suffix # label for the dropdown menu + key_val = plot_data_orb[bond_key] + # get cohp data for each orbital and associated bond labels iteratively + for orb, val in key_val.items(): + for lab in val["bond_labels"]: + mapped_bond_labels = [item for item in [lab] for _ in range(len(val["relevant_sub_orbitals"]))] + + cohp_orb = complete_cohp.get_summed_cohp_by_label_and_orbital_list( + label_list=mapped_bond_labels, orbital_list=val["relevant_sub_orbitals"] + ) + + energies = cohp_orb.energies - cohp_orb.efermi if self.zero_at_efermi else cohp_orb.energies + # plot legends will contain species and orbital along with relevant bond label + plot_legend = self._get_plot_label_for_label_resolved( + structure=analyse.structure, + label_list=[lab], + complete_cohp=complete_cohp, + orb_list=[orb], + orbital_resolved=True, + label_resolved=True, + ) + if len(plot_data) > 1: + self._cohps[drop_down_key].update( + { + plot_legend: { + "energies": energies, + "COHP": cohp_orb.get_cohp(), + "ICOHP": cohp_orb.get_icohp(), + "efermi": cohp_orb.efermi, + } + } + ) + + plot_legend_here = plot_legend + suffix + + self._cohps["All"].update( + { + plot_legend_here: { + "energies": energies, + "COHP": cohp_orb.get_cohp(), + "ICOHP": cohp_orb.get_icohp(), + "efermi": cohp_orb.efermi, + } + } + ) + # Adds summed cohp data for each relevant orbitals + if orbital_resolved and not label_resolved: + if label_with_count + suffix not in self._cohps: + self._cohps[label_with_count + suffix] = {} + # get relevant orbitals associated with each bond label + plot_data_orb = analyse.get_site_orbital_resolved_labels() + drop_down_key = label_with_count + suffix # label for the dropdown menu + key_val = plot_data_orb[bond_key] + # get summed cohp data for each relevant orbital + for orb, val in key_val.items(): + mapped_bond_labels = [ + item for item in val["bond_labels"] for _ in range(len(val["relevant_sub_orbitals"])) + ] + cohp_orb = complete_cohp.get_summed_cohp_by_label_and_orbital_list( + label_list=mapped_bond_labels, + orbital_list=val["relevant_sub_orbitals"] * len(val["bond_labels"]), + ) + + energies = cohp_orb.energies - cohp_orb.efermi if self.zero_at_efermi else cohp_orb.energies + # plot legends will contain species and orbital along with number of bonds at the site + plot_legend = self._get_plot_label_for_label_resolved( + structure=analyse.structure, + label_list=val["bond_labels"], + complete_cohp=complete_cohp, + orb_list=[orb], + orbital_resolved=True, + label_resolved=False, + ) + + if len(plot_data) > 1: + self._cohps[drop_down_key].update( + { + plot_legend: { + "energies": energies, + "COHP": cohp_orb.get_cohp(), + "ICOHP": cohp_orb.get_icohp(), + "efermi": cohp_orb.efermi, + } + } + ) + + plot_legend_here = plot_legend + suffix + + self._cohps["All"].update( + { + plot_legend_here: { + "energies": energies, + "COHP": cohp_orb.get_cohp(), + "ICOHP": cohp_orb.get_icohp(), + "efermi": cohp_orb.efermi, + } + } + )
+ + +
+[docs] + def add_cohps_by_lobster_label(self, analyse: Analysis, label_list: list[str], suffix: str = ""): + """ + Add COHPs explicitly specified in label list. + + :param analyse: Analyse object from lobsterpy. + :param label_list: List of COHP labels as from LOBSTER. + :param suffix: Optional addition to LOBSTER label to avoid key + conflicts when plotting multiple calcs or just for additional legend information. + + """ + complete_cohp = analyse.chemenv.completecohp + + if "All" not in self._cohps: + self._cohps["All"] = {} + + for label in label_list: + atom1 = complete_cohp.bonds[label]["sites"][0].species_string + atom2 = complete_cohp.bonds[label]["sites"][1].species_string + sorted_label = sorted([atom1, atom2]) + cohp = complete_cohp.get_cohp_by_label(label) + energies = cohp.energies - cohp.efermi if self.zero_at_efermi else cohp.energies + key = sorted_label[0] + "-" + sorted_label[1] + ": " + label + suffix + self._cohps["All"].update( + { + key: { + "energies": energies, + "COHP": cohp.get_cohp(), + "ICOHP": cohp.get_icohp(), + "efermi": cohp.efermi, + } + } + )
+ + +
+[docs] + def add_cohps_from_plot_data(self, plot_data_dict: dict[str, Cohp], suffix: str = ""): + """ + Add all relevant COHPs for specified bond type from lobster lightweight json.gz file. + + :param plot_data_dict: Lobsterpy plot data dict + :param suffix: Optional addition to LOBSTER label to avoid key + conflicts when plotting multiple calcs or just for additional legend information. + + """ + # convert to cohp objects + plot_data_dict = plot_data_dict.copy() + for key, cohps in plot_data_dict.items(): + if isinstance(cohps, Cohp): + plot_data_dict.update({key: cohps}) + else: + try: + cohps = Cohp.from_dict(cohps) + plot_data_dict.update({key: cohps}) + except (TypeError, AttributeError): + raise ValueError( + "The data provided could not be converted to cohp object.Please recheck the input data" + ) + + if "All" not in self._cohps: + self._cohps["All"] = {} + + for bond_key, cohps in plot_data_dict.items(): + energies = cohps.energies - cohps.efermi if self.zero_at_efermi else cohps.energies + key = bond_key + suffix + self._cohps["All"].update( + { + key: { + "energies": energies, + "COHP": cohps.get_cohp(), + "ICOHP": cohps.get_icohp(), + "efermi": cohps.efermi, + } + } + )
+ + +
+[docs] + def get_plot( + self, + xlim: list[float] | None = None, + rangeslider: bool = False, + ylim: list[float] | None = None, + plot_negative: bool | None = None, + integrated: bool = False, + invert_axes: bool = True, + sigma: float | None = None, + colors: list[str] | None = None, + ): + """ + Get an interactive plotly figure showing the COHPs. + + :param xlim: Specifies the x-axis limits. Defaults to None for + automatic determination. + :param rangeslider: Adds a plotly.graph_objs.layout.xaxis.Rangeslider + object to figure to allow easy manipulation of x-axis.. + :param ylim: Specifies the y-axis limits. Defaults to None for + automatic determination. + :param plot_negative: It is common to plot -COHP(E) so that the + sign means the same for COOPs and COHPs. Defaults to None + for automatic determination - If are_coops is True, this + will be set to False, else it will be set to True. + :param integrated: Switch to plot ICOHPs. Defaults to False. + :param invert_axes: Put the energies onto the y-axis, which is + common in chemistry. + :param sigma: Standard deviation of Gaussian broadening applied to + population data. If this is unset (None) no broadening will be added. + :param colors: list of hex color codes to be used in plot + + Returns: + A plotly.graph_objects.Figure object. + + """ + if self.are_coops and not self.are_cobis: + cohp_label = "COOP" + elif self.are_cobis and not self.are_coops: + cohp_label = "COBI" + elif self.are_cobis and self.are_coops: + raise ValueError("Plot data should not contain COBI and COOP data at same time") + else: + cohp_label = "COHP" + " (eV)" + + if plot_negative is None: + plot_negative = (not self.are_coops) and (not self.are_cobis) + + if integrated: + cohp_label = "I" + cohp_label + + if plot_negative: + cohp_label = "\u2212" + cohp_label + + energy_label = "$E - E_f \\text{ (eV)}$" if self.zero_at_efermi else "$E \\text{ (eV)}$" + + # Setting up repeating color scheme (same as for matplotlib plots in .mplstyle) + palette = InteractiveCohpPlotter.COLOR_PALETTE if colors is None else colors + pal_iter = cycle(palette) + + traces = {} # type: ignore + for k, v in self._cohps.items(): + traces.update({k: []}) + for label in v: + population_key = v[label]["ICOHP"] if integrated else v[label]["COHP"] + band_color = next(pal_iter) + for spin in [Spin.up, Spin.down]: + if spin in population_key: + population = [-i for i in population_key[spin]] if plot_negative else population_key[spin] + if invert_axes: + x = population + y = v[label]["energies"] + x = PlainCohpPlotter._broaden(y, x, sigma=sigma) + else: + x = v[label]["energies"] + y = population + y = PlainCohpPlotter._broaden(x, y, sigma=sigma) + if spin == Spin.up: + trace = go.Scatter(x=x, y=y, name=label) + trace.update(ld.spin_up_trace_style_dict) + else: + trace = go.Scatter(x=x, y=y, name="") + trace.update(ld.spin_down_trace_style_dict) + trace.update(line={"color": band_color}) + traces[k].append(trace) + + energy_axis = ( + go.layout.YAxis(title=energy_label) + if invert_axes + else go.layout.XAxis(title=energy_label, rangeslider={"visible": rangeslider}) + ) + energy_axis.update(ld.energy_axis_style_dict) + cohp_axis = ( + go.layout.XAxis(title=cohp_label, rangeslider={"visible": rangeslider}) + if invert_axes + else go.layout.YAxis(title=cohp_label) + ) + cohp_axis.update(ld.cohp_axis_style_dict) + + layout = ( + go.Layout(xaxis=cohp_axis, yaxis=energy_axis) + if invert_axes + else go.Layout(xaxis=energy_axis, yaxis=cohp_axis) + ) + + # Create figure object + fig = go.Figure(layout=layout) + fig.update_layout(ld.layout_dict) + fig.update_layout(legend=ld.legend_style_dict) + + # Add all traces to figure + for val_trace in traces.values(): + for trace in val_trace: + fig.add_trace(trace) + + # Update layout with dropdown menu if label resolved plot + if len(traces) > 2: + # Update visibility of traces + for i, _ in enumerate(fig.data): + if i <= len(traces["All"]) - 1: + pass + else: + fig.data[i].visible = False + # Add dropdown buttons + fig.update_layout( + updatemenus=[ + { + "buttons": [ + { + "args": [ + { + "visible": [ + selected_group == group + for group, val_trace in traces.items() + for _trace in val_trace + ] + } + ], + "label": selected_group, + "method": "update", + } + for selected_group in traces + ], + "direction": "down", + "showactive": True, + "active": 0, + "x": 0.5, + "y": 1.15, + "bgcolor": "rgba(255,255,255,0.8)", + "bordercolor": "rgba(0,0,0,0.2)", + "xanchor": "center", + "yanchor": "top", + "font": {"family": "Arial", "color": "#444444", "size": 18}, + } + ] + ) + + if xlim: + fig.update_xaxes(range=xlim) + if ylim: + fig.update_yaxes(range=ylim) + + fig.update_yaxes(automargin=True) + + return fig
+ + + @staticmethod + def _insert_number_of_bonds_in_label(label: str, character: str, number_of_bonds: int) -> str: + """ + Add number of bonds to bond label. + + For example : for input label 'Ba1: Ba-Ti', character ':', number_of_bonds: 3, + Will return 'Ba1: 3 x Ba-Ti' + + :param label: bond label to which number of bonds needs to be inserted + :param character: string character where number of bonds needs to be inserted + :param number_of_bonds: number of bonds corresponding to the label + + Returns: + bond label with number of bonds inserted + """ + return label.replace(character, f"{character} {number_of_bonds} x", 1) + + @staticmethod + def _get_plot_label_for_label_resolved( + structure: Structure, + label_list: list[str], + complete_cohp: CompleteCohp, + orb_list: list[str], + label_resolved: bool = False, + orbital_resolved: bool = False, + ) -> str: + """ + Generate plot labels for both orbital and label-resolved plots. + + For example for NaCl structure, label:21, orb: 3s-3s + Will return '21: Cl2-Na1 (2.85 Å)' if label_resolved is True and orbital_resolved is False + Will return '21: Cl2(3s)-Na1(3s) (2.85 Å)' If label and orbital resolved True + Will return 'Cl(3s)-Na(3s) (2.85 Å)' if orbital_resolved is True and label_resolved is False + + :param structure: pymatgen structure object + :param label_list: bond label to which number of bonds needs to be inserted + :param complete_cohp: complete cohp object + :param orb_list: relevant orbital + :param label_resolved: specifies type of label to be returned is for label_resolved case + :param orbital_resolved: specifies type of label to be returned is for orbital_resolved case + + Returns: + plot label string + """ + if label_resolved and not orbital_resolved: + atom_pairs = [] + for site in complete_cohp.bonds[label_list[0]]["sites"]: + atom = f"{site.species_string}{structure.sites.index(site) + 1!s}" + atom_pairs.append(atom) + atom_pair_str = "-".join(atom_pairs) + bond_length = round(complete_cohp.bonds[label_list[0]]["length"], 2) + plot_label = f"{label_list[0]}: {atom_pair_str} ({bond_length} \u00c5)" + + elif not label_resolved and orbital_resolved: + orb_atom_pairs = [] + orb_pair = orb_list[0].split("-") + for site, site_orb in zip(complete_cohp.bonds[label_list[0]]["sites"], orb_pair): + atom_orb = f"{site.species_string} ({site_orb})" + orb_atom_pairs.append(atom_orb) + orb_atom_pairs_str = "-".join(orb_atom_pairs) + bond_length = round(complete_cohp.bonds[label_list[0]]["length"], 2) + plot_label = f"{len(label_list)}x {orb_atom_pairs_str} ({bond_length} \u00c5)" + else: + orb_atom_pairs = [] + orb_pair = orb_list[0].split("-") + for site, site_orb in zip(complete_cohp.bonds[label_list[0]]["sites"], orb_pair): + atom_orb = f"{site.species_string}{structure.sites.index(site) + 1!s} ({site_orb})" + orb_atom_pairs.append(atom_orb) + orb_atom_pairs_str = "-".join(orb_atom_pairs) + bond_length = round(complete_cohp.bonds[label_list[0]]["length"], 2) + plot_label = f"{label_list[0]}: {orb_atom_pairs_str} ({bond_length} \u00c5)" + + return plot_label
+ + + +
+[docs] +class IcohpDistancePlotter: + """ + Plotter to generate ICOHP or ICOBI or ICOOP vs bond lengths plots. + + :param are_coops: Bool indicating that populations are ICOOPs, not ICOHPs. + Defaults to False for COHPs. + :param are_cobis: Bool indicating that populations are ICOBIs, not ICOHPs. + Defaults to False for COHPs. + """ + + def __init__(self, are_coops: bool = False, are_cobis: bool = False): + """Initialize ICOHPs or ICOBI or ICOOP vs bond lengths plotter.""" + self.are_coops = are_coops + self.are_cobis = are_cobis + self._icohps = {} # type: ignore + +
+[docs] + def add_icohps(self, label: str, icohpcollection: IcohpCollection): + """ + Add ICOHPs or ICOBIs or ICOOPS for plotting. + + :param label: Label for the ICOHPs. Must be unique. + :param icohpcollection: IcohpCollection object. + + """ + icohps = [] + bond_len = [] + atom_pairs = [] + orb_data = {} # type: ignore + for indx, bond_label in enumerate(icohpcollection._list_labels): + orb_data.update({bond_label: {}}) + for k, v in icohpcollection._list_orb_icohp[indx].items(): + orb_data[bond_label].update({k: sum(v["icohp"].values())}) + icohps.append(sum(icohpcollection._list_icohp[indx].values())) + bond_len.append(icohpcollection._list_length[indx]) + atom1 = icohpcollection._list_atom1[indx] + atom2 = icohpcollection._list_atom2[indx] + atom_pairs.append(atom1 + "-" + atom2) + + self._icohps[label] = { + "atom_pairs": atom_pairs, + "bond_labels": icohpcollection._list_labels, + "icohps": icohps, + "bond_lengths": bond_len, + "orb_data": orb_data, + }
+ + +
+[docs] + def get_plot( + self, + ax: mpl.axes.Axes | None = None, + marker_size: float = 50, + marker_style: str = "o", + xlim: tuple[float, float] | None = None, + ylim: tuple[float, float] | None = None, + plot_negative: bool = True, + ): + """ + Get a matplotlib plot showing the COHP or COBI or COOP with respect to bond lengths. + + :param ax: Existing Matplotlib Axes object to plot to. + :param marker_size: sets the size of markers in scatter plots + :param marker_style: sets type of marker used in plot + :param xlim: Specifies the x-axis limits. Defaults to None for + automatic determination. + :param ylim: Specifies the y-axis limits. Defaults to None for + automatic determination. + :param plot_negative: Will plot -1*ICOHPs. Works only for ICOHPs + + Returns: + A matplotlib object. + """ + if self.are_coops and not self.are_cobis: + cohp_label = "ICOOP" + elif self.are_cobis and not self.are_coops: + cohp_label = "ICOBI" + elif self.are_cobis and self.are_coops: + raise ValueError("Plot data should not contain ICOBI and ICOOP data at same time") + else: + cohp_label = "ICOHP (eV)" + + if ax is None: + _, ax = plt.subplots() + + if xlim: + ax.set_xlim(xlim) + if ylim: + ax.set_ylim(ylim) + + ax.set_ylabel(cohp_label) + ax.set_xlabel("Bond lengths (\u00c5)") + + for label, data in self._icohps.items(): + x = data["bond_lengths"] + if plot_negative and cohp_label == "ICOHP (eV)": + ax.set_ylabel("$-$" + cohp_label) + y = [-1 * icohp for icohp in data["icohps"]] + else: + y = data["icohps"] + + ax.scatter(x, y, s=marker_size, marker=marker_style, label=label) + + return plt
+
+ +
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_modules/lobsterpy/structuregraph/graph.html b/_modules/lobsterpy/structuregraph/graph.html new file mode 100644 index 00000000..2c56387b --- /dev/null +++ b/_modules/lobsterpy/structuregraph/graph.html @@ -0,0 +1,661 @@ + + + + + + + + + + lobsterpy.structuregraph.graph — lobsterpy + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

+ +
+
+ +
+
+
+ + + + +
+ +

Source code for lobsterpy.structuregraph.graph

+# Copyright (c) lobsterpy development team
+# Distributed under the terms of a BSD 3-Clause "New" or "Revised" License
+
+"""This module provides a class for generating graph objects using lobsterpy data."""
+
+from __future__ import annotations
+
+from typing import TYPE_CHECKING
+
+if TYPE_CHECKING:
+    from pathlib import Path
+
+from pymatgen.core.structure import Structure
+from pymatgen.io.lobster.lobsterenv import LobsterNeighbors
+from pymatgen.io.lobster.outputs import Charge
+
+from lobsterpy.cohp.analyze import Analysis
+
+
+
+[docs] +class LobsterGraph: + """ + Class to generate structure graph objects with bonding data from Lobster. + + Mode of automatic bonding analysis can be `cation-anion` or `all` bonds. The strongest bond is + determined based on the ICOHPs. The coordination environments are determined based on + `cutoff_icohp * ICOHPs` values. If the path of ICOBILIST (ICOOPLIST) is provided, the ICOBI (ICOOP) + values corresponding to relevant bond labels obtained from the ICOHPLIST are also added as edge properties + to the structure graph objects. The Mulliken and Loewdin charges are added as node properties to + the structure graph objects. + + Attributes: + sg: return structure_graph object + + :param path_to_poscar: path to POSCAR (e.g., "POSCAR"). + :param path_to_charge: path to CHARGE.lobster (e.g., "CHARGE.lobster"). + :param path_to_cohpcar: path to COHPCAR.lobster (e.g., "COHPCAR.lobster"). + :param path_to_icohplist: path to ICOHPLIST.lobster (e.g., "ICOHPLIST.lobster"). + :param path_to_icooplist: path to ICOOPLIST.lobster (e.g., "ICOOPLIST.lobster"). + :param path_to_icobilist: path to ICOBILIST.lobster (e.g., "ICOBILIST.lobster"). + :param path_to_madelung: path to MadelungEnergies.lobster (e.g., "MadelungEnergies.lobster") + :param cutoff_icohp: only bonds that are stronger than cutoff_icohp * strongest ICOHP will be considered. + :param noise_cutoff: if provided hardcodes the lower limit of icohps considered. + :param add_additional_data_sg: if True will add the information from ICOOPLIST.lobster + and ICOBILIST.lobster based on ICOHPLIST.lobster relevant bond. + :param which_bonds: selects which kind of bonds are analyzed. "all" is the default. + :param start: start energy for bonding antibonding percent integration. + """ + + def __init__( + self, + path_to_poscar: str | Path, + path_to_charge: str | Path, + path_to_cohpcar: str | Path, + path_to_icohplist: str | Path, + path_to_madelung: str | Path, + add_additional_data_sg: bool = True, + path_to_icooplist: str | Path | None = None, + path_to_icobilist: str | Path | None = None, + which_bonds: str = "all", + cutoff_icohp: float = 0.10, + noise_cutoff: float = 0.1, + start: float | None = None, + ): + """Initialize and return a structure graph object.""" + if add_additional_data_sg: + self.add_additional_data_sg = add_additional_data_sg + if path_to_icooplist is not None and path_to_icobilist is not None: + self.path_to_icooplist = path_to_icooplist + self.path_to_icobilist = path_to_icobilist + else: + raise ValueError( + "add_additional_data_sg is set to True.Please provide path_to_icooplist and path_to_icobilist" + ) + else: + self.add_additional_data_sg = add_additional_data_sg # type: ignore + + self.path_to_poscar = path_to_poscar + self.path_to_charge = path_to_charge + self.path_to_cohpcar = path_to_cohpcar + self.path_to_icohplist = path_to_icohplist + self.path_to_madelung = path_to_madelung + self.which_bonds = which_bonds + self.cutoff_icohp = cutoff_icohp + self.noise_cutoff = noise_cutoff + + if self.which_bonds == "all": + self.additional_condition = 0 + elif self.which_bonds == "cation-anion": + self.additional_condition = 1 + else: + raise ValueError( + "Only accepted values are 'all' and 'cation-anion'." + "Please check the input parameters of which_bonds arg" + ) + self.start = start + + self.sg = self.get_decorated_sg() + +
+[docs] + def get_decorated_sg(self): + """ + Create a graph object decorated with bonding data from LobsterPy. + + Returns: + structure graph object + """ + if self.add_additional_data_sg: + chemenvlobster = LobsterNeighbors( + are_coops=False, + filename_icohp=self.path_to_icohplist, + perc_strength_icohp=self.cutoff_icohp, + structure=Structure.from_file(self.path_to_poscar), + additional_condition=self.additional_condition, + filename_charge=self.path_to_charge, + add_additional_data_sg=self.add_additional_data_sg, + filename_blist_sg1=self.path_to_icobilist, + id_blist_sg1="ICOBI", + filename_blist_sg2=self.path_to_icooplist, + id_blist_sg2="ICOOP", + valences_from_charges=True, + adapt_extremum_to_add_cond=True, + noise_cutoff=self.noise_cutoff, + ) + + else: + chemenvlobster = LobsterNeighbors( + are_coops=False, + filename_icohp=self.path_to_icohplist, + perc_strength_icohp=self.cutoff_icohp, + structure=Structure.from_file(self.path_to_poscar), + additional_condition=self.additional_condition, + filename_charge=self.path_to_charge, + add_additional_data_sg=self.add_additional_data_sg, + valences_from_charges=True, + adapt_extremum_to_add_cond=True, + noise_cutoff=self.noise_cutoff, + ) + + # Adds Mulliken and Löwdin charges as site properties to structure object (node properties) + decorated_structure = Charge(self.path_to_charge).get_structure_with_charges(self.path_to_poscar) + + # Create the structure graph object decorated with site and edge properties based on ICOHP/ICOBI/ICOOP data + lobster_env = chemenvlobster.get_bonded_structure( + structure=decorated_structure, decorate=True, edge_properties=True + ) + + # Initialize automating bonding analysis from Lobsterpy based on ICOHP + analyze = Analysis( + path_to_charge=self.path_to_charge, + path_to_cohpcar=self.path_to_cohpcar, + path_to_poscar=self.path_to_poscar, + path_to_icohplist=self.path_to_icohplist, + path_to_madelung=self.path_to_madelung, + which_bonds=self.which_bonds, + cutoff_icohp=self.cutoff_icohp, + ) + + # Store the summarized dictionary object containing bonding information + cba = analyze.condensed_bonding_analysis + + # Iterate over sites in the dictionary + for cba_data in cba["sites"].values(): + for _, node_data in lobster_env.graph.nodes.data(): + # Check if ions are same and add its corresponding environment in node properties + if cba_data["ion"] == node_data["specie"]: + node_data["properties"].update({"env": cba_data["env"]}) + + for edge_prop in lobster_env.graph.edges.data(): # Iterate over structure graph edges + _ab, ab_p, _b, b_p = analyze._integrate_antbdstates_below_efermi( + cohp=analyze.chemenv.completecohp.get_cohp_by_label(edge_prop[2]["bond_label"]), + start=self.start, + ) # Compute bonding- antibonding percentages for each bond in structure graph object + edge_prop[2]["ICOHP_bonding_perc"] = b_p # Store bonding percentage in edge of graph object + edge_prop[2]["ICOHP_antibonding_perc"] = ab_p # Store anti-bonding percentage in edge graph object + + return lobster_env
+
+ +
+ +
+ + + + + + +
+ +
+
+
+ +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_sources/about/changelog.md b/_sources/about/changelog.md new file mode 100644 index 00000000..3139cd42 --- /dev/null +++ b/_sources/about/changelog.md @@ -0,0 +1,2 @@ +```{include} ../../CHANGELOG.md +``` diff --git a/_sources/about/license.md b/_sources/about/license.md new file mode 100644 index 00000000..b5e808da --- /dev/null +++ b/_sources/about/license.md @@ -0,0 +1,32 @@ +License +======= + +BSD 3-Clause License + +Copyright (c) 2021, LobsterPy Development Team +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +1. Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +2. Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +3. Neither the name of the copyright holder nor the names of its + contributors may be used to endorse or promote products derived from + this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/_sources/dev/contributing.md b/_sources/dev/contributing.md new file mode 100644 index 00000000..ef6daa82 --- /dev/null +++ b/_sources/dev/contributing.md @@ -0,0 +1,2 @@ +```{include} ../../CONTRIBUTING.md +``` diff --git a/_sources/dev/dev_installation.md b/_sources/dev/dev_installation.md new file mode 100644 index 00000000..7096ffd4 --- /dev/null +++ b/_sources/dev/dev_installation.md @@ -0,0 +1,53 @@ +# Developer Installation + +Install LobsterPy from source, by cloning the repository via [github](https://github.com/JaGeo/LobsterPy.git) + +```bash +git clone https://github.com/JaGeo/LobsterPy.git +cd LobsterPy +pip install -e .[featurizer,docs,tests,dev] +``` +This will install LobsterPy will all dependencies for tests, pre-commit and docs building. + +## Running unit tests + +Unit tests can be run from the source folder using `pytest`. + +```bash +pytest +``` +This will run all the tests. + +To get a detailed report of test coverage you can use following command +```bash +pytest --cov=lobsterpy --cov-report term-missing --cov-append +``` + +If you feel test execution takes too long locally, you can speedup the execution using [pytest-xdist](https://pypi.org/project/pytest-xdist/). Install this in library in your environment using + +```bash +pip install pytest-xdist +``` + +Once installed, you can now use multiple processors to run your tests. For example, if you want to use 8 processors to run tests in parallel, run + +```bash +pytest -n 8 +``` + +We rely on pytest-split to run tests in parallel on github workflow, thus it is necessary to update the test-durations files in the repository, incase you add new tests. To generate this file, use + +```bash +pytest --cov=lobsterpy --cov-append --splits 1 --group 1 --durations-path ./tests/test_data/.pytest-split-durations --store-durations +``` + +## Building the documentation locally + +The atomate2 documentation can be built using the sphinx package. + +The docs can be built to the `_build` directory: + +```bash +sphinx-build -W docs _build +``` + diff --git a/_sources/fundamentals/index.ipynb b/_sources/fundamentals/index.ipynb new file mode 100644 index 00000000..4eab7303 --- /dev/null +++ b/_sources/fundamentals/index.ipynb @@ -0,0 +1,306 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "e4746f4b", + "metadata": {}, + "source": [ + "# Fundamental Aspects\n", + "\n", + "This document aims to provide an overview of important algorithms and implementations that should help users understand the results one obtains from LobsterPy." + ] + }, + { + "cell_type": "markdown", + "id": "50cc984c", + "metadata": {}, + "source": [ + ":::{important}\n", + "In the following sections the implementations are described using ICOHPs/COHPs. \n", + "\n", + "It is implied that the procedure followed is the same even for analyzing and curating features for ML for ICOOPs/COOPs or ICOBIs/COBIs.\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "43408e8b", + "metadata": {}, + "source": [ + "## LobsterEnv : Detect coordination environments based on the electronic structure" + ] + }, + { + "cell_type": "markdown", + "id": "efcea299", + "metadata": {}, + "source": [ + ":::{admonition} New in LobsterEnv\n", + ":class: versionadded\n", + "* Can handle ICOBIs and ICOOPs to detect co-ordination environments and relevant bonds.\n", + "* Provide structure graphs with ICOHPs/ ICOBIs/ ICOOPs as edge properties\n", + ":::\n", + "\n", + "Lobsterenv is the central algorithm on which LobsterPy depends for automatic bonding analysis. \n", + "\n", + "Below is a schematic depicting how this algorithm works. The image is from a talk given by Prof. Dr. George at [MC16 2023 Dublin](https://opus4.kobv.de/opus4-bam/frontdoor/index/index/start/0/rows/10/sortfield/year/sortorder/desc/searchtype/simple/query/George/author_facetfq/George%2C+Janine/doctypefq/lecture/docId/57876) \n", + "\n", + "![Schema depicting working of LobsterEnv algorithm](fundamentals_assets/LobsterEnv_schema.png)\n", + "\n", + "Unlike purely geometry-based algorithms, e.g., Voronoi construction, which depends on angle and distance cutoffs, LobsterEnv needs only one parameter that influences neighbor selection, i.e., ICOHPs.\n", + "\n", + "Thus, when running automatic analysis using the Analysis module, `cutoff_icohp` is the parameter to be paid attention to. This value is set to 10% by default. This means that, depending on the type of bond (cation-anion or all), only ICOHPs with a value of more than 10% of the largest ICOHPs (this value also changes depending on the type of bonds considered for analysis, cation-anion/all bonds) are considered in the analysis.\n", + "\n", + "The `noise_cutoff` parameter takes care of numerical noise, which always exists in theoretical computations. So, ICOHPs, which are negligible, will not be considered in the bonding analysis.\n", + "\n", + ":::{caution}\n", + "So far LobsterEnv has only been tested for ICOHPs. ICOOP and ICOBI implementations are recently added.\n", + ":::\n", + "\n", + ":::{seealso}\n", + ":class: dropdown\n", + "\n", + "Please refer to the following sources for `ChemEnv` and `LobsterEnv` for more details on these algorithms.\n", + "\n", + "* [D. Waroquiers, J. George, M. Horton, S. Schenk, K. A. Persson, G.-M. Rignanese, X. Gonze, G. Hautier, Acta Cryst B 2020, 76, 683–695.](https://scripts.iucr.org/cgi-bin/paper?S2052520620007994)\n", + "* [J. George, G. Petretto, A. Naik, M. Esters, A. J. Jackson, R. Nelson, R. Dronskowski, G.-M. Rignanese, G. Hautier, ChemPlusChem 2022, e202200123](https://chemistry-europe.onlinelibrary.wiley.com/doi/full/10.1002/cplu.202200123)\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "44546121", + "metadata": {}, + "source": [ + "## Evaluating bonding and anti-bonding percentages" + ] + }, + { + "cell_type": "markdown", + "id": "a81a04cc", + "metadata": {}, + "source": [ + "LobsterPy follows the following steps to evaluate the bonding and anti-bonding percentages at each symmetrically independent site:\n", + "\n", + "1. All the relevant bonds are identified for the site in the structure using ICOHPs via LobsterEnv (bond labels from `ICOHPLIST.lobster` are also stored, along with ICOHP values).\n", + "2. Read the COHP data from `COHPCAR.lobster` corresponding to bond labels from step 1 and get summed COHPs data for each site separately.\n", + "3. Perform numerical integration of the summed COHPs at each site to evaluate the bonding and antibonding integral and percentages below efermi.\n", + "4. One can also set the `start` parameter when initializing the Analysis class object to set the start point of energy range below efermi for the integration. (Optional and useful if one wants to look at specific energy range below efermi)\n", + "\n", + "Below is a visual depiction of the evaluation of bonding percentage (Step 3) from COHP data for a site with its relevant neighbours (i.e., bonds).\n", + "\n", + "![Bonding percentage evaluation](fundamentals_assets/bonding_percentage.png)\n", + "\n", + "Similarly, the antibonding percentage is evaluated for the site from the COHP data with its relevant neighbours (i.e., bonds).\n", + "\n", + ":::{note}\n", + "Ideally, the $(bonding-antibonding) $ integral values should equal the summed ICOHP values at each site. However, as it is a known fact, numerical integration is bound to have some errors. Thus, we might not see this corroborate well for all cases.\n", + "\n", + "Another crucial factor influencing the results of the numerical integration is the number of points on which the integration is performed. Thus, having a finer grid, i.e., setting `COHPSteps` to `2000` or more in your LOBSTER run, will help one get better estimates. From our experience, setting `COHPSteps` to `10000` provided very consistent results. (Be mindful that the sizes of files generated from such setting can become quite large depending on the complexity of the structure)\n", + "\n", + "Also, it is important to note that the ICOHP values from `ICOHPLIST.lobster` consider the entire range below efermi. Thus, if the `COHPCAR.lobster` is not computed for the entire energy range below efermi, then your results will also not corroborate to the summed ICOHPs at the site.\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "6094b839", + "metadata": {}, + "source": [ + "## Automatic orbital-wise analysis implementation" + ] + }, + { + "cell_type": "markdown", + "id": "82d92b02", + "metadata": {}, + "source": [ + "LobsterPy follows the following steps to evaluate the relevant orbitals contributing to the bonds automatically. Steps 1 to 3 are identical to the **Evaluating bonding and anti-bonding percentages**. Thus, for brevity, we will not relist them here and only list the steps further. The steps mentioned below are repeated for each symmetrically independent site:\n", + "\n", + "4. Read the list of available orbitals from `COHPCAR.lobster` at the site\n", + "5. Get summed COHPs for each orbital using the bond label list (step 1)\n", + "6. Check if the total bonding and antibonding integrals obtained in step 3 are each greater than 0\n", + "7. Evaluate the bonding integral (area under the curve) from COHP data for each orbital and store these values in two lists. One will have orbital pair names, and the other will have corresponding evaluated bonding integrals. Similarly, create two more lists with antibonding orbital pair names and corresponding antibonding integrals.\n", + "8. Evaluate the orbital contribution percentages using the following formula:\n", + "\n", + "$$\\text{(Anti) bonding contribution for each orbital}=\\frac{\\text{each orbital (anti)bonding integral}}{\\text{sum(orbital (anti)bonding integral)}}$$\n", + "\n", + "9. If the orbital contribution is more than the `orbital_cutoff` set in the Analysis class object, include that orbital pair interaction as relevant (do this for bonding and antibonding separately using contribution percentages as evaluated in step 8.\n", + "10. Get max anti(bonding) contribution using contribution percentages evaluated in step 8 and add it to the orbital summary dict (this dict is used in description text output generation). \n", + "\n", + "As mentioned in step 9, the results will vary a lot depending on the `orbital_cutoff` set when initializing the Analysis class object. The default value is set to 0.05 (i.e. 5%).\n", + "\n", + "Below is a visual depiction of the evaluation of orbital contribution percentage (Step 7) from summed orbital COHP data for a site. Subfigure (a) and (b) depict the evaluation of orbital contribution for bonding and antibonding interactions relative to summed orbital COHPs at the site.\n", + "\n", + "![Orbital contribution percentage evaluation](fundamentals_assets/orbital_wise_illustration.png)\n" + ] + }, + { + "cell_type": "markdown", + "id": "6f631f31", + "metadata": {}, + "source": [ + "## Features curated for ML via Featurizer" + ] + }, + { + "cell_type": "markdown", + "id": "e5952139", + "metadata": {}, + "source": [ + "### DOS based features" + ] + }, + { + "cell_type": "markdown", + "id": "f215c734", + "metadata": {}, + "source": [ + "

Moment based features

\n", + "\n", + "These features are implemented for DOS in [pymatgen](https://github.com/materialsproject/pymatgen/tree/master) by Rosen et.al. as part of their [A. S. Rosen, S. Vijay, K. A. Persson, Chem. Sci. 2023, 14, 1503–1511.](https://pubs.rsc.org/en/content/articlelanding/2023/SC/D2SC05772G) work\n", + "\n", + "\n", + "1. [Center](https://github.com/materialsproject/pymatgen/blob/2ccbfa16cbffb1016501c18117e70a3f96a83de2/pymatgen/electronic_structure/dos.py#L833)\n", + "2. [Width](https://github.com/materialsproject/pymatgen/blob/2ccbfa16cbffb1016501c18117e70a3f96a83de2/pymatgen/electronic_structure/dos.py#L862)\n", + "3. [Skewness](https://github.com/materialsproject/pymatgen/blob/2ccbfa16cbffb1016501c18117e70a3f96a83de2/pymatgen/electronic_structure/dos.py#L889)\n", + "4. [Kurtosis](https://github.com/materialsproject/pymatgen/blob/2ccbfa16cbffb1016501c18117e70a3f96a83de2/pymatgen/electronic_structure/dos.py#L919)\n", + "5. [Edge](https://github.com/materialsproject/pymatgen/blob/2ccbfa16cbffb1016501c18117e70a3f96a83de2/pymatgen/electronic_structure/dos.py#L1056)\n", + "\n", + "The $n^{th}$ moment for projected dos (PDOS) is computed using following relation\n", + "\n", + "$n^{th}_{moment} = \\frac{\\int (p^n \\cdot \\text{PDOS} \\, dE)}{\\int \\text{PDOS} \\, dE}$\n", + "\n", + "The resulting $1^{st}$, $2^{nd}$, $3^{rd}$ and $4^{th}$ moment are named as *_band_center, *_band_width, *_band_skew, *_band_kurtosis, respectively. Here `*` denotes the orbital names, namely `s,p,d, or f`.\n", + "\n", + "Similar features for elements can also be obtained, element DOS will be used instead of PDOS. Please check the tutorials for example usage.\n", + "\n", + ":::{seealso}\n", + ":class: dropdown\n", + "\n", + "Please refer to the following sources for more details on these.\n", + "\n", + "* [B. Hammer, J. K. Nørskov, Surface Science 1995, 343, 211–220.](https://doi.org/10.1016/0039-6028(96)80007-0)\n", + "* [H. Xin, A. Vojvodic, J. Voss, J. K. Nørskov, F. Abild-Pedersen, Phys. Rev. B 2014, 89, 115114.](https://doi.org/10.1103/PhysRevB.89.115114)\n", + ":::\n", + "\n", + "

Fingerprints

\n", + "\n", + "DOS [Fingerprints](https://github.com/materialsproject/pymatgen/blob/2ccbfa16cbffb1016501c18117e70a3f96a83de2/pymatgen/electronic_structure/dos.py#L1093) are basically DOS data discretized into histograms that will allow to compute similarity between DOS/PDOS of different materials numerically.\n", + "\n", + "This feature was implemented in [pymatgen](https://github.com/materialsproject/pymatgen/tree/master) as part of our LOBSTER database publication [A. A. Naik, C. Ertural, N. Dhamrait, P. Benner, J. George, Sci Data 2023, 10, 610.](https://www.nature.com/articles/s41597-023-02477-5)" + ] + }, + { + "cell_type": "markdown", + "id": "8f8f7deb", + "metadata": {}, + "source": [ + "### COXX based features (COXX: COHP / COBI / COOP)" + ] + }, + { + "cell_type": "markdown", + "id": "ffd726d1", + "metadata": {}, + "source": [ + "

Average features

\n", + "\n", + "The below mentioned features are implemented based on the work of \n", + "\n", + "[R. Nelson, C. Ertural, P. C. Müller, R. Dronskowski, in Compr. Inorg. Chem. III, Elsevier, 2023, pp. 141–201.](https://linkinghub.elsevier.com/retrieve/pii/B9780128231449001205)\n", + "\n", + "\n", + "The $\\overline{\\mathrm{ICOHP}}$ can be interpreted as the average bond strength inside the given material.\n", + "\n", + "$\\overline{\\mathrm{COHP}}(E) =\\sum_i\\left(w_i \\cdot \\operatorname{COHP}_i(E)\\right)$ \n", + "\n", + "$w_i =\\frac{\\mathrm{ICOHP}_i}{\\mathrm{ICOHP}_{\\text {total}}}$\n", + "\n", + "$\\overline{\\mathrm{ICOHP}}=\\int_{-\\infty}^{\\varepsilon_{\\mathrm{F}}} \\overline{\\mathrm{COHP}}(E) \\mathrm{d}E $\n", + "\n", + "The EIN is comparable to a coordination number\n", + "\n", + "$\\mathrm{EIN}=\\frac{\\mathrm{ICOHP}_{\\text {total }}}{\\overline{\\mathrm{ICOHP}}} \\cdot \\frac{2}{N_{\\text {Atoms }}}$\n" + ] + }, + { + "cell_type": "markdown", + "id": "b486f6f8", + "metadata": {}, + "source": [ + "

Moment based features and fingerprints

\n", + "\n", + "These features are inspired from the features implemented for DOS in [pymatgen](https://github.com/materialsproject/pymatgen/tree/master) as described in DOS based features section above. Following features are accessible\n", + "1. Center\n", + "2. Width\n", + "3. Skewness\n", + "4. Kurtosis\n", + "5. Edge\n", + "6. Fingerprints\n", + "\n", + "For the case of COXXs, the $n^{th}$ moment is computed using following relation\n", + "\n", + "$n^{th}_{moment} = \\frac{\\int (p^n \\cdot \\text{COXXs} \\, dE)}{\\int \\text{COXXs} \\, dE}$\n", + "\n", + "The resulting $1^{st}$, $2^{nd}$, $3^{rd}$ and $4^{th}$ moment are named as center_COXX, width_COXX, skewness_COXX, kurtosis_COXX, respectively.\n", + "\n", + "To generate COXX fingerprints we discretize COXX data into histograms that will allow to compute similarity between COXX curves of different materials numerically.\n", + "\n", + ":::{tip}\n", + "One can select the range of energy and type of interactions (bonding, antibonding, overall) one would like to compute these features.\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "2a1f1a31", + "metadata": {}, + "source": [ + "

Summary stats features from LobsterPy condensed bonding analysis dicts

\n", + "\n", + "These features were first implemented as part of our Database publication : [A. A. Naik, C. Ertural, N. Dhamrait, P. Benner, J. George, Sci. Data 2023, 10, 610.](https://doi.org/10.1038/s41597-023-02477-5)\n", + "\n", + "The source code can be found [here](https://github.com/naik-aakash/lobster-database-paper-analysis-scripts/blob/e274cc66fe5cdef981c9de0609eaba4368226c9a/ML_model/featurizer/lobster_featurizer.py#L33).\n", + "\n", + "This is code have been intergrated in our Package and it is extended to also work for COBI/COOP condensed bonding analysis dicts and can user can now also include orbital wise analysis summary stats (Optional)." + ] + }, + { + "cell_type": "markdown", + "id": "7d4e224f", + "metadata": {}, + "source": [ + "### Charge based features\n", + "\n", + "As Ionicity quantifies the strength of an ionic bond in the compound, there are several approaches to quantify it. Here we use the formulation as per [R. Nelson, C. Ertural, P. C. Müller, R. Dronskowski, in Compr. Inorg. Chem. III, Elsevier, 2023, pp. 141–201.](https://linkinghub.elsevier.com/retrieve/pii/B9780128231449001205), which use following relation: \n", + "\n", + "$I_{\\text {Charges }}=\\frac{1}{N_{\\text {Atoms }}} \\sum_i^{N_{\\text {Atoms }}}\\left(\\frac{q_i}{v_{\\text {eff }, i}}\\right)$\n", + "\n", + "It is possible to compute ionicity based on above mentioned formula using either the Mulliken or Löwdin charges obtained from LOBSTER run." + ] + } + ], + "metadata": { + "hide_input": false, + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.0" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/index.md b/_sources/index.md new file mode 100644 index 00000000..777bb7ff --- /dev/null +++ b/_sources/index.md @@ -0,0 +1,84 @@ +```{toctree} +:caption: User Guide +:hidden: +installation/index +fundamentals/index +tutorial/index +``` + +```{toctree} +:caption: Reference +:hidden: +reference/index +reference/cli +``` + +```{toctree} +:caption: Contributing Guide +:hidden: +dev/contributing +dev/dev_installation +``` + +```{toctree} +:caption: About +:hidden: +about/changelog +about/license +``` + +# LobsterPy documentation + +**Date**: {sub-ref}`today` + +**Useful links**: +[Github Repository](https://github.com/JaGeo/LobsterPy) | +[PyPI](https://pypi.org/project/lobsterpy/) | +[Issues & Ideas](https://github.com/JaGeo/LobsterPy/issues) | + +LobsterPy is a package that enables automatic analysis of LOBTSER outputs to get summarized bonding information and relevant bond plots. Additionally, one can also generate features for machine learning studies from LOBSTER outputs. + +::::{grid} 1 1 2 2 +:class-container: text-center +:gutter: 3 + + +:::{grid-item-card} +:link: fundamentals/index +:link-type: doc +:class-header: bg-light +**Fundamental Aspects** +^^^ +This guide contains a detailed explanation of the key functionalites on +which LobsterPy automatic analysis is based on. +::: + +:::{grid-item-card} +:link: installation/index +:link-type: doc +:class-header: bg-light +**User Guide** +^^^ +This guide provides in-depth information for getting started and tutorials for *LobsterPy*. +::: + +:::{grid-item-card} +:link: https://materialsproject.github.io/atomate2/user/codes/vasp.html#lobster +:class-header: bg-light +**LOBSTER Workflow** +^^^ +Here you can find how to use our completely automated workflow to perform bonding analysis with +LOBSTER and Lobsterpy via atomate2. +::: + + +:::{grid-item-card} +:link: dev/dev_installation +:link-type: doc +:class-header: bg-light +**Developer guide** +^^^ +Do you want contribute or improve existing functionalities? +Check out the developer guide. +::: +:::: diff --git a/_sources/installation/index.md b/_sources/installation/index.md new file mode 100644 index 00000000..9398c614 --- /dev/null +++ b/_sources/installation/index.md @@ -0,0 +1,7 @@ +Getting started +================ +```{include} ../../README.md +--- +start-line: 5 +--- +``` diff --git a/_sources/reference/cli.rst b/_sources/reference/cli.rst new file mode 100644 index 00000000..dcb7d8f9 --- /dev/null +++ b/_sources/reference/cli.rst @@ -0,0 +1,14 @@ +CLI Reference +============== + +.. toctree:: + :maxdepth: 1 + + cli_subcommands/createinputs + cli_subcommands/description + cli_subcommands/descriptionquality + cli_subcommands/plotauto + cli_subcommands/plotautoia + cli_subcommands/plotdos + cli_subcommands/ploticohpdistance + cli_subcommands/plot diff --git a/_sources/reference/cli_subcommands/createinputs.rst b/_sources/reference/cli_subcommands/createinputs.rst new file mode 100644 index 00000000..bf25a332 --- /dev/null +++ b/_sources/reference/cli_subcommands/createinputs.rst @@ -0,0 +1,16 @@ +create-inputs +============== + +Create inputs for lobster computation. It works only with PBE POTCARs. + +.. hint:: Aliases available + + - createinputs + + +.. argparse:: + :module: lobsterpy.cli + :func: get_parser + :prog: lobsterpy + :path: create-inputs + diff --git a/_sources/reference/cli_subcommands/description.rst b/_sources/reference/cli_subcommands/description.rst new file mode 100644 index 00000000..e401d213 --- /dev/null +++ b/_sources/reference/cli_subcommands/description.rst @@ -0,0 +1,11 @@ +description +============ + +Deliver a text description of the COHPs or COBIS or COOP results from Lobster and VASP + +.. argparse:: + :module: lobsterpy.cli + :func: get_parser + :prog: lobsterpy + :path: description + diff --git a/_sources/reference/cli_subcommands/descriptionquality.rst b/_sources/reference/cli_subcommands/descriptionquality.rst new file mode 100644 index 00000000..6a4d6390 --- /dev/null +++ b/_sources/reference/cli_subcommands/descriptionquality.rst @@ -0,0 +1,10 @@ +description-quality +=================== + +Deliver a text description of the LOBSTER calc quality analysis. Mandatory required files: POSCAR, POTCAR or POTCAR symbols, lobsterout, lobsterin. Optional files (BVA comparison): CHARGE.lobster, (DOS comparison): DOSCAR.lobster/ DOSCAR.LSO.lobster, Vasprun.xml. + +.. argparse:: + :module: lobsterpy.cli + :func: get_parser + :prog: lobsterpy + :path: description-quality diff --git a/_sources/reference/cli_subcommands/plot.rst b/_sources/reference/cli_subcommands/plot.rst new file mode 100644 index 00000000..3d91f0b0 --- /dev/null +++ b/_sources/reference/cli_subcommands/plot.rst @@ -0,0 +1,11 @@ +plot +==== + +Plot specific COHPs/COBIs/COOPs based on bond numbers. + +.. argparse:: + :module: lobsterpy.cli + :func: get_parser + :prog: lobsterpy + :path: plot + diff --git a/_sources/reference/cli_subcommands/plotauto.rst b/_sources/reference/cli_subcommands/plotauto.rst new file mode 100644 index 00000000..2d7efafb --- /dev/null +++ b/_sources/reference/cli_subcommands/plotauto.rst @@ -0,0 +1,19 @@ +plot-automatic +============== + +Plot most important COHPs or COBIs or COOPs automatically. This option also includes an automatic description. + +.. hint:: Aliases available + + - plot-auto + - auto-plot + - autoplot + - automatic-plot + - automaticplot + +.. argparse:: + :module: lobsterpy.cli + :func: get_parser + :prog: lobsterpy + :path: plot-automatic + diff --git a/_sources/reference/cli_subcommands/plotautoia.rst b/_sources/reference/cli_subcommands/plotautoia.rst new file mode 100644 index 00000000..d9faee35 --- /dev/null +++ b/_sources/reference/cli_subcommands/plotautoia.rst @@ -0,0 +1,18 @@ +plot-automatic-ia +================== + +Creates an interactive plot of most important COHPs or COBIs or COOPs automatically. + +.. hint:: Aliases available + + - plot-auto-ia + - auto-plot-ia + - autoplotia + - automatic-plot-ia + - automaticplot-ia + +.. argparse:: + :module: lobsterpy.cli + :func: get_parser + :prog: lobsterpy + :path: plot-automatic-ia diff --git a/_sources/reference/cli_subcommands/plotdos.rst b/_sources/reference/cli_subcommands/plotdos.rst new file mode 100644 index 00000000..5a1ee12e --- /dev/null +++ b/_sources/reference/cli_subcommands/plotdos.rst @@ -0,0 +1,11 @@ +plot-dos +========= + +Plots DOS from lobster computation. + +.. argparse:: + :module: lobsterpy.cli + :func: get_parser + :prog: lobsterpy + :path: plot-dos + diff --git a/_sources/reference/cli_subcommands/ploticohpdistance.rst b/_sources/reference/cli_subcommands/ploticohpdistance.rst new file mode 100644 index 00000000..0f6e13e4 --- /dev/null +++ b/_sources/reference/cli_subcommands/ploticohpdistance.rst @@ -0,0 +1,15 @@ +plot-icohp-distance +==================== + +Plot ICOHPs or ICOOPs or ICOBIs with respect to bond lengths. + +.. hint:: Aliases available + + - ploticohpdistance + +.. argparse:: + :module: lobsterpy.cli + :func: get_parser + :prog: lobsterpy + :path: plot-icohp-distance + diff --git a/_sources/reference/index.rst b/_sources/reference/index.rst new file mode 100644 index 00000000..053b7a14 --- /dev/null +++ b/_sources/reference/index.rst @@ -0,0 +1,15 @@ +Python API reference +==================== + + +.. currentmodule:: lobsterpy + +.. autosummary:: + :recursive: + :toctree: + :nosignatures: + + cohp + featurize + plotting + structuregraph diff --git a/_sources/reference/lobsterpy.cohp.analyze.Analysis.rst b/_sources/reference/lobsterpy.cohp.analyze.Analysis.rst new file mode 100644 index 00000000..da4601d0 --- /dev/null +++ b/_sources/reference/lobsterpy.cohp.analyze.Analysis.rst @@ -0,0 +1,8 @@ +Analysis +======== + +.. currentmodule:: lobsterpy.cohp.analyze + +.. autoclass:: Analysis + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.cohp.analyze.rst b/_sources/reference/lobsterpy.cohp.analyze.rst new file mode 100644 index 00000000..629d6d25 --- /dev/null +++ b/_sources/reference/lobsterpy.cohp.analyze.rst @@ -0,0 +1,33 @@ +lobsterpy.cohp.analyze +====================== + +.. automodule:: lobsterpy.cohp.analyze + + + + + + + + + + + + + + + + + + + + + .. rubric:: Classes + + .. autosummary:: + :toctree: + :nosignatures: + + Analysis + + diff --git a/_sources/reference/lobsterpy.cohp.describe.Description.rst b/_sources/reference/lobsterpy.cohp.describe.Description.rst new file mode 100644 index 00000000..0276e86e --- /dev/null +++ b/_sources/reference/lobsterpy.cohp.describe.Description.rst @@ -0,0 +1,8 @@ +Description +=========== + +.. currentmodule:: lobsterpy.cohp.describe + +.. autoclass:: Description + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.cohp.describe.rst b/_sources/reference/lobsterpy.cohp.describe.rst new file mode 100644 index 00000000..f0d22d8d --- /dev/null +++ b/_sources/reference/lobsterpy.cohp.describe.rst @@ -0,0 +1,33 @@ +lobsterpy.cohp.describe +======================= + +.. automodule:: lobsterpy.cohp.describe + + + + + + + + + + + + + + + + + + + + + .. rubric:: Classes + + .. autosummary:: + :toctree: + :nosignatures: + + Description + + diff --git a/_sources/reference/lobsterpy.cohp.rst b/_sources/reference/lobsterpy.cohp.rst new file mode 100644 index 00000000..ae471fe7 --- /dev/null +++ b/_sources/reference/lobsterpy.cohp.rst @@ -0,0 +1,31 @@ +lobsterpy.cohp +============== + +.. automodule:: lobsterpy.cohp + + + + + + + + + + + + + + + + + + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + analyze + describe diff --git a/_sources/reference/lobsterpy.featurize.batch.BatchCoxxFingerprint.rst b/_sources/reference/lobsterpy.featurize.batch.BatchCoxxFingerprint.rst new file mode 100644 index 00000000..de2848e4 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.batch.BatchCoxxFingerprint.rst @@ -0,0 +1,8 @@ +BatchCoxxFingerprint +==================== + +.. currentmodule:: lobsterpy.featurize.batch + +.. autoclass:: BatchCoxxFingerprint + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.batch.BatchDosFeaturizer.rst b/_sources/reference/lobsterpy.featurize.batch.BatchDosFeaturizer.rst new file mode 100644 index 00000000..ef5875de --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.batch.BatchDosFeaturizer.rst @@ -0,0 +1,8 @@ +BatchDosFeaturizer +================== + +.. currentmodule:: lobsterpy.featurize.batch + +.. autoclass:: BatchDosFeaturizer + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.batch.BatchStructureGraphs.rst b/_sources/reference/lobsterpy.featurize.batch.BatchStructureGraphs.rst new file mode 100644 index 00000000..621352e0 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.batch.BatchStructureGraphs.rst @@ -0,0 +1,8 @@ +BatchStructureGraphs +==================== + +.. currentmodule:: lobsterpy.featurize.batch + +.. autoclass:: BatchStructureGraphs + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.batch.BatchSummaryFeaturizer.rst b/_sources/reference/lobsterpy.featurize.batch.BatchSummaryFeaturizer.rst new file mode 100644 index 00000000..68940a81 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.batch.BatchSummaryFeaturizer.rst @@ -0,0 +1,8 @@ +BatchSummaryFeaturizer +====================== + +.. currentmodule:: lobsterpy.featurize.batch + +.. autoclass:: BatchSummaryFeaturizer + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.batch.rst b/_sources/reference/lobsterpy.featurize.batch.rst new file mode 100644 index 00000000..b49b0dda --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.batch.rst @@ -0,0 +1,45 @@ +lobsterpy.featurize.batch +========================= + +.. automodule:: lobsterpy.featurize.batch + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + .. rubric:: Classes + + .. autosummary:: + :toctree: + :nosignatures: + + BatchCoxxFingerprint + BatchDosFeaturizer + BatchStructureGraphs + BatchSummaryFeaturizer + + diff --git a/_sources/reference/lobsterpy.featurize.core.CoxxFingerprint.rst b/_sources/reference/lobsterpy.featurize.core.CoxxFingerprint.rst new file mode 100644 index 00000000..f6c5b5db --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.core.CoxxFingerprint.rst @@ -0,0 +1,6 @@ +CoxxFingerprint +=============== + +.. currentmodule:: lobsterpy.featurize.core + +.. autonamedtuple:: CoxxFingerprint \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.core.DosFingerprint.rst b/_sources/reference/lobsterpy.featurize.core.DosFingerprint.rst new file mode 100644 index 00000000..e50352d8 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.core.DosFingerprint.rst @@ -0,0 +1,6 @@ +DosFingerprint +============== + +.. currentmodule:: lobsterpy.featurize.core + +.. autonamedtuple:: DosFingerprint \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.core.FeaturizeCOXX.rst b/_sources/reference/lobsterpy.featurize.core.FeaturizeCOXX.rst new file mode 100644 index 00000000..b680832d --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.core.FeaturizeCOXX.rst @@ -0,0 +1,8 @@ +FeaturizeCOXX +============= + +.. currentmodule:: lobsterpy.featurize.core + +.. autoclass:: FeaturizeCOXX + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.core.FeaturizeCharges.rst b/_sources/reference/lobsterpy.featurize.core.FeaturizeCharges.rst new file mode 100644 index 00000000..f51613f7 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.core.FeaturizeCharges.rst @@ -0,0 +1,8 @@ +FeaturizeCharges +================ + +.. currentmodule:: lobsterpy.featurize.core + +.. autoclass:: FeaturizeCharges + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.core.FeaturizeDoscar.rst b/_sources/reference/lobsterpy.featurize.core.FeaturizeDoscar.rst new file mode 100644 index 00000000..2bb56585 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.core.FeaturizeDoscar.rst @@ -0,0 +1,8 @@ +FeaturizeDoscar +=============== + +.. currentmodule:: lobsterpy.featurize.core + +.. autoclass:: FeaturizeDoscar + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.core.FeaturizeLobsterpy.rst b/_sources/reference/lobsterpy.featurize.core.FeaturizeLobsterpy.rst new file mode 100644 index 00000000..acb83612 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.core.FeaturizeLobsterpy.rst @@ -0,0 +1,8 @@ +FeaturizeLobsterpy +================== + +.. currentmodule:: lobsterpy.featurize.core + +.. autoclass:: FeaturizeLobsterpy + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.core.rst b/_sources/reference/lobsterpy.featurize.core.rst new file mode 100644 index 00000000..b653ed14 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.core.rst @@ -0,0 +1,53 @@ +lobsterpy.featurize.core +======================== + +.. automodule:: lobsterpy.featurize.core + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + .. rubric:: Classes + + .. autosummary:: + :toctree: + :nosignatures: + + CoxxFingerprint + DosFingerprint + FeaturizeCOXX + FeaturizeCharges + FeaturizeDoscar + FeaturizeLobsterpy + + diff --git a/_sources/reference/lobsterpy.featurize.rst b/_sources/reference/lobsterpy.featurize.rst new file mode 100644 index 00000000..c1bc3f2f --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.rst @@ -0,0 +1,32 @@ +lobsterpy.featurize +=================== + +.. automodule:: lobsterpy.featurize + + + + + + + + + + + + + + + + + + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + batch + core + utils diff --git a/_sources/reference/lobsterpy.featurize.utils.get_file_paths.rst b/_sources/reference/lobsterpy.featurize.utils.get_file_paths.rst new file mode 100644 index 00000000..34be9840 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.utils.get_file_paths.rst @@ -0,0 +1,6 @@ +get\_file\_paths +================ + +.. currentmodule:: lobsterpy.featurize.utils + +.. autofunction:: get_file_paths \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.utils.get_structure_path.rst b/_sources/reference/lobsterpy.featurize.utils.get_structure_path.rst new file mode 100644 index 00000000..f60a1cda --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.utils.get_structure_path.rst @@ -0,0 +1,6 @@ +get\_structure\_path +==================== + +.. currentmodule:: lobsterpy.featurize.utils + +.. autofunction:: get_structure_path \ No newline at end of file diff --git a/_sources/reference/lobsterpy.featurize.utils.rst b/_sources/reference/lobsterpy.featurize.utils.rst new file mode 100644 index 00000000..4b584f85 --- /dev/null +++ b/_sources/reference/lobsterpy.featurize.utils.rst @@ -0,0 +1,32 @@ +lobsterpy.featurize.utils +========================= + +.. automodule:: lobsterpy.featurize.utils + + + + + + .. rubric:: Functions + + .. autosummary:: + :toctree: + :nosignatures: + + get_file_paths + get_structure_path + + + + + + + + + + + + + + + diff --git a/_sources/reference/lobsterpy.plotting.IcohpDistancePlotter.rst b/_sources/reference/lobsterpy.plotting.IcohpDistancePlotter.rst new file mode 100644 index 00000000..3e377628 --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.IcohpDistancePlotter.rst @@ -0,0 +1,8 @@ +IcohpDistancePlotter +==================== + +.. currentmodule:: lobsterpy.plotting + +.. autoclass:: IcohpDistancePlotter + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.InteractiveCohpPlotter.rst b/_sources/reference/lobsterpy.plotting.InteractiveCohpPlotter.rst new file mode 100644 index 00000000..9da31099 --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.InteractiveCohpPlotter.rst @@ -0,0 +1,8 @@ +InteractiveCohpPlotter +====================== + +.. currentmodule:: lobsterpy.plotting + +.. autoclass:: InteractiveCohpPlotter + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.PlainCohpPlotter.rst b/_sources/reference/lobsterpy.plotting.PlainCohpPlotter.rst new file mode 100644 index 00000000..cf4dab6d --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.PlainCohpPlotter.rst @@ -0,0 +1,8 @@ +PlainCohpPlotter +================ + +.. currentmodule:: lobsterpy.plotting + +.. autoclass:: PlainCohpPlotter + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.PlainDosPlotter.rst b/_sources/reference/lobsterpy.plotting.PlainDosPlotter.rst new file mode 100644 index 00000000..664dc7f1 --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.PlainDosPlotter.rst @@ -0,0 +1,8 @@ +PlainDosPlotter +=============== + +.. currentmodule:: lobsterpy.plotting + +.. autoclass:: PlainDosPlotter + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.TYPE_CHECKING.rst b/_sources/reference/lobsterpy.plotting.TYPE_CHECKING.rst new file mode 100644 index 00000000..52801fce --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.TYPE_CHECKING.rst @@ -0,0 +1,6 @@ +TYPE\_CHECKING +============== + +.. currentmodule:: lobsterpy.plotting + +.. autodata:: TYPE_CHECKING \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.get_style_list.rst b/_sources/reference/lobsterpy.plotting.get_style_list.rst new file mode 100644 index 00000000..767b1518 --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.get_style_list.rst @@ -0,0 +1,6 @@ +get\_style\_list +================ + +.. currentmodule:: lobsterpy.plotting + +.. autofunction:: get_style_list \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.layout_dicts.cohp_axis_style_dict.rst b/_sources/reference/lobsterpy.plotting.layout_dicts.cohp_axis_style_dict.rst new file mode 100644 index 00000000..284e28fa --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.layout_dicts.cohp_axis_style_dict.rst @@ -0,0 +1,6 @@ +cohp\_axis\_style\_dict +======================= + +.. currentmodule:: lobsterpy.plotting.layout_dicts + +.. autodata:: cohp_axis_style_dict \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.layout_dicts.energy_axis_style_dict.rst b/_sources/reference/lobsterpy.plotting.layout_dicts.energy_axis_style_dict.rst new file mode 100644 index 00000000..1c311d8e --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.layout_dicts.energy_axis_style_dict.rst @@ -0,0 +1,6 @@ +energy\_axis\_style\_dict +========================= + +.. currentmodule:: lobsterpy.plotting.layout_dicts + +.. autodata:: energy_axis_style_dict \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.layout_dicts.layout_dict.rst b/_sources/reference/lobsterpy.plotting.layout_dicts.layout_dict.rst new file mode 100644 index 00000000..4421e1b8 --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.layout_dicts.layout_dict.rst @@ -0,0 +1,6 @@ +layout\_dict +============ + +.. currentmodule:: lobsterpy.plotting.layout_dicts + +.. autodata:: layout_dict \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.layout_dicts.legend_style_dict.rst b/_sources/reference/lobsterpy.plotting.layout_dicts.legend_style_dict.rst new file mode 100644 index 00000000..18b8d4c6 --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.layout_dicts.legend_style_dict.rst @@ -0,0 +1,6 @@ +legend\_style\_dict +=================== + +.. currentmodule:: lobsterpy.plotting.layout_dicts + +.. autodata:: legend_style_dict \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.layout_dicts.rst b/_sources/reference/lobsterpy.plotting.layout_dicts.rst new file mode 100644 index 00000000..92566de3 --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.layout_dicts.rst @@ -0,0 +1,40 @@ +lobsterpy.plotting.layout\_dicts +================================ + +.. automodule:: lobsterpy.plotting.layout_dicts + + + + .. rubric:: Module Attributes + + .. autosummary:: + :toctree: + :nosignatures: + + layout_dict + cohp_axis_style_dict + energy_axis_style_dict + spin_up_trace_style_dict + spin_down_trace_style_dict + legend_style_dict + + + + + + + + + + + + + + + + + + + + + diff --git a/_sources/reference/lobsterpy.plotting.layout_dicts.spin_down_trace_style_dict.rst b/_sources/reference/lobsterpy.plotting.layout_dicts.spin_down_trace_style_dict.rst new file mode 100644 index 00000000..f688dc9e --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.layout_dicts.spin_down_trace_style_dict.rst @@ -0,0 +1,6 @@ +spin\_down\_trace\_style\_dict +============================== + +.. currentmodule:: lobsterpy.plotting.layout_dicts + +.. autodata:: spin_down_trace_style_dict \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.layout_dicts.spin_up_trace_style_dict.rst b/_sources/reference/lobsterpy.plotting.layout_dicts.spin_up_trace_style_dict.rst new file mode 100644 index 00000000..ee64a16b --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.layout_dicts.spin_up_trace_style_dict.rst @@ -0,0 +1,6 @@ +spin\_up\_trace\_style\_dict +============================ + +.. currentmodule:: lobsterpy.plotting.layout_dicts + +.. autodata:: spin_up_trace_style_dict \ No newline at end of file diff --git a/_sources/reference/lobsterpy.plotting.rst b/_sources/reference/lobsterpy.plotting.rst new file mode 100644 index 00000000..84f6977e --- /dev/null +++ b/_sources/reference/lobsterpy.plotting.rst @@ -0,0 +1,67 @@ +lobsterpy.plotting +================== + +.. automodule:: lobsterpy.plotting + + + + + + .. rubric:: Functions + + .. autosummary:: + :toctree: + :nosignatures: + + get_style_list + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + .. rubric:: Classes + + .. autosummary:: + :toctree: + :nosignatures: + + IcohpDistancePlotter + InteractiveCohpPlotter + PlainCohpPlotter + PlainDosPlotter + TYPE_CHECKING + + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + layout_dicts diff --git a/_sources/reference/lobsterpy.structuregraph.graph.LobsterGraph.rst b/_sources/reference/lobsterpy.structuregraph.graph.LobsterGraph.rst new file mode 100644 index 00000000..2c1a34e7 --- /dev/null +++ b/_sources/reference/lobsterpy.structuregraph.graph.LobsterGraph.rst @@ -0,0 +1,8 @@ +LobsterGraph +============ + +.. currentmodule:: lobsterpy.structuregraph.graph + +.. autoclass:: LobsterGraph + :show-inheritance: + :members: \ No newline at end of file diff --git a/_sources/reference/lobsterpy.structuregraph.graph.TYPE_CHECKING.rst b/_sources/reference/lobsterpy.structuregraph.graph.TYPE_CHECKING.rst new file mode 100644 index 00000000..fe1ef37b --- /dev/null +++ b/_sources/reference/lobsterpy.structuregraph.graph.TYPE_CHECKING.rst @@ -0,0 +1,6 @@ +TYPE\_CHECKING +============== + +.. currentmodule:: lobsterpy.structuregraph.graph + +.. autodata:: TYPE_CHECKING \ No newline at end of file diff --git a/_sources/reference/lobsterpy.structuregraph.graph.rst b/_sources/reference/lobsterpy.structuregraph.graph.rst new file mode 100644 index 00000000..2671f8eb --- /dev/null +++ b/_sources/reference/lobsterpy.structuregraph.graph.rst @@ -0,0 +1,37 @@ +lobsterpy.structuregraph.graph +============================== + +.. automodule:: lobsterpy.structuregraph.graph + + + + + + + + + + + + + + + + + + + + + + + + .. rubric:: Classes + + .. autosummary:: + :toctree: + :nosignatures: + + LobsterGraph + TYPE_CHECKING + + diff --git a/_sources/reference/lobsterpy.structuregraph.rst b/_sources/reference/lobsterpy.structuregraph.rst new file mode 100644 index 00000000..920db00a --- /dev/null +++ b/_sources/reference/lobsterpy.structuregraph.rst @@ -0,0 +1,30 @@ +lobsterpy.structuregraph +======================== + +.. automodule:: lobsterpy.structuregraph + + + + + + + + + + + + + + + + + + + +.. rubric:: Modules + +.. autosummary:: + :toctree: + :recursive: + + graph diff --git a/_sources/tutorial/atomateauto.rst b/_sources/tutorial/atomateauto.rst new file mode 100644 index 00000000..46924df0 --- /dev/null +++ b/_sources/tutorial/atomateauto.rst @@ -0,0 +1,6 @@ +High-throughput LOBSTER calcs +============================== + + 1. In *atomate_v2*, the LobsterPy is has been made an integral part of LOBSTER workflow. Check the link which shows how to use our this workflow to perform bonding analysis with LOBSTER via `atomate2 `_. + + 2. Older *atomate_v1* workflow tutorial can be found `here `_. diff --git a/_sources/tutorial/commandlineinterface.rst b/_sources/tutorial/commandlineinterface.rst new file mode 100644 index 00000000..c7bb5993 --- /dev/null +++ b/_sources/tutorial/commandlineinterface.rst @@ -0,0 +1,311 @@ +Command line interface +====================== + +Creating input files +-------------------- + +.. note:: + Currently, the input set generated via pymatgen only supports PBE_54 standard POTCARS for identifying available basis sets for elements and adapting INCAR NBANDS. + + Important tags in INCAR of VASP to pay attention to before performing lobster runs are NBANDS, NSW, and ISYM. A VASP static run must be performed (no movements of atoms, NSW = 0) before running the LOBSTER program. LOBSTER can only deal with VASP WAVECAR that contains results for the entire mesh or only half of it. + + To do this, in the INCAR set, `ISYM = -1` (complete mesh/symmetry switched off) or `ISYM = 0` (half mesh/time-reversal). And to make sure WAVECAR is written, set `LWAVE = .TRUE`. For pCOHP analyses, one needs to have as many bands as there are orbitals on a local basis. + + For pCOHP analyses using LOBSTER, however, you need to set NBANDS in the INCAR file manually. + + +With LobsterPy, these intricate details are handled with a single command. We need the standard VASP input files, i.e. +``INCAR, KPOINTS, POTCAR and POSCAR`` in the calculation directory. Once you have these files, one needs to run the following command: + +``lobsterpy create-inputs`` + +The above command will create input files (INCAR and lobsterin) depending on the basis sets available in Lobster. + +The NBANDS, NSW, and ISYM tags will be changed in the existing INCAR file, and new INCAR files will be written in the current directory. +The newly created INCAR file will be named ``INCAR.lobsterpy`` by default. +Simultaneously, ``lobsterin.lobsterpy`` files are created that are necessary for a lobster run (this is the file that instructs the LOBSTER program what computations must be performed). + +You can also change the names of output files and path where they are saved using following optional tags: + +``lobsterpy create-inputs --file-incar-out /INCAR --file-lobsterin /lobsterin`` + + +For example if ``Cd`` element has two basis sets ``4d 5s`` ``4d 5s 5p``, thus following files are created: + +.. code:: bash + + INCAR.lobsterpy-0 + INCAR.lobsterpy-1 + lobsterin.lobsterpy-0 + lobsterin.lobsterpy-1 + + +The suffix “-0” & “-1” indicate input files corresponding to smaller and larger basis of ``Cd`` respectively. + +.. warning:: + + The ‘KPOINTS’ file is not adapted; the user must select the appropriate grid density before starting VASP computations. Usually, a factor of 50 x crystallographic reciprocal lattice vectors (i.e., no factor of 2 * pi) is sufficient for reliable bonding analysis results. + +Running VASP and Lobster program +-------------------------------- + +Before we start computations, it is important to organize the files in +separate directories to avoid overwriting our results. So Let's create +two new directories named **Basis_0** and **Basis_1.** + +1. Copy ‘INCAR.lobsterpy-0, KPOINTS, POSCAR, POTCAR, + lobsterin.lobsterpy-0’ files to **Basis_0** +2. Copy ‘INCAR.lobsterpy-1, KPOINTS, POSCAR, POTCAR, + lobsterin.lobsterpy-1’ files to **Basis_1** +3. Rename ‘INCAR.lobsterpy-\*’ to ‘INCAR’ and ‘lobsterin.lobsterpy-\*’ + to lobsterin in *both* the directories (\* denotes 0 or 1) +4. Run VASP using the job submission script to your job scheduler on HPC + .Eg: ``sbatch submit.sh`` +5. Wait for VASP computation to be finished.(Lobster program needs + WAVECAR generated by VASP) +6. Now run the lobster program. + +The sample job scripts for slurm job scheduler are provided below. + +VASP job submission script + +.. code:: bash + + #!/bin/bash -l + #SBATCH -J vasp_job + #SBATCH --no-requeue + #SBATCH --export=NONE + #SBATCH --get-user-env + #SBATCH -D ./ + #SBATCH --ntasks=144 + #SBATCH --time=04:00:00 + #SBATCH --partition=micro + #SBATCH --nodes=3 + #SBATCH --output=vaspjob.out.%j + #SBATCH --error=vaspjob.err.%j + + /vasp_std + +-------------- + +Lobster job submission script + +.. code:: bash + + #!/bin/bash -l + #SBATCH -J lob_job + #SBATCH --no-requeue + #SBATCH --export=NONE + #SBATCH --get-user-env + #SBATCH -D ./ + #SBATCH --ntasks=48 + #SBATCH --time=04:00:00 + #SBATCH --nodes=1 + #SBATCH --output=lobsterjob.out.%j + #SBATCH --error=lobsterjob.err.%j + + export OMP_NUM_THREADS=48 + + /lobster-4.1.0 + +-------------- + +Analyze the lobster outputs with automation +------------------------------------------- + +Navigate to directory containing the files of lobster run and then one can use following commands: + +1. Automatic analysis and plotting of COHPs/ICOHPs +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +- The ``lobsterpy description`` command will automatically analyze COHPs for relevant cation-anion bonds. This command also allows saving the output in a JSON file. Below is an example output of this command. + +.. code:: bash + + lobsterpy description --file-json description.json + +.. code:: bash + + The compound CdF2 has 1 symmetry-independent cation(s) with relevant cation-anion interactions: Cd1. + Cd1 has a cubic (CN=8) coordination environment. It has 8 Cd-F (mean ICOHP: -0.62 eV, 27.843 percent antibonding interaction below EFermi) bonds. + + +Following is the json file produced. + +.. code:: json + + { + "formula": "CdF2", + "max_considered_bond_length": 5.98538, + "limit_icohp": [ + -100000, + -0.1 + ], + "number_of_considered_ions": 1, + "sites": { + "0": { + "env": "C:8", + "bonds": { + "F": { + "ICOHP_mean": "-0.62", + "ICOHP_sum": "-4.97", + "has_antibdg_states_below_Efermi": true, + "number_of_bonds": 8, + "bonding": { + "integral": 7.93, + "perc": 0.72157 + }, + "antibonding": { + "integral": 3.06, + "perc": 0.27843 + } + } + }, + "ion": "Cd", + "charge": 1.57, + "relevant_bonds": [ + "29", + "30", + "33", + "40", + "53", + "60", + "63", + "64" + ] + } + }, + "type_charges": "Mulliken" + } + + +- ``lobsterpy description-quality --potcar-symbols "Na_pv Cl" --bvacomp --doscomp`` command will automatically analyze your lobster calculation quality. + +.. note:: + The LOBSTER calculation directory need to have POTCAR, POSCAR, LOBSTER calculation input and output files to run the **lobsterpy calc-description** command successfully. + If POTCAR is not available then you need to supply **--potcar-symbols** along with the command. Other optional files are vasprun.xml if **--doscomp** is switched on. + +.. code:: bash + + lobsterpy description-quality --potcar-symbols "Na_pv Cl" --bvacomp --doscomp --file-calc-quality-json calc_quality_description.json + +.. code:: bash + + The LOBSTER calculation used minimal basis. The absolute and total charge spilling for the calculation is 0.3 and 5.58 %, respectively. The projected wave function is completely orthonormalized as no + bandOverlaps.lobster file is generated during the LOBSTER run. The atomic charge signs from Mulliken population analysis agree with the bond valence analysis. The atomic charge signs from Loewdin + population analysis agree with the bond valence analysis. The Tanimoto index from DOS comparisons in the energy range between -5, 0 eV for s, p, summed orbitals are: 0.9785, 0.9973, 0.9953. + +- ``lobsterpy automatic-plot`` command will plot the results + automatically. It will evaluate all COHPs with ICOHP values down to + 10% of the strongest ICOHP. You can enforce an analysis of all bonds + by using ``lobsterpy automatic-plot --allbonds``. Currently, the + computed Mulliken charges will be used to determine cations and + anions. If no CHARGE.lobster is available, the algorithm will fall + back to the BondValence analysis from pymatgen. Please be aware that + LobsterPy can only analyze bonds that have been included in the + initial Lobster computation. Below is an example and sample output + using this command. + +.. code:: bash + + lobsterpy automatic-plot --title 'Automatic COHP plot' --save-plot COHP.png + +.. image:: tutorial_assets/COHP.png + +You can also plot integrated ICOHP computed by lobster by turning on +``--integrated`` flag when executing ``lobsterpy automatic-plot`` +command. Below is an example and sample output using this command. + +.. code:: bash + + lobsterpy automatic-plot --title 'Automatic ICOHP plot' --integrated --save-plot ICOHP.png + +.. image:: tutorial_assets/ICOHP.png + +- ``lobsterpy automatic-plot-ia`` command can be used to obtain a interactive plot of analysis automatically. It will evaluate all COHPs with ICOHP values down to 10% of the strongest ICOHP. You can enforce an analysis of all bonds by using ``lobsterpy automatic-plot-ia --allbonds``. Currently, the computed Mulliken charges will be used to determine cations and anions. If no CHARGE.lobster is available, the algorithm will fall back to the BondValence analysis from pymatgen. Please be aware that LobsterPy can only analyze bonds that have been included in the initial Lobster computation. You can also obtain a label resolved plot for all bonds using the ``lobsterpy automatic-plot-ia --allbonds --label-resolved`` command. Below is an sample output using ``lobsterpy automatic-plot-ia --label-resolved`` command. + +.. raw:: html + :file: tutorial_assets/CdF2.html + + +2. Plotting of COHPs/COBIs/COOPs +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +You can plot COHPs/COBIs/COOPs from the command line. + +``lobsterpy plot 3 30`` will plot COHPs of the first and second bond from COHPCAR.lobster. It is possible to sum or integrate the COHPs as well (–summed, –integrated). You can switch to COBIs or COOPs by using `--cobis` or `--coops`, respectively. Below is an example output of command to plot COHP and COOP for bond labels 3 and 30. + +.. code:: bash + + lobsterpy plot 3 30 --save-plot COHP_330.png + +.. image:: tutorial_assets/COHP_330.png + +.. code:: bash + + lobsterpy plot 3 30 --coops --save-plot COOP_330.png + +.. image:: tutorial_assets/COOP_330.png + + +3. Plotting of DOS +~~~~~~~~~~~~~~~~~~~ + +- ``lobsterpy plot-dos --summedspins`` will plot total and element DOS. Example output plot is shown below. + +.. code:: bash + + lobsterpy plot-dos --summedspins + +.. image:: tutorial_assets/DOS_example.png + +4. Plotting of ICOHPs/ ICOOPs/ICOBIS againsts bond lengths +~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + +- ``lobsterpy plot-icohps-distances`` will plot ICOHPs against bond lengths. Example output plot is shown below. + +.. code:: bash + + lobsterpy plot-icohp-distance + +.. image:: tutorial_assets/ICOHPs_distance_example.png + +5. Additional Options +~~~~~~~~~~~~~~~~~~~~~ + +You can also customize the style and parameters of the plots generated +by using optional tags. One can easily get an overview of these using +either of these commands: + +.. code:: bash + + lobsterpy automatic-plot --help + +.. code:: bash + + lobsterpy automatic-plot-ia --help + +.. code:: bash + + lobsterpy create-inputs --help + +.. code:: bash + + lobsterpy description --help + +.. code:: bash + + lobsterpy description-quality --help + +.. code:: bash + + lobsterpy plot-dos --help + +.. code:: bash + + lobsterpy plot-icohp-distance --help + +.. code:: bash + + lobsterpy plot --help + diff --git a/_sources/tutorial/computingtimes.rst b/_sources/tutorial/computingtimes.rst new file mode 100644 index 00000000..1def3378 --- /dev/null +++ b/_sources/tutorial/computingtimes.rst @@ -0,0 +1,15 @@ +Computing times +================ + +Exemplar computing time for CdF\ :sub:`2` \(Materials project ID : mp-241) + ++-----------------+------------------------+---------+--------+-------------------------+--------------------+ +| Calc Type | Computing time (secs) | NCORES | NODES | CPU | RAM per Node (GB) | ++=================+========================+=========+========+=========================+====================+ +| VASP | 1381.848 | 144 | 3 | Intel Xeon ("Skylake") | 96 | ++-----------------+------------------------+---------+--------+-------------------------+--------------------+ +| lobsterbasis_0 | 166 | 48 | 1 | Intel Xeon ("Skylake") | 96 | ++-----------------+------------------------+---------+--------+-------------------------+--------------------+ +| lobsterbasis_1 | 259 | 48 | 1 | Intel Xeon ("Skylake") | 96 | ++-----------------+------------------------+---------+--------+-------------------------+--------------------+ + diff --git a/_sources/tutorial/index.rst b/_sources/tutorial/index.rst new file mode 100644 index 00000000..b22f1a14 --- /dev/null +++ b/_sources/tutorial/index.rst @@ -0,0 +1,30 @@ +Tutorial +========= + +Written by Aakash Naik (aakash.naik@bam.de) based on suggestions provided by Prof. Dr. Janine George (janine.george@bam.de) + + +Prerequisites + +* Familiar with `LOBSTER software `_ and its output files +* Familiar with the :doc:`../fundamentals/index` guide. If not, please read that guide before proceeding. +* Basic Python knowledge + + +This tutorial will demonstrate how to use the LobsterPy package using example code snippets. By the end of this tutorial, you will be able to use the package to: + +1. Automatically analyze the lobster outputs using the Python interface +2. Generate custom plots via plotting utilities +3. Use structuregraph to generate graph objects consisting of the LOBSTER data +4. Use featurizers to extract the LOBSTER bonding analysis data as features for the ML studies +5. Get automatic analysis results and plots using command line utilities + +**Note**: The following tutorial is jupyter Notebook, you can download it and execute locally. Please ignore the code blocks which have `remove-cell` tags. You can see these cell tags using `View -> Cell Toolbar -> Tags` (These code blocks are hidden in rendered docs to keep it consistent with example files paths you will use.) + +.. toctree:: + :maxdepth: 2 + + tutorial + commandlineinterface + atomateauto + computingtimes diff --git a/_sources/tutorial/tutorial.ipynb b/_sources/tutorial/tutorial.ipynb new file mode 100644 index 00000000..4bd552b8 --- /dev/null +++ b/_sources/tutorial/tutorial.ipynb @@ -0,0 +1,1082 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "0ea5fe17", + "metadata": {}, + "source": [ + "# Python interface" + ] + }, + { + "cell_type": "markdown", + "id": "aa1a414b", + "metadata": {}, + "source": [ + "For this tutorial, we will use the [test data](https://github.com/JaGeo/LobsterPy/tests/test_data) that can be downloaded from our git repository using the following commands.\n", + "\n", + "```bash\n", + "git clone --filter=blob:none --no-checkout https://github.com/JaGeo/LobsterPy.git\n", + "cd LobsterPy\n", + "git sparse-checkout set tests/test_data\n", + "git read-tree -mu HEAD\n", + "```" + ] + }, + { + "cell_type": "markdown", + "id": "1b224947", + "metadata": {}, + "source": [ + "## Usage of Analysis, Description class and automatic plotting" + ] + }, + { + "cell_type": "markdown", + "id": "ac74798d", + "metadata": {}, + "source": [ + "### Basic usage : Analysis, Description\n", + "\n", + "Lets first import the necessary modules" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "1ed178c0", + "metadata": { + "hide_input": false + }, + "outputs": [], + "source": [ + "from pathlib import Path\n", + "from lobsterpy.cohp.analyze import Analysis\n", + "from lobsterpy.cohp.describe import Description\n", + "import warnings\n", + "warnings.filterwarnings('ignore')" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "b26e3796", + "metadata": { + "tags": [ + "remove-cell" + ] + }, + "outputs": [], + "source": [ + "# Directory of your VASP and Lobster computations\n", + "directory = Path(\".\") / \"..\" / \"..\" / \"tests\" / \"test_data\" / \"CdF_comp_range\"" + ] + }, + { + "cell_type": "markdown", + "id": "a9a4164c", + "metadata": {}, + "source": [ + "```python\n", + "#### Change directory to your Lobster computations (Change this cell block type to Code and remove formatting when executing locally)\n", + "directory = Path(\"LobsterPy\") / \"tests\" / \"test_data\" / \"CdF_comp_range\"\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a0ebf615", + "metadata": {}, + "outputs": [], + "source": [ + "# Initialize Analysis object\n", + "analyse = Analysis(\n", + " path_to_poscar=directory / \"POSCAR.gz\",\n", + " path_to_icohplist=directory / \"ICOHPLIST.lobster.gz\",\n", + " path_to_cohpcar=directory / \"COHPCAR.lobster.gz\",\n", + " path_to_charge=directory / \"CHARGE.lobster.gz\",\n", + " which_bonds=\"cation-anion\",\n", + ")" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "9db2ca46", + "metadata": {}, + "outputs": [], + "source": [ + "# Initialize Description object and to get text description of the analysis\n", + "describe = Description(analysis_object=analyse)\n", + "describe.write_description()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "c7244804", + "metadata": {}, + "outputs": [], + "source": [ + "# Get static plots for detected relevant bonds\n", + "describe.plot_cohps(ylim=[-10, 2], xlim=[-4, 4])" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "b2b1f822", + "metadata": { + "tags": [ + "remove-output" + ] + }, + "outputs": [], + "source": [ + "# Get interactive plots of relevant bonds, \n", + "\n", + "# Setting label_resolved arg to True will plot each COHP curve separately, alongside summed COHP for the bonds.\n", + "fig = describe.plot_interactive_cohps(label_resolved=True, hide=True)\n", + "fig.show(renderer='notebook')" + ] + }, + { + "cell_type": "markdown", + "id": "bdeb0f37", + "metadata": { + "raw_mimetype": "text/restructuredtext" + }, + "source": [ + "Due to sphinx rendering limitations for Plotly figures, the output is not directly visible within the notebook; please use the link to see the [interactive label resolved plot](tutorial_assets/CdF2.html)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "0dff40f8", + "metadata": {}, + "outputs": [], + "source": [ + "# Dict summarizing the automatic analysis results\n", + "analyse.condensed_bonding_analysis" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "f243f239", + "metadata": {}, + "outputs": [], + "source": [ + "# Dict with bonds identified\n", + "analyse.final_dict_bonds" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "0e9cd6e6", + "metadata": {}, + "outputs": [], + "source": [ + "# Dict with ions and their co-ordination environments\n", + "analyse.final_dict_ions" + ] + }, + { + "cell_type": "markdown", + "id": "69e47886", + "metadata": {}, + "source": [ + ":::{note}\n", + "You can also perform automatic analysis using `COBICAR(ICOBILIST.lobster)` or `COOPCAR(ICOOPLIST.lobster)`. You would need to set `are_cobis`/`are_coops` to `True` depending on the type of file you decide to analyze when you initialize the Analysis object. Change the default `noise_cutoff` value to 0.001 or lower, as ICOOP and ICOBI typically have smaller values and different units than ICOHP. Below is an example code snippet.\n", + ":::\n", + "\n", + "```python\n", + "analyse = Analysis(\n", + " path_to_poscar=directory / \"POSCAR.gz\",\n", + " path_to_icohplist=directory / \"ICOBILIST.lobster.gz\",\n", + " path_to_cohpcar=directory / \"COBICAR.lobster.gz\",\n", + " path_to_charge=directory / \"CHARGE.lobster.gz\",\n", + " which_bonds=\"cation-anion\",\n", + " are_cobis=True,\n", + " noise_cutoff=0.001,\n", + ")\n", + "```\n", + "\n", + "Accessing other results is the same as the above." + ] + }, + { + "cell_type": "markdown", + "id": "f82ecbe9", + "metadata": {}, + "source": [ + "### Advanced usage : Analysis, Description" + ] + }, + { + "cell_type": "markdown", + "id": "5772c114", + "metadata": {}, + "source": [ + "LobsterPy now also allows for automatic orbital-wise analysis and plotting of COHPs, COBIs, and COOPs. To switch on orbital-wise analysis, one must set `orbital_resolved` arg to `True`. By default, orbitals contributing 5% or more relative to summed ICOHPs are considered in the analysis. One can change this default threshold using the `orbital_cutoff` argument. Here, we will set this cutoff value to 3%." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "77f40ef2", + "metadata": {}, + "outputs": [], + "source": [ + "analyse = Analysis(\n", + " path_to_poscar=directory / \"POSCAR.gz\",\n", + " path_to_icohplist=directory / \"ICOHPLIST.lobster.gz\",\n", + " path_to_cohpcar=directory / \"COHPCAR.lobster.gz\",\n", + " path_to_charge=directory / \"CHARGE.lobster.gz\",\n", + " which_bonds=\"cation-anion\",\n", + " orbital_resolved=True,\n", + " orbital_cutoff=0.03,\n", + ")" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "861da67a", + "metadata": {}, + "outputs": [], + "source": [ + "# Access the dict summarizing the results including orbital-wise analysis data \n", + "analyse.condensed_bonding_analysis" + ] + }, + { + "cell_type": "markdown", + "id": "4f504fb4", + "metadata": {}, + "source": [ + "In the above output, you will now see a key named `orbital_data` associated with each relevant bond identified. The `orbital_summary_stats` key contains the orbitals that contribute the most to the bonding and antibonding interactions, and values are reported there in percent." + ] + }, + { + "cell_type": "markdown", + "id": "8be302fe", + "metadata": {}, + "source": [ + ":::{note}\n", + "You can get plots from orbital resolved analysis only when `orbital_resolved` arg to `True` when initializing the Analysis object. If this is not done, you will run into errors. Also, only the interactive plotter will plot the results of orbital resolved analysis, as static plots will not be much readable. In any case, you can generate static plots if you need to. You will learn how to use the plotters available in LobsterPy further in the Plotter usage section of the tutorial.\n", + ":::" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "17190525", + "metadata": {}, + "outputs": [], + "source": [ + "# Initialize the Description object\n", + "describe = Description(analysis_object=analyse)\n", + "describe.write_description()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "84f26141", + "metadata": { + "tags": [ + "remove-output" + ] + }, + "outputs": [], + "source": [ + "# Automatic interactive plots\n", + "fig = describe.plot_interactive_cohps(orbital_resolved=True, ylim=[-15,5], hide=True)\n", + "fig.show(renderer='notebook')" + ] + }, + { + "cell_type": "markdown", + "id": "ca2be8d8", + "metadata": { + "raw_mimetype": "text/restructuredtext" + }, + "source": [ + "Due to sphinx rendering limitations for Plotly figures, the output is not directly visible within the notebook; please use the link to see the [interactive orbital resolved plot](tutorial_assets/CdF2_orb.html)" + ] + }, + { + "cell_type": "markdown", + "id": "0084ec1a", + "metadata": {}, + "source": [ + "### Get LOBSTER calculation quality and description\n", + "\n", + "This utility provides a quick overview of your LOBSTER calculation quality by reading the charge spilling and band overlaps file (if these are generated during LOBSTER runs). Optionally, one can obtain atom charge classification comparisons with the BVA method and a comparison between DOS from LOBSTER and VASP.\n", + "\n", + ":::{note}\n", + "The DOS comparisons and basis set utilized analysis are now limited to VASP calculations only. Support for other code output will be added in the future.\n", + ":::" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "051a9998", + "metadata": { + "tags": [ + "remove-cell" + ] + }, + "outputs": [], + "source": [ + "# Directory to your VASP and Lobster computations\n", + "directory = Path(\".\") / \"..\" / \"..\" / \"tests\" / \"test_data\" / \"K3Sb\"" + ] + }, + { + "cell_type": "markdown", + "id": "39c2f183", + "metadata": {}, + "source": [ + "```python\n", + "#### Change directory to your Lobster computations (Change this cell block type to Code and remove formatting when executing locally)\n", + "directory = Path(\"LobsterPy\") / \"tests\" / \"test_data\" / \"K3Sb\"\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "f67b4bc6", + "metadata": {}, + "outputs": [], + "source": [ + "# Get calculation quality summary dict\n", + "calc_quality_K3Sb = Analysis.get_lobster_calc_quality_summary(\n", + " path_to_poscar=directory / \"POSCAR.gz\",\n", + " path_to_charge=directory / \"CHARGE.lobster.gz\",\n", + " path_to_lobsterin=directory / \"lobsterin.gz\",\n", + " path_to_lobsterout=directory / \"lobsterout.gz\",\n", + " potcar_symbols=[\"K_sv\", \"Sb\"], # if POTCAR exists, then provide path_to_potcar and set this to None \n", + " path_to_bandoverlaps=directory / \"bandOverlaps.lobster.gz\",\n", + " dos_comparison=True, # set to false to disable DOS comparisons \n", + " bva_comp=True, # set to false to disable LOBSTER charge classification comparisons with BVA method\n", + " path_to_doscar=directory / \"DOSCAR.LSO.lobster.gz\",\n", + " e_range=[-20, 0],\n", + " path_to_vasprun=directory / \"vasprun.xml.gz\",\n", + " n_bins=256,\n", + " )\n", + "calc_quality_K3Sb" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "0f11cac6", + "metadata": {}, + "outputs": [], + "source": [ + "# Get a text description from calculation quality summary dictionary\n", + "calc_quality_k3sb_des = Description.get_calc_quality_description(\n", + " calc_quality_K3Sb\n", + " )\n", + "Description.write_calc_quality_description(calc_quality_k3sb_des)" + ] + }, + { + "cell_type": "markdown", + "id": "df3591f0", + "metadata": {}, + "source": [ + "## Using plotting utilities" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "f6687ef3", + "metadata": {}, + "outputs": [], + "source": [ + "from matplotlib import style\n", + "from pymatgen.io.lobster import Doscar\n", + "from lobsterpy.plotting import InteractiveCohpPlotter, IcohpDistancePlotter, PlainCohpPlotter, PlainDosPlotter, get_style_list" + ] + }, + { + "cell_type": "markdown", + "id": "62d7d703", + "metadata": {}, + "source": [ + "You can alter the appearance of the static plots using the style sheet that comes with LobsterPy or use any of the readily available matplotlib style sheets." + ] + }, + { + "cell_type": "markdown", + "id": "b965fdce", + "metadata": {}, + "source": [ + "### Plot COHPs / COBIS / COOPs from Analysis object\n", + "\n", + "The `are_cobis`/`are_coops` arg must be set to `True` in the plotter depending on the type of files you analyze or want to plot. Here, we will keep them false as we are plotting COHPs." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "5eca8c7c", + "metadata": {}, + "outputs": [], + "source": [ + "# Using PlainCohpPlotter to get static plots of relevant bonds from Analysis object\n", + "\n", + "style.use(get_style_list()[0]) # Use the LobsterPy style sheet for the generated plots\n", + "\n", + "cohp_plot_static = PlainCohpPlotter(are_cobis=False, are_coops=False)\n", + "for plot_label, label_list in analyse.get_site_bond_resolved_labels().items():\n", + " cohp = analyse.chemenv.completecohp.get_summed_cohp_by_label_list(label_list=label_list)\n", + " cohp_plot_static.add_cohp(plot_label, cohp)\n", + "cohp_plot_static.get_plot(ylim=[-15,2]);" + ] + }, + { + "cell_type": "markdown", + "id": "ffc87f04", + "metadata": {}, + "source": [ + ":::{note}\n", + "You can get plots from orbital resolved analysis only when `orbital_resolved` arg is set to `True` when initializing the Analysis object.\n", + ":::" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a7a454c5", + "metadata": {}, + "outputs": [], + "source": [ + "label_list" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "750935ed", + "metadata": {}, + "outputs": [], + "source": [ + "# Using PlainCohpPlotter to get static plots of relevant orbitals COHPs from Analysis object\n", + "\n", + "style.use('default') # Complete reset the matplotlib figure style\n", + "style.use('seaborn-v0_8-ticks') # use one of the existing matplotlib style sheet\n", + "\n", + "cohp_plot_static = PlainCohpPlotter()\n", + "for plot_label , orb_data in analyse.get_site_orbital_resolved_labels().items():\n", + " for orb, plot_data in orb_data.items():\n", + " mapped_bond_labels = [\n", + " item for item in plot_data[\"bond_labels\"] for _ in range(len(plot_data[\"relevant_sub_orbitals\"]))\n", + " ]\n", + " cohp = analyse.chemenv.completecohp.get_summed_cohp_by_label_and_orbital_list(label_list=mapped_bond_labels, \n", + " orbital_list=plot_data[\"relevant_sub_orbitals\"] * \n", + " len(plot_data[\"bond_labels\"]))\n", + " cohp_plot_static.add_cohp(orb, cohp)\n", + "cohp_plot_static.get_plot(ylim=[-15,2]);" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "80462ffb", + "metadata": {}, + "outputs": [], + "source": [ + "# Using interactive plotter to add relevant cohps\n", + "interactive_cohp_plot = InteractiveCohpPlotter()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "819090a7", + "metadata": {}, + "outputs": [], + "source": [ + "interactive_cohp_plot.add_all_relevant_cohps(analyse=analyse, label_resolved=False,orbital_resolved=True,suffix='')" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "aa76b7ff", + "metadata": { + "tags": [ + "remove-output" + ] + }, + "outputs": [], + "source": [ + "fig = interactive_cohp_plot.get_plot()\n", + "fig.show(renderer='notebook')" + ] + }, + { + "cell_type": "markdown", + "id": "d1657035", + "metadata": { + "raw_mimetype": "text/restructuredtext" + }, + "source": [ + "Due to sphinx rendering limitations for Plotly figures, the output is not directly visible within the notebook; please use the link to see the [interactive orbital resolved plot](tutorial_assets/CdF2_orb.html)" + ] + }, + { + "cell_type": "markdown", + "id": "eb17675e", + "metadata": {}, + "source": [ + "### Plot DOS from Lobster" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a9354732", + "metadata": { + "tags": [ + "remove-cell" + ] + }, + "outputs": [], + "source": [ + "# Load Lobster DOS\n", + "directory = Path(\".\") / \"..\" / \"..\" / \"tests\" / \"test_data\" / \"NaCl_comp_range\"\n", + "dos = Doscar(doscar=directory / 'DOSCAR.lobster.gz',\n", + " structure_file=directory / 'POSCAR.gz')" + ] + }, + { + "cell_type": "markdown", + "id": "9ad3c82c", + "metadata": {}, + "source": [ + "```python\n", + "# Load Lobster DOS (Change this cell block type to Code when executing locally)\n", + "directory = Path(\"LobsterPy\") / \"tests\" / \"test_data\" / \"NaCl_comp_range\"\n", + "dos = Doscar(doscar=directory / 'DOSCAR.lobster.gz',\n", + " structure_file=directory / 'POSCAR.gz')\n", + "```" + ] + }, + { + "cell_type": "markdown", + "id": "dd6698b2", + "metadata": {}, + "source": [ + "Plot total, element and spd dos" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a271f2f0", + "metadata": { + "scrolled": false + }, + "outputs": [], + "source": [ + "style.use('default') # Complete reset the matplotlib figure style\n", + "style.use(get_style_list()[0]) # Use the LobsterPy style sheet for the generated plots\n", + "\n", + "dos_plotter = PlainDosPlotter(summed=True, stack=False, sigma=None)\n", + "dos_plotter.add_dos(dos=dos.completedos, label='Total DOS')\n", + "dos_plotter.add_dos_dict(dos_dict=dos.completedos.get_element_dos()) # Add element dos\n", + "dos_plotter.add_dos_dict(dos_dict=dos.completedos.get_spd_dos()) # add spd dos\n", + "dos_plotter.get_plot(xlim=[-10, 3]);" + ] + }, + { + "cell_type": "markdown", + "id": "fb06692b", + "metadata": {}, + "source": [ + "Plotting DOS at particular site and orbital" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "dbd469bc", + "metadata": {}, + "outputs": [], + "source": [ + "dos_plotter = PlainDosPlotter(summed=True, stack=False, sigma=0.03)\n", + "dos_plotter.add_site_orbital_dos(dos = dos.completedos, site_index=0, orbital='3s')\n", + "dos_plotter.get_plot(xlim=[-10, 3]);" + ] + }, + { + "cell_type": "markdown", + "id": "28d5c5ee", + "metadata": {}, + "source": [ + "## Generate structure graph objects with LOBSTER data" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "9d9a4a6a", + "metadata": {}, + "outputs": [], + "source": [ + "from lobsterpy.structuregraph.graph import LobsterGraph" + ] + }, + { + "cell_type": "markdown", + "id": "57c584bf", + "metadata": {}, + "source": [ + "Below code snippet will generate a networkx graph object with ICOHP, ICOOP, and ICOBI data as edge properties and charges as node properties." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2e6a8da7", + "metadata": { + "tags": [ + "remove-cell" + ] + }, + "outputs": [], + "source": [ + "graph_NaCl_all = LobsterGraph(\n", + " path_to_poscar=directory / \"POSCAR.gz\",\n", + " path_to_charge=directory / \"CHARGE.lobster.gz\",\n", + " path_to_cohpcar=directory / \"COHPCAR.lobster.gz\",\n", + " path_to_icohplist=directory / \"ICOHPLIST.lobster.gz\",\n", + " add_additional_data_sg=True,\n", + " path_to_icooplist=directory / \"ICOOPLIST.lobster.gz\",\n", + " path_to_icobilist=directory / \"ICOBILIST.lobster.gz\",\n", + " path_to_madelung=directory / \"MadelungEnergies.lobster.gz\",\n", + " which_bonds=\"all\",\n", + " start=None,\n", + ")" + ] + }, + { + "cell_type": "markdown", + "id": "a72e86f1", + "metadata": {}, + "source": [ + "```python\n", + "#### (Change this cell block type to Code or copy it from here when executing locally)\n", + "graph_NaCl_all = LobsterGraph(\n", + " path_to_poscar=directory / \"POSCAR.gz\",\n", + " path_to_charge=directory / \"CHARGE.lobster.gz\",\n", + " path_to_cohpcar=directory / \"COHPCAR.lobster.gz\",\n", + " path_to_icohplist=directory / \"ICOHPLIST.lobster.gz\",\n", + " add_additional_data_sg=True,\n", + " path_to_icooplist=directory / \"ICOOPLIST.lobster.gz\",\n", + " path_to_icobilist=directory / \"ICOBILIST.lobster.gz\",\n", + " path_to_madelung=directory / \"MadelungEnergies.lobster.gz\",\n", + " which_bonds=\"all\",\n", + " start=None,\n", + ")\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "b70d9131", + "metadata": {}, + "outputs": [], + "source": [ + "graph_NaCl_all.sg.graph.nodes.data() # view node data" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d15e116e", + "metadata": {}, + "outputs": [], + "source": [ + "graph_NaCl_all.sg.graph.edges.data() # view edge data" + ] + }, + { + "cell_type": "markdown", + "id": "42fcafa3", + "metadata": {}, + "source": [ + "## Featurizer usage examples (Generates features from LOBSTER data for ML studies)" + ] + }, + { + "cell_type": "markdown", + "id": "8a590062", + "metadata": {}, + "source": [ + ":::{note}\n", + "To use the batch featurizers, the path to the parent directory containing LOBSTER calculation outputs needs to be provided. For example, your directory structure needs to be like this:\n", + "\n", + "parent_dir/lobster_calc_output_dir_for_compound_1/\n", + "parent_dir/lobster_calc_output_dir_for_compound_2/\n", + "parent_dir/lobster_calc_output_dir_for_compound_3/\n", + "\n", + "the `lobster_calc_output_dir_for_compound_*` directory should contain all your LOBSTER outputs and POSCAR file.\n", + "\n", + "In such a case `path_to_lobster_calcs=\"parent_dir\"` needs to be set \n", + ":::" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "033a1f84", + "metadata": {}, + "outputs": [], + "source": [ + "from lobsterpy.featurize.batch import (BatchCoxxFingerprint, BatchDosFeaturizer,\n", + " BatchSummaryFeaturizer, BatchStructureGraphs)" + ] + }, + { + "cell_type": "markdown", + "id": "1eb06be7", + "metadata": {}, + "source": [ + "### BatchCoxxFingerprint" + ] + }, + { + "cell_type": "markdown", + "id": "1ed1a472", + "metadata": {}, + "source": [ + "`BatchCoxxFingerprint` provides a convenient way to directly generate fingerprint objects from COHP / COBI/ COOPCAR.lobster data. Generating fingerprints specifically for `bonding`, `antibonding`, and `overall` interactions is feasible. \n", + "\n", + "One can also generate a pair-wise fingerprint similarity matrix dataframe (currently, only simple vector dot product or Tanimoto index are implemented)\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "657d3eb2", + "metadata": { + "tags": [ + "remove-cell" + ] + }, + "outputs": [], + "source": [ + "# Initialize the batch COXX featurizer \n", + "fp_cohp_bonding = BatchCoxxFingerprint(\n", + " path_to_lobster_calcs=directory / \"..\" / \"Featurizer_test_data\" / \"Lobster_calcs\",\n", + " e_range=[-15, 0], \n", + " feature_type=\"bonding\",\n", + " normalize=True, # affects only the fingerprint similarity matrix computation\n", + " tanimoto=True, # affects only the fingerprint similarity matrix computation\n", + " n_jobs=3,\n", + " fingerprint_for='cohp' # changing this to cobi/coop will result in reading cobicar/coopcar file\n", + " )" + ] + }, + { + "cell_type": "markdown", + "id": "d3c68947", + "metadata": {}, + "source": [ + "```python\n", + "## Initialize batch COXX featurizer (Change this cell block type to Code and remove formatting when executing locally)\n", + "fp_cohp_bonding = BatchCoxxFingerprint(\n", + " path_to_lobster_calcs=directory / \"..\" / \"Featurizer_test_data\" / \"Lobster_calcs\",\n", + " e_range=[-15, 0], \n", + " feature_type=\"bonding\",\n", + " normalize=True, # affects only the fingerprint similarity matrix computation\n", + " tanimoto=True, # affects only the fingerprint similarity matrix computation\n", + " n_jobs=3,\n", + " fingerprint_for='cohp' # changing this to cobi/coop will result in reading cobicar/coopcar file\n", + ")\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "1e1fd1d0", + "metadata": { + "scrolled": true + }, + "outputs": [], + "source": [ + "# Access the fingerprints dataframe\n", + "fp_cohp_bonding.fingerprint_df" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d54090e3", + "metadata": {}, + "outputs": [], + "source": [ + "# Get the fingerprints similarity matrix\n", + "fp_cohp_bonding.get_similarity_matrix_df()" + ] + }, + { + "cell_type": "markdown", + "id": "4bf34582", + "metadata": {}, + "source": [ + "### BatchDosFeaturizer" + ] + }, + { + "cell_type": "markdown", + "id": "6a98975c", + "metadata": {}, + "source": [ + "`BatchDosFeaturizer` provides a convenient way to extract LOBSTER DOS moment features and fingerprints in the form of pandas dataframe from the LOBSTER calculation directory. The extracted features consist of the following:\n", + "\n", + "\n", + "1. Element and PDOS center, width, skewness, kurtosis, and edges \n", + "2. PDOS or total DOS fingerprint objects" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "57176d72", + "metadata": { + "tags": [ + "remove-cell" + ] + }, + "outputs": [], + "source": [ + "# Initialize the batch DOS featurizer\n", + "batch_dos = BatchDosFeaturizer(path_to_lobster_calcs=directory / \"..\" / \"Featurizer_test_data\" / \"Lobster_calcs\", # path to parent lobster calcs\n", + " use_lso_dos=True, # will enforce using DOSCAR.LSO.lobster\n", + " add_element_dos_moments=True, # set to false to not have element moments dos features \n", + " e_range=None, # setting this to none results in features computed for the entire energy range \n", + " fingerprint_type=\"summed_pdos\", # fingerprint type (s,p,d,f, summed_pdos)\n", + " n_bins=256,\n", + " n_jobs=3,)" + ] + }, + { + "cell_type": "markdown", + "id": "cc9f8bf9", + "metadata": {}, + "source": [ + "```python\n", + "## Initialize batch DOS featurizer (Change this cell block type to Code and remove formatting when executing locally)\n", + "batch_dos = BatchDosFeaturizer(path_to_lobster_calcs=directory / \"..\" / \"Featurizer_test_data\" / \"Lobster_calcs\", # path to parent lobster calcs\n", + " use_lso_dos=True, # will enforce using DOSCAR.LSO.lobster\n", + " add_element_dos_moments=True, # set to false to not have element moments dos features \n", + " e_range=None, # setting this to none results in features computed for the entire energy range \n", + " fingerprint_type=\"summed_pdos\", # fingerprint type (s,p,d,f, summed_pdos)\n", + " n_bins=256,\n", + " n_jobs=3,)\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "94df0905", + "metadata": {}, + "outputs": [], + "source": [ + "# get the DOS moments df\n", + "batch_dos.get_df()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d2456f82", + "metadata": {}, + "outputs": [], + "source": [ + "# get the DOS fingerprints df\n", + "batch_dos.get_fingerprints_df()" + ] + }, + { + "cell_type": "markdown", + "id": "87ad8083", + "metadata": {}, + "source": [ + "### BatchSummaryFeaturizer" + ] + }, + { + "cell_type": "markdown", + "id": "d73b8bd3", + "metadata": {}, + "source": [ + "`BatchSummaryFeaturizer` provides a convenient way to extract summary stats as pandas dataframe from the LOBSTER calculation directory. The summary stats consist of the following:\n", + "\n", + "1. ICOHP, bonding, antibonding percent (mean, min, max, standard deviation) of relevant bonds from LobsterPy analysis (Orbital-wise analysis stats data can also be included: Optional)\n", + "2. Weighted ICOHP ( ICOOP/ ICOBI: Optional)\n", + "3. COHP center, width, skewness, kurtosis, edge (COOP/ COBI: Optional)\n", + "4. Ionicity and Madelung energies for the structure based on Mulliken and Loewdin charges" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7c05bae8", + "metadata": { + "tags": [ + "remove-cell" + ] + }, + "outputs": [], + "source": [ + "# Initialize batch summary featurizer\n", + "summary_features = BatchSummaryFeaturizer(\n", + " path_to_lobster_calcs=directory / \"..\" / \"Featurizer_test_data\" / \"Lobster_calcs\",\n", + " bonds=\"all\",\n", + " include_cobi_data=False,\n", + " include_coop_data=False,\n", + " e_range=[-15, 0],\n", + " n_jobs=3,\n", + " )" + ] + }, + { + "cell_type": "markdown", + "id": "90808106", + "metadata": { + "scrolled": false + }, + "source": [ + "```python\n", + "## Initialize batch summary featurizer (Change this cell block type to Code and remove formatting when executing locally)\n", + "summary_features = BatchSummaryFeaturizer(\n", + " path_to_lobster_calcs=directory / \"..\" / \"Featurizer_test_data\" / \"Lobster_calcs\",\n", + " bonds=\"all\",\n", + " include_cobi_data=False,\n", + " include_coop_data=False,\n", + " e_range=[-15, 0],\n", + " n_jobs=3,\n", + " )\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "9b49fcf7", + "metadata": {}, + "outputs": [], + "source": [ + "# get summary stats features \n", + "summary_features.get_df()" + ] + }, + { + "cell_type": "markdown", + "id": "e21c5dc2", + "metadata": {}, + "source": [ + "### BatchStructureGraphs" + ] + }, + { + "cell_type": "markdown", + "id": "b11d4652", + "metadata": {}, + "source": [ + "`BatchStructureGraphs` provides a convenient way to generate structure graph objects with LOBSTER data in the form of pandas dataframe from a set of the LOBSTER calculation directories." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2d40b39a", + "metadata": { + "tags": [ + "remove-cell" + ] + }, + "outputs": [], + "source": [ + "batch_sg = BatchStructureGraphs(path_to_lobster_calcs=directory / \"..\" / \"Featurizer_test_data\" / \"Lobster_calcs\",\n", + " add_additional_data_sg=True,\n", + " which_bonds='all',\n", + " n_jobs=3,\n", + " start=None)" + ] + }, + { + "cell_type": "markdown", + "id": "ac1c776a", + "metadata": {}, + "source": [ + "```python\n", + "## Initialize batch structure graphs featurizer (Change this cell block type to Code and remove formatting when executing locally)\n", + "batch_sg = BatchStructureGraphs(path_to_lobster_calcs=directory / \"..\" / \"Featurizer_test_data\" / \"Lobster_calcs\",\n", + " add_additional_data_sg=True,\n", + " which_bonds='all',\n", + " n_jobs=3,\n", + " start=None)\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "5f7259c0", + "metadata": {}, + "outputs": [], + "source": [ + "# get the structure graphs df\n", + "batch_sg.get_df()" + ] + } + ], + "metadata": { + "celltoolbar": "Raw Cell Format", + "hide_input": false, + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.12.4" + }, + "widgets": { + "application/vnd.jupyter.widget-state+json": { + "state": {}, + "version_major": 2, + "version_minor": 0 + } + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sphinx_design_static/design-tabs.js b/_sphinx_design_static/design-tabs.js new file mode 100644 index 00000000..b25bd6a4 --- /dev/null +++ b/_sphinx_design_static/design-tabs.js @@ -0,0 +1,101 @@ +// @ts-check + +// Extra JS capability for selected tabs to be synced +// The selection is stored in local storage so that it persists across page loads. + +/** + * @type {Record} + */ +let sd_id_to_elements = {}; +const storageKeyPrefix = "sphinx-design-tab-id-"; + +/** + * Create a key for a tab element. + * @param {HTMLElement} el - The tab element. + * @returns {[string, string, string] | null} - The key. + * + */ +function create_key(el) { + let syncId = el.getAttribute("data-sync-id"); + let syncGroup = el.getAttribute("data-sync-group"); + if (!syncId || !syncGroup) return null; + return [syncGroup, syncId, syncGroup + "--" + syncId]; +} + +/** + * Initialize the tab selection. + * + */ +function ready() { + // Find all tabs with sync data + + /** @type {string[]} */ + let groups = []; + + document.querySelectorAll(".sd-tab-label").forEach((label) => { + if (label instanceof HTMLElement) { + let data = create_key(label); + if (data) { + let [group, id, key] = data; + + // add click event listener + // @ts-ignore + label.onclick = onSDLabelClick; + + // store map of key to elements + if (!sd_id_to_elements[key]) { + sd_id_to_elements[key] = []; + } + sd_id_to_elements[key].push(label); + + if (groups.indexOf(group) === -1) { + groups.push(group); + // Check if a specific tab has been selected via URL parameter + const tabParam = new URLSearchParams(window.location.search).get( + group + ); + if (tabParam) { + console.log( + "sphinx-design: Selecting tab id for group '" + + group + + "' from URL parameter: " + + tabParam + ); + window.sessionStorage.setItem(storageKeyPrefix + group, tabParam); + } + } + + // Check is a specific tab has been selected previously + let previousId = window.sessionStorage.getItem( + storageKeyPrefix + group + ); + if (previousId === id) { + // console.log( + // "sphinx-design: Selecting tab from session storage: " + id + // ); + // @ts-ignore + label.previousElementSibling.checked = true; + } + } + } + }); +} + +/** + * Activate other tabs with the same sync id. + * + * @this {HTMLElement} - The element that was clicked. + */ +function onSDLabelClick() { + let data = create_key(this); + if (!data) return; + let [group, id, key] = data; + for (const label of sd_id_to_elements[key]) { + if (label === this) continue; + // @ts-ignore + label.previousElementSibling.checked = true; + } + window.sessionStorage.setItem(storageKeyPrefix + group, id); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_sphinx_design_static/sphinx-design.min.css b/_sphinx_design_static/sphinx-design.min.css new file mode 100644 index 00000000..a325746f --- /dev/null +++ b/_sphinx_design_static/sphinx-design.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative;font-size:var(--sd-fontsize-dropdown)}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary.sd-summary-title{padding:.5em 1em;font-size:var(--sd-fontsize-dropdown-title);font-weight:var(--sd-fontweight-dropdown-title);user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;list-style:none;display:inline-flex;justify-content:space-between}details.sd-dropdown summary.sd-summary-title::-webkit-details-marker{display:none}details.sd-dropdown summary.sd-summary-title:focus{outline:none}details.sd-dropdown summary.sd-summary-title .sd-summary-icon{margin-right:.6em;display:inline-flex;align-items:center}details.sd-dropdown summary.sd-summary-title .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary.sd-summary-title .sd-summary-text{flex-grow:1;line-height:1.5;padding-right:.5rem}details.sd-dropdown summary.sd-summary-title .sd-summary-state-marker{pointer-events:none;display:inline-flex;align-items:center}details.sd-dropdown summary.sd-summary-title .sd-summary-state-marker svg{opacity:.6}details.sd-dropdown summary.sd-summary-title:hover .sd-summary-state-marker svg{opacity:1;transform:scale(1.1)}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown .sd-summary-chevron-right{transition:.25s}details.sd-dropdown[open]>.sd-summary-title .sd-summary-chevron-right{transform:rotate(90deg)}details.sd-dropdown[open]>.sd-summary-title .sd-summary-chevron-down{transform:rotate(180deg)}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #0071bc;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0060a0;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-bg: rgba(0, 113, 188, 0.2);--sd-color-secondary-bg: rgba(108, 117, 125, 0.2);--sd-color-success-bg: rgba(40, 167, 69, 0.2);--sd-color-info-bg: rgba(23, 162, 184, 0.2);--sd-color-warning-bg: rgba(240, 179, 126, 0.2);--sd-color-danger-bg: rgba(220, 53, 69, 0.2);--sd-color-light-bg: rgba(248, 249, 250, 0.2);--sd-color-muted-bg: rgba(108, 117, 125, 0.2);--sd-color-dark-bg: rgba(33, 37, 41, 0.2);--sd-color-black-bg: rgba(0, 0, 0, 0.2);--sd-color-white-bg: rgba(255, 255, 255, 0.2);--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem;--sd-fontsize-dropdown: inherit;--sd-fontsize-dropdown-title: 1rem;--sd-fontweight-dropdown-title: 700} diff --git a/_static/basic.css b/_static/basic.css new file mode 100644 index 00000000..2af6139e --- /dev/null +++ b/_static/basic.css @@ -0,0 +1,925 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +div.section::after { + display: block; + content: ''; + clear: left; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 270px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li p.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 360px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} + +a:visited { + color: #551A8B; +} + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, figure.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, figure.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, figure.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, figure.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar, +aside.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px; + background-color: #ffe; + width: 40%; + float: right; + clear: right; + overflow-x: auto; +} + +p.sidebar-title { + font-weight: bold; +} + +nav.contents, +aside.topic, +div.admonition, div.topic, blockquote { + clear: left; +} + +/* -- topics ---------------------------------------------------------------- */ + +nav.contents, +aside.topic, +div.topic { + border: 1px solid #ccc; + padding: 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- content of sidebars/topics/admonitions -------------------------------- */ + +div.sidebar > :last-child, +aside.sidebar > :last-child, +nav.contents > :last-child, +aside.topic > :last-child, +div.topic > :last-child, +div.admonition > :last-child { + margin-bottom: 0; +} + +div.sidebar::after, +aside.sidebar::after, +nav.contents::after, +aside.topic::after, +div.topic::after, +div.admonition::after, +blockquote::after { + display: block; + content: ''; + clear: both; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + margin-top: 10px; + margin-bottom: 10px; + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > :first-child, +td > :first-child { + margin-top: 0px; +} + +th > :last-child, +td > :last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure, figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption, figcaption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number, +figcaption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text, +figcaption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist { + margin: 1em 0; +} + +table.hlist td { + vertical-align: top; +} + +/* -- object description styles --------------------------------------------- */ + +.sig { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; +} + +.sig-name, code.descname { + background-color: transparent; + font-weight: bold; +} + +.sig-name { + font-size: 1.1em; +} + +code.descname { + font-size: 1.2em; +} + +.sig-prename, code.descclassname { + background-color: transparent; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.sig-param.n { + font-style: italic; +} + +/* C++ specific styling */ + +.sig-inline.c-texpr, +.sig-inline.cpp-texpr { + font-family: unset; +} + +.sig.c .k, .sig.c .kt, +.sig.cpp .k, .sig.cpp .kt { + color: #0033B3; +} + +.sig.c .m, +.sig.cpp .m { + color: #1750EB; +} + +.sig.c .s, .sig.c .sc, +.sig.cpp .s, .sig.cpp .sc { + color: #067D17; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +:not(li) > ol > li:first-child > :first-child, +:not(li) > ul > li:first-child > :first-child { + margin-top: 0px; +} + +:not(li) > ol > li:last-child > :last-child, +:not(li) > ul > li:last-child > :last-child { + margin-bottom: 0px; +} + +ol.simple ol p, +ol.simple ul p, +ul.simple ol p, +ul.simple ul p { + margin-top: 0; +} + +ol.simple > li:not(:first-child) > p, +ul.simple > li:not(:first-child) > p { + margin-top: 0; +} + +ol.simple p, +ul.simple p { + margin-bottom: 0; +} + +aside.footnote > span, +div.citation > span { + float: left; +} +aside.footnote > span:last-of-type, +div.citation > span:last-of-type { + padding-right: 0.5em; +} +aside.footnote > p { + margin-left: 2em; +} +div.citation > p { + margin-left: 4em; +} +aside.footnote > p:last-of-type, +div.citation > p:last-of-type { + margin-bottom: 0em; +} +aside.footnote > p:last-of-type:after, +div.citation > p:last-of-type:after { + content: ""; + clear: both; +} + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > :first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +.sig dd { + margin-top: 0px; + margin-bottom: 0px; +} + +.sig dl { + margin-top: 0px; + margin-bottom: 0px; +} + +dl > dd:last-child, +dl > dd:last-child > :last-child { + margin-bottom: 0; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0 0.5em; + content: ":"; + display: inline-block; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +.translated { + background-color: rgba(207, 255, 207, 0.2) +} + +.untranslated { + background-color: rgba(255, 207, 207, 0.2) +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +pre, div[class*="highlight-"] { + clear: both; +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; + white-space: nowrap; +} + +div[class*="highlight-"] { + margin: 1em 0; +} + +td.linenos pre { + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + display: block; +} + +table.highlighttable tbody { + display: block; +} + +table.highlighttable tr { + display: flex; +} + +table.highlighttable td { + margin: 0; + padding: 0; +} + +table.highlighttable td.linenos { + padding-right: 0.5em; +} + +table.highlighttable td.code { + flex: 1; + overflow: hidden; +} + +.highlight .hll { + display: block; +} + +div.highlight pre, +table.highlighttable pre { + margin: 0; +} + +div.code-block-caption + div { + margin-top: 0; +} + +div.code-block-caption { + margin-top: 1em; + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +table.highlighttable td.linenos, +span.linenos, +div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; + -webkit-user-select: text; /* Safari fallback only */ + -webkit-user-select: none; /* Chrome/Safari */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + margin: 1em 0; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: absolute; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/_static/check-solid.svg b/_static/check-solid.svg new file mode 100644 index 00000000..92fad4b5 --- /dev/null +++ b/_static/check-solid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/_static/clipboard.min.js b/_static/clipboard.min.js new file mode 100644 index 00000000..54b3c463 --- /dev/null +++ b/_static/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.8 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1 + + + + diff --git a/_static/copybutton.css b/_static/copybutton.css new file mode 100644 index 00000000..f1916ec7 --- /dev/null +++ b/_static/copybutton.css @@ -0,0 +1,94 @@ +/* Copy buttons */ +button.copybtn { + position: absolute; + display: flex; + top: .3em; + right: .3em; + width: 1.7em; + height: 1.7em; + opacity: 0; + transition: opacity 0.3s, border .3s, background-color .3s; + user-select: none; + padding: 0; + border: none; + outline: none; + border-radius: 0.4em; + /* The colors that GitHub uses */ + border: #1b1f2426 1px solid; + background-color: #f6f8fa; + color: #57606a; +} + +button.copybtn.success { + border-color: #22863a; + color: #22863a; +} + +button.copybtn svg { + stroke: currentColor; + width: 1.5em; + height: 1.5em; + padding: 0.1em; +} + +div.highlight { + position: relative; +} + +/* Show the copybutton */ +.highlight:hover button.copybtn, button.copybtn.success { + opacity: 1; +} + +.highlight button.copybtn:hover { + background-color: rgb(235, 235, 235); +} + +.highlight button.copybtn:active { + background-color: rgb(187, 187, 187); +} + +/** + * A minimal CSS-only tooltip copied from: + * https://codepen.io/mildrenben/pen/rVBrpK + * + * To use, write HTML like the following: + * + *

Short

+ */ + .o-tooltip--left { + position: relative; + } + + .o-tooltip--left:after { + opacity: 0; + visibility: hidden; + position: absolute; + content: attr(data-tooltip); + padding: .2em; + font-size: .8em; + left: -.2em; + background: grey; + color: white; + white-space: nowrap; + z-index: 2; + border-radius: 2px; + transform: translateX(-102%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); +} + +.o-tooltip--left:hover:after { + display: block; + opacity: 1; + visibility: visible; + transform: translateX(-100%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); + transition-delay: .5s; +} + +/* By default the copy button shouldn't show up when printing a page */ +@media print { + button.copybtn { + display: none; + } +} diff --git a/_static/copybutton.js b/_static/copybutton.js new file mode 100644 index 00000000..2ea7ff3e --- /dev/null +++ b/_static/copybutton.js @@ -0,0 +1,248 @@ +// Localization support +const messages = { + 'en': { + 'copy': 'Copy', + 'copy_to_clipboard': 'Copy to clipboard', + 'copy_success': 'Copied!', + 'copy_failure': 'Failed to copy', + }, + 'es' : { + 'copy': 'Copiar', + 'copy_to_clipboard': 'Copiar al portapapeles', + 'copy_success': '¡Copiado!', + 'copy_failure': 'Error al copiar', + }, + 'de' : { + 'copy': 'Kopieren', + 'copy_to_clipboard': 'In die Zwischenablage kopieren', + 'copy_success': 'Kopiert!', + 'copy_failure': 'Fehler beim Kopieren', + }, + 'fr' : { + 'copy': 'Copier', + 'copy_to_clipboard': 'Copier dans le presse-papier', + 'copy_success': 'Copié !', + 'copy_failure': 'Échec de la copie', + }, + 'ru': { + 'copy': 'Скопировать', + 'copy_to_clipboard': 'Скопировать в буфер', + 'copy_success': 'Скопировано!', + 'copy_failure': 'Не удалось скопировать', + }, + 'zh-CN': { + 'copy': '复制', + 'copy_to_clipboard': '复制到剪贴板', + 'copy_success': '复制成功!', + 'copy_failure': '复制失败', + }, + 'it' : { + 'copy': 'Copiare', + 'copy_to_clipboard': 'Copiato negli appunti', + 'copy_success': 'Copiato!', + 'copy_failure': 'Errore durante la copia', + } +} + +let locale = 'en' +if( document.documentElement.lang !== undefined + && messages[document.documentElement.lang] !== undefined ) { + locale = document.documentElement.lang +} + +let doc_url_root = DOCUMENTATION_OPTIONS.URL_ROOT; +if (doc_url_root == '#') { + doc_url_root = ''; +} + +/** + * SVG files for our copy buttons + */ +let iconCheck = ` + ${messages[locale]['copy_success']} + + +` + +// If the user specified their own SVG use that, otherwise use the default +let iconCopy = ``; +if (!iconCopy) { + iconCopy = ` + ${messages[locale]['copy_to_clipboard']} + + + +` +} + +/** + * Set up copy/paste for code blocks + */ + +const runWhenDOMLoaded = cb => { + if (document.readyState != 'loading') { + cb() + } else if (document.addEventListener) { + document.addEventListener('DOMContentLoaded', cb) + } else { + document.attachEvent('onreadystatechange', function() { + if (document.readyState == 'complete') cb() + }) + } +} + +const codeCellId = index => `codecell${index}` + +// Clears selected text since ClipboardJS will select the text when copying +const clearSelection = () => { + if (window.getSelection) { + window.getSelection().removeAllRanges() + } else if (document.selection) { + document.selection.empty() + } +} + +// Changes tooltip text for a moment, then changes it back +// We want the timeout of our `success` class to be a bit shorter than the +// tooltip and icon change, so that we can hide the icon before changing back. +var timeoutIcon = 2000; +var timeoutSuccessClass = 1500; + +const temporarilyChangeTooltip = (el, oldText, newText) => { + el.setAttribute('data-tooltip', newText) + el.classList.add('success') + // Remove success a little bit sooner than we change the tooltip + // So that we can use CSS to hide the copybutton first + setTimeout(() => el.classList.remove('success'), timeoutSuccessClass) + setTimeout(() => el.setAttribute('data-tooltip', oldText), timeoutIcon) +} + +// Changes the copy button icon for two seconds, then changes it back +const temporarilyChangeIcon = (el) => { + el.innerHTML = iconCheck; + setTimeout(() => {el.innerHTML = iconCopy}, timeoutIcon) +} + +const addCopyButtonToCodeCells = () => { + // If ClipboardJS hasn't loaded, wait a bit and try again. This + // happens because we load ClipboardJS asynchronously. + if (window.ClipboardJS === undefined) { + setTimeout(addCopyButtonToCodeCells, 250) + return + } + + // Add copybuttons to all of our code cells + const COPYBUTTON_SELECTOR = 'div.highlight pre'; + const codeCells = document.querySelectorAll(COPYBUTTON_SELECTOR) + codeCells.forEach((codeCell, index) => { + const id = codeCellId(index) + codeCell.setAttribute('id', id) + + const clipboardButton = id => + `` + codeCell.insertAdjacentHTML('afterend', clipboardButton(id)) + }) + +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} + + +var copyTargetText = (trigger) => { + var target = document.querySelector(trigger.attributes['data-clipboard-target'].value); + + // get filtered text + let exclude = '.linenos'; + + let text = filterText(target, exclude); + return formatCopyText(text, '', false, true, true, true, '', '') +} + + // Initialize with a callback so we can modify the text before copy + const clipboard = new ClipboardJS('.copybtn', {text: copyTargetText}) + + // Update UI with error/success messages + clipboard.on('success', event => { + clearSelection() + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_success']) + temporarilyChangeIcon(event.trigger) + }) + + clipboard.on('error', event => { + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_failure']) + }) +} + +runWhenDOMLoaded(addCopyButtonToCodeCells) \ No newline at end of file diff --git a/_static/copybutton_funcs.js b/_static/copybutton_funcs.js new file mode 100644 index 00000000..dbe1aaad --- /dev/null +++ b/_static/copybutton_funcs.js @@ -0,0 +1,73 @@ +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +export function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +export function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} diff --git a/_static/custom.css b/_static/custom.css new file mode 100644 index 00000000..e1fad460 --- /dev/null +++ b/_static/custom.css @@ -0,0 +1,128 @@ +/******************************************************************************* +* light theme +* +* all the variables used for light theme coloring +*/ +html[data-theme="light"] { + /***************************************************************************** + * main colors + */ + --pst-color-primary: rgb(82, 165, 171); + --pst-color-secondary: rgb(200, 30, 109); + --pst-color-success: rgb(40, 167, 69); + --pst-color-info: var(--pst-color-primary); + --pst-color-warning: var(--pst-color-secondary); + --pst-color-danger: rgb(220, 53, 69); + --pst-color-text-base: rgb(51, 51, 51); + --pst-color-text-muted: rgb(77, 77, 77); + --pst-color-border: rgb(201, 201, 201); + --pst-color-shadow: rgb(216, 216, 216); + + /***************************************************************************** + * depth colors + * + * background: the more in depth color + * on-background: the object directly set on the background, use of shadows in light theme + * surface: object set on the background (without shadows) + * on_surface: object set on surface object (without shadows) + */ + --pst-color-background: rgb(255, 255, 255); + --pst-color-on-background: rgb(242, 239, 233); + --pst-color-surface: rgb(242, 239, 233); + --pst-color-on-surface: rgb(242, 239, 233); + + /***************************************************************************** + * extentions + */ + + --pst-color-panel-background: var(--pst-color-background); + + /***************************************************************************** + * layout + */ + + // links + --pst-color-link: var(--pst-color-primary); + --pst-color-link-hover: var(--pst-color-secondary); + + // inline code + --pst-color-inline-code: rgb(232, 62, 140); + + // targeted content + --pst-color-target: rgb(251, 229, 78); + + // hide any content that should not be displayed in the light theme + .only-dark { + display: none !important; + } +} + +/******************************************************************************* +* dark theme +* +* all the variables used for dark theme coloring +*/ +html[data-theme="dark"] { + /***************************************************************************** + * main colors + */ + --pst-color-primary: rgb(82, 165, 171); + --pst-color-secondary: rgb(200, 30, 109); + --pst-color-success: rgb(72, 135, 87); + --pst-color-info: var(--pst-color-primary); + --pst-color-warning: var(--pst-color-secondary); + --pst-color-danger: rgb(203, 70, 83); + --pst-color-text-base: rgb(201, 209, 217); + --pst-color-text-muted: rgb(192, 192, 192); + --pst-color-border: rgb(192, 192, 192); + --pst-color-shadow: var(--pst-color-background); + + /***************************************************************************** + * depth colors + * + * background: the more in depth color + * on-background: the object directly set on the background, use of a light grey in dark theme + * surface: object set on the background (without shadows) + * on_surface: object set on surface object (without shadows) + */ + --pst-color-background: rgb(18, 18, 18); + --pst-color-on-background: rgb(30, 30, 30); + --pst-color-surface: rgb(41, 41, 41); + --pst-color-on-surface: rgb(55, 55, 55); + + /***************************************************************************** + * extentions + */ + + --pst-color-panel-background: var(--pst-color-background-up); + + /***************************************************************************** + * layout + */ + + // links + --pst-color-link: var(--pst-color-primary); + --pst-color-link-hover: var(--pst-color-secondary); + + // inline code + --pst-color-inline-code: rgb(221, 158, 194); + + // targeted content + --pst-color-target: rgb(71, 39, 0); + + // hide any content that should not be displayed in the dark theme + .only-light { + display: none !important; + } + + // specific brightness applied on images + img { + filter: brightness(0.8) contrast(1.2); + } +} + + +.bg-light { + background-color:rgba(80, 164, 171, 0.52)!important +} + diff --git a/_static/design-tabs.js b/_static/design-tabs.js new file mode 100644 index 00000000..b25bd6a4 --- /dev/null +++ b/_static/design-tabs.js @@ -0,0 +1,101 @@ +// @ts-check + +// Extra JS capability for selected tabs to be synced +// The selection is stored in local storage so that it persists across page loads. + +/** + * @type {Record} + */ +let sd_id_to_elements = {}; +const storageKeyPrefix = "sphinx-design-tab-id-"; + +/** + * Create a key for a tab element. + * @param {HTMLElement} el - The tab element. + * @returns {[string, string, string] | null} - The key. + * + */ +function create_key(el) { + let syncId = el.getAttribute("data-sync-id"); + let syncGroup = el.getAttribute("data-sync-group"); + if (!syncId || !syncGroup) return null; + return [syncGroup, syncId, syncGroup + "--" + syncId]; +} + +/** + * Initialize the tab selection. + * + */ +function ready() { + // Find all tabs with sync data + + /** @type {string[]} */ + let groups = []; + + document.querySelectorAll(".sd-tab-label").forEach((label) => { + if (label instanceof HTMLElement) { + let data = create_key(label); + if (data) { + let [group, id, key] = data; + + // add click event listener + // @ts-ignore + label.onclick = onSDLabelClick; + + // store map of key to elements + if (!sd_id_to_elements[key]) { + sd_id_to_elements[key] = []; + } + sd_id_to_elements[key].push(label); + + if (groups.indexOf(group) === -1) { + groups.push(group); + // Check if a specific tab has been selected via URL parameter + const tabParam = new URLSearchParams(window.location.search).get( + group + ); + if (tabParam) { + console.log( + "sphinx-design: Selecting tab id for group '" + + group + + "' from URL parameter: " + + tabParam + ); + window.sessionStorage.setItem(storageKeyPrefix + group, tabParam); + } + } + + // Check is a specific tab has been selected previously + let previousId = window.sessionStorage.getItem( + storageKeyPrefix + group + ); + if (previousId === id) { + // console.log( + // "sphinx-design: Selecting tab from session storage: " + id + // ); + // @ts-ignore + label.previousElementSibling.checked = true; + } + } + } + }); +} + +/** + * Activate other tabs with the same sync id. + * + * @this {HTMLElement} - The element that was clicked. + */ +function onSDLabelClick() { + let data = create_key(this); + if (!data) return; + let [group, id, key] = data; + for (const label of sd_id_to_elements[key]) { + if (label === this) continue; + // @ts-ignore + label.previousElementSibling.checked = true; + } + window.sessionStorage.setItem(storageKeyPrefix + group, id); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_static/doctools.js b/_static/doctools.js new file mode 100644 index 00000000..4d67807d --- /dev/null +++ b/_static/doctools.js @@ -0,0 +1,156 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Base JavaScript utilities for all Sphinx HTML documentation. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ +"use strict"; + +const BLACKLISTED_KEY_CONTROL_ELEMENTS = new Set([ + "TEXTAREA", + "INPUT", + "SELECT", + "BUTTON", +]); + +const _ready = (callback) => { + if (document.readyState !== "loading") { + callback(); + } else { + document.addEventListener("DOMContentLoaded", callback); + } +}; + +/** + * Small JavaScript module for the documentation. + */ +const Documentation = { + init: () => { + Documentation.initDomainIndexTable(); + Documentation.initOnKeyListeners(); + }, + + /** + * i18n support + */ + TRANSLATIONS: {}, + PLURAL_EXPR: (n) => (n === 1 ? 0 : 1), + LOCALE: "unknown", + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext: (string) => { + const translated = Documentation.TRANSLATIONS[string]; + switch (typeof translated) { + case "undefined": + return string; // no translation + case "string": + return translated; // translation exists + default: + return translated[0]; // (singular, plural) translation tuple exists + } + }, + + ngettext: (singular, plural, n) => { + const translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated !== "undefined") + return translated[Documentation.PLURAL_EXPR(n)]; + return n === 1 ? singular : plural; + }, + + addTranslations: (catalog) => { + Object.assign(Documentation.TRANSLATIONS, catalog.messages); + Documentation.PLURAL_EXPR = new Function( + "n", + `return (${catalog.plural_expr})` + ); + Documentation.LOCALE = catalog.locale; + }, + + /** + * helper function to focus on search bar + */ + focusSearchBar: () => { + document.querySelectorAll("input[name=q]")[0]?.focus(); + }, + + /** + * Initialise the domain index toggle buttons + */ + initDomainIndexTable: () => { + const toggler = (el) => { + const idNumber = el.id.substr(7); + const toggledRows = document.querySelectorAll(`tr.cg-${idNumber}`); + if (el.src.substr(-9) === "minus.png") { + el.src = `${el.src.substr(0, el.src.length - 9)}plus.png`; + toggledRows.forEach((el) => (el.style.display = "none")); + } else { + el.src = `${el.src.substr(0, el.src.length - 8)}minus.png`; + toggledRows.forEach((el) => (el.style.display = "")); + } + }; + + const togglerElements = document.querySelectorAll("img.toggler"); + togglerElements.forEach((el) => + el.addEventListener("click", (event) => toggler(event.currentTarget)) + ); + togglerElements.forEach((el) => (el.style.display = "")); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) togglerElements.forEach(toggler); + }, + + initOnKeyListeners: () => { + // only install a listener if it is really needed + if ( + !DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS && + !DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS + ) + return; + + document.addEventListener("keydown", (event) => { + // bail for input elements + if (BLACKLISTED_KEY_CONTROL_ELEMENTS.has(document.activeElement.tagName)) return; + // bail with special keys + if (event.altKey || event.ctrlKey || event.metaKey) return; + + if (!event.shiftKey) { + switch (event.key) { + case "ArrowLeft": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const prevLink = document.querySelector('link[rel="prev"]'); + if (prevLink && prevLink.href) { + window.location.href = prevLink.href; + event.preventDefault(); + } + break; + case "ArrowRight": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const nextLink = document.querySelector('link[rel="next"]'); + if (nextLink && nextLink.href) { + window.location.href = nextLink.href; + event.preventDefault(); + } + break; + } + } + + // some keyboard layouts may need Shift to get / + switch (event.key) { + case "/": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.focusSearchBar(); + event.preventDefault(); + } + }); + }, +}; + +// quick alias for translations +const _ = Documentation.gettext; + +_ready(Documentation.init); diff --git a/_static/documentation_options.js b/_static/documentation_options.js new file mode 100644 index 00000000..dab586c0 --- /dev/null +++ b/_static/documentation_options.js @@ -0,0 +1,13 @@ +const DOCUMENTATION_OPTIONS = { + VERSION: '', + LANGUAGE: 'en', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + LINK_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '', + NAVIGATION_WITH_KEYS: false, + SHOW_SEARCH_SUMMARY: true, + ENABLE_SEARCH_SHORTCUTS: true, +}; \ No newline at end of file diff --git a/_static/file.png b/_static/file.png new file mode 100644 index 00000000..a858a410 Binary files /dev/null and b/_static/file.png differ diff --git a/_static/images/logo_binder.svg b/_static/images/logo_binder.svg new file mode 100644 index 00000000..45fecf75 --- /dev/null +++ b/_static/images/logo_binder.svg @@ -0,0 +1,19 @@ + + + + +logo + + + + + + + + diff --git a/_static/images/logo_colab.png b/_static/images/logo_colab.png new file mode 100644 index 00000000..b7560ec2 Binary files /dev/null and b/_static/images/logo_colab.png differ diff --git a/_static/images/logo_deepnote.svg b/_static/images/logo_deepnote.svg new file mode 100644 index 00000000..fa77ebfc --- /dev/null +++ b/_static/images/logo_deepnote.svg @@ -0,0 +1 @@ + diff --git a/_static/images/logo_jupyterhub.svg b/_static/images/logo_jupyterhub.svg new file mode 100644 index 00000000..60cfe9f2 --- /dev/null +++ b/_static/images/logo_jupyterhub.svg @@ -0,0 +1 @@ +logo_jupyterhubHub diff --git a/_static/language_data.js b/_static/language_data.js new file mode 100644 index 00000000..367b8ed8 --- /dev/null +++ b/_static/language_data.js @@ -0,0 +1,199 @@ +/* + * language_data.js + * ~~~~~~~~~~~~~~~~ + * + * This script contains the language-specific data used by searchtools.js, + * namely the list of stopwords, stemmer, scorer and splitter. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +var stopwords = ["a", "and", "are", "as", "at", "be", "but", "by", "for", "if", "in", "into", "is", "it", "near", "no", "not", "of", "on", "or", "such", "that", "the", "their", "then", "there", "these", "they", "this", "to", "was", "will", "with"]; + + +/* Non-minified version is copied as a separate JS file, if available */ + +/** + * Porter Stemmer + */ +var Stemmer = function() { + + var step2list = { + ational: 'ate', + tional: 'tion', + enci: 'ence', + anci: 'ance', + izer: 'ize', + bli: 'ble', + alli: 'al', + entli: 'ent', + eli: 'e', + ousli: 'ous', + ization: 'ize', + ation: 'ate', + ator: 'ate', + alism: 'al', + iveness: 'ive', + fulness: 'ful', + ousness: 'ous', + aliti: 'al', + iviti: 'ive', + biliti: 'ble', + logi: 'log' + }; + + var step3list = { + icate: 'ic', + ative: '', + alize: 'al', + iciti: 'ic', + ical: 'ic', + ful: '', + ness: '' + }; + + var c = "[^aeiou]"; // consonant + var v = "[aeiouy]"; // vowel + var C = c + "[^aeiouy]*"; // consonant sequence + var V = v + "[aeiou]*"; // vowel sequence + + var mgr0 = "^(" + C + ")?" + V + C; // [C]VC... is m>0 + var meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$"; // [C]VC[V] is m=1 + var mgr1 = "^(" + C + ")?" + V + C + V + C; // [C]VCVC... is m>1 + var s_v = "^(" + C + ")?" + v; // vowel in stem + + this.stemWord = function (w) { + var stem; + var suffix; + var firstch; + var origword = w; + + if (w.length < 3) + return w; + + var re; + var re2; + var re3; + var re4; + + firstch = w.substr(0,1); + if (firstch == "y") + w = firstch.toUpperCase() + w.substr(1); + + // Step 1a + re = /^(.+?)(ss|i)es$/; + re2 = /^(.+?)([^s])s$/; + + if (re.test(w)) + w = w.replace(re,"$1$2"); + else if (re2.test(w)) + w = w.replace(re2,"$1$2"); + + // Step 1b + re = /^(.+?)eed$/; + re2 = /^(.+?)(ed|ing)$/; + if (re.test(w)) { + var fp = re.exec(w); + re = new RegExp(mgr0); + if (re.test(fp[1])) { + re = /.$/; + w = w.replace(re,""); + } + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1]; + re2 = new RegExp(s_v); + if (re2.test(stem)) { + w = stem; + re2 = /(at|bl|iz)$/; + re3 = new RegExp("([^aeiouylsz])\\1$"); + re4 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re2.test(w)) + w = w + "e"; + else if (re3.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + else if (re4.test(w)) + w = w + "e"; + } + } + + // Step 1c + re = /^(.+?)y$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(s_v); + if (re.test(stem)) + w = stem + "i"; + } + + // Step 2 + re = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step2list[suffix]; + } + + // Step 3 + re = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step3list[suffix]; + } + + // Step 4 + re = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/; + re2 = /^(.+?)(s|t)(ion)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + if (re.test(stem)) + w = stem; + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1] + fp[2]; + re2 = new RegExp(mgr1); + if (re2.test(stem)) + w = stem; + } + + // Step 5 + re = /^(.+?)e$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + re2 = new RegExp(meq1); + re3 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re.test(stem) || (re2.test(stem) && !(re3.test(stem)))) + w = stem; + } + re = /ll$/; + re2 = new RegExp(mgr1); + if (re.test(w) && re2.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + + // and turn initial Y back to y + if (firstch == "y") + w = firstch.toLowerCase() + w.substr(1); + return w; + } +} + diff --git a/_static/locales/ar/LC_MESSAGES/booktheme.mo b/_static/locales/ar/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..15541a6a Binary files /dev/null and b/_static/locales/ar/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ar/LC_MESSAGES/booktheme.po b/_static/locales/ar/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..34d404c6 --- /dev/null +++ b/_static/locales/ar/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ar\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "طباعة إلى PDF" + +msgid "Theme by the" +msgstr "موضوع بواسطة" + +msgid "Download source file" +msgstr "تنزيل ملف المصدر" + +msgid "open issue" +msgstr "قضية مفتوحة" + +msgid "Contents" +msgstr "محتويات" + +msgid "previous page" +msgstr "الصفحة السابقة" + +msgid "Download notebook file" +msgstr "تنزيل ملف دفتر الملاحظات" + +msgid "Copyright" +msgstr "حقوق النشر" + +msgid "Download this page" +msgstr "قم بتنزيل هذه الصفحة" + +msgid "Source repository" +msgstr "مستودع المصدر" + +msgid "By" +msgstr "بواسطة" + +msgid "repository" +msgstr "مخزن" + +msgid "Last updated on" +msgstr "آخر تحديث في" + +msgid "Toggle navigation" +msgstr "تبديل التنقل" + +msgid "Sphinx Book Theme" +msgstr "موضوع كتاب أبو الهول" + +msgid "suggest edit" +msgstr "أقترح تحرير" + +msgid "Open an issue" +msgstr "افتح قضية" + +msgid "Launch" +msgstr "إطلاق" + +msgid "Fullscreen mode" +msgstr "وضع ملء الشاشة" + +msgid "Edit this page" +msgstr "قم بتحرير هذه الصفحة" + +msgid "By the" +msgstr "بواسطة" + +msgid "next page" +msgstr "الصفحة التالية" diff --git a/_static/locales/bg/LC_MESSAGES/booktheme.mo b/_static/locales/bg/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..da951200 Binary files /dev/null and b/_static/locales/bg/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/bg/LC_MESSAGES/booktheme.po b/_static/locales/bg/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..7420c19e --- /dev/null +++ b/_static/locales/bg/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: bg\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Печат в PDF" + +msgid "Theme by the" +msgstr "Тема от" + +msgid "Download source file" +msgstr "Изтеглете изходния файл" + +msgid "open issue" +msgstr "отворен брой" + +msgid "Contents" +msgstr "Съдържание" + +msgid "previous page" +msgstr "предишна страница" + +msgid "Download notebook file" +msgstr "Изтеглете файла на бележника" + +msgid "Copyright" +msgstr "Авторско право" + +msgid "Download this page" +msgstr "Изтеглете тази страница" + +msgid "Source repository" +msgstr "Хранилище на източника" + +msgid "By" +msgstr "От" + +msgid "repository" +msgstr "хранилище" + +msgid "Last updated on" +msgstr "Последна актуализация на" + +msgid "Toggle navigation" +msgstr "Превключване на навигацията" + +msgid "Sphinx Book Theme" +msgstr "Тема на книгата Sphinx" + +msgid "suggest edit" +msgstr "предложи редактиране" + +msgid "Open an issue" +msgstr "Отворете проблем" + +msgid "Launch" +msgstr "Стартиране" + +msgid "Fullscreen mode" +msgstr "Режим на цял екран" + +msgid "Edit this page" +msgstr "Редактирайте тази страница" + +msgid "By the" +msgstr "По" + +msgid "next page" +msgstr "Следваща страница" diff --git a/_static/locales/bn/LC_MESSAGES/booktheme.mo b/_static/locales/bn/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..6b96639b Binary files /dev/null and b/_static/locales/bn/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/bn/LC_MESSAGES/booktheme.po b/_static/locales/bn/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..63a07c36 --- /dev/null +++ b/_static/locales/bn/LC_MESSAGES/booktheme.po @@ -0,0 +1,63 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: bn\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "পিডিএফ প্রিন্ট করুন" + +msgid "Theme by the" +msgstr "থিম দ্বারা" + +msgid "Download source file" +msgstr "উত্স ফাইল ডাউনলোড করুন" + +msgid "open issue" +msgstr "খোলা সমস্যা" + +msgid "previous page" +msgstr "আগের পৃষ্ঠা" + +msgid "Download notebook file" +msgstr "নোটবুক ফাইল ডাউনলোড করুন" + +msgid "Copyright" +msgstr "কপিরাইট" + +msgid "Download this page" +msgstr "এই পৃষ্ঠাটি ডাউনলোড করুন" + +msgid "Source repository" +msgstr "উত্স সংগ্রহস্থল" + +msgid "By" +msgstr "দ্বারা" + +msgid "Last updated on" +msgstr "সর্বশেষ আপডেট" + +msgid "Toggle navigation" +msgstr "নেভিগেশন টগল করুন" + +msgid "Sphinx Book Theme" +msgstr "স্পিনিক্স বুক থিম" + +msgid "Open an issue" +msgstr "একটি সমস্যা খুলুন" + +msgid "Launch" +msgstr "শুরু করা" + +msgid "Edit this page" +msgstr "এই পৃষ্ঠাটি সম্পাদনা করুন" + +msgid "By the" +msgstr "দ্বারা" + +msgid "next page" +msgstr "পরবর্তী পৃষ্ঠা" diff --git a/_static/locales/ca/LC_MESSAGES/booktheme.mo b/_static/locales/ca/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..a4dd30e9 Binary files /dev/null and b/_static/locales/ca/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ca/LC_MESSAGES/booktheme.po b/_static/locales/ca/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..8fb358bf --- /dev/null +++ b/_static/locales/ca/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ca\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimeix a PDF" + +msgid "Theme by the" +msgstr "Tema del" + +msgid "Download source file" +msgstr "Baixeu el fitxer font" + +msgid "open issue" +msgstr "número obert" + +msgid "previous page" +msgstr "Pàgina anterior" + +msgid "Download notebook file" +msgstr "Descarregar fitxer de quadern" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download this page" +msgstr "Descarregueu aquesta pàgina" + +msgid "Source repository" +msgstr "Dipòsit de fonts" + +msgid "By" +msgstr "Per" + +msgid "Last updated on" +msgstr "Darrera actualització el" + +msgid "Toggle navigation" +msgstr "Commuta la navegació" + +msgid "Sphinx Book Theme" +msgstr "Tema del llibre Esfinx" + +msgid "suggest edit" +msgstr "suggerir edició" + +msgid "Open an issue" +msgstr "Obriu un número" + +msgid "Launch" +msgstr "Llançament" + +msgid "Edit this page" +msgstr "Editeu aquesta pàgina" + +msgid "By the" +msgstr "Per la" + +msgid "next page" +msgstr "pàgina següent" diff --git a/_static/locales/cs/LC_MESSAGES/booktheme.mo b/_static/locales/cs/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..c39e01a6 Binary files /dev/null and b/_static/locales/cs/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/cs/LC_MESSAGES/booktheme.po b/_static/locales/cs/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..c6ef4690 --- /dev/null +++ b/_static/locales/cs/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: cs\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Tisk do PDF" + +msgid "Theme by the" +msgstr "Téma od" + +msgid "Download source file" +msgstr "Stáhněte si zdrojový soubor" + +msgid "open issue" +msgstr "otevřené číslo" + +msgid "Contents" +msgstr "Obsah" + +msgid "previous page" +msgstr "předchozí stránka" + +msgid "Download notebook file" +msgstr "Stáhnout soubor poznámkového bloku" + +msgid "Copyright" +msgstr "autorská práva" + +msgid "Download this page" +msgstr "Stáhněte si tuto stránku" + +msgid "Source repository" +msgstr "Zdrojové úložiště" + +msgid "By" +msgstr "Podle" + +msgid "repository" +msgstr "úložiště" + +msgid "Last updated on" +msgstr "Naposledy aktualizováno" + +msgid "Toggle navigation" +msgstr "Přepnout navigaci" + +msgid "Sphinx Book Theme" +msgstr "Téma knihy Sfinga" + +msgid "suggest edit" +msgstr "navrhnout úpravy" + +msgid "Open an issue" +msgstr "Otevřete problém" + +msgid "Launch" +msgstr "Zahájení" + +msgid "Fullscreen mode" +msgstr "Režim celé obrazovky" + +msgid "Edit this page" +msgstr "Upravit tuto stránku" + +msgid "By the" +msgstr "Podle" + +msgid "next page" +msgstr "další strana" diff --git a/_static/locales/da/LC_MESSAGES/booktheme.mo b/_static/locales/da/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..f43157d7 Binary files /dev/null and b/_static/locales/da/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/da/LC_MESSAGES/booktheme.po b/_static/locales/da/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..306a38e5 --- /dev/null +++ b/_static/locales/da/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: da\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Udskriv til PDF" + +msgid "Theme by the" +msgstr "Tema af" + +msgid "Download source file" +msgstr "Download kildefil" + +msgid "open issue" +msgstr "åbent nummer" + +msgid "Contents" +msgstr "Indhold" + +msgid "previous page" +msgstr "forrige side" + +msgid "Download notebook file" +msgstr "Download notesbog-fil" + +msgid "Copyright" +msgstr "ophavsret" + +msgid "Download this page" +msgstr "Download denne side" + +msgid "Source repository" +msgstr "Kildelager" + +msgid "By" +msgstr "Ved" + +msgid "repository" +msgstr "lager" + +msgid "Last updated on" +msgstr "Sidst opdateret den" + +msgid "Toggle navigation" +msgstr "Skift navigation" + +msgid "Sphinx Book Theme" +msgstr "Sphinx bogtema" + +msgid "suggest edit" +msgstr "foreslå redigering" + +msgid "Open an issue" +msgstr "Åbn et problem" + +msgid "Launch" +msgstr "Start" + +msgid "Fullscreen mode" +msgstr "Fuldskærmstilstand" + +msgid "Edit this page" +msgstr "Rediger denne side" + +msgid "By the" +msgstr "Ved" + +msgid "next page" +msgstr "Næste side" diff --git a/_static/locales/de/LC_MESSAGES/booktheme.mo b/_static/locales/de/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..648b565c Binary files /dev/null and b/_static/locales/de/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/de/LC_MESSAGES/booktheme.po b/_static/locales/de/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..4925360d --- /dev/null +++ b/_static/locales/de/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: de\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "In PDF drucken" + +msgid "Theme by the" +msgstr "Thema von der" + +msgid "Download source file" +msgstr "Quelldatei herunterladen" + +msgid "open issue" +msgstr "offenes Thema" + +msgid "Contents" +msgstr "Inhalt" + +msgid "previous page" +msgstr "vorherige Seite" + +msgid "Download notebook file" +msgstr "Notebook-Datei herunterladen" + +msgid "Copyright" +msgstr "Urheberrechte ©" + +msgid "Download this page" +msgstr "Laden Sie diese Seite herunter" + +msgid "Source repository" +msgstr "Quell-Repository" + +msgid "By" +msgstr "Durch" + +msgid "repository" +msgstr "Repository" + +msgid "Last updated on" +msgstr "Zuletzt aktualisiert am" + +msgid "Toggle navigation" +msgstr "Navigation umschalten" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-Buch-Thema" + +msgid "suggest edit" +msgstr "vorschlagen zu bearbeiten" + +msgid "Open an issue" +msgstr "Öffnen Sie ein Problem" + +msgid "Launch" +msgstr "Starten" + +msgid "Fullscreen mode" +msgstr "Vollbildmodus" + +msgid "Edit this page" +msgstr "Bearbeite diese Seite" + +msgid "By the" +msgstr "Bis zum" + +msgid "next page" +msgstr "Nächste Seite" diff --git a/_static/locales/el/LC_MESSAGES/booktheme.mo b/_static/locales/el/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..fca6e935 Binary files /dev/null and b/_static/locales/el/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/el/LC_MESSAGES/booktheme.po b/_static/locales/el/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..3e01acbd --- /dev/null +++ b/_static/locales/el/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: el\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Εκτύπωση σε PDF" + +msgid "Theme by the" +msgstr "Θέμα από το" + +msgid "Download source file" +msgstr "Λήψη αρχείου προέλευσης" + +msgid "open issue" +msgstr "ανοιχτό ζήτημα" + +msgid "Contents" +msgstr "Περιεχόμενα" + +msgid "previous page" +msgstr "προηγούμενη σελίδα" + +msgid "Download notebook file" +msgstr "Λήψη αρχείου σημειωματάριου" + +msgid "Copyright" +msgstr "Πνευματική ιδιοκτησία" + +msgid "Download this page" +msgstr "Λήψη αυτής της σελίδας" + +msgid "Source repository" +msgstr "Αποθήκη πηγής" + +msgid "By" +msgstr "Με" + +msgid "repository" +msgstr "αποθήκη" + +msgid "Last updated on" +msgstr "Τελευταία ενημέρωση στις" + +msgid "Toggle navigation" +msgstr "Εναλλαγή πλοήγησης" + +msgid "Sphinx Book Theme" +msgstr "Θέμα βιβλίου Sphinx" + +msgid "suggest edit" +msgstr "προτείνω επεξεργασία" + +msgid "Open an issue" +msgstr "Ανοίξτε ένα ζήτημα" + +msgid "Launch" +msgstr "Εκτόξευση" + +msgid "Fullscreen mode" +msgstr "ΛΕΙΤΟΥΡΓΙΑ ΠΛΗΡΟΥΣ ΟΘΟΝΗΣ" + +msgid "Edit this page" +msgstr "Επεξεργαστείτε αυτήν τη σελίδα" + +msgid "By the" +msgstr "Από το" + +msgid "next page" +msgstr "επόμενη σελίδα" diff --git a/_static/locales/eo/LC_MESSAGES/booktheme.mo b/_static/locales/eo/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..d1072bbe Binary files /dev/null and b/_static/locales/eo/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/eo/LC_MESSAGES/booktheme.po b/_static/locales/eo/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..f7ed2262 --- /dev/null +++ b/_static/locales/eo/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: eo\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Presi al PDF" + +msgid "Theme by the" +msgstr "Temo de la" + +msgid "Download source file" +msgstr "Elŝutu fontodosieron" + +msgid "open issue" +msgstr "malferma numero" + +msgid "Contents" +msgstr "Enhavo" + +msgid "previous page" +msgstr "antaŭa paĝo" + +msgid "Download notebook file" +msgstr "Elŝutu kajeran dosieron" + +msgid "Copyright" +msgstr "Kopirajto" + +msgid "Download this page" +msgstr "Elŝutu ĉi tiun paĝon" + +msgid "Source repository" +msgstr "Fonto-deponejo" + +msgid "By" +msgstr "De" + +msgid "repository" +msgstr "deponejo" + +msgid "Last updated on" +msgstr "Laste ĝisdatigita la" + +msgid "Toggle navigation" +msgstr "Ŝalti navigadon" + +msgid "Sphinx Book Theme" +msgstr "Sfinksa Libro-Temo" + +msgid "suggest edit" +msgstr "sugesti redaktadon" + +msgid "Open an issue" +msgstr "Malfermu numeron" + +msgid "Launch" +msgstr "Lanĉo" + +msgid "Fullscreen mode" +msgstr "Plenekrana reĝimo" + +msgid "Edit this page" +msgstr "Redaktu ĉi tiun paĝon" + +msgid "By the" +msgstr "Per la" + +msgid "next page" +msgstr "sekva paĝo" diff --git a/_static/locales/es/LC_MESSAGES/booktheme.mo b/_static/locales/es/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..ba2ee4dc Binary files /dev/null and b/_static/locales/es/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/es/LC_MESSAGES/booktheme.po b/_static/locales/es/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..5e0029e5 --- /dev/null +++ b/_static/locales/es/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: es\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimir en PDF" + +msgid "Theme by the" +msgstr "Tema por el" + +msgid "Download source file" +msgstr "Descargar archivo fuente" + +msgid "open issue" +msgstr "Tema abierto" + +msgid "Contents" +msgstr "Contenido" + +msgid "previous page" +msgstr "pagina anterior" + +msgid "Download notebook file" +msgstr "Descargar archivo de cuaderno" + +msgid "Copyright" +msgstr "Derechos de autor" + +msgid "Download this page" +msgstr "Descarga esta pagina" + +msgid "Source repository" +msgstr "Repositorio de origen" + +msgid "By" +msgstr "Por" + +msgid "repository" +msgstr "repositorio" + +msgid "Last updated on" +msgstr "Ultima actualización en" + +msgid "Toggle navigation" +msgstr "Navegación de palanca" + +msgid "Sphinx Book Theme" +msgstr "Tema del libro de la esfinge" + +msgid "suggest edit" +msgstr "sugerir editar" + +msgid "Open an issue" +msgstr "Abrir un problema" + +msgid "Launch" +msgstr "Lanzamiento" + +msgid "Fullscreen mode" +msgstr "Modo de pantalla completa" + +msgid "Edit this page" +msgstr "Edita esta página" + +msgid "By the" +msgstr "Por el" + +msgid "next page" +msgstr "siguiente página" diff --git a/_static/locales/et/LC_MESSAGES/booktheme.mo b/_static/locales/et/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..983b8239 Binary files /dev/null and b/_static/locales/et/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/et/LC_MESSAGES/booktheme.po b/_static/locales/et/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..8680982a --- /dev/null +++ b/_static/locales/et/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: et\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Prindi PDF-i" + +msgid "Theme by the" +msgstr "Teema" + +msgid "Download source file" +msgstr "Laadige alla lähtefail" + +msgid "open issue" +msgstr "avatud küsimus" + +msgid "Contents" +msgstr "Sisu" + +msgid "previous page" +msgstr "eelmine leht" + +msgid "Download notebook file" +msgstr "Laadige sülearvuti fail alla" + +msgid "Copyright" +msgstr "Autoriõigus" + +msgid "Download this page" +msgstr "Laadige see leht alla" + +msgid "Source repository" +msgstr "Allikahoidla" + +msgid "By" +msgstr "Kõrval" + +msgid "repository" +msgstr "hoidla" + +msgid "Last updated on" +msgstr "Viimati uuendatud" + +msgid "Toggle navigation" +msgstr "Lülita navigeerimine sisse" + +msgid "Sphinx Book Theme" +msgstr "Sfinksiraamatu teema" + +msgid "suggest edit" +msgstr "soovita muuta" + +msgid "Open an issue" +msgstr "Avage probleem" + +msgid "Launch" +msgstr "Käivitage" + +msgid "Fullscreen mode" +msgstr "Täisekraanirežiim" + +msgid "Edit this page" +msgstr "Muutke seda lehte" + +msgid "By the" +msgstr "Autor" + +msgid "next page" +msgstr "järgmine leht" diff --git a/_static/locales/fi/LC_MESSAGES/booktheme.mo b/_static/locales/fi/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..d8ac0545 Binary files /dev/null and b/_static/locales/fi/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/fi/LC_MESSAGES/booktheme.po b/_static/locales/fi/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..34dac218 --- /dev/null +++ b/_static/locales/fi/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: fi\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Tulosta PDF-tiedostoon" + +msgid "Theme by the" +msgstr "Teeman tekijä" + +msgid "Download source file" +msgstr "Lataa lähdetiedosto" + +msgid "open issue" +msgstr "avoin ongelma" + +msgid "Contents" +msgstr "Sisällys" + +msgid "previous page" +msgstr "Edellinen sivu" + +msgid "Download notebook file" +msgstr "Lataa muistikirjatiedosto" + +msgid "Copyright" +msgstr "Tekijänoikeus" + +msgid "Download this page" +msgstr "Lataa tämä sivu" + +msgid "Source repository" +msgstr "Lähteen arkisto" + +msgid "By" +msgstr "Tekijä" + +msgid "repository" +msgstr "arkisto" + +msgid "Last updated on" +msgstr "Viimeksi päivitetty" + +msgid "Toggle navigation" +msgstr "Vaihda navigointia" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-kirjan teema" + +msgid "suggest edit" +msgstr "ehdottaa muokkausta" + +msgid "Open an issue" +msgstr "Avaa ongelma" + +msgid "Launch" +msgstr "Tuoda markkinoille" + +msgid "Fullscreen mode" +msgstr "Koko näytön tila" + +msgid "Edit this page" +msgstr "Muokkaa tätä sivua" + +msgid "By the" +msgstr "Mukaan" + +msgid "next page" +msgstr "seuraava sivu" diff --git a/_static/locales/fr/LC_MESSAGES/booktheme.mo b/_static/locales/fr/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..f663d39f Binary files /dev/null and b/_static/locales/fr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/fr/LC_MESSAGES/booktheme.po b/_static/locales/fr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..8991a1b8 --- /dev/null +++ b/_static/locales/fr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: fr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimer au format PDF" + +msgid "Theme by the" +msgstr "Thème par le" + +msgid "Download source file" +msgstr "Télécharger le fichier source" + +msgid "open issue" +msgstr "signaler un problème" + +msgid "Contents" +msgstr "Contenu" + +msgid "previous page" +msgstr "page précédente" + +msgid "Download notebook file" +msgstr "Télécharger le fichier notebook" + +msgid "Copyright" +msgstr "droits d'auteur" + +msgid "Download this page" +msgstr "Téléchargez cette page" + +msgid "Source repository" +msgstr "Dépôt source" + +msgid "By" +msgstr "Par" + +msgid "repository" +msgstr "dépôt" + +msgid "Last updated on" +msgstr "Dernière mise à jour le" + +msgid "Toggle navigation" +msgstr "Basculer la navigation" + +msgid "Sphinx Book Theme" +msgstr "Thème du livre Sphinx" + +msgid "suggest edit" +msgstr "suggestion de modification" + +msgid "Open an issue" +msgstr "Ouvrez un problème" + +msgid "Launch" +msgstr "lancement" + +msgid "Fullscreen mode" +msgstr "Mode plein écran" + +msgid "Edit this page" +msgstr "Modifier cette page" + +msgid "By the" +msgstr "Par le" + +msgid "next page" +msgstr "page suivante" diff --git a/_static/locales/hr/LC_MESSAGES/booktheme.mo b/_static/locales/hr/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..eca4a1a2 Binary files /dev/null and b/_static/locales/hr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/hr/LC_MESSAGES/booktheme.po b/_static/locales/hr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..42c4233d --- /dev/null +++ b/_static/locales/hr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: hr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Ispis u PDF" + +msgid "Theme by the" +msgstr "Tema autora" + +msgid "Download source file" +msgstr "Preuzmi izvornu datoteku" + +msgid "open issue" +msgstr "otvoreno izdanje" + +msgid "Contents" +msgstr "Sadržaj" + +msgid "previous page" +msgstr "Prethodna stranica" + +msgid "Download notebook file" +msgstr "Preuzmi datoteku bilježnice" + +msgid "Copyright" +msgstr "Autorska prava" + +msgid "Download this page" +msgstr "Preuzmite ovu stranicu" + +msgid "Source repository" +msgstr "Izvorno spremište" + +msgid "By" +msgstr "Po" + +msgid "repository" +msgstr "spremište" + +msgid "Last updated on" +msgstr "Posljednje ažuriranje:" + +msgid "Toggle navigation" +msgstr "Uključi / isključi navigaciju" + +msgid "Sphinx Book Theme" +msgstr "Tema knjige Sphinx" + +msgid "suggest edit" +msgstr "predloži uređivanje" + +msgid "Open an issue" +msgstr "Otvorite izdanje" + +msgid "Launch" +msgstr "Pokrenite" + +msgid "Fullscreen mode" +msgstr "Način preko cijelog zaslona" + +msgid "Edit this page" +msgstr "Uredite ovu stranicu" + +msgid "By the" +msgstr "Od strane" + +msgid "next page" +msgstr "sljedeća stranica" diff --git a/_static/locales/id/LC_MESSAGES/booktheme.mo b/_static/locales/id/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..d07a06a9 Binary files /dev/null and b/_static/locales/id/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/id/LC_MESSAGES/booktheme.po b/_static/locales/id/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..b8d8d898 --- /dev/null +++ b/_static/locales/id/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: id\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Cetak ke PDF" + +msgid "Theme by the" +msgstr "Tema oleh" + +msgid "Download source file" +msgstr "Unduh file sumber" + +msgid "open issue" +msgstr "masalah terbuka" + +msgid "Contents" +msgstr "Isi" + +msgid "previous page" +msgstr "halaman sebelumnya" + +msgid "Download notebook file" +msgstr "Unduh file notebook" + +msgid "Copyright" +msgstr "hak cipta" + +msgid "Download this page" +msgstr "Unduh halaman ini" + +msgid "Source repository" +msgstr "Repositori sumber" + +msgid "By" +msgstr "Oleh" + +msgid "repository" +msgstr "gudang" + +msgid "Last updated on" +msgstr "Terakhir diperbarui saat" + +msgid "Toggle navigation" +msgstr "Alihkan navigasi" + +msgid "Sphinx Book Theme" +msgstr "Tema Buku Sphinx" + +msgid "suggest edit" +msgstr "menyarankan edit" + +msgid "Open an issue" +msgstr "Buka masalah" + +msgid "Launch" +msgstr "Meluncurkan" + +msgid "Fullscreen mode" +msgstr "Mode layar penuh" + +msgid "Edit this page" +msgstr "Edit halaman ini" + +msgid "By the" +msgstr "Oleh" + +msgid "next page" +msgstr "halaman selanjutnya" diff --git a/_static/locales/it/LC_MESSAGES/booktheme.mo b/_static/locales/it/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..53ba476e Binary files /dev/null and b/_static/locales/it/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/it/LC_MESSAGES/booktheme.po b/_static/locales/it/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..36fca59f --- /dev/null +++ b/_static/locales/it/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: it\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Stampa in PDF" + +msgid "Theme by the" +msgstr "Tema di" + +msgid "Download source file" +msgstr "Scarica il file sorgente" + +msgid "open issue" +msgstr "questione aperta" + +msgid "Contents" +msgstr "Contenuti" + +msgid "previous page" +msgstr "pagina precedente" + +msgid "Download notebook file" +msgstr "Scarica il file del taccuino" + +msgid "Copyright" +msgstr "Diritto d'autore" + +msgid "Download this page" +msgstr "Scarica questa pagina" + +msgid "Source repository" +msgstr "Repository di origine" + +msgid "By" +msgstr "Di" + +msgid "repository" +msgstr "repository" + +msgid "Last updated on" +msgstr "Ultimo aggiornamento il" + +msgid "Toggle navigation" +msgstr "Attiva / disattiva la navigazione" + +msgid "Sphinx Book Theme" +msgstr "Tema del libro della Sfinge" + +msgid "suggest edit" +msgstr "suggerisci modifica" + +msgid "Open an issue" +msgstr "Apri un problema" + +msgid "Launch" +msgstr "Lanciare" + +msgid "Fullscreen mode" +msgstr "Modalità schermo intero" + +msgid "Edit this page" +msgstr "Modifica questa pagina" + +msgid "By the" +msgstr "Dal" + +msgid "next page" +msgstr "pagina successiva" diff --git a/_static/locales/iw/LC_MESSAGES/booktheme.mo b/_static/locales/iw/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..a45c6575 Binary files /dev/null and b/_static/locales/iw/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/iw/LC_MESSAGES/booktheme.po b/_static/locales/iw/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..dede9cb0 --- /dev/null +++ b/_static/locales/iw/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: iw\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "הדפס לקובץ PDF" + +msgid "Theme by the" +msgstr "נושא מאת" + +msgid "Download source file" +msgstr "הורד את קובץ המקור" + +msgid "open issue" +msgstr "בעיה פתוחה" + +msgid "Contents" +msgstr "תוכן" + +msgid "previous page" +msgstr "עמוד קודם" + +msgid "Download notebook file" +msgstr "הורד קובץ מחברת" + +msgid "Copyright" +msgstr "זכויות יוצרים" + +msgid "Download this page" +msgstr "הורד דף זה" + +msgid "Source repository" +msgstr "מאגר המקורות" + +msgid "By" +msgstr "על ידי" + +msgid "repository" +msgstr "מאגר" + +msgid "Last updated on" +msgstr "עודכן לאחרונה ב" + +msgid "Toggle navigation" +msgstr "החלף ניווט" + +msgid "Sphinx Book Theme" +msgstr "נושא ספר ספינקס" + +msgid "suggest edit" +msgstr "מציע לערוך" + +msgid "Open an issue" +msgstr "פתח גיליון" + +msgid "Launch" +msgstr "לְהַשִׁיק" + +msgid "Fullscreen mode" +msgstr "מצב מסך מלא" + +msgid "Edit this page" +msgstr "ערוך דף זה" + +msgid "By the" +msgstr "דרך" + +msgid "next page" +msgstr "עמוד הבא" diff --git a/_static/locales/ja/LC_MESSAGES/booktheme.mo b/_static/locales/ja/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..1cefd29c Binary files /dev/null and b/_static/locales/ja/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ja/LC_MESSAGES/booktheme.po b/_static/locales/ja/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..2615f0d8 --- /dev/null +++ b/_static/locales/ja/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ja\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDFに印刷" + +msgid "Theme by the" +msgstr "のテーマ" + +msgid "Download source file" +msgstr "ソースファイルをダウンロード" + +msgid "open issue" +msgstr "未解決の問題" + +msgid "Contents" +msgstr "目次" + +msgid "previous page" +msgstr "前のページ" + +msgid "Download notebook file" +msgstr "ノートブックファイルをダウンロード" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download this page" +msgstr "このページをダウンロード" + +msgid "Source repository" +msgstr "ソースリポジトリ" + +msgid "By" +msgstr "著者" + +msgid "repository" +msgstr "リポジトリ" + +msgid "Last updated on" +msgstr "最終更新日" + +msgid "Toggle navigation" +msgstr "ナビゲーションを切り替え" + +msgid "Sphinx Book Theme" +msgstr "スフィンクスの本のテーマ" + +msgid "suggest edit" +msgstr "編集を提案する" + +msgid "Open an issue" +msgstr "問題を報告" + +msgid "Launch" +msgstr "起動" + +msgid "Fullscreen mode" +msgstr "全画面モード" + +msgid "Edit this page" +msgstr "このページを編集" + +msgid "By the" +msgstr "によって" + +msgid "next page" +msgstr "次のページ" diff --git a/_static/locales/ko/LC_MESSAGES/booktheme.mo b/_static/locales/ko/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..06c7ec93 Binary files /dev/null and b/_static/locales/ko/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ko/LC_MESSAGES/booktheme.po b/_static/locales/ko/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..c9e13a42 --- /dev/null +++ b/_static/locales/ko/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ko\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF로 인쇄" + +msgid "Theme by the" +msgstr "테마별" + +msgid "Download source file" +msgstr "소스 파일 다운로드" + +msgid "open issue" +msgstr "열린 문제" + +msgid "Contents" +msgstr "내용" + +msgid "previous page" +msgstr "이전 페이지" + +msgid "Download notebook file" +msgstr "노트북 파일 다운로드" + +msgid "Copyright" +msgstr "저작권" + +msgid "Download this page" +msgstr "이 페이지 다운로드" + +msgid "Source repository" +msgstr "소스 저장소" + +msgid "By" +msgstr "으로" + +msgid "repository" +msgstr "저장소" + +msgid "Last updated on" +msgstr "마지막 업데이트" + +msgid "Toggle navigation" +msgstr "탐색 전환" + +msgid "Sphinx Book Theme" +msgstr "스핑크스 도서 테마" + +msgid "suggest edit" +msgstr "편집 제안" + +msgid "Open an issue" +msgstr "이슈 열기" + +msgid "Launch" +msgstr "시작하다" + +msgid "Fullscreen mode" +msgstr "전체 화면으로보기" + +msgid "Edit this page" +msgstr "이 페이지 편집" + +msgid "By the" +msgstr "에 의해" + +msgid "next page" +msgstr "다음 페이지" diff --git a/_static/locales/lt/LC_MESSAGES/booktheme.mo b/_static/locales/lt/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..4468ba04 Binary files /dev/null and b/_static/locales/lt/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/lt/LC_MESSAGES/booktheme.po b/_static/locales/lt/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..35eabd95 --- /dev/null +++ b/_static/locales/lt/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: lt\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Spausdinti į PDF" + +msgid "Theme by the" +msgstr "Tema" + +msgid "Download source file" +msgstr "Atsisiųsti šaltinio failą" + +msgid "open issue" +msgstr "atviras klausimas" + +msgid "Contents" +msgstr "Turinys" + +msgid "previous page" +msgstr "Ankstesnis puslapis" + +msgid "Download notebook file" +msgstr "Atsisiųsti nešiojamojo kompiuterio failą" + +msgid "Copyright" +msgstr "Autorių teisės" + +msgid "Download this page" +msgstr "Atsisiųskite šį puslapį" + +msgid "Source repository" +msgstr "Šaltinio saugykla" + +msgid "By" +msgstr "Iki" + +msgid "repository" +msgstr "saugykla" + +msgid "Last updated on" +msgstr "Paskutinį kartą atnaujinta" + +msgid "Toggle navigation" +msgstr "Perjungti naršymą" + +msgid "Sphinx Book Theme" +msgstr "Sfinkso knygos tema" + +msgid "suggest edit" +msgstr "pasiūlyti redaguoti" + +msgid "Open an issue" +msgstr "Atidarykite problemą" + +msgid "Launch" +msgstr "Paleiskite" + +msgid "Fullscreen mode" +msgstr "Pilno ekrano režimas" + +msgid "Edit this page" +msgstr "Redaguoti šį puslapį" + +msgid "By the" +msgstr "Prie" + +msgid "next page" +msgstr "Kitas puslapis" diff --git a/_static/locales/lv/LC_MESSAGES/booktheme.mo b/_static/locales/lv/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..74aa4d89 Binary files /dev/null and b/_static/locales/lv/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/lv/LC_MESSAGES/booktheme.po b/_static/locales/lv/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..ee1bd08d --- /dev/null +++ b/_static/locales/lv/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: lv\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Drukāt PDF formātā" + +msgid "Theme by the" +msgstr "Autora tēma" + +msgid "Download source file" +msgstr "Lejupielādēt avota failu" + +msgid "open issue" +msgstr "atklāts jautājums" + +msgid "Contents" +msgstr "Saturs" + +msgid "previous page" +msgstr "iepriekšējā lapa" + +msgid "Download notebook file" +msgstr "Lejupielādēt piezīmju grāmatiņu" + +msgid "Copyright" +msgstr "Autortiesības" + +msgid "Download this page" +msgstr "Lejupielādējiet šo lapu" + +msgid "Source repository" +msgstr "Avota krātuve" + +msgid "By" +msgstr "Autors" + +msgid "repository" +msgstr "krātuve" + +msgid "Last updated on" +msgstr "Pēdējoreiz atjaunināts" + +msgid "Toggle navigation" +msgstr "Pārslēgt navigāciju" + +msgid "Sphinx Book Theme" +msgstr "Sfinksa grāmatas tēma" + +msgid "suggest edit" +msgstr "ieteikt rediģēt" + +msgid "Open an issue" +msgstr "Atveriet problēmu" + +msgid "Launch" +msgstr "Uzsākt" + +msgid "Fullscreen mode" +msgstr "Pilnekrāna režīms" + +msgid "Edit this page" +msgstr "Rediģēt šo lapu" + +msgid "By the" +msgstr "Ar" + +msgid "next page" +msgstr "nākamā lapaspuse" diff --git a/_static/locales/ml/LC_MESSAGES/booktheme.mo b/_static/locales/ml/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..2736e8fc Binary files /dev/null and b/_static/locales/ml/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ml/LC_MESSAGES/booktheme.po b/_static/locales/ml/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..d471277d --- /dev/null +++ b/_static/locales/ml/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ml\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF- ലേക്ക് പ്രിന്റുചെയ്യുക" + +msgid "Theme by the" +msgstr "പ്രമേയം" + +msgid "Download source file" +msgstr "ഉറവിട ഫയൽ ഡൗൺലോഡുചെയ്യുക" + +msgid "open issue" +msgstr "തുറന്ന പ്രശ്നം" + +msgid "previous page" +msgstr "മുൻപത്തെ താൾ" + +msgid "Download notebook file" +msgstr "നോട്ട്ബുക്ക് ഫയൽ ഡൺലോഡ് ചെയ്യുക" + +msgid "Copyright" +msgstr "പകർപ്പവകാശം" + +msgid "Download this page" +msgstr "ഈ പേജ് ഡൗൺലോഡുചെയ്യുക" + +msgid "Source repository" +msgstr "ഉറവിട ശേഖരം" + +msgid "By" +msgstr "എഴുതിയത്" + +msgid "Last updated on" +msgstr "അവസാനം അപ്‌ഡേറ്റുചെയ്‌തത്" + +msgid "Toggle navigation" +msgstr "നാവിഗേഷൻ ടോഗിൾ ചെയ്യുക" + +msgid "Sphinx Book Theme" +msgstr "സ്ഫിങ്ക്സ് പുസ്തക തീം" + +msgid "suggest edit" +msgstr "എഡിറ്റുചെയ്യാൻ നിർദ്ദേശിക്കുക" + +msgid "Open an issue" +msgstr "ഒരു പ്രശ്നം തുറക്കുക" + +msgid "Launch" +msgstr "സമാരംഭിക്കുക" + +msgid "Edit this page" +msgstr "ഈ പേജ് എഡിറ്റുചെയ്യുക" + +msgid "By the" +msgstr "എഴുതിയത്" + +msgid "next page" +msgstr "അടുത്ത പേജ്" diff --git a/_static/locales/mr/LC_MESSAGES/booktheme.mo b/_static/locales/mr/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..fe530100 Binary files /dev/null and b/_static/locales/mr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/mr/LC_MESSAGES/booktheme.po b/_static/locales/mr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..f3694acf --- /dev/null +++ b/_static/locales/mr/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: mr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "पीडीएफवर मुद्रित करा" + +msgid "Theme by the" +msgstr "द्वारा थीम" + +msgid "Download source file" +msgstr "स्त्रोत फाइल डाउनलोड करा" + +msgid "open issue" +msgstr "खुला मुद्दा" + +msgid "previous page" +msgstr "मागील पान" + +msgid "Download notebook file" +msgstr "नोटबुक फाईल डाउनलोड करा" + +msgid "Copyright" +msgstr "कॉपीराइट" + +msgid "Download this page" +msgstr "हे पृष्ठ डाउनलोड करा" + +msgid "Source repository" +msgstr "स्त्रोत भांडार" + +msgid "By" +msgstr "द्वारा" + +msgid "Last updated on" +msgstr "अखेरचे अद्यतनित" + +msgid "Toggle navigation" +msgstr "नेव्हिगेशन टॉगल करा" + +msgid "Sphinx Book Theme" +msgstr "स्फिंक्स बुक थीम" + +msgid "suggest edit" +msgstr "संपादन सुचवा" + +msgid "Open an issue" +msgstr "एक मुद्दा उघडा" + +msgid "Launch" +msgstr "लाँच करा" + +msgid "Edit this page" +msgstr "हे पृष्ठ संपादित करा" + +msgid "By the" +msgstr "द्वारा" + +msgid "next page" +msgstr "पुढील पृष्ठ" diff --git a/_static/locales/ms/LC_MESSAGES/booktheme.mo b/_static/locales/ms/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..f02603fa Binary files /dev/null and b/_static/locales/ms/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ms/LC_MESSAGES/booktheme.po b/_static/locales/ms/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..65b7c602 --- /dev/null +++ b/_static/locales/ms/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ms\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Cetak ke PDF" + +msgid "Theme by the" +msgstr "Tema oleh" + +msgid "Download source file" +msgstr "Muat turun fail sumber" + +msgid "open issue" +msgstr "isu terbuka" + +msgid "previous page" +msgstr "halaman sebelumnya" + +msgid "Download notebook file" +msgstr "Muat turun fail buku nota" + +msgid "Copyright" +msgstr "hak cipta" + +msgid "Download this page" +msgstr "Muat turun halaman ini" + +msgid "Source repository" +msgstr "Repositori sumber" + +msgid "By" +msgstr "Oleh" + +msgid "Last updated on" +msgstr "Terakhir dikemas kini pada" + +msgid "Toggle navigation" +msgstr "Togol navigasi" + +msgid "Sphinx Book Theme" +msgstr "Tema Buku Sphinx" + +msgid "suggest edit" +msgstr "cadangkan edit" + +msgid "Open an issue" +msgstr "Buka masalah" + +msgid "Launch" +msgstr "Lancarkan" + +msgid "Edit this page" +msgstr "Edit halaman ini" + +msgid "By the" +msgstr "Oleh" + +msgid "next page" +msgstr "muka surat seterusnya" diff --git a/_static/locales/nl/LC_MESSAGES/booktheme.mo b/_static/locales/nl/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..e59e7ecb Binary files /dev/null and b/_static/locales/nl/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/nl/LC_MESSAGES/booktheme.po b/_static/locales/nl/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..71bd1cda --- /dev/null +++ b/_static/locales/nl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: nl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Afdrukken naar pdf" + +msgid "Theme by the" +msgstr "Thema door de" + +msgid "Download source file" +msgstr "Download het bronbestand" + +msgid "open issue" +msgstr "open probleem" + +msgid "Contents" +msgstr "Inhoud" + +msgid "previous page" +msgstr "vorige pagina" + +msgid "Download notebook file" +msgstr "Download notebookbestand" + +msgid "Copyright" +msgstr "auteursrechten" + +msgid "Download this page" +msgstr "Download deze pagina" + +msgid "Source repository" +msgstr "Bronopslagplaats" + +msgid "By" +msgstr "Door" + +msgid "repository" +msgstr "repository" + +msgid "Last updated on" +msgstr "Laatst geupdate op" + +msgid "Toggle navigation" +msgstr "Schakel navigatie" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-boekthema" + +msgid "suggest edit" +msgstr "suggereren bewerken" + +msgid "Open an issue" +msgstr "Open een probleem" + +msgid "Launch" +msgstr "Lancering" + +msgid "Fullscreen mode" +msgstr "Volledig scherm" + +msgid "Edit this page" +msgstr "bewerk deze pagina" + +msgid "By the" +msgstr "Door de" + +msgid "next page" +msgstr "volgende bladzijde" diff --git a/_static/locales/no/LC_MESSAGES/booktheme.mo b/_static/locales/no/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..6cd15c88 Binary files /dev/null and b/_static/locales/no/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/no/LC_MESSAGES/booktheme.po b/_static/locales/no/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..b21346a5 --- /dev/null +++ b/_static/locales/no/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: no\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Skriv ut til PDF" + +msgid "Theme by the" +msgstr "Tema av" + +msgid "Download source file" +msgstr "Last ned kildefilen" + +msgid "open issue" +msgstr "åpent nummer" + +msgid "Contents" +msgstr "Innhold" + +msgid "previous page" +msgstr "forrige side" + +msgid "Download notebook file" +msgstr "Last ned notatbokfilen" + +msgid "Copyright" +msgstr "opphavsrett" + +msgid "Download this page" +msgstr "Last ned denne siden" + +msgid "Source repository" +msgstr "Kildedepot" + +msgid "By" +msgstr "Av" + +msgid "repository" +msgstr "oppbevaringssted" + +msgid "Last updated on" +msgstr "Sist oppdatert den" + +msgid "Toggle navigation" +msgstr "Bytt navigasjon" + +msgid "Sphinx Book Theme" +msgstr "Sphinx boktema" + +msgid "suggest edit" +msgstr "foreslå redigering" + +msgid "Open an issue" +msgstr "Åpne et problem" + +msgid "Launch" +msgstr "Start" + +msgid "Fullscreen mode" +msgstr "Fullskjerm-modus" + +msgid "Edit this page" +msgstr "Rediger denne siden" + +msgid "By the" +msgstr "Ved" + +msgid "next page" +msgstr "neste side" diff --git a/_static/locales/pl/LC_MESSAGES/booktheme.mo b/_static/locales/pl/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..9ebb584f Binary files /dev/null and b/_static/locales/pl/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/pl/LC_MESSAGES/booktheme.po b/_static/locales/pl/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..1b7233f4 --- /dev/null +++ b/_static/locales/pl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: pl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Drukuj do PDF" + +msgid "Theme by the" +msgstr "Motyw autorstwa" + +msgid "Download source file" +msgstr "Pobierz plik źródłowy" + +msgid "open issue" +msgstr "otwarty problem" + +msgid "Contents" +msgstr "Zawartość" + +msgid "previous page" +msgstr "Poprzednia strona" + +msgid "Download notebook file" +msgstr "Pobierz plik notatnika" + +msgid "Copyright" +msgstr "prawa autorskie" + +msgid "Download this page" +msgstr "Pobierz tę stronę" + +msgid "Source repository" +msgstr "Repozytorium źródłowe" + +msgid "By" +msgstr "Przez" + +msgid "repository" +msgstr "magazyn" + +msgid "Last updated on" +msgstr "Ostatnia aktualizacja" + +msgid "Toggle navigation" +msgstr "Przełącz nawigację" + +msgid "Sphinx Book Theme" +msgstr "Motyw książki Sphinx" + +msgid "suggest edit" +msgstr "zaproponuj edycję" + +msgid "Open an issue" +msgstr "Otwórz problem" + +msgid "Launch" +msgstr "Uruchomić" + +msgid "Fullscreen mode" +msgstr "Pełny ekran" + +msgid "Edit this page" +msgstr "Edytuj tę strone" + +msgid "By the" +msgstr "Przez" + +msgid "next page" +msgstr "Następna strona" diff --git a/_static/locales/pt/LC_MESSAGES/booktheme.mo b/_static/locales/pt/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..d0ddb872 Binary files /dev/null and b/_static/locales/pt/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/pt/LC_MESSAGES/booktheme.po b/_static/locales/pt/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..1b27314d --- /dev/null +++ b/_static/locales/pt/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: pt\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimir em PDF" + +msgid "Theme by the" +msgstr "Tema por" + +msgid "Download source file" +msgstr "Baixar arquivo fonte" + +msgid "open issue" +msgstr "questão aberta" + +msgid "Contents" +msgstr "Conteúdo" + +msgid "previous page" +msgstr "página anterior" + +msgid "Download notebook file" +msgstr "Baixar arquivo de notebook" + +msgid "Copyright" +msgstr "direito autoral" + +msgid "Download this page" +msgstr "Baixe esta página" + +msgid "Source repository" +msgstr "Repositório fonte" + +msgid "By" +msgstr "De" + +msgid "repository" +msgstr "repositório" + +msgid "Last updated on" +msgstr "Última atualização em" + +msgid "Toggle navigation" +msgstr "Alternar de navegação" + +msgid "Sphinx Book Theme" +msgstr "Tema do livro Sphinx" + +msgid "suggest edit" +msgstr "sugerir edição" + +msgid "Open an issue" +msgstr "Abra um problema" + +msgid "Launch" +msgstr "Lançamento" + +msgid "Fullscreen mode" +msgstr "Modo tela cheia" + +msgid "Edit this page" +msgstr "Edite essa página" + +msgid "By the" +msgstr "Pelo" + +msgid "next page" +msgstr "próxima página" diff --git a/_static/locales/ro/LC_MESSAGES/booktheme.mo b/_static/locales/ro/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..3c36ab1d Binary files /dev/null and b/_static/locales/ro/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ro/LC_MESSAGES/booktheme.po b/_static/locales/ro/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..1783ad2c --- /dev/null +++ b/_static/locales/ro/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ro\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Imprimați în PDF" + +msgid "Theme by the" +msgstr "Tema de" + +msgid "Download source file" +msgstr "Descărcați fișierul sursă" + +msgid "open issue" +msgstr "problema deschisă" + +msgid "Contents" +msgstr "Cuprins" + +msgid "previous page" +msgstr "pagina anterioară" + +msgid "Download notebook file" +msgstr "Descărcați fișierul notebook" + +msgid "Copyright" +msgstr "Drepturi de autor" + +msgid "Download this page" +msgstr "Descarcă această pagină" + +msgid "Source repository" +msgstr "Depozit sursă" + +msgid "By" +msgstr "De" + +msgid "repository" +msgstr "repertoriu" + +msgid "Last updated on" +msgstr "Ultima actualizare la" + +msgid "Toggle navigation" +msgstr "Comutare navigare" + +msgid "Sphinx Book Theme" +msgstr "Tema Sphinx Book" + +msgid "suggest edit" +msgstr "sugerează editare" + +msgid "Open an issue" +msgstr "Deschideți o problemă" + +msgid "Launch" +msgstr "Lansa" + +msgid "Fullscreen mode" +msgstr "Modul ecran întreg" + +msgid "Edit this page" +msgstr "Editați această pagină" + +msgid "By the" +msgstr "Langa" + +msgid "next page" +msgstr "pagina următoare" diff --git a/_static/locales/ru/LC_MESSAGES/booktheme.mo b/_static/locales/ru/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..6b8ca41f Binary files /dev/null and b/_static/locales/ru/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ru/LC_MESSAGES/booktheme.po b/_static/locales/ru/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..b1176b7a --- /dev/null +++ b/_static/locales/ru/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ru\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Распечатать в PDF" + +msgid "Theme by the" +msgstr "Тема от" + +msgid "Download source file" +msgstr "Скачать исходный файл" + +msgid "open issue" +msgstr "открытый вопрос" + +msgid "Contents" +msgstr "Содержание" + +msgid "previous page" +msgstr "Предыдущая страница" + +msgid "Download notebook file" +msgstr "Скачать файл записной книжки" + +msgid "Copyright" +msgstr "авторское право" + +msgid "Download this page" +msgstr "Загрузите эту страницу" + +msgid "Source repository" +msgstr "Исходный репозиторий" + +msgid "By" +msgstr "По" + +msgid "repository" +msgstr "хранилище" + +msgid "Last updated on" +msgstr "Последнее обновление" + +msgid "Toggle navigation" +msgstr "Переключить навигацию" + +msgid "Sphinx Book Theme" +msgstr "Тема книги Сфинкс" + +msgid "suggest edit" +msgstr "предложить редактировать" + +msgid "Open an issue" +msgstr "Открыть вопрос" + +msgid "Launch" +msgstr "Запуск" + +msgid "Fullscreen mode" +msgstr "Полноэкранный режим" + +msgid "Edit this page" +msgstr "Редактировать эту страницу" + +msgid "By the" +msgstr "Посредством" + +msgid "next page" +msgstr "Следующая страница" diff --git a/_static/locales/sk/LC_MESSAGES/booktheme.mo b/_static/locales/sk/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..59bd0ddf Binary files /dev/null and b/_static/locales/sk/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/sk/LC_MESSAGES/booktheme.po b/_static/locales/sk/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..65012881 --- /dev/null +++ b/_static/locales/sk/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sk\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Tlač do PDF" + +msgid "Theme by the" +msgstr "Téma od" + +msgid "Download source file" +msgstr "Stiahnite si zdrojový súbor" + +msgid "open issue" +msgstr "otvorené vydanie" + +msgid "Contents" +msgstr "Obsah" + +msgid "previous page" +msgstr "predchádzajúca strana" + +msgid "Download notebook file" +msgstr "Stiahnite si zošit" + +msgid "Copyright" +msgstr "Autorské práva" + +msgid "Download this page" +msgstr "Stiahnite si túto stránku" + +msgid "Source repository" +msgstr "Zdrojové úložisko" + +msgid "By" +msgstr "Autor:" + +msgid "repository" +msgstr "Úložisko" + +msgid "Last updated on" +msgstr "Posledná aktualizácia dňa" + +msgid "Toggle navigation" +msgstr "Prepnúť navigáciu" + +msgid "Sphinx Book Theme" +msgstr "Téma knihy Sfinga" + +msgid "suggest edit" +msgstr "navrhnúť úpravu" + +msgid "Open an issue" +msgstr "Otvorte problém" + +msgid "Launch" +msgstr "Spustiť" + +msgid "Fullscreen mode" +msgstr "Režim celej obrazovky" + +msgid "Edit this page" +msgstr "Upraviť túto stránku" + +msgid "By the" +msgstr "Podľa" + +msgid "next page" +msgstr "ďalšia strana" diff --git a/_static/locales/sl/LC_MESSAGES/booktheme.mo b/_static/locales/sl/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..87bf26de Binary files /dev/null and b/_static/locales/sl/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/sl/LC_MESSAGES/booktheme.po b/_static/locales/sl/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..3c7e3a86 --- /dev/null +++ b/_static/locales/sl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Natisni v PDF" + +msgid "Theme by the" +msgstr "Tema avtorja" + +msgid "Download source file" +msgstr "Prenesite izvorno datoteko" + +msgid "open issue" +msgstr "odprto vprašanje" + +msgid "Contents" +msgstr "Vsebina" + +msgid "previous page" +msgstr "Prejšnja stran" + +msgid "Download notebook file" +msgstr "Prenesite datoteko zvezka" + +msgid "Copyright" +msgstr "avtorske pravice" + +msgid "Download this page" +msgstr "Prenesite to stran" + +msgid "Source repository" +msgstr "Izvorno skladišče" + +msgid "By" +msgstr "Avtor" + +msgid "repository" +msgstr "odlagališče" + +msgid "Last updated on" +msgstr "Nazadnje posodobljeno dne" + +msgid "Toggle navigation" +msgstr "Preklopi navigacijo" + +msgid "Sphinx Book Theme" +msgstr "Tema knjige Sphinx" + +msgid "suggest edit" +msgstr "predlagajte urejanje" + +msgid "Open an issue" +msgstr "Odprite številko" + +msgid "Launch" +msgstr "Kosilo" + +msgid "Fullscreen mode" +msgstr "Celozaslonski način" + +msgid "Edit this page" +msgstr "Uredite to stran" + +msgid "By the" +msgstr "Avtor" + +msgid "next page" +msgstr "Naslednja stran" diff --git a/_static/locales/sr/LC_MESSAGES/booktheme.mo b/_static/locales/sr/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..ec740f48 Binary files /dev/null and b/_static/locales/sr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/sr/LC_MESSAGES/booktheme.po b/_static/locales/sr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..773b8ada --- /dev/null +++ b/_static/locales/sr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Испис у ПДФ" + +msgid "Theme by the" +msgstr "Тхеме би" + +msgid "Download source file" +msgstr "Преузми изворну датотеку" + +msgid "open issue" +msgstr "отворено издање" + +msgid "Contents" +msgstr "Садржај" + +msgid "previous page" +msgstr "Претходна страница" + +msgid "Download notebook file" +msgstr "Преузмите датотеку бележнице" + +msgid "Copyright" +msgstr "Ауторско право" + +msgid "Download this page" +msgstr "Преузмите ову страницу" + +msgid "Source repository" +msgstr "Изворно спремиште" + +msgid "By" +msgstr "Од стране" + +msgid "repository" +msgstr "спремиште" + +msgid "Last updated on" +msgstr "Последње ажурирање" + +msgid "Toggle navigation" +msgstr "Укључи / искључи навигацију" + +msgid "Sphinx Book Theme" +msgstr "Тема књиге Спхинк" + +msgid "suggest edit" +msgstr "предложи уређивање" + +msgid "Open an issue" +msgstr "Отворите издање" + +msgid "Launch" +msgstr "Лансирање" + +msgid "Fullscreen mode" +msgstr "Режим целог екрана" + +msgid "Edit this page" +msgstr "Уредите ову страницу" + +msgid "By the" +msgstr "Од" + +msgid "next page" +msgstr "Следећа страна" diff --git a/_static/locales/sv/LC_MESSAGES/booktheme.mo b/_static/locales/sv/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..b07dc76f Binary files /dev/null and b/_static/locales/sv/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/sv/LC_MESSAGES/booktheme.po b/_static/locales/sv/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..bcac54c0 --- /dev/null +++ b/_static/locales/sv/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sv\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Skriv ut till PDF" + +msgid "Theme by the" +msgstr "Tema av" + +msgid "Download source file" +msgstr "Ladda ner källfil" + +msgid "open issue" +msgstr "öppna problemrapport" + +msgid "Contents" +msgstr "Innehåll" + +msgid "previous page" +msgstr "föregående sida" + +msgid "Download notebook file" +msgstr "Ladda ner notebook-fil" + +msgid "Copyright" +msgstr "Upphovsrätt" + +msgid "Download this page" +msgstr "Ladda ner den här sidan" + +msgid "Source repository" +msgstr "Källkodsrepositorium" + +msgid "By" +msgstr "Av" + +msgid "repository" +msgstr "repositorium" + +msgid "Last updated on" +msgstr "Senast uppdaterad den" + +msgid "Toggle navigation" +msgstr "Växla navigering" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Boktema" + +msgid "suggest edit" +msgstr "föreslå ändring" + +msgid "Open an issue" +msgstr "Öppna en problemrapport" + +msgid "Launch" +msgstr "Öppna" + +msgid "Fullscreen mode" +msgstr "Fullskärmsläge" + +msgid "Edit this page" +msgstr "Redigera den här sidan" + +msgid "By the" +msgstr "Av den" + +msgid "next page" +msgstr "nästa sida" diff --git a/_static/locales/ta/LC_MESSAGES/booktheme.mo b/_static/locales/ta/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..29f52e1f Binary files /dev/null and b/_static/locales/ta/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ta/LC_MESSAGES/booktheme.po b/_static/locales/ta/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..b48bdfaf --- /dev/null +++ b/_static/locales/ta/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ta\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF இல் அச்சிடுக" + +msgid "Theme by the" +msgstr "வழங்கிய தீம்" + +msgid "Download source file" +msgstr "மூல கோப்பைப் பதிவிறக்குக" + +msgid "open issue" +msgstr "திறந்த பிரச்சினை" + +msgid "previous page" +msgstr "முந்தைய பக்கம்" + +msgid "Download notebook file" +msgstr "நோட்புக் கோப்பைப் பதிவிறக்கவும்" + +msgid "Copyright" +msgstr "பதிப்புரிமை" + +msgid "Download this page" +msgstr "இந்தப் பக்கத்தைப் பதிவிறக்கவும்" + +msgid "Source repository" +msgstr "மூல களஞ்சியம்" + +msgid "By" +msgstr "வழங்கியவர்" + +msgid "Last updated on" +msgstr "கடைசியாக புதுப்பிக்கப்பட்டது" + +msgid "Toggle navigation" +msgstr "வழிசெலுத்தலை நிலைமாற்று" + +msgid "Sphinx Book Theme" +msgstr "ஸ்பிங்க்ஸ் புத்தக தீம்" + +msgid "suggest edit" +msgstr "திருத்த பரிந்துரைக்கவும்" + +msgid "Open an issue" +msgstr "சிக்கலைத் திறக்கவும்" + +msgid "Launch" +msgstr "தொடங்க" + +msgid "Edit this page" +msgstr "இந்தப் பக்கத்தைத் திருத்தவும்" + +msgid "By the" +msgstr "மூலம்" + +msgid "next page" +msgstr "அடுத்த பக்கம்" diff --git a/_static/locales/te/LC_MESSAGES/booktheme.mo b/_static/locales/te/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..0a5f4b46 Binary files /dev/null and b/_static/locales/te/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/te/LC_MESSAGES/booktheme.po b/_static/locales/te/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..952278f5 --- /dev/null +++ b/_static/locales/te/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: te\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF కి ముద్రించండి" + +msgid "Theme by the" +msgstr "ద్వారా థీమ్" + +msgid "Download source file" +msgstr "మూల ఫైల్‌ను డౌన్‌లోడ్ చేయండి" + +msgid "open issue" +msgstr "ఓపెన్ ఇష్యూ" + +msgid "previous page" +msgstr "ముందు పేజి" + +msgid "Download notebook file" +msgstr "నోట్బుక్ ఫైల్ను డౌన్లోడ్ చేయండి" + +msgid "Copyright" +msgstr "కాపీరైట్" + +msgid "Download this page" +msgstr "ఈ పేజీని డౌన్‌లోడ్ చేయండి" + +msgid "Source repository" +msgstr "మూల రిపోజిటరీ" + +msgid "By" +msgstr "ద్వారా" + +msgid "Last updated on" +msgstr "చివరిగా నవీకరించబడింది" + +msgid "Toggle navigation" +msgstr "నావిగేషన్‌ను టోగుల్ చేయండి" + +msgid "Sphinx Book Theme" +msgstr "సింహిక పుస్తక థీమ్" + +msgid "suggest edit" +msgstr "సవరించమని సూచించండి" + +msgid "Open an issue" +msgstr "సమస్యను తెరవండి" + +msgid "Launch" +msgstr "ప్రారంభించండి" + +msgid "Edit this page" +msgstr "ఈ పేజీని సవరించండి" + +msgid "By the" +msgstr "ద్వారా" + +msgid "next page" +msgstr "తరువాతి పేజీ" diff --git a/_static/locales/tg/LC_MESSAGES/booktheme.mo b/_static/locales/tg/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..b21c6c63 Binary files /dev/null and b/_static/locales/tg/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/tg/LC_MESSAGES/booktheme.po b/_static/locales/tg/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..c33dc421 --- /dev/null +++ b/_static/locales/tg/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tg\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Чоп ба PDF" + +msgid "Theme by the" +msgstr "Мавзӯъи аз" + +msgid "Download source file" +msgstr "Файли манбаъро зеркашӣ кунед" + +msgid "open issue" +msgstr "барориши кушод" + +msgid "Contents" +msgstr "Мундариҷа" + +msgid "previous page" +msgstr "саҳифаи қаблӣ" + +msgid "Download notebook file" +msgstr "Файли дафтарро зеркашӣ кунед" + +msgid "Copyright" +msgstr "Ҳуқуқи муаллиф" + +msgid "Download this page" +msgstr "Ин саҳифаро зеркашӣ кунед" + +msgid "Source repository" +msgstr "Анбори манбаъ" + +msgid "By" +msgstr "Бо" + +msgid "repository" +msgstr "анбор" + +msgid "Last updated on" +msgstr "Last навсозӣ дар" + +msgid "Toggle navigation" +msgstr "Гузаришро иваз кунед" + +msgid "Sphinx Book Theme" +msgstr "Сфинкс Мавзӯи китоб" + +msgid "suggest edit" +msgstr "пешниҳод вироиш" + +msgid "Open an issue" +msgstr "Масъаларо кушоед" + +msgid "Launch" +msgstr "Оғоз" + +msgid "Fullscreen mode" +msgstr "Ҳолати экрани пурра" + +msgid "Edit this page" +msgstr "Ин саҳифаро таҳрир кунед" + +msgid "By the" +msgstr "Бо" + +msgid "next page" +msgstr "саҳифаи оянда" diff --git a/_static/locales/th/LC_MESSAGES/booktheme.mo b/_static/locales/th/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..abede98a Binary files /dev/null and b/_static/locales/th/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/th/LC_MESSAGES/booktheme.po b/_static/locales/th/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..9d24294a --- /dev/null +++ b/_static/locales/th/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: th\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "พิมพ์เป็น PDF" + +msgid "Theme by the" +msgstr "ธีมโดย" + +msgid "Download source file" +msgstr "ดาวน์โหลดไฟล์ต้นฉบับ" + +msgid "open issue" +msgstr "เปิดปัญหา" + +msgid "Contents" +msgstr "สารบัญ" + +msgid "previous page" +msgstr "หน้าที่แล้ว" + +msgid "Download notebook file" +msgstr "ดาวน์โหลดไฟล์สมุดบันทึก" + +msgid "Copyright" +msgstr "ลิขสิทธิ์" + +msgid "Download this page" +msgstr "ดาวน์โหลดหน้านี้" + +msgid "Source repository" +msgstr "ที่เก็บซอร์ส" + +msgid "By" +msgstr "โดย" + +msgid "repository" +msgstr "ที่เก็บ" + +msgid "Last updated on" +msgstr "ปรับปรุงล่าสุดเมื่อ" + +msgid "Toggle navigation" +msgstr "ไม่ต้องสลับช่องทาง" + +msgid "Sphinx Book Theme" +msgstr "ธีมหนังสือสฟิงซ์" + +msgid "suggest edit" +msgstr "แนะนำแก้ไข" + +msgid "Open an issue" +msgstr "เปิดปัญหา" + +msgid "Launch" +msgstr "เปิด" + +msgid "Fullscreen mode" +msgstr "โหมดเต็มหน้าจอ" + +msgid "Edit this page" +msgstr "แก้ไขหน้านี้" + +msgid "By the" +msgstr "โดย" + +msgid "next page" +msgstr "หน้าต่อไป" diff --git a/_static/locales/tl/LC_MESSAGES/booktheme.mo b/_static/locales/tl/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..8df1b733 Binary files /dev/null and b/_static/locales/tl/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/tl/LC_MESSAGES/booktheme.po b/_static/locales/tl/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..20e0d07c --- /dev/null +++ b/_static/locales/tl/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "I-print sa PDF" + +msgid "Theme by the" +msgstr "Tema ng" + +msgid "Download source file" +msgstr "Mag-download ng file ng pinagmulan" + +msgid "open issue" +msgstr "bukas na isyu" + +msgid "previous page" +msgstr "Nakaraang pahina" + +msgid "Download notebook file" +msgstr "Mag-download ng file ng notebook" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download this page" +msgstr "I-download ang pahinang ito" + +msgid "Source repository" +msgstr "Pinagmulan ng imbakan" + +msgid "By" +msgstr "Ni" + +msgid "Last updated on" +msgstr "Huling na-update noong" + +msgid "Toggle navigation" +msgstr "I-toggle ang pag-navigate" + +msgid "Sphinx Book Theme" +msgstr "Tema ng Sphinx Book" + +msgid "suggest edit" +msgstr "iminumungkahi i-edit" + +msgid "Open an issue" +msgstr "Magbukas ng isyu" + +msgid "Launch" +msgstr "Ilunsad" + +msgid "Edit this page" +msgstr "I-edit ang pahinang ito" + +msgid "By the" +msgstr "Sa pamamagitan ng" + +msgid "next page" +msgstr "Susunod na pahina" diff --git a/_static/locales/tr/LC_MESSAGES/booktheme.mo b/_static/locales/tr/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..029ae18a Binary files /dev/null and b/_static/locales/tr/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/tr/LC_MESSAGES/booktheme.po b/_static/locales/tr/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..a77eb027 --- /dev/null +++ b/_static/locales/tr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "PDF olarak yazdır" + +msgid "Theme by the" +msgstr "Tarafından tema" + +msgid "Download source file" +msgstr "Kaynak dosyayı indirin" + +msgid "open issue" +msgstr "Açık konu" + +msgid "Contents" +msgstr "İçindekiler" + +msgid "previous page" +msgstr "önceki sayfa" + +msgid "Download notebook file" +msgstr "Defter dosyasını indirin" + +msgid "Copyright" +msgstr "Telif hakkı" + +msgid "Download this page" +msgstr "Bu sayfayı indirin" + +msgid "Source repository" +msgstr "Kaynak kod deposu" + +msgid "By" +msgstr "Tarafından" + +msgid "repository" +msgstr "depo" + +msgid "Last updated on" +msgstr "Son güncelleme tarihi" + +msgid "Toggle navigation" +msgstr "Gezinmeyi değiştir" + +msgid "Sphinx Book Theme" +msgstr "Sfenks Kitap Teması" + +msgid "suggest edit" +msgstr "düzenleme öner" + +msgid "Open an issue" +msgstr "Bir sorunu açın" + +msgid "Launch" +msgstr "Başlatmak" + +msgid "Fullscreen mode" +msgstr "Tam ekran modu" + +msgid "Edit this page" +msgstr "Bu sayfayı düzenle" + +msgid "By the" +msgstr "Tarafından" + +msgid "next page" +msgstr "sonraki Sayfa" diff --git a/_static/locales/uk/LC_MESSAGES/booktheme.mo b/_static/locales/uk/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..16ab7890 Binary files /dev/null and b/_static/locales/uk/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/uk/LC_MESSAGES/booktheme.po b/_static/locales/uk/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..993dd078 --- /dev/null +++ b/_static/locales/uk/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: uk\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "Друк у форматі PDF" + +msgid "Theme by the" +msgstr "Тема від" + +msgid "Download source file" +msgstr "Завантажити вихідний файл" + +msgid "open issue" +msgstr "відкритий випуск" + +msgid "Contents" +msgstr "Зміст" + +msgid "previous page" +msgstr "Попередня сторінка" + +msgid "Download notebook file" +msgstr "Завантажте файл блокнота" + +msgid "Copyright" +msgstr "Авторське право" + +msgid "Download this page" +msgstr "Завантажте цю сторінку" + +msgid "Source repository" +msgstr "Джерело сховища" + +msgid "By" +msgstr "Автор" + +msgid "repository" +msgstr "сховище" + +msgid "Last updated on" +msgstr "Останнє оновлення:" + +msgid "Toggle navigation" +msgstr "Переключити навігацію" + +msgid "Sphinx Book Theme" +msgstr "Тема книги \"Сфінкс\"" + +msgid "suggest edit" +msgstr "запропонувати редагувати" + +msgid "Open an issue" +msgstr "Відкрийте випуск" + +msgid "Launch" +msgstr "Запуск" + +msgid "Fullscreen mode" +msgstr "Повноекранний режим" + +msgid "Edit this page" +msgstr "Редагувати цю сторінку" + +msgid "By the" +msgstr "По" + +msgid "next page" +msgstr "Наступна сторінка" diff --git a/_static/locales/ur/LC_MESSAGES/booktheme.mo b/_static/locales/ur/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..de8c84b9 Binary files /dev/null and b/_static/locales/ur/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/ur/LC_MESSAGES/booktheme.po b/_static/locales/ur/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..2f774267 --- /dev/null +++ b/_static/locales/ur/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ur\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "پی ڈی ایف پرنٹ کریں" + +msgid "Theme by the" +msgstr "کے ذریعہ تھیم" + +msgid "Download source file" +msgstr "سورس فائل ڈاؤن لوڈ کریں" + +msgid "open issue" +msgstr "کھلا مسئلہ" + +msgid "previous page" +msgstr "سابقہ ​​صفحہ" + +msgid "Download notebook file" +msgstr "نوٹ بک فائل ڈاؤن لوڈ کریں" + +msgid "Copyright" +msgstr "کاپی رائٹ" + +msgid "Download this page" +msgstr "اس صفحے کو ڈاؤن لوڈ کریں" + +msgid "Source repository" +msgstr "ماخذ ذخیرہ" + +msgid "By" +msgstr "بذریعہ" + +msgid "Last updated on" +msgstr "آخری بار تازہ کاری ہوئی" + +msgid "Toggle navigation" +msgstr "نیویگیشن ٹوگل کریں" + +msgid "Sphinx Book Theme" +msgstr "سپنکس بک تھیم" + +msgid "suggest edit" +msgstr "ترمیم کی تجویز کریں" + +msgid "Open an issue" +msgstr "ایک مسئلہ کھولیں" + +msgid "Launch" +msgstr "لانچ کریں" + +msgid "Edit this page" +msgstr "اس صفحے میں ترمیم کریں" + +msgid "By the" +msgstr "کی طرف" + +msgid "next page" +msgstr "اگلا صفحہ" diff --git a/_static/locales/vi/LC_MESSAGES/booktheme.mo b/_static/locales/vi/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..2bb32555 Binary files /dev/null and b/_static/locales/vi/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/vi/LC_MESSAGES/booktheme.po b/_static/locales/vi/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..33159f3e --- /dev/null +++ b/_static/locales/vi/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: vi\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "In sang PDF" + +msgid "Theme by the" +msgstr "Chủ đề của" + +msgid "Download source file" +msgstr "Tải xuống tệp nguồn" + +msgid "open issue" +msgstr "vấn đề mở" + +msgid "Contents" +msgstr "Nội dung" + +msgid "previous page" +msgstr "trang trước" + +msgid "Download notebook file" +msgstr "Tải xuống tệp sổ tay" + +msgid "Copyright" +msgstr "Bản quyền" + +msgid "Download this page" +msgstr "Tải xuống trang này" + +msgid "Source repository" +msgstr "Kho nguồn" + +msgid "By" +msgstr "Bởi" + +msgid "repository" +msgstr "kho" + +msgid "Last updated on" +msgstr "Cập nhật lần cuối vào" + +msgid "Toggle navigation" +msgstr "Chuyển đổi điều hướng thành" + +msgid "Sphinx Book Theme" +msgstr "Chủ đề sách nhân sư" + +msgid "suggest edit" +msgstr "đề nghị chỉnh sửa" + +msgid "Open an issue" +msgstr "Mở một vấn đề" + +msgid "Launch" +msgstr "Phóng" + +msgid "Fullscreen mode" +msgstr "Chế độ toàn màn hình" + +msgid "Edit this page" +msgstr "chỉnh sửa trang này" + +msgid "By the" +msgstr "Bằng" + +msgid "next page" +msgstr "Trang tiếp theo" diff --git a/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo b/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..0e3235d0 Binary files /dev/null and b/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/zh_CN/LC_MESSAGES/booktheme.po b/_static/locales/zh_CN/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..2e519ef4 --- /dev/null +++ b/_static/locales/zh_CN/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: zh_CN\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "列印成 PDF" + +msgid "Theme by the" +msgstr "主题作者:" + +msgid "Download source file" +msgstr "下载源文件" + +msgid "open issue" +msgstr "创建议题" + +msgid "Contents" +msgstr "目录" + +msgid "previous page" +msgstr "上一页" + +msgid "Download notebook file" +msgstr "下载笔记本文件" + +msgid "Copyright" +msgstr "版权" + +msgid "Download this page" +msgstr "下载此页面" + +msgid "Source repository" +msgstr "源码库" + +msgid "By" +msgstr "作者:" + +msgid "repository" +msgstr "仓库" + +msgid "Last updated on" +msgstr "上次更新时间:" + +msgid "Toggle navigation" +msgstr "显示或隐藏导航栏" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Book 主题" + +msgid "suggest edit" +msgstr "提出修改建议" + +msgid "Open an issue" +msgstr "创建议题" + +msgid "Launch" +msgstr "启动" + +msgid "Fullscreen mode" +msgstr "全屏模式" + +msgid "Edit this page" +msgstr "编辑此页面" + +msgid "By the" +msgstr "作者:" + +msgid "next page" +msgstr "下一页" diff --git a/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo b/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo new file mode 100644 index 00000000..9116fa95 Binary files /dev/null and b/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo differ diff --git a/_static/locales/zh_TW/LC_MESSAGES/booktheme.po b/_static/locales/zh_TW/LC_MESSAGES/booktheme.po new file mode 100644 index 00000000..beecb076 --- /dev/null +++ b/_static/locales/zh_TW/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: zh_TW\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "Print to PDF" +msgstr "列印成 PDF" + +msgid "Theme by the" +msgstr "佈景主題作者:" + +msgid "Download source file" +msgstr "下載原始檔" + +msgid "open issue" +msgstr "公開的問題" + +msgid "Contents" +msgstr "目錄" + +msgid "previous page" +msgstr "上一頁" + +msgid "Download notebook file" +msgstr "下載 Notebook 檔案" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download this page" +msgstr "下載此頁面" + +msgid "Source repository" +msgstr "來源儲存庫" + +msgid "By" +msgstr "作者:" + +msgid "repository" +msgstr "儲存庫" + +msgid "Last updated on" +msgstr "最後更新時間:" + +msgid "Toggle navigation" +msgstr "顯示或隱藏導覽列" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Book 佈景主題" + +msgid "suggest edit" +msgstr "提出修改建議" + +msgid "Open an issue" +msgstr "開啟議題" + +msgid "Launch" +msgstr "啟動" + +msgid "Fullscreen mode" +msgstr "全螢幕模式" + +msgid "Edit this page" +msgstr "編輯此頁面" + +msgid "By the" +msgstr "作者:" + +msgid "next page" +msgstr "下一頁" diff --git a/_static/logo.png b/_static/logo.png new file mode 100644 index 00000000..db104cc1 Binary files /dev/null and b/_static/logo.png differ diff --git a/_static/minus.png b/_static/minus.png new file mode 100644 index 00000000..d96755fd Binary files /dev/null and b/_static/minus.png differ diff --git a/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css b/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css new file mode 100644 index 00000000..33566310 --- /dev/null +++ b/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css @@ -0,0 +1,2342 @@ +/* Variables */ +:root { + --mystnb-source-bg-color: #f7f7f7; + --mystnb-stdout-bg-color: #fcfcfc; + --mystnb-stderr-bg-color: #fdd; + --mystnb-traceback-bg-color: #fcfcfc; + --mystnb-source-border-color: #ccc; + --mystnb-source-margin-color: green; + --mystnb-stdout-border-color: #f7f7f7; + --mystnb-stderr-border-color: #f7f7f7; + --mystnb-traceback-border-color: #ffd6d6; + --mystnb-hide-prompt-opacity: 70%; + --mystnb-source-border-radius: .4em; + --mystnb-source-border-width: 1px; +} + +/* Whole cell */ +div.container.cell { + padding-left: 0; + margin-bottom: 1em; +} + +/* Removing all background formatting so we can control at the div level */ +.cell_input div.highlight, +.cell_output pre, +.cell_input pre, +.cell_output .output { + border: none; + box-shadow: none; +} + +.cell_output .output pre, +.cell_input pre { + margin: 0px; +} + +/* Input cells */ +div.cell div.cell_input, +div.cell details.above-input>summary { + padding-left: 0em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + background-color: var(--mystnb-source-bg-color); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; + border-radius: var(--mystnb-source-border-radius); +} + +div.cell_input>div, +div.cell_output div.output>div.highlight { + margin: 0em !important; + border: none !important; +} + +/* All cell outputs */ +.cell_output { + padding-left: 1em; + padding-right: 0em; + margin-top: 1em; +} + +/* Text outputs from cells */ +.cell_output .output.text_plain, +.cell_output .output.traceback, +.cell_output .output.stream, +.cell_output .output.stderr { + margin-top: 1em; + margin-bottom: 0em; + box-shadow: none; +} + +.cell_output .output.text_plain, +.cell_output .output.stream { + background: var(--mystnb-stdout-bg-color); + border: 1px solid var(--mystnb-stdout-border-color); +} + +.cell_output .output.stderr { + background: var(--mystnb-stderr-bg-color); + border: 1px solid var(--mystnb-stderr-border-color); +} + +.cell_output .output.traceback { + background: var(--mystnb-traceback-bg-color); + border: 1px solid var(--mystnb-traceback-border-color); +} + +/* Collapsible cell content */ +div.cell details.above-input div.cell_input { + border-top-left-radius: 0; + border-top-right-radius: 0; + border-top: var(--mystnb-source-border-width) var(--mystnb-source-border-color) dashed; +} + +div.cell div.cell_input.above-output-prompt { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +div.cell details.above-input>summary { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; + border-bottom: var(--mystnb-source-border-width) var(--mystnb-source-border-color) dashed; + padding-left: 1em; + margin-bottom: 0; +} + +div.cell details.above-output>summary { + background-color: var(--mystnb-source-bg-color); + padding-left: 1em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + border-radius: var(--mystnb-source-border-radius); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; +} + +div.cell details.below-input>summary { + background-color: var(--mystnb-source-bg-color); + padding-left: 1em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + border-top: none; + border-bottom-left-radius: var(--mystnb-source-border-radius); + border-bottom-right-radius: var(--mystnb-source-border-radius); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; +} + +div.cell details.hide>summary>span { + opacity: var(--mystnb-hide-prompt-opacity); +} + +div.cell details.hide[open]>summary>span.collapsed { + display: none; +} + +div.cell details.hide:not([open])>summary>span.expanded { + display: none; +} + +@keyframes collapsed-fade-in { + 0% { + opacity: 0; + } + + 100% { + opacity: 1; + } +} +div.cell details.hide[open]>summary~* { + -moz-animation: collapsed-fade-in 0.3s ease-in-out; + -webkit-animation: collapsed-fade-in 0.3s ease-in-out; + animation: collapsed-fade-in 0.3s ease-in-out; +} + +/* Math align to the left */ +.cell_output .MathJax_Display { + text-align: left !important; +} + +/* Pandas tables. Pulled from the Jupyter / nbsphinx CSS */ +div.cell_output table { + border: none; + border-collapse: collapse; + border-spacing: 0; + color: black; + font-size: 1em; + table-layout: fixed; +} + +div.cell_output thead { + border-bottom: 1px solid black; + vertical-align: bottom; +} + +div.cell_output tr, +div.cell_output th, +div.cell_output td { + text-align: right; + vertical-align: middle; + padding: 0.5em 0.5em; + line-height: normal; + white-space: normal; + max-width: none; + border: none; +} + +div.cell_output th { + font-weight: bold; +} + +div.cell_output tbody tr:nth-child(odd) { + background: #f5f5f5; +} + +div.cell_output tbody tr:hover { + background: rgba(66, 165, 245, 0.2); +} + +/** source code line numbers **/ +span.linenos { + opacity: 0.5; +} + +/* Inline text from `paste` operation */ + +span.pasted-text { + font-weight: bold; +} + +span.pasted-inline img { + max-height: 2em; +} + +tbody span.pasted-inline img { + max-height: none; +} + +/* Font colors for translated ANSI escape sequences +Color values are copied from Jupyter Notebook +https://github.com/jupyter/notebook/blob/52581f8eda9b319eb0390ac77fe5903c38f81e3e/notebook/static/notebook/less/ansicolors.less#L14-L21 +Background colors from +https://nbsphinx.readthedocs.io/en/latest/code-cells.html#ANSI-Colors +*/ +div.highlight .-Color-Bold { + font-weight: bold; +} + +div.highlight .-Color[class*=-Black] { + color: #3E424D +} + +div.highlight .-Color[class*=-Red] { + color: #E75C58 +} + +div.highlight .-Color[class*=-Green] { + color: #00A250 +} + +div.highlight .-Color[class*=-Yellow] { + color: #DDB62B +} + +div.highlight .-Color[class*=-Blue] { + color: #208FFB +} + +div.highlight .-Color[class*=-Magenta] { + color: #D160C4 +} + +div.highlight .-Color[class*=-Cyan] { + color: #60C6C8 +} + +div.highlight .-Color[class*=-White] { + color: #C5C1B4 +} + +div.highlight .-Color[class*=-BGBlack] { + background-color: #3E424D +} + +div.highlight .-Color[class*=-BGRed] { + background-color: #E75C58 +} + +div.highlight .-Color[class*=-BGGreen] { + background-color: #00A250 +} + +div.highlight .-Color[class*=-BGYellow] { + background-color: #DDB62B +} + +div.highlight .-Color[class*=-BGBlue] { + background-color: #208FFB +} + +div.highlight .-Color[class*=-BGMagenta] { + background-color: #D160C4 +} + +div.highlight .-Color[class*=-BGCyan] { + background-color: #60C6C8 +} + +div.highlight .-Color[class*=-BGWhite] { + background-color: #C5C1B4 +} + +/* Font colors for 8-bit ANSI */ + +div.highlight .-Color[class*=-C0] { + color: #000000 +} + +div.highlight .-Color[class*=-BGC0] { + background-color: #000000 +} + +div.highlight .-Color[class*=-C1] { + color: #800000 +} + +div.highlight .-Color[class*=-BGC1] { + background-color: #800000 +} + +div.highlight .-Color[class*=-C2] { + color: #008000 +} + +div.highlight .-Color[class*=-BGC2] { + background-color: #008000 +} + +div.highlight .-Color[class*=-C3] { + color: #808000 +} + +div.highlight .-Color[class*=-BGC3] { + background-color: #808000 +} + +div.highlight .-Color[class*=-C4] { + color: #000080 +} + +div.highlight .-Color[class*=-BGC4] { + background-color: #000080 +} + +div.highlight .-Color[class*=-C5] { + color: #800080 +} + +div.highlight .-Color[class*=-BGC5] { + background-color: #800080 +} + +div.highlight .-Color[class*=-C6] { + color: #008080 +} + +div.highlight .-Color[class*=-BGC6] { + background-color: #008080 +} + +div.highlight .-Color[class*=-C7] { + color: #C0C0C0 +} + +div.highlight .-Color[class*=-BGC7] { + background-color: #C0C0C0 +} + +div.highlight .-Color[class*=-C8] { + color: #808080 +} + +div.highlight .-Color[class*=-BGC8] { + background-color: #808080 +} + +div.highlight .-Color[class*=-C9] { + color: #FF0000 +} + +div.highlight .-Color[class*=-BGC9] { + background-color: #FF0000 +} + +div.highlight .-Color[class*=-C10] { + color: #00FF00 +} + +div.highlight .-Color[class*=-BGC10] { + background-color: #00FF00 +} + +div.highlight .-Color[class*=-C11] { + color: #FFFF00 +} + +div.highlight .-Color[class*=-BGC11] { + background-color: #FFFF00 +} + +div.highlight .-Color[class*=-C12] { + color: #0000FF +} + +div.highlight .-Color[class*=-BGC12] { + background-color: #0000FF +} + +div.highlight .-Color[class*=-C13] { + color: #FF00FF +} + +div.highlight .-Color[class*=-BGC13] { + background-color: #FF00FF +} + +div.highlight .-Color[class*=-C14] { + color: #00FFFF +} + +div.highlight .-Color[class*=-BGC14] { + background-color: #00FFFF +} + +div.highlight .-Color[class*=-C15] { + color: #FFFFFF +} + +div.highlight .-Color[class*=-BGC15] { + background-color: #FFFFFF +} + +div.highlight .-Color[class*=-C16] { + color: #000000 +} + +div.highlight .-Color[class*=-BGC16] { + background-color: #000000 +} + +div.highlight .-Color[class*=-C17] { + color: #00005F +} + +div.highlight .-Color[class*=-BGC17] { + background-color: #00005F +} + +div.highlight .-Color[class*=-C18] { + color: #000087 +} + +div.highlight .-Color[class*=-BGC18] { + background-color: #000087 +} + +div.highlight .-Color[class*=-C19] { + color: #0000AF +} + +div.highlight .-Color[class*=-BGC19] { + background-color: #0000AF +} + +div.highlight .-Color[class*=-C20] { + color: #0000D7 +} + +div.highlight .-Color[class*=-BGC20] { + background-color: #0000D7 +} + +div.highlight .-Color[class*=-C21] { + color: #0000FF +} + +div.highlight .-Color[class*=-BGC21] { + background-color: #0000FF +} + +div.highlight .-Color[class*=-C22] { + color: #005F00 +} + +div.highlight .-Color[class*=-BGC22] { + background-color: #005F00 +} + +div.highlight .-Color[class*=-C23] { + color: #005F5F +} + +div.highlight .-Color[class*=-BGC23] { + background-color: #005F5F +} + +div.highlight .-Color[class*=-C24] { + color: #005F87 +} + +div.highlight .-Color[class*=-BGC24] { + background-color: #005F87 +} + +div.highlight .-Color[class*=-C25] { + color: #005FAF +} + +div.highlight .-Color[class*=-BGC25] { + background-color: #005FAF +} + +div.highlight .-Color[class*=-C26] { + color: #005FD7 +} + +div.highlight .-Color[class*=-BGC26] { + background-color: #005FD7 +} + +div.highlight .-Color[class*=-C27] { + color: #005FFF +} + +div.highlight .-Color[class*=-BGC27] { + background-color: #005FFF +} + +div.highlight .-Color[class*=-C28] { + color: #008700 +} + +div.highlight .-Color[class*=-BGC28] { + background-color: #008700 +} + +div.highlight .-Color[class*=-C29] { + color: #00875F +} + +div.highlight .-Color[class*=-BGC29] { + background-color: #00875F +} + +div.highlight .-Color[class*=-C30] { + color: #008787 +} + +div.highlight .-Color[class*=-BGC30] { + background-color: #008787 +} + +div.highlight .-Color[class*=-C31] { + color: #0087AF +} + +div.highlight .-Color[class*=-BGC31] { + background-color: #0087AF +} + +div.highlight .-Color[class*=-C32] { + color: #0087D7 +} + +div.highlight .-Color[class*=-BGC32] { + background-color: #0087D7 +} + +div.highlight .-Color[class*=-C33] { + color: #0087FF +} + +div.highlight .-Color[class*=-BGC33] { + background-color: #0087FF +} + +div.highlight .-Color[class*=-C34] { + color: #00AF00 +} + +div.highlight .-Color[class*=-BGC34] { + background-color: #00AF00 +} + +div.highlight .-Color[class*=-C35] { + color: #00AF5F +} + +div.highlight .-Color[class*=-BGC35] { + background-color: #00AF5F +} + +div.highlight .-Color[class*=-C36] { + color: #00AF87 +} + +div.highlight .-Color[class*=-BGC36] { + background-color: #00AF87 +} + +div.highlight .-Color[class*=-C37] { + color: #00AFAF +} + +div.highlight .-Color[class*=-BGC37] { + background-color: #00AFAF +} + +div.highlight .-Color[class*=-C38] { + color: #00AFD7 +} + +div.highlight .-Color[class*=-BGC38] { + background-color: #00AFD7 +} + +div.highlight .-Color[class*=-C39] { + color: #00AFFF +} + +div.highlight .-Color[class*=-BGC39] { + background-color: #00AFFF +} + +div.highlight .-Color[class*=-C40] { + color: #00D700 +} + +div.highlight .-Color[class*=-BGC40] { + background-color: #00D700 +} + +div.highlight .-Color[class*=-C41] { + color: #00D75F +} + +div.highlight .-Color[class*=-BGC41] { + background-color: #00D75F +} + +div.highlight .-Color[class*=-C42] { + color: #00D787 +} + +div.highlight .-Color[class*=-BGC42] { + background-color: #00D787 +} + +div.highlight .-Color[class*=-C43] { + color: #00D7AF +} + +div.highlight .-Color[class*=-BGC43] { + background-color: #00D7AF +} + +div.highlight .-Color[class*=-C44] { + color: #00D7D7 +} + +div.highlight .-Color[class*=-BGC44] { + background-color: #00D7D7 +} + +div.highlight .-Color[class*=-C45] { + color: #00D7FF +} + +div.highlight .-Color[class*=-BGC45] { + background-color: #00D7FF +} + +div.highlight .-Color[class*=-C46] { + color: #00FF00 +} + +div.highlight .-Color[class*=-BGC46] { + background-color: #00FF00 +} + +div.highlight .-Color[class*=-C47] { + color: #00FF5F +} + +div.highlight .-Color[class*=-BGC47] { + background-color: #00FF5F +} + +div.highlight .-Color[class*=-C48] { + color: #00FF87 +} + +div.highlight .-Color[class*=-BGC48] { + background-color: #00FF87 +} + +div.highlight .-Color[class*=-C49] { + color: #00FFAF +} + +div.highlight .-Color[class*=-BGC49] { + background-color: #00FFAF +} + +div.highlight .-Color[class*=-C50] { + color: #00FFD7 +} + +div.highlight .-Color[class*=-BGC50] { + background-color: #00FFD7 +} + +div.highlight .-Color[class*=-C51] { + color: #00FFFF +} + +div.highlight .-Color[class*=-BGC51] { + background-color: #00FFFF +} + +div.highlight .-Color[class*=-C52] { + color: #5F0000 +} + +div.highlight .-Color[class*=-BGC52] { + background-color: #5F0000 +} + +div.highlight .-Color[class*=-C53] { + color: #5F005F +} + +div.highlight .-Color[class*=-BGC53] { + background-color: #5F005F +} + +div.highlight .-Color[class*=-C54] { + color: #5F0087 +} + +div.highlight .-Color[class*=-BGC54] { + background-color: #5F0087 +} + +div.highlight .-Color[class*=-C55] { + color: #5F00AF +} + +div.highlight .-Color[class*=-BGC55] { + background-color: #5F00AF +} + +div.highlight .-Color[class*=-C56] { + color: #5F00D7 +} + +div.highlight .-Color[class*=-BGC56] { + background-color: #5F00D7 +} + +div.highlight .-Color[class*=-C57] { + color: #5F00FF +} + +div.highlight .-Color[class*=-BGC57] { + background-color: #5F00FF +} + +div.highlight .-Color[class*=-C58] { + color: #5F5F00 +} + +div.highlight .-Color[class*=-BGC58] { + background-color: #5F5F00 +} + +div.highlight .-Color[class*=-C59] { + color: #5F5F5F +} + +div.highlight .-Color[class*=-BGC59] { + background-color: #5F5F5F +} + +div.highlight .-Color[class*=-C60] { + color: #5F5F87 +} + +div.highlight .-Color[class*=-BGC60] { + background-color: #5F5F87 +} + +div.highlight .-Color[class*=-C61] { + color: #5F5FAF +} + +div.highlight .-Color[class*=-BGC61] { + background-color: #5F5FAF +} + +div.highlight .-Color[class*=-C62] { + color: #5F5FD7 +} + +div.highlight .-Color[class*=-BGC62] { + background-color: #5F5FD7 +} + +div.highlight .-Color[class*=-C63] { + color: #5F5FFF +} + +div.highlight .-Color[class*=-BGC63] { + background-color: #5F5FFF +} + +div.highlight .-Color[class*=-C64] { + color: #5F8700 +} + +div.highlight .-Color[class*=-BGC64] { + background-color: #5F8700 +} + +div.highlight .-Color[class*=-C65] { + color: #5F875F +} + +div.highlight .-Color[class*=-BGC65] { + background-color: #5F875F +} + +div.highlight .-Color[class*=-C66] { + color: #5F8787 +} + +div.highlight .-Color[class*=-BGC66] { + background-color: #5F8787 +} + +div.highlight .-Color[class*=-C67] { + color: #5F87AF +} + +div.highlight .-Color[class*=-BGC67] { + background-color: #5F87AF +} + +div.highlight .-Color[class*=-C68] { + color: #5F87D7 +} + +div.highlight .-Color[class*=-BGC68] { + background-color: #5F87D7 +} + +div.highlight .-Color[class*=-C69] { + color: #5F87FF +} + +div.highlight .-Color[class*=-BGC69] { + background-color: #5F87FF +} + +div.highlight .-Color[class*=-C70] { + color: #5FAF00 +} + +div.highlight .-Color[class*=-BGC70] { + background-color: #5FAF00 +} + +div.highlight .-Color[class*=-C71] { + color: #5FAF5F +} + +div.highlight .-Color[class*=-BGC71] { + background-color: #5FAF5F +} + +div.highlight .-Color[class*=-C72] { + color: #5FAF87 +} + +div.highlight .-Color[class*=-BGC72] { + background-color: #5FAF87 +} + +div.highlight .-Color[class*=-C73] { + color: #5FAFAF +} + +div.highlight .-Color[class*=-BGC73] { + background-color: #5FAFAF +} + +div.highlight .-Color[class*=-C74] { + color: #5FAFD7 +} + +div.highlight .-Color[class*=-BGC74] { + background-color: #5FAFD7 +} + +div.highlight .-Color[class*=-C75] { + color: #5FAFFF +} + +div.highlight .-Color[class*=-BGC75] { + background-color: #5FAFFF +} + +div.highlight .-Color[class*=-C76] { + color: #5FD700 +} + +div.highlight .-Color[class*=-BGC76] { + background-color: #5FD700 +} + +div.highlight .-Color[class*=-C77] { + color: #5FD75F +} + +div.highlight .-Color[class*=-BGC77] { + background-color: #5FD75F +} + +div.highlight .-Color[class*=-C78] { + color: #5FD787 +} + +div.highlight .-Color[class*=-BGC78] { + background-color: #5FD787 +} + +div.highlight .-Color[class*=-C79] { + color: #5FD7AF +} + +div.highlight .-Color[class*=-BGC79] { + background-color: #5FD7AF +} + +div.highlight .-Color[class*=-C80] { + color: #5FD7D7 +} + +div.highlight .-Color[class*=-BGC80] { + background-color: #5FD7D7 +} + +div.highlight .-Color[class*=-C81] { + color: #5FD7FF +} + +div.highlight .-Color[class*=-BGC81] { + background-color: #5FD7FF +} + +div.highlight .-Color[class*=-C82] { + color: #5FFF00 +} + +div.highlight .-Color[class*=-BGC82] { + background-color: #5FFF00 +} + +div.highlight .-Color[class*=-C83] { + color: #5FFF5F +} + +div.highlight .-Color[class*=-BGC83] { + background-color: #5FFF5F +} + +div.highlight .-Color[class*=-C84] { + color: #5FFF87 +} + +div.highlight .-Color[class*=-BGC84] { + background-color: #5FFF87 +} + +div.highlight .-Color[class*=-C85] { + color: #5FFFAF +} + +div.highlight .-Color[class*=-BGC85] { + background-color: #5FFFAF +} + +div.highlight .-Color[class*=-C86] { + color: #5FFFD7 +} + +div.highlight .-Color[class*=-BGC86] { + background-color: #5FFFD7 +} + +div.highlight .-Color[class*=-C87] { + color: #5FFFFF +} + +div.highlight .-Color[class*=-BGC87] { + background-color: #5FFFFF +} + +div.highlight .-Color[class*=-C88] { + color: #870000 +} + +div.highlight .-Color[class*=-BGC88] { + background-color: #870000 +} + +div.highlight .-Color[class*=-C89] { + color: #87005F +} + +div.highlight .-Color[class*=-BGC89] { + background-color: #87005F +} + +div.highlight .-Color[class*=-C90] { + color: #870087 +} + +div.highlight .-Color[class*=-BGC90] { + background-color: #870087 +} + +div.highlight .-Color[class*=-C91] { + color: #8700AF +} + +div.highlight .-Color[class*=-BGC91] { + background-color: #8700AF +} + +div.highlight .-Color[class*=-C92] { + color: #8700D7 +} + +div.highlight .-Color[class*=-BGC92] { + background-color: #8700D7 +} + +div.highlight .-Color[class*=-C93] { + color: #8700FF +} + +div.highlight .-Color[class*=-BGC93] { + background-color: #8700FF +} + +div.highlight .-Color[class*=-C94] { + color: #875F00 +} + +div.highlight .-Color[class*=-BGC94] { + background-color: #875F00 +} + +div.highlight .-Color[class*=-C95] { + color: #875F5F +} + +div.highlight .-Color[class*=-BGC95] { + background-color: #875F5F +} + +div.highlight .-Color[class*=-C96] { + color: #875F87 +} + +div.highlight .-Color[class*=-BGC96] { + background-color: #875F87 +} + +div.highlight .-Color[class*=-C97] { + color: #875FAF +} + +div.highlight .-Color[class*=-BGC97] { + background-color: #875FAF +} + +div.highlight .-Color[class*=-C98] { + color: #875FD7 +} + +div.highlight .-Color[class*=-BGC98] { + background-color: #875FD7 +} + +div.highlight .-Color[class*=-C99] { + color: #875FFF +} + +div.highlight .-Color[class*=-BGC99] { + background-color: #875FFF +} + +div.highlight .-Color[class*=-C100] { + color: #878700 +} + +div.highlight .-Color[class*=-BGC100] { + background-color: #878700 +} + +div.highlight .-Color[class*=-C101] { + color: #87875F +} + +div.highlight .-Color[class*=-BGC101] { + background-color: #87875F +} + +div.highlight .-Color[class*=-C102] { + color: #878787 +} + +div.highlight .-Color[class*=-BGC102] { + background-color: #878787 +} + +div.highlight .-Color[class*=-C103] { + color: #8787AF +} + +div.highlight .-Color[class*=-BGC103] { + background-color: #8787AF +} + +div.highlight .-Color[class*=-C104] { + color: #8787D7 +} + +div.highlight .-Color[class*=-BGC104] { + background-color: #8787D7 +} + +div.highlight .-Color[class*=-C105] { + color: #8787FF +} + +div.highlight .-Color[class*=-BGC105] { + background-color: #8787FF +} + +div.highlight .-Color[class*=-C106] { + color: #87AF00 +} + +div.highlight .-Color[class*=-BGC106] { + background-color: #87AF00 +} + +div.highlight .-Color[class*=-C107] { + color: #87AF5F +} + +div.highlight .-Color[class*=-BGC107] { + background-color: #87AF5F +} + +div.highlight .-Color[class*=-C108] { + color: #87AF87 +} + +div.highlight .-Color[class*=-BGC108] { + background-color: #87AF87 +} + +div.highlight .-Color[class*=-C109] { + color: #87AFAF +} + +div.highlight .-Color[class*=-BGC109] { + background-color: #87AFAF +} + +div.highlight .-Color[class*=-C110] { + color: #87AFD7 +} + +div.highlight .-Color[class*=-BGC110] { + background-color: #87AFD7 +} + +div.highlight .-Color[class*=-C111] { + color: #87AFFF +} + +div.highlight .-Color[class*=-BGC111] { + background-color: #87AFFF +} + +div.highlight .-Color[class*=-C112] { + color: #87D700 +} + +div.highlight .-Color[class*=-BGC112] { + background-color: #87D700 +} + +div.highlight .-Color[class*=-C113] { + color: #87D75F +} + +div.highlight .-Color[class*=-BGC113] { + background-color: #87D75F +} + +div.highlight .-Color[class*=-C114] { + color: #87D787 +} + +div.highlight .-Color[class*=-BGC114] { + background-color: #87D787 +} + +div.highlight .-Color[class*=-C115] { + color: #87D7AF +} + +div.highlight .-Color[class*=-BGC115] { + background-color: #87D7AF +} + +div.highlight .-Color[class*=-C116] { + color: #87D7D7 +} + +div.highlight .-Color[class*=-BGC116] { + background-color: #87D7D7 +} + +div.highlight .-Color[class*=-C117] { + color: #87D7FF +} + +div.highlight .-Color[class*=-BGC117] { + background-color: #87D7FF +} + +div.highlight .-Color[class*=-C118] { + color: #87FF00 +} + +div.highlight .-Color[class*=-BGC118] { + background-color: #87FF00 +} + +div.highlight .-Color[class*=-C119] { + color: #87FF5F +} + +div.highlight .-Color[class*=-BGC119] { + background-color: #87FF5F +} + +div.highlight .-Color[class*=-C120] { + color: #87FF87 +} + +div.highlight .-Color[class*=-BGC120] { + background-color: #87FF87 +} + +div.highlight .-Color[class*=-C121] { + color: #87FFAF +} + +div.highlight .-Color[class*=-BGC121] { + background-color: #87FFAF +} + +div.highlight .-Color[class*=-C122] { + color: #87FFD7 +} + +div.highlight .-Color[class*=-BGC122] { + background-color: #87FFD7 +} + +div.highlight .-Color[class*=-C123] { + color: #87FFFF +} + +div.highlight .-Color[class*=-BGC123] { + background-color: #87FFFF +} + +div.highlight .-Color[class*=-C124] { + color: #AF0000 +} + +div.highlight .-Color[class*=-BGC124] { + background-color: #AF0000 +} + +div.highlight .-Color[class*=-C125] { + color: #AF005F +} + +div.highlight .-Color[class*=-BGC125] { + background-color: #AF005F +} + +div.highlight .-Color[class*=-C126] { + color: #AF0087 +} + +div.highlight .-Color[class*=-BGC126] { + background-color: #AF0087 +} + +div.highlight .-Color[class*=-C127] { + color: #AF00AF +} + +div.highlight .-Color[class*=-BGC127] { + background-color: #AF00AF +} + +div.highlight .-Color[class*=-C128] { + color: #AF00D7 +} + +div.highlight .-Color[class*=-BGC128] { + background-color: #AF00D7 +} + +div.highlight .-Color[class*=-C129] { + color: #AF00FF +} + +div.highlight .-Color[class*=-BGC129] { + background-color: #AF00FF +} + +div.highlight .-Color[class*=-C130] { + color: #AF5F00 +} + +div.highlight .-Color[class*=-BGC130] { + background-color: #AF5F00 +} + +div.highlight .-Color[class*=-C131] { + color: #AF5F5F +} + +div.highlight .-Color[class*=-BGC131] { + background-color: #AF5F5F +} + +div.highlight .-Color[class*=-C132] { + color: #AF5F87 +} + +div.highlight .-Color[class*=-BGC132] { + background-color: #AF5F87 +} + +div.highlight .-Color[class*=-C133] { + color: #AF5FAF +} + +div.highlight .-Color[class*=-BGC133] { + background-color: #AF5FAF +} + +div.highlight .-Color[class*=-C134] { + color: #AF5FD7 +} + +div.highlight .-Color[class*=-BGC134] { + background-color: #AF5FD7 +} + +div.highlight .-Color[class*=-C135] { + color: #AF5FFF +} + +div.highlight .-Color[class*=-BGC135] { + background-color: #AF5FFF +} + +div.highlight .-Color[class*=-C136] { + color: #AF8700 +} + +div.highlight .-Color[class*=-BGC136] { + background-color: #AF8700 +} + +div.highlight .-Color[class*=-C137] { + color: #AF875F +} + +div.highlight .-Color[class*=-BGC137] { + background-color: #AF875F +} + +div.highlight .-Color[class*=-C138] { + color: #AF8787 +} + +div.highlight .-Color[class*=-BGC138] { + background-color: #AF8787 +} + +div.highlight .-Color[class*=-C139] { + color: #AF87AF +} + +div.highlight .-Color[class*=-BGC139] { + background-color: #AF87AF +} + +div.highlight .-Color[class*=-C140] { + color: #AF87D7 +} + +div.highlight .-Color[class*=-BGC140] { + background-color: #AF87D7 +} + +div.highlight .-Color[class*=-C141] { + color: #AF87FF +} + +div.highlight .-Color[class*=-BGC141] { + background-color: #AF87FF +} + +div.highlight .-Color[class*=-C142] { + color: #AFAF00 +} + +div.highlight .-Color[class*=-BGC142] { + background-color: #AFAF00 +} + +div.highlight .-Color[class*=-C143] { + color: #AFAF5F +} + +div.highlight .-Color[class*=-BGC143] { + background-color: #AFAF5F +} + +div.highlight .-Color[class*=-C144] { + color: #AFAF87 +} + +div.highlight .-Color[class*=-BGC144] { + background-color: #AFAF87 +} + +div.highlight .-Color[class*=-C145] { + color: #AFAFAF +} + +div.highlight .-Color[class*=-BGC145] { + background-color: #AFAFAF +} + +div.highlight .-Color[class*=-C146] { + color: #AFAFD7 +} + +div.highlight .-Color[class*=-BGC146] { + background-color: #AFAFD7 +} + +div.highlight .-Color[class*=-C147] { + color: #AFAFFF +} + +div.highlight .-Color[class*=-BGC147] { + background-color: #AFAFFF +} + +div.highlight .-Color[class*=-C148] { + color: #AFD700 +} + +div.highlight .-Color[class*=-BGC148] { + background-color: #AFD700 +} + +div.highlight .-Color[class*=-C149] { + color: #AFD75F +} + +div.highlight .-Color[class*=-BGC149] { + background-color: #AFD75F +} + +div.highlight .-Color[class*=-C150] { + color: #AFD787 +} + +div.highlight .-Color[class*=-BGC150] { + background-color: #AFD787 +} + +div.highlight .-Color[class*=-C151] { + color: #AFD7AF +} + +div.highlight .-Color[class*=-BGC151] { + background-color: #AFD7AF +} + +div.highlight .-Color[class*=-C152] { + color: #AFD7D7 +} + +div.highlight .-Color[class*=-BGC152] { + background-color: #AFD7D7 +} + +div.highlight .-Color[class*=-C153] { + color: #AFD7FF +} + +div.highlight .-Color[class*=-BGC153] { + background-color: #AFD7FF +} + +div.highlight .-Color[class*=-C154] { + color: #AFFF00 +} + +div.highlight .-Color[class*=-BGC154] { + background-color: #AFFF00 +} + +div.highlight .-Color[class*=-C155] { + color: #AFFF5F +} + +div.highlight .-Color[class*=-BGC155] { + background-color: #AFFF5F +} + +div.highlight .-Color[class*=-C156] { + color: #AFFF87 +} + +div.highlight .-Color[class*=-BGC156] { + background-color: #AFFF87 +} + +div.highlight .-Color[class*=-C157] { + color: #AFFFAF +} + +div.highlight .-Color[class*=-BGC157] { + background-color: #AFFFAF +} + +div.highlight .-Color[class*=-C158] { + color: #AFFFD7 +} + +div.highlight .-Color[class*=-BGC158] { + background-color: #AFFFD7 +} + +div.highlight .-Color[class*=-C159] { + color: #AFFFFF +} + +div.highlight .-Color[class*=-BGC159] { + background-color: #AFFFFF +} + +div.highlight .-Color[class*=-C160] { + color: #D70000 +} + +div.highlight .-Color[class*=-BGC160] { + background-color: #D70000 +} + +div.highlight .-Color[class*=-C161] { + color: #D7005F +} + +div.highlight .-Color[class*=-BGC161] { + background-color: #D7005F +} + +div.highlight .-Color[class*=-C162] { + color: #D70087 +} + +div.highlight .-Color[class*=-BGC162] { + background-color: #D70087 +} + +div.highlight .-Color[class*=-C163] { + color: #D700AF +} + +div.highlight .-Color[class*=-BGC163] { + background-color: #D700AF +} + +div.highlight .-Color[class*=-C164] { + color: #D700D7 +} + +div.highlight .-Color[class*=-BGC164] { + background-color: #D700D7 +} + +div.highlight .-Color[class*=-C165] { + color: #D700FF +} + +div.highlight .-Color[class*=-BGC165] { + background-color: #D700FF +} + +div.highlight .-Color[class*=-C166] { + color: #D75F00 +} + +div.highlight .-Color[class*=-BGC166] { + background-color: #D75F00 +} + +div.highlight .-Color[class*=-C167] { + color: #D75F5F +} + +div.highlight .-Color[class*=-BGC167] { + background-color: #D75F5F +} + +div.highlight .-Color[class*=-C168] { + color: #D75F87 +} + +div.highlight .-Color[class*=-BGC168] { + background-color: #D75F87 +} + +div.highlight .-Color[class*=-C169] { + color: #D75FAF +} + +div.highlight .-Color[class*=-BGC169] { + background-color: #D75FAF +} + +div.highlight .-Color[class*=-C170] { + color: #D75FD7 +} + +div.highlight .-Color[class*=-BGC170] { + background-color: #D75FD7 +} + +div.highlight .-Color[class*=-C171] { + color: #D75FFF +} + +div.highlight .-Color[class*=-BGC171] { + background-color: #D75FFF +} + +div.highlight .-Color[class*=-C172] { + color: #D78700 +} + +div.highlight .-Color[class*=-BGC172] { + background-color: #D78700 +} + +div.highlight .-Color[class*=-C173] { + color: #D7875F +} + +div.highlight .-Color[class*=-BGC173] { + background-color: #D7875F +} + +div.highlight .-Color[class*=-C174] { + color: #D78787 +} + +div.highlight .-Color[class*=-BGC174] { + background-color: #D78787 +} + +div.highlight .-Color[class*=-C175] { + color: #D787AF +} + +div.highlight .-Color[class*=-BGC175] { + background-color: #D787AF +} + +div.highlight .-Color[class*=-C176] { + color: #D787D7 +} + +div.highlight .-Color[class*=-BGC176] { + background-color: #D787D7 +} + +div.highlight .-Color[class*=-C177] { + color: #D787FF +} + +div.highlight .-Color[class*=-BGC177] { + background-color: #D787FF +} + +div.highlight .-Color[class*=-C178] { + color: #D7AF00 +} + +div.highlight .-Color[class*=-BGC178] { + background-color: #D7AF00 +} + +div.highlight .-Color[class*=-C179] { + color: #D7AF5F +} + +div.highlight .-Color[class*=-BGC179] { + background-color: #D7AF5F +} + +div.highlight .-Color[class*=-C180] { + color: #D7AF87 +} + +div.highlight .-Color[class*=-BGC180] { + background-color: #D7AF87 +} + +div.highlight .-Color[class*=-C181] { + color: #D7AFAF +} + +div.highlight .-Color[class*=-BGC181] { + background-color: #D7AFAF +} + +div.highlight .-Color[class*=-C182] { + color: #D7AFD7 +} + +div.highlight .-Color[class*=-BGC182] { + background-color: #D7AFD7 +} + +div.highlight .-Color[class*=-C183] { + color: #D7AFFF +} + +div.highlight .-Color[class*=-BGC183] { + background-color: #D7AFFF +} + +div.highlight .-Color[class*=-C184] { + color: #D7D700 +} + +div.highlight .-Color[class*=-BGC184] { + background-color: #D7D700 +} + +div.highlight .-Color[class*=-C185] { + color: #D7D75F +} + +div.highlight .-Color[class*=-BGC185] { + background-color: #D7D75F +} + +div.highlight .-Color[class*=-C186] { + color: #D7D787 +} + +div.highlight .-Color[class*=-BGC186] { + background-color: #D7D787 +} + +div.highlight .-Color[class*=-C187] { + color: #D7D7AF +} + +div.highlight .-Color[class*=-BGC187] { + background-color: #D7D7AF +} + +div.highlight .-Color[class*=-C188] { + color: #D7D7D7 +} + +div.highlight .-Color[class*=-BGC188] { + background-color: #D7D7D7 +} + +div.highlight .-Color[class*=-C189] { + color: #D7D7FF +} + +div.highlight .-Color[class*=-BGC189] { + background-color: #D7D7FF +} + +div.highlight .-Color[class*=-C190] { + color: #D7FF00 +} + +div.highlight .-Color[class*=-BGC190] { + background-color: #D7FF00 +} + +div.highlight .-Color[class*=-C191] { + color: #D7FF5F +} + +div.highlight .-Color[class*=-BGC191] { + background-color: #D7FF5F +} + +div.highlight .-Color[class*=-C192] { + color: #D7FF87 +} + +div.highlight .-Color[class*=-BGC192] { + background-color: #D7FF87 +} + +div.highlight .-Color[class*=-C193] { + color: #D7FFAF +} + +div.highlight .-Color[class*=-BGC193] { + background-color: #D7FFAF +} + +div.highlight .-Color[class*=-C194] { + color: #D7FFD7 +} + +div.highlight .-Color[class*=-BGC194] { + background-color: #D7FFD7 +} + +div.highlight .-Color[class*=-C195] { + color: #D7FFFF +} + +div.highlight .-Color[class*=-BGC195] { + background-color: #D7FFFF +} + +div.highlight .-Color[class*=-C196] { + color: #FF0000 +} + +div.highlight .-Color[class*=-BGC196] { + background-color: #FF0000 +} + +div.highlight .-Color[class*=-C197] { + color: #FF005F +} + +div.highlight .-Color[class*=-BGC197] { + background-color: #FF005F +} + +div.highlight .-Color[class*=-C198] { + color: #FF0087 +} + +div.highlight .-Color[class*=-BGC198] { + background-color: #FF0087 +} + +div.highlight .-Color[class*=-C199] { + color: #FF00AF +} + +div.highlight .-Color[class*=-BGC199] { + background-color: #FF00AF +} + +div.highlight .-Color[class*=-C200] { + color: #FF00D7 +} + +div.highlight .-Color[class*=-BGC200] { + background-color: #FF00D7 +} + +div.highlight .-Color[class*=-C201] { + color: #FF00FF +} + +div.highlight .-Color[class*=-BGC201] { + background-color: #FF00FF +} + +div.highlight .-Color[class*=-C202] { + color: #FF5F00 +} + +div.highlight .-Color[class*=-BGC202] { + background-color: #FF5F00 +} + +div.highlight .-Color[class*=-C203] { + color: #FF5F5F +} + +div.highlight .-Color[class*=-BGC203] { + background-color: #FF5F5F +} + +div.highlight .-Color[class*=-C204] { + color: #FF5F87 +} + +div.highlight .-Color[class*=-BGC204] { + background-color: #FF5F87 +} + +div.highlight .-Color[class*=-C205] { + color: #FF5FAF +} + +div.highlight .-Color[class*=-BGC205] { + background-color: #FF5FAF +} + +div.highlight .-Color[class*=-C206] { + color: #FF5FD7 +} + +div.highlight .-Color[class*=-BGC206] { + background-color: #FF5FD7 +} + +div.highlight .-Color[class*=-C207] { + color: #FF5FFF +} + +div.highlight .-Color[class*=-BGC207] { + background-color: #FF5FFF +} + +div.highlight .-Color[class*=-C208] { + color: #FF8700 +} + +div.highlight .-Color[class*=-BGC208] { + background-color: #FF8700 +} + +div.highlight .-Color[class*=-C209] { + color: #FF875F +} + +div.highlight .-Color[class*=-BGC209] { + background-color: #FF875F +} + +div.highlight .-Color[class*=-C210] { + color: #FF8787 +} + +div.highlight .-Color[class*=-BGC210] { + background-color: #FF8787 +} + +div.highlight .-Color[class*=-C211] { + color: #FF87AF +} + +div.highlight .-Color[class*=-BGC211] { + background-color: #FF87AF +} + +div.highlight .-Color[class*=-C212] { + color: #FF87D7 +} + +div.highlight .-Color[class*=-BGC212] { + background-color: #FF87D7 +} + +div.highlight .-Color[class*=-C213] { + color: #FF87FF +} + +div.highlight .-Color[class*=-BGC213] { + background-color: #FF87FF +} + +div.highlight .-Color[class*=-C214] { + color: #FFAF00 +} + +div.highlight .-Color[class*=-BGC214] { + background-color: #FFAF00 +} + +div.highlight .-Color[class*=-C215] { + color: #FFAF5F +} + +div.highlight .-Color[class*=-BGC215] { + background-color: #FFAF5F +} + +div.highlight .-Color[class*=-C216] { + color: #FFAF87 +} + +div.highlight .-Color[class*=-BGC216] { + background-color: #FFAF87 +} + +div.highlight .-Color[class*=-C217] { + color: #FFAFAF +} + +div.highlight .-Color[class*=-BGC217] { + background-color: #FFAFAF +} + +div.highlight .-Color[class*=-C218] { + color: #FFAFD7 +} + +div.highlight .-Color[class*=-BGC218] { + background-color: #FFAFD7 +} + +div.highlight .-Color[class*=-C219] { + color: #FFAFFF +} + +div.highlight .-Color[class*=-BGC219] { + background-color: #FFAFFF +} + +div.highlight .-Color[class*=-C220] { + color: #FFD700 +} + +div.highlight .-Color[class*=-BGC220] { + background-color: #FFD700 +} + +div.highlight .-Color[class*=-C221] { + color: #FFD75F +} + +div.highlight .-Color[class*=-BGC221] { + background-color: #FFD75F +} + +div.highlight .-Color[class*=-C222] { + color: #FFD787 +} + +div.highlight .-Color[class*=-BGC222] { + background-color: #FFD787 +} + +div.highlight .-Color[class*=-C223] { + color: #FFD7AF +} + +div.highlight .-Color[class*=-BGC223] { + background-color: #FFD7AF +} + +div.highlight .-Color[class*=-C224] { + color: #FFD7D7 +} + +div.highlight .-Color[class*=-BGC224] { + background-color: #FFD7D7 +} + +div.highlight .-Color[class*=-C225] { + color: #FFD7FF +} + +div.highlight .-Color[class*=-BGC225] { + background-color: #FFD7FF +} + +div.highlight .-Color[class*=-C226] { + color: #FFFF00 +} + +div.highlight .-Color[class*=-BGC226] { + background-color: #FFFF00 +} + +div.highlight .-Color[class*=-C227] { + color: #FFFF5F +} + +div.highlight .-Color[class*=-BGC227] { + background-color: #FFFF5F +} + +div.highlight .-Color[class*=-C228] { + color: #FFFF87 +} + +div.highlight .-Color[class*=-BGC228] { + background-color: #FFFF87 +} + +div.highlight .-Color[class*=-C229] { + color: #FFFFAF +} + +div.highlight .-Color[class*=-BGC229] { + background-color: #FFFFAF +} + +div.highlight .-Color[class*=-C230] { + color: #FFFFD7 +} + +div.highlight .-Color[class*=-BGC230] { + background-color: #FFFFD7 +} + +div.highlight .-Color[class*=-C231] { + color: #FFFFFF +} + +div.highlight .-Color[class*=-BGC231] { + background-color: #FFFFFF +} + +div.highlight .-Color[class*=-C232] { + color: #080808 +} + +div.highlight .-Color[class*=-BGC232] { + background-color: #080808 +} + +div.highlight .-Color[class*=-C233] { + color: #121212 +} + +div.highlight .-Color[class*=-BGC233] { + background-color: #121212 +} + +div.highlight .-Color[class*=-C234] { + color: #1C1C1C +} + +div.highlight .-Color[class*=-BGC234] { + background-color: #1C1C1C +} + +div.highlight .-Color[class*=-C235] { + color: #262626 +} + +div.highlight .-Color[class*=-BGC235] { + background-color: #262626 +} + +div.highlight .-Color[class*=-C236] { + color: #303030 +} + +div.highlight .-Color[class*=-BGC236] { + background-color: #303030 +} + +div.highlight .-Color[class*=-C237] { + color: #3A3A3A +} + +div.highlight .-Color[class*=-BGC237] { + background-color: #3A3A3A +} + +div.highlight .-Color[class*=-C238] { + color: #444444 +} + +div.highlight .-Color[class*=-BGC238] { + background-color: #444444 +} + +div.highlight .-Color[class*=-C239] { + color: #4E4E4E +} + +div.highlight .-Color[class*=-BGC239] { + background-color: #4E4E4E +} + +div.highlight .-Color[class*=-C240] { + color: #585858 +} + +div.highlight .-Color[class*=-BGC240] { + background-color: #585858 +} + +div.highlight .-Color[class*=-C241] { + color: #626262 +} + +div.highlight .-Color[class*=-BGC241] { + background-color: #626262 +} + +div.highlight .-Color[class*=-C242] { + color: #6C6C6C +} + +div.highlight .-Color[class*=-BGC242] { + background-color: #6C6C6C +} + +div.highlight .-Color[class*=-C243] { + color: #767676 +} + +div.highlight .-Color[class*=-BGC243] { + background-color: #767676 +} + +div.highlight .-Color[class*=-C244] { + color: #808080 +} + +div.highlight .-Color[class*=-BGC244] { + background-color: #808080 +} + +div.highlight .-Color[class*=-C245] { + color: #8A8A8A +} + +div.highlight .-Color[class*=-BGC245] { + background-color: #8A8A8A +} + +div.highlight .-Color[class*=-C246] { + color: #949494 +} + +div.highlight .-Color[class*=-BGC246] { + background-color: #949494 +} + +div.highlight .-Color[class*=-C247] { + color: #9E9E9E +} + +div.highlight .-Color[class*=-BGC247] { + background-color: #9E9E9E +} + +div.highlight .-Color[class*=-C248] { + color: #A8A8A8 +} + +div.highlight .-Color[class*=-BGC248] { + background-color: #A8A8A8 +} + +div.highlight .-Color[class*=-C249] { + color: #B2B2B2 +} + +div.highlight .-Color[class*=-BGC249] { + background-color: #B2B2B2 +} + +div.highlight .-Color[class*=-C250] { + color: #BCBCBC +} + +div.highlight .-Color[class*=-BGC250] { + background-color: #BCBCBC +} + +div.highlight .-Color[class*=-C251] { + color: #C6C6C6 +} + +div.highlight .-Color[class*=-BGC251] { + background-color: #C6C6C6 +} + +div.highlight .-Color[class*=-C252] { + color: #D0D0D0 +} + +div.highlight .-Color[class*=-BGC252] { + background-color: #D0D0D0 +} + +div.highlight .-Color[class*=-C253] { + color: #DADADA +} + +div.highlight .-Color[class*=-BGC253] { + background-color: #DADADA +} + +div.highlight .-Color[class*=-C254] { + color: #E4E4E4 +} + +div.highlight .-Color[class*=-BGC254] { + background-color: #E4E4E4 +} + +div.highlight .-Color[class*=-C255] { + color: #EEEEEE +} + +div.highlight .-Color[class*=-BGC255] { + background-color: #EEEEEE +} diff --git a/_static/plus.png b/_static/plus.png new file mode 100644 index 00000000..7107cec9 Binary files /dev/null and b/_static/plus.png differ diff --git a/_static/pygments.css b/_static/pygments.css new file mode 100644 index 00000000..012e6a00 --- /dev/null +++ b/_static/pygments.css @@ -0,0 +1,152 @@ +html[data-theme="light"] .highlight pre { line-height: 125%; } +html[data-theme="light"] .highlight td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight .hll { background-color: #fae4c2 } +html[data-theme="light"] .highlight { background: #fefefe; color: #080808 } +html[data-theme="light"] .highlight .c { color: #515151 } /* Comment */ +html[data-theme="light"] .highlight .err { color: #a12236 } /* Error */ +html[data-theme="light"] .highlight .k { color: #6730c5 } /* Keyword */ +html[data-theme="light"] .highlight .l { color: #7f4707 } /* Literal */ +html[data-theme="light"] .highlight .n { color: #080808 } /* Name */ +html[data-theme="light"] .highlight .o { color: #00622f } /* Operator */ +html[data-theme="light"] .highlight .p { color: #080808 } /* Punctuation */ +html[data-theme="light"] .highlight .ch { color: #515151 } /* Comment.Hashbang */ +html[data-theme="light"] .highlight .cm { color: #515151 } /* Comment.Multiline */ +html[data-theme="light"] .highlight .cp { color: #515151 } /* Comment.Preproc */ +html[data-theme="light"] .highlight .cpf { color: #515151 } /* Comment.PreprocFile */ +html[data-theme="light"] .highlight .c1 { color: #515151 } /* Comment.Single */ +html[data-theme="light"] .highlight .cs { color: #515151 } /* Comment.Special */ +html[data-theme="light"] .highlight .gd { color: #005b82 } /* Generic.Deleted */ +html[data-theme="light"] .highlight .ge { font-style: italic } /* Generic.Emph */ +html[data-theme="light"] .highlight .gh { color: #005b82 } /* Generic.Heading */ +html[data-theme="light"] .highlight .gs { font-weight: bold } /* Generic.Strong */ +html[data-theme="light"] .highlight .gu { color: #005b82 } /* Generic.Subheading */ +html[data-theme="light"] .highlight .kc { color: #6730c5 } /* Keyword.Constant */ +html[data-theme="light"] .highlight .kd { color: #6730c5 } /* Keyword.Declaration */ +html[data-theme="light"] .highlight .kn { color: #6730c5 } /* Keyword.Namespace */ +html[data-theme="light"] .highlight .kp { color: #6730c5 } /* Keyword.Pseudo */ +html[data-theme="light"] .highlight .kr { color: #6730c5 } /* Keyword.Reserved */ +html[data-theme="light"] .highlight .kt { color: #7f4707 } /* Keyword.Type */ +html[data-theme="light"] .highlight .ld { color: #7f4707 } /* Literal.Date */ +html[data-theme="light"] .highlight .m { color: #7f4707 } /* Literal.Number */ +html[data-theme="light"] .highlight .s { color: #00622f } /* Literal.String */ +html[data-theme="light"] .highlight .na { color: #912583 } /* Name.Attribute */ +html[data-theme="light"] .highlight .nb { color: #7f4707 } /* Name.Builtin */ +html[data-theme="light"] .highlight .nc { color: #005b82 } /* Name.Class */ +html[data-theme="light"] .highlight .no { color: #005b82 } /* Name.Constant */ +html[data-theme="light"] .highlight .nd { color: #7f4707 } /* Name.Decorator */ +html[data-theme="light"] .highlight .ni { color: #00622f } /* Name.Entity */ +html[data-theme="light"] .highlight .ne { color: #6730c5 } /* Name.Exception */ +html[data-theme="light"] .highlight .nf { color: #005b82 } /* Name.Function */ +html[data-theme="light"] .highlight .nl { color: #7f4707 } /* Name.Label */ +html[data-theme="light"] .highlight .nn { color: #080808 } /* Name.Namespace */ +html[data-theme="light"] .highlight .nx { color: #080808 } /* Name.Other */ +html[data-theme="light"] .highlight .py { color: #005b82 } /* Name.Property */ +html[data-theme="light"] .highlight .nt { color: #005b82 } /* Name.Tag */ +html[data-theme="light"] .highlight .nv { color: #a12236 } /* Name.Variable */ +html[data-theme="light"] .highlight .ow { color: #6730c5 } /* Operator.Word */ +html[data-theme="light"] .highlight .pm { color: #080808 } /* Punctuation.Marker */ +html[data-theme="light"] .highlight .w { color: #080808 } /* Text.Whitespace */ +html[data-theme="light"] .highlight .mb { color: #7f4707 } /* Literal.Number.Bin */ +html[data-theme="light"] .highlight .mf { color: #7f4707 } /* Literal.Number.Float */ +html[data-theme="light"] .highlight .mh { color: #7f4707 } /* Literal.Number.Hex */ +html[data-theme="light"] .highlight .mi { color: #7f4707 } /* Literal.Number.Integer */ +html[data-theme="light"] .highlight .mo { color: #7f4707 } /* Literal.Number.Oct */ +html[data-theme="light"] .highlight .sa { color: #00622f } /* Literal.String.Affix */ +html[data-theme="light"] .highlight .sb { color: #00622f } /* Literal.String.Backtick */ +html[data-theme="light"] .highlight .sc { color: #00622f } /* Literal.String.Char */ +html[data-theme="light"] .highlight .dl { color: #00622f } /* Literal.String.Delimiter */ +html[data-theme="light"] .highlight .sd { color: #00622f } /* Literal.String.Doc */ +html[data-theme="light"] .highlight .s2 { color: #00622f } /* Literal.String.Double */ +html[data-theme="light"] .highlight .se { color: #00622f } /* Literal.String.Escape */ +html[data-theme="light"] .highlight .sh { color: #00622f } /* Literal.String.Heredoc */ +html[data-theme="light"] .highlight .si { color: #00622f } /* Literal.String.Interpol */ +html[data-theme="light"] .highlight .sx { color: #00622f } /* Literal.String.Other */ +html[data-theme="light"] .highlight .sr { color: #a12236 } /* Literal.String.Regex */ +html[data-theme="light"] .highlight .s1 { color: #00622f } /* Literal.String.Single */ +html[data-theme="light"] .highlight .ss { color: #005b82 } /* Literal.String.Symbol */ +html[data-theme="light"] .highlight .bp { color: #7f4707 } /* Name.Builtin.Pseudo */ +html[data-theme="light"] .highlight .fm { color: #005b82 } /* Name.Function.Magic */ +html[data-theme="light"] .highlight .vc { color: #a12236 } /* Name.Variable.Class */ +html[data-theme="light"] .highlight .vg { color: #a12236 } /* Name.Variable.Global */ +html[data-theme="light"] .highlight .vi { color: #a12236 } /* Name.Variable.Instance */ +html[data-theme="light"] .highlight .vm { color: #7f4707 } /* Name.Variable.Magic */ +html[data-theme="light"] .highlight .il { color: #7f4707 } /* Literal.Number.Integer.Long */ +html[data-theme="dark"] .highlight pre { line-height: 125%; } +html[data-theme="dark"] .highlight td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight .hll { background-color: #ffd9002e } +html[data-theme="dark"] .highlight { background: #2b2b2b; color: #f8f8f2 } +html[data-theme="dark"] .highlight .c { color: #ffd900 } /* Comment */ +html[data-theme="dark"] .highlight .err { color: #ffa07a } /* Error */ +html[data-theme="dark"] .highlight .k { color: #dcc6e0 } /* Keyword */ +html[data-theme="dark"] .highlight .l { color: #ffd900 } /* Literal */ +html[data-theme="dark"] .highlight .n { color: #f8f8f2 } /* Name */ +html[data-theme="dark"] .highlight .o { color: #abe338 } /* Operator */ +html[data-theme="dark"] .highlight .p { color: #f8f8f2 } /* Punctuation */ +html[data-theme="dark"] .highlight .ch { color: #ffd900 } /* Comment.Hashbang */ +html[data-theme="dark"] .highlight .cm { color: #ffd900 } /* Comment.Multiline */ +html[data-theme="dark"] .highlight .cp { color: #ffd900 } /* Comment.Preproc */ +html[data-theme="dark"] .highlight .cpf { color: #ffd900 } /* Comment.PreprocFile */ +html[data-theme="dark"] .highlight .c1 { color: #ffd900 } /* Comment.Single */ +html[data-theme="dark"] .highlight .cs { color: #ffd900 } /* Comment.Special */ +html[data-theme="dark"] .highlight .gd { color: #00e0e0 } /* Generic.Deleted */ +html[data-theme="dark"] .highlight .ge { font-style: italic } /* Generic.Emph */ +html[data-theme="dark"] .highlight .gh { color: #00e0e0 } /* Generic.Heading */ +html[data-theme="dark"] .highlight .gs { font-weight: bold } /* Generic.Strong */ +html[data-theme="dark"] .highlight .gu { color: #00e0e0 } /* Generic.Subheading */ +html[data-theme="dark"] .highlight .kc { color: #dcc6e0 } /* Keyword.Constant */ +html[data-theme="dark"] .highlight .kd { color: #dcc6e0 } /* Keyword.Declaration */ +html[data-theme="dark"] .highlight .kn { color: #dcc6e0 } /* Keyword.Namespace */ +html[data-theme="dark"] .highlight .kp { color: #dcc6e0 } /* Keyword.Pseudo */ +html[data-theme="dark"] .highlight .kr { color: #dcc6e0 } /* Keyword.Reserved */ +html[data-theme="dark"] .highlight .kt { color: #ffd900 } /* Keyword.Type */ +html[data-theme="dark"] .highlight .ld { color: #ffd900 } /* Literal.Date */ +html[data-theme="dark"] .highlight .m { color: #ffd900 } /* Literal.Number */ +html[data-theme="dark"] .highlight .s { color: #abe338 } /* Literal.String */ +html[data-theme="dark"] .highlight .na { color: #ffd900 } /* Name.Attribute */ +html[data-theme="dark"] .highlight .nb { color: #ffd900 } /* Name.Builtin */ +html[data-theme="dark"] .highlight .nc { color: #00e0e0 } /* Name.Class */ +html[data-theme="dark"] .highlight .no { color: #00e0e0 } /* Name.Constant */ +html[data-theme="dark"] .highlight .nd { color: #ffd900 } /* Name.Decorator */ +html[data-theme="dark"] .highlight .ni { color: #abe338 } /* Name.Entity */ +html[data-theme="dark"] .highlight .ne { color: #dcc6e0 } /* Name.Exception */ +html[data-theme="dark"] .highlight .nf { color: #00e0e0 } /* Name.Function */ +html[data-theme="dark"] .highlight .nl { color: #ffd900 } /* Name.Label */ +html[data-theme="dark"] .highlight .nn { color: #f8f8f2 } /* Name.Namespace */ +html[data-theme="dark"] .highlight .nx { color: #f8f8f2 } /* Name.Other */ +html[data-theme="dark"] .highlight .py { color: #00e0e0 } /* Name.Property */ +html[data-theme="dark"] .highlight .nt { color: #00e0e0 } /* Name.Tag */ +html[data-theme="dark"] .highlight .nv { color: #ffa07a } /* Name.Variable */ +html[data-theme="dark"] .highlight .ow { color: #dcc6e0 } /* Operator.Word */ +html[data-theme="dark"] .highlight .pm { color: #f8f8f2 } /* Punctuation.Marker */ +html[data-theme="dark"] .highlight .w { color: #f8f8f2 } /* Text.Whitespace */ +html[data-theme="dark"] .highlight .mb { color: #ffd900 } /* Literal.Number.Bin */ +html[data-theme="dark"] .highlight .mf { color: #ffd900 } /* Literal.Number.Float */ +html[data-theme="dark"] .highlight .mh { color: #ffd900 } /* Literal.Number.Hex */ +html[data-theme="dark"] .highlight .mi { color: #ffd900 } /* Literal.Number.Integer */ +html[data-theme="dark"] .highlight .mo { color: #ffd900 } /* Literal.Number.Oct */ +html[data-theme="dark"] .highlight .sa { color: #abe338 } /* Literal.String.Affix */ +html[data-theme="dark"] .highlight .sb { color: #abe338 } /* Literal.String.Backtick */ +html[data-theme="dark"] .highlight .sc { color: #abe338 } /* Literal.String.Char */ +html[data-theme="dark"] .highlight .dl { color: #abe338 } /* Literal.String.Delimiter */ +html[data-theme="dark"] .highlight .sd { color: #abe338 } /* Literal.String.Doc */ +html[data-theme="dark"] .highlight .s2 { color: #abe338 } /* Literal.String.Double */ +html[data-theme="dark"] .highlight .se { color: #abe338 } /* Literal.String.Escape */ +html[data-theme="dark"] .highlight .sh { color: #abe338 } /* Literal.String.Heredoc */ +html[data-theme="dark"] .highlight .si { color: #abe338 } /* Literal.String.Interpol */ +html[data-theme="dark"] .highlight .sx { color: #abe338 } /* Literal.String.Other */ +html[data-theme="dark"] .highlight .sr { color: #ffa07a } /* Literal.String.Regex */ +html[data-theme="dark"] .highlight .s1 { color: #abe338 } /* Literal.String.Single */ +html[data-theme="dark"] .highlight .ss { color: #00e0e0 } /* Literal.String.Symbol */ +html[data-theme="dark"] .highlight .bp { color: #ffd900 } /* Name.Builtin.Pseudo */ +html[data-theme="dark"] .highlight .fm { color: #00e0e0 } /* Name.Function.Magic */ +html[data-theme="dark"] .highlight .vc { color: #ffa07a } /* Name.Variable.Class */ +html[data-theme="dark"] .highlight .vg { color: #ffa07a } /* Name.Variable.Global */ +html[data-theme="dark"] .highlight .vi { color: #ffa07a } /* Name.Variable.Instance */ +html[data-theme="dark"] .highlight .vm { color: #ffd900 } /* Name.Variable.Magic */ +html[data-theme="dark"] .highlight .il { color: #ffd900 } /* Literal.Number.Integer.Long */ \ No newline at end of file diff --git a/_static/sbt-webpack-macros.html b/_static/sbt-webpack-macros.html new file mode 100644 index 00000000..6cbf559f --- /dev/null +++ b/_static/sbt-webpack-macros.html @@ -0,0 +1,11 @@ + +{% macro head_pre_bootstrap() %} + +{% endmacro %} + +{% macro body_post() %} + +{% endmacro %} diff --git a/_static/scripts/bootstrap.js b/_static/scripts/bootstrap.js new file mode 100644 index 00000000..c8178deb --- /dev/null +++ b/_static/scripts/bootstrap.js @@ -0,0 +1,3 @@ +/*! For license information please see bootstrap.js.LICENSE.txt */ +(()=>{"use strict";var t={d:(e,i)=>{for(var n in i)t.o(i,n)&&!t.o(e,n)&&Object.defineProperty(e,n,{enumerable:!0,get:i[n]})},o:(t,e)=>Object.prototype.hasOwnProperty.call(t,e),r:t=>{"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(t,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(t,"__esModule",{value:!0})}},e={};t.r(e),t.d(e,{afterMain:()=>E,afterRead:()=>v,afterWrite:()=>C,applyStyles:()=>$,arrow:()=>J,auto:()=>a,basePlacements:()=>l,beforeMain:()=>y,beforeRead:()=>_,beforeWrite:()=>A,bottom:()=>s,clippingParents:()=>d,computeStyles:()=>it,createPopper:()=>Dt,createPopperBase:()=>St,createPopperLite:()=>$t,detectOverflow:()=>_t,end:()=>h,eventListeners:()=>st,flip:()=>bt,hide:()=>wt,left:()=>r,main:()=>w,modifierPhases:()=>O,offset:()=>Et,placements:()=>g,popper:()=>f,popperGenerator:()=>Lt,popperOffsets:()=>At,preventOverflow:()=>Tt,read:()=>b,reference:()=>p,right:()=>o,start:()=>c,top:()=>n,variationPlacements:()=>m,viewport:()=>u,write:()=>T});var i={};t.r(i),t.d(i,{Alert:()=>Oe,Button:()=>ke,Carousel:()=>li,Collapse:()=>Ei,Dropdown:()=>Ki,Modal:()=>Ln,Offcanvas:()=>Kn,Popover:()=>bs,ScrollSpy:()=>Ls,Tab:()=>Js,Toast:()=>po,Tooltip:()=>fs});var n="top",s="bottom",o="right",r="left",a="auto",l=[n,s,o,r],c="start",h="end",d="clippingParents",u="viewport",f="popper",p="reference",m=l.reduce((function(t,e){return t.concat([e+"-"+c,e+"-"+h])}),[]),g=[].concat(l,[a]).reduce((function(t,e){return t.concat([e,e+"-"+c,e+"-"+h])}),[]),_="beforeRead",b="read",v="afterRead",y="beforeMain",w="main",E="afterMain",A="beforeWrite",T="write",C="afterWrite",O=[_,b,v,y,w,E,A,T,C];function x(t){return t?(t.nodeName||"").toLowerCase():null}function k(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function L(t){return t instanceof k(t).Element||t instanceof Element}function S(t){return t instanceof k(t).HTMLElement||t instanceof HTMLElement}function D(t){return"undefined"!=typeof ShadowRoot&&(t instanceof k(t).ShadowRoot||t instanceof ShadowRoot)}const $={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];S(s)&&x(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});S(n)&&x(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function I(t){return t.split("-")[0]}var N=Math.max,P=Math.min,M=Math.round;function j(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function F(){return!/^((?!chrome|android).)*safari/i.test(j())}function H(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&S(t)&&(s=t.offsetWidth>0&&M(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&M(n.height)/t.offsetHeight||1);var r=(L(t)?k(t):window).visualViewport,a=!F()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function B(t){var e=H(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function W(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&D(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function z(t){return k(t).getComputedStyle(t)}function R(t){return["table","td","th"].indexOf(x(t))>=0}function q(t){return((L(t)?t.ownerDocument:t.document)||window.document).documentElement}function V(t){return"html"===x(t)?t:t.assignedSlot||t.parentNode||(D(t)?t.host:null)||q(t)}function Y(t){return S(t)&&"fixed"!==z(t).position?t.offsetParent:null}function K(t){for(var e=k(t),i=Y(t);i&&R(i)&&"static"===z(i).position;)i=Y(i);return i&&("html"===x(i)||"body"===x(i)&&"static"===z(i).position)?e:i||function(t){var e=/firefox/i.test(j());if(/Trident/i.test(j())&&S(t)&&"fixed"===z(t).position)return null;var i=V(t);for(D(i)&&(i=i.host);S(i)&&["html","body"].indexOf(x(i))<0;){var n=z(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Q(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function X(t,e,i){return N(t,P(e,i))}function U(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function G(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const J={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,a=t.name,c=t.options,h=i.elements.arrow,d=i.modifiersData.popperOffsets,u=I(i.placement),f=Q(u),p=[r,o].indexOf(u)>=0?"height":"width";if(h&&d){var m=function(t,e){return U("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:G(t,l))}(c.padding,i),g=B(h),_="y"===f?n:r,b="y"===f?s:o,v=i.rects.reference[p]+i.rects.reference[f]-d[f]-i.rects.popper[p],y=d[f]-i.rects.reference[f],w=K(h),E=w?"y"===f?w.clientHeight||0:w.clientWidth||0:0,A=v/2-y/2,T=m[_],C=E-g[p]-m[b],O=E/2-g[p]/2+A,x=X(T,O,C),k=f;i.modifiersData[a]=((e={})[k]=x,e.centerOffset=x-O,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&W(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Z(t){return t.split("-")[1]}var tt={top:"auto",right:"auto",bottom:"auto",left:"auto"};function et(t){var e,i=t.popper,a=t.popperRect,l=t.placement,c=t.variation,d=t.offsets,u=t.position,f=t.gpuAcceleration,p=t.adaptive,m=t.roundOffsets,g=t.isFixed,_=d.x,b=void 0===_?0:_,v=d.y,y=void 0===v?0:v,w="function"==typeof m?m({x:b,y}):{x:b,y};b=w.x,y=w.y;var E=d.hasOwnProperty("x"),A=d.hasOwnProperty("y"),T=r,C=n,O=window;if(p){var x=K(i),L="clientHeight",S="clientWidth";x===k(i)&&"static"!==z(x=q(i)).position&&"absolute"===u&&(L="scrollHeight",S="scrollWidth"),(l===n||(l===r||l===o)&&c===h)&&(C=s,y-=(g&&x===O&&O.visualViewport?O.visualViewport.height:x[L])-a.height,y*=f?1:-1),l!==r&&(l!==n&&l!==s||c!==h)||(T=o,b-=(g&&x===O&&O.visualViewport?O.visualViewport.width:x[S])-a.width,b*=f?1:-1)}var D,$=Object.assign({position:u},p&&tt),I=!0===m?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:M(i*s)/s||0,y:M(n*s)/s||0}}({x:b,y},k(i)):{x:b,y};return b=I.x,y=I.y,f?Object.assign({},$,((D={})[C]=A?"0":"",D[T]=E?"0":"",D.transform=(O.devicePixelRatio||1)<=1?"translate("+b+"px, "+y+"px)":"translate3d("+b+"px, "+y+"px, 0)",D)):Object.assign({},$,((e={})[C]=A?y+"px":"",e[T]=E?b+"px":"",e.transform="",e))}const it={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:I(e.placement),variation:Z(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,et(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,et(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var nt={passive:!0};const st={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=k(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,nt)})),a&&l.addEventListener("resize",i.update,nt),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,nt)})),a&&l.removeEventListener("resize",i.update,nt)}},data:{}};var ot={left:"right",right:"left",bottom:"top",top:"bottom"};function rt(t){return t.replace(/left|right|bottom|top/g,(function(t){return ot[t]}))}var at={start:"end",end:"start"};function lt(t){return t.replace(/start|end/g,(function(t){return at[t]}))}function ct(t){var e=k(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function ht(t){return H(q(t)).left+ct(t).scrollLeft}function dt(t){var e=z(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function ut(t){return["html","body","#document"].indexOf(x(t))>=0?t.ownerDocument.body:S(t)&&dt(t)?t:ut(V(t))}function ft(t,e){var i;void 0===e&&(e=[]);var n=ut(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=k(n),r=s?[o].concat(o.visualViewport||[],dt(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(ft(V(r)))}function pt(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function mt(t,e,i){return e===u?pt(function(t,e){var i=k(t),n=q(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=F();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+ht(t),y:l}}(t,i)):L(e)?function(t,e){var i=H(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):pt(function(t){var e,i=q(t),n=ct(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=N(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=N(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+ht(t),l=-n.scrollTop;return"rtl"===z(s||i).direction&&(a+=N(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(q(t)))}function gt(t){var e,i=t.reference,a=t.element,l=t.placement,d=l?I(l):null,u=l?Z(l):null,f=i.x+i.width/2-a.width/2,p=i.y+i.height/2-a.height/2;switch(d){case n:e={x:f,y:i.y-a.height};break;case s:e={x:f,y:i.y+i.height};break;case o:e={x:i.x+i.width,y:p};break;case r:e={x:i.x-a.width,y:p};break;default:e={x:i.x,y:i.y}}var m=d?Q(d):null;if(null!=m){var g="y"===m?"height":"width";switch(u){case c:e[m]=e[m]-(i[g]/2-a[g]/2);break;case h:e[m]=e[m]+(i[g]/2-a[g]/2)}}return e}function _t(t,e){void 0===e&&(e={});var i=e,r=i.placement,a=void 0===r?t.placement:r,c=i.strategy,h=void 0===c?t.strategy:c,m=i.boundary,g=void 0===m?d:m,_=i.rootBoundary,b=void 0===_?u:_,v=i.elementContext,y=void 0===v?f:v,w=i.altBoundary,E=void 0!==w&&w,A=i.padding,T=void 0===A?0:A,C=U("number"!=typeof T?T:G(T,l)),O=y===f?p:f,k=t.rects.popper,D=t.elements[E?O:y],$=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=ft(V(t)),i=["absolute","fixed"].indexOf(z(t).position)>=0&&S(t)?K(t):t;return L(i)?e.filter((function(t){return L(t)&&W(t,i)&&"body"!==x(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=mt(t,i,n);return e.top=N(s.top,e.top),e.right=P(s.right,e.right),e.bottom=P(s.bottom,e.bottom),e.left=N(s.left,e.left),e}),mt(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(L(D)?D:D.contextElement||q(t.elements.popper),g,b,h),I=H(t.elements.reference),M=gt({reference:I,element:k,strategy:"absolute",placement:a}),j=pt(Object.assign({},k,M)),F=y===f?j:I,B={top:$.top-F.top+C.top,bottom:F.bottom-$.bottom+C.bottom,left:$.left-F.left+C.left,right:F.right-$.right+C.right},R=t.modifiersData.offset;if(y===f&&R){var Y=R[a];Object.keys(B).forEach((function(t){var e=[o,s].indexOf(t)>=0?1:-1,i=[n,s].indexOf(t)>=0?"y":"x";B[t]+=Y[i]*e}))}return B}const bt={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,h=t.name;if(!e.modifiersData[h]._skip){for(var d=i.mainAxis,u=void 0===d||d,f=i.altAxis,p=void 0===f||f,_=i.fallbackPlacements,b=i.padding,v=i.boundary,y=i.rootBoundary,w=i.altBoundary,E=i.flipVariations,A=void 0===E||E,T=i.allowedAutoPlacements,C=e.options.placement,O=I(C),x=_||(O!==C&&A?function(t){if(I(t)===a)return[];var e=rt(t);return[lt(t),e,lt(e)]}(C):[rt(C)]),k=[C].concat(x).reduce((function(t,i){return t.concat(I(i)===a?function(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,c=i.allowedAutoPlacements,h=void 0===c?g:c,d=Z(n),u=d?a?m:m.filter((function(t){return Z(t)===d})):l,f=u.filter((function(t){return h.indexOf(t)>=0}));0===f.length&&(f=u);var p=f.reduce((function(e,i){return e[i]=_t(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[I(i)],e}),{});return Object.keys(p).sort((function(t,e){return p[t]-p[e]}))}(e,{placement:i,boundary:v,rootBoundary:y,padding:b,flipVariations:A,allowedAutoPlacements:T}):i)}),[]),L=e.rects.reference,S=e.rects.popper,D=new Map,$=!0,N=k[0],P=0;P=0,B=H?"width":"height",W=_t(e,{placement:M,boundary:v,rootBoundary:y,altBoundary:w,padding:b}),z=H?F?o:r:F?s:n;L[B]>S[B]&&(z=rt(z));var R=rt(z),q=[];if(u&&q.push(W[j]<=0),p&&q.push(W[z]<=0,W[R]<=0),q.every((function(t){return t}))){N=M,$=!1;break}D.set(M,q)}if($)for(var V=function(t){var e=k.find((function(e){var i=D.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return N=e,"break"},Y=A?3:1;Y>0&&"break"!==V(Y);Y--);e.placement!==N&&(e.modifiersData[h]._skip=!0,e.placement=N,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function vt(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function yt(t){return[n,o,s,r].some((function(e){return t[e]>=0}))}const wt={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=_t(e,{elementContext:"reference"}),a=_t(e,{altBoundary:!0}),l=vt(r,n),c=vt(a,s,o),h=yt(l),d=yt(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},Et={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,s=t.name,a=i.offset,l=void 0===a?[0,0]:a,c=g.reduce((function(t,i){return t[i]=function(t,e,i){var s=I(t),a=[r,n].indexOf(s)>=0?-1:1,l="function"==typeof i?i(Object.assign({},e,{placement:t})):i,c=l[0],h=l[1];return c=c||0,h=(h||0)*a,[r,o].indexOf(s)>=0?{x:h,y:c}:{x:c,y:h}}(i,e.rects,l),t}),{}),h=c[e.placement],d=h.x,u=h.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=d,e.modifiersData.popperOffsets.y+=u),e.modifiersData[s]=c}},At={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=gt({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},Tt={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,a=t.name,l=i.mainAxis,h=void 0===l||l,d=i.altAxis,u=void 0!==d&&d,f=i.boundary,p=i.rootBoundary,m=i.altBoundary,g=i.padding,_=i.tether,b=void 0===_||_,v=i.tetherOffset,y=void 0===v?0:v,w=_t(e,{boundary:f,rootBoundary:p,padding:g,altBoundary:m}),E=I(e.placement),A=Z(e.placement),T=!A,C=Q(E),O="x"===C?"y":"x",x=e.modifiersData.popperOffsets,k=e.rects.reference,L=e.rects.popper,S="function"==typeof y?y(Object.assign({},e.rects,{placement:e.placement})):y,D="number"==typeof S?{mainAxis:S,altAxis:S}:Object.assign({mainAxis:0,altAxis:0},S),$=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,M={x:0,y:0};if(x){if(h){var j,F="y"===C?n:r,H="y"===C?s:o,W="y"===C?"height":"width",z=x[C],R=z+w[F],q=z-w[H],V=b?-L[W]/2:0,Y=A===c?k[W]:L[W],U=A===c?-L[W]:-k[W],G=e.elements.arrow,J=b&&G?B(G):{width:0,height:0},tt=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},et=tt[F],it=tt[H],nt=X(0,k[W],J[W]),st=T?k[W]/2-V-nt-et-D.mainAxis:Y-nt-et-D.mainAxis,ot=T?-k[W]/2+V+nt+it+D.mainAxis:U+nt+it+D.mainAxis,rt=e.elements.arrow&&K(e.elements.arrow),at=rt?"y"===C?rt.clientTop||0:rt.clientLeft||0:0,lt=null!=(j=null==$?void 0:$[C])?j:0,ct=z+ot-lt,ht=X(b?P(R,z+st-lt-at):R,z,b?N(q,ct):q);x[C]=ht,M[C]=ht-z}if(u){var dt,ut="x"===C?n:r,ft="x"===C?s:o,pt=x[O],mt="y"===O?"height":"width",gt=pt+w[ut],bt=pt-w[ft],vt=-1!==[n,r].indexOf(E),yt=null!=(dt=null==$?void 0:$[O])?dt:0,wt=vt?gt:pt-k[mt]-L[mt]-yt+D.altAxis,Et=vt?pt+k[mt]+L[mt]-yt-D.altAxis:bt,At=b&&vt?function(t,e,i){var n=X(t,e,i);return n>i?i:n}(wt,pt,Et):X(b?wt:gt,pt,b?Et:bt);x[O]=At,M[O]=At-pt}e.modifiersData[a]=M}},requiresIfExists:["offset"]};function Ct(t,e,i){void 0===i&&(i=!1);var n,s,o=S(e),r=S(e)&&function(t){var e=t.getBoundingClientRect(),i=M(e.width)/t.offsetWidth||1,n=M(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=q(e),l=H(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==x(e)||dt(a))&&(c=(n=e)!==k(n)&&S(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:ct(n)),S(e)?((h=H(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=ht(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function Ot(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var xt={placement:"bottom",modifiers:[],strategy:"absolute"};function kt(){for(var t=arguments.length,e=new Array(t),i=0;iIt.has(t)&&It.get(t).get(e)||null,remove(t,e){if(!It.has(t))return;const i=It.get(t);i.delete(e),0===i.size&&It.delete(t)}},Pt="transitionend",Mt=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),jt=t=>{t.dispatchEvent(new Event(Pt))},Ft=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),Ht=t=>Ft(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(Mt(t)):null,Bt=t=>{if(!Ft(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},Wt=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),zt=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?zt(t.parentNode):null},Rt=()=>{},qt=t=>{t.offsetHeight},Vt=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,Yt=[],Kt=()=>"rtl"===document.documentElement.dir,Qt=t=>{var e;e=()=>{const e=Vt();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(Yt.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of Yt)t()})),Yt.push(e)):e()},Xt=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,Ut=(t,e,i=!0)=>{if(!i)return void Xt(t);const n=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let s=!1;const o=({target:i})=>{i===e&&(s=!0,e.removeEventListener(Pt,o),Xt(t))};e.addEventListener(Pt,o),setTimeout((()=>{s||jt(e)}),n)},Gt=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},Jt=/[^.]*(?=\..*)\.|.*/,Zt=/\..*/,te=/::\d+$/,ee={};let ie=1;const ne={mouseenter:"mouseover",mouseleave:"mouseout"},se=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function oe(t,e){return e&&`${e}::${ie++}`||t.uidEvent||ie++}function re(t){const e=oe(t);return t.uidEvent=e,ee[e]=ee[e]||{},ee[e]}function ae(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function le(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=ue(t);return se.has(o)||(o=t),[n,s,o]}function ce(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=le(e,i,n);if(e in ne){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=re(t),c=l[a]||(l[a]={}),h=ae(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=oe(r,e.replace(Jt,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return pe(s,{delegateTarget:r}),n.oneOff&&fe.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return pe(n,{delegateTarget:t}),i.oneOff&&fe.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function he(t,e,i,n,s){const o=ae(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function de(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&he(t,e,i,r.callable,r.delegationSelector)}function ue(t){return t=t.replace(Zt,""),ne[t]||t}const fe={on(t,e,i,n){ce(t,e,i,n,!1)},one(t,e,i,n){ce(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=le(e,i,n),a=r!==e,l=re(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))de(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(te,"");a&&!e.includes(s)||he(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;he(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=Vt();let s=null,o=!0,r=!0,a=!1;e!==ue(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=pe(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function pe(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function me(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function ge(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const _e={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${ge(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${ge(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=me(t.dataset[n])}return e},getDataAttribute:(t,e)=>me(t.getAttribute(`data-bs-${ge(e)}`))};class be{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=Ft(e)?_e.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...Ft(e)?_e.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],o=Ft(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(o))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${o}" but expected type "${s}".`)}var i}}class ve extends be{constructor(t,e){super(),(t=Ht(t))&&(this._element=t,this._config=this._getConfig(e),Nt.set(this._element,this.constructor.DATA_KEY,this))}dispose(){Nt.remove(this._element,this.constructor.DATA_KEY),fe.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){Ut(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return Nt.get(Ht(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const ye=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e?e.split(",").map((t=>Mt(t))).join(","):null},we={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!Wt(t)&&Bt(t)))},getSelectorFromElement(t){const e=ye(t);return e&&we.findOne(e)?e:null},getElementFromSelector(t){const e=ye(t);return e?we.findOne(e):null},getMultipleElementsFromSelector(t){const e=ye(t);return e?we.find(e):[]}},Ee=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;fe.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),Wt(this))return;const s=we.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},Ae=".bs.alert",Te=`close${Ae}`,Ce=`closed${Ae}`;class Oe extends ve{static get NAME(){return"alert"}close(){if(fe.trigger(this._element,Te).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),fe.trigger(this._element,Ce),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Oe.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}Ee(Oe,"close"),Qt(Oe);const xe='[data-bs-toggle="button"]';class ke extends ve{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=ke.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}fe.on(document,"click.bs.button.data-api",xe,(t=>{t.preventDefault();const e=t.target.closest(xe);ke.getOrCreateInstance(e).toggle()})),Qt(ke);const Le=".bs.swipe",Se=`touchstart${Le}`,De=`touchmove${Le}`,$e=`touchend${Le}`,Ie=`pointerdown${Le}`,Ne=`pointerup${Le}`,Pe={endCallback:null,leftCallback:null,rightCallback:null},Me={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class je extends be{constructor(t,e){super(),this._element=t,t&&je.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return Pe}static get DefaultType(){return Me}static get NAME(){return"swipe"}dispose(){fe.off(this._element,Le)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),Xt(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&Xt(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(fe.on(this._element,Ie,(t=>this._start(t))),fe.on(this._element,Ne,(t=>this._end(t))),this._element.classList.add("pointer-event")):(fe.on(this._element,Se,(t=>this._start(t))),fe.on(this._element,De,(t=>this._move(t))),fe.on(this._element,$e,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const Fe=".bs.carousel",He=".data-api",Be="ArrowLeft",We="ArrowRight",ze="next",Re="prev",qe="left",Ve="right",Ye=`slide${Fe}`,Ke=`slid${Fe}`,Qe=`keydown${Fe}`,Xe=`mouseenter${Fe}`,Ue=`mouseleave${Fe}`,Ge=`dragstart${Fe}`,Je=`load${Fe}${He}`,Ze=`click${Fe}${He}`,ti="carousel",ei="active",ii=".active",ni=".carousel-item",si=ii+ni,oi={[Be]:Ve,[We]:qe},ri={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},ai={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class li extends ve{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=we.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===ti&&this.cycle()}static get Default(){return ri}static get DefaultType(){return ai}static get NAME(){return"carousel"}next(){this._slide(ze)}nextWhenVisible(){!document.hidden&&Bt(this._element)&&this.next()}prev(){this._slide(Re)}pause(){this._isSliding&&jt(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?fe.one(this._element,Ke,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void fe.one(this._element,Ke,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?ze:Re;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&fe.on(this._element,Qe,(t=>this._keydown(t))),"hover"===this._config.pause&&(fe.on(this._element,Xe,(()=>this.pause())),fe.on(this._element,Ue,(()=>this._maybeEnableCycle()))),this._config.touch&&je.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of we.find(".carousel-item img",this._element))fe.on(t,Ge,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(qe)),rightCallback:()=>this._slide(this._directionToOrder(Ve)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new je(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=oi[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=we.findOne(ii,this._indicatorsElement);e.classList.remove(ei),e.removeAttribute("aria-current");const i=we.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(ei),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===ze,s=e||Gt(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>fe.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(Ye).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),qt(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(ei),i.classList.remove(ei,c,l),this._isSliding=!1,r(Ke)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return we.findOne(si,this._element)}_getItems(){return we.find(ni,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return Kt()?t===qe?Re:ze:t===qe?ze:Re}_orderToDirection(t){return Kt()?t===Re?qe:Ve:t===Re?Ve:qe}static jQueryInterface(t){return this.each((function(){const e=li.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}fe.on(document,Ze,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=we.getElementFromSelector(this);if(!e||!e.classList.contains(ti))return;t.preventDefault();const i=li.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===_e.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),fe.on(window,Je,(()=>{const t=we.find('[data-bs-ride="carousel"]');for(const e of t)li.getOrCreateInstance(e)})),Qt(li);const ci=".bs.collapse",hi=`show${ci}`,di=`shown${ci}`,ui=`hide${ci}`,fi=`hidden${ci}`,pi=`click${ci}.data-api`,mi="show",gi="collapse",_i="collapsing",bi=`:scope .${gi} .${gi}`,vi='[data-bs-toggle="collapse"]',yi={parent:null,toggle:!0},wi={parent:"(null|element)",toggle:"boolean"};class Ei extends ve{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=we.find(vi);for(const t of i){const e=we.getSelectorFromElement(t),i=we.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return yi}static get DefaultType(){return wi}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Ei.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(fe.trigger(this._element,hi).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(gi),this._element.classList.add(_i),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_i),this._element.classList.add(gi,mi),this._element.style[e]="",fe.trigger(this._element,di)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(fe.trigger(this._element,ui).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,qt(this._element),this._element.classList.add(_i),this._element.classList.remove(gi,mi);for(const t of this._triggerArray){const e=we.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_i),this._element.classList.add(gi),fe.trigger(this._element,fi)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(mi)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=Ht(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(vi);for(const e of t){const t=we.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=we.find(bi,this._config.parent);return we.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Ei.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}fe.on(document,pi,vi,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of we.getMultipleElementsFromSelector(this))Ei.getOrCreateInstance(t,{toggle:!1}).toggle()})),Qt(Ei);const Ai="dropdown",Ti=".bs.dropdown",Ci=".data-api",Oi="ArrowUp",xi="ArrowDown",ki=`hide${Ti}`,Li=`hidden${Ti}`,Si=`show${Ti}`,Di=`shown${Ti}`,$i=`click${Ti}${Ci}`,Ii=`keydown${Ti}${Ci}`,Ni=`keyup${Ti}${Ci}`,Pi="show",Mi='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',ji=`${Mi}.${Pi}`,Fi=".dropdown-menu",Hi=Kt()?"top-end":"top-start",Bi=Kt()?"top-start":"top-end",Wi=Kt()?"bottom-end":"bottom-start",zi=Kt()?"bottom-start":"bottom-end",Ri=Kt()?"left-start":"right-start",qi=Kt()?"right-start":"left-start",Vi={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},Yi={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class Ki extends ve{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=we.next(this._element,Fi)[0]||we.prev(this._element,Fi)[0]||we.findOne(Fi,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return Vi}static get DefaultType(){return Yi}static get NAME(){return Ai}toggle(){return this._isShown()?this.hide():this.show()}show(){if(Wt(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!fe.trigger(this._element,Si,t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))fe.on(t,"mouseover",Rt);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add(Pi),this._element.classList.add(Pi),fe.trigger(this._element,Di,t)}}hide(){if(Wt(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!fe.trigger(this._element,ki,t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.off(t,"mouseover",Rt);this._popper&&this._popper.destroy(),this._menu.classList.remove(Pi),this._element.classList.remove(Pi),this._element.setAttribute("aria-expanded","false"),_e.removeDataAttribute(this._menu,"popper"),fe.trigger(this._element,Li,t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!Ft(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${Ai.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===e)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:Ft(this._config.reference)?t=Ht(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const i=this._getPopperConfig();this._popper=Dt(t,this._menu,i)}_isShown(){return this._menu.classList.contains(Pi)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Ri;if(t.classList.contains("dropstart"))return qi;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?Bi:Hi:e?zi:Wi}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(_e.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...Xt(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=we.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>Bt(t)));i.length&&Gt(i,e,t===xi,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=Ki.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=we.find(ji);for(const i of e){const e=Ki.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Oi,xi].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Mi)?this:we.prev(this,Mi)[0]||we.next(this,Mi)[0]||we.findOne(Mi,t.delegateTarget.parentNode),o=Ki.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}fe.on(document,Ii,Mi,Ki.dataApiKeydownHandler),fe.on(document,Ii,Fi,Ki.dataApiKeydownHandler),fe.on(document,$i,Ki.clearMenus),fe.on(document,Ni,Ki.clearMenus),fe.on(document,$i,Mi,(function(t){t.preventDefault(),Ki.getOrCreateInstance(this).toggle()})),Qt(Ki);const Qi="backdrop",Xi="show",Ui=`mousedown.bs.${Qi}`,Gi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Ji={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Zi extends be{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Gi}static get DefaultType(){return Ji}static get NAME(){return Qi}show(t){if(!this._config.isVisible)return void Xt(t);this._append();const e=this._getElement();this._config.isAnimated&&qt(e),e.classList.add(Xi),this._emulateAnimation((()=>{Xt(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Xi),this._emulateAnimation((()=>{this.dispose(),Xt(t)}))):Xt(t)}dispose(){this._isAppended&&(fe.off(this._element,Ui),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=Ht(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),fe.on(t,Ui,(()=>{Xt(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){Ut(t,this._getElement(),this._config.isAnimated)}}const tn=".bs.focustrap",en=`focusin${tn}`,nn=`keydown.tab${tn}`,sn="backward",on={autofocus:!0,trapElement:null},rn={autofocus:"boolean",trapElement:"element"};class an extends be{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return on}static get DefaultType(){return rn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),fe.off(document,tn),fe.on(document,en,(t=>this._handleFocusin(t))),fe.on(document,nn,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,fe.off(document,tn))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=we.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===sn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?sn:"forward")}}const ln=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",cn=".sticky-top",hn="padding-right",dn="margin-right";class un{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,hn,(e=>e+t)),this._setElementAttributes(ln,hn,(e=>e+t)),this._setElementAttributes(cn,dn,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,hn),this._resetElementAttributes(ln,hn),this._resetElementAttributes(cn,dn)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&_e.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=_e.getDataAttribute(t,e);null!==i?(_e.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(Ft(t))e(t);else for(const i of we.find(t,this._element))e(i)}}const fn=".bs.modal",pn=`hide${fn}`,mn=`hidePrevented${fn}`,gn=`hidden${fn}`,_n=`show${fn}`,bn=`shown${fn}`,vn=`resize${fn}`,yn=`click.dismiss${fn}`,wn=`mousedown.dismiss${fn}`,En=`keydown.dismiss${fn}`,An=`click${fn}.data-api`,Tn="modal-open",Cn="show",On="modal-static",xn={backdrop:!0,focus:!0,keyboard:!0},kn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class Ln extends ve{constructor(t,e){super(t,e),this._dialog=we.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new un,this._addEventListeners()}static get Default(){return xn}static get DefaultType(){return kn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||fe.trigger(this._element,_n,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(Tn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(fe.trigger(this._element,pn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(Cn),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){fe.off(window,fn),fe.off(this._dialog,fn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Zi({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new an({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=we.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),qt(this._element),this._element.classList.add(Cn),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,fe.trigger(this._element,bn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){fe.on(this._element,En,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),fe.on(window,vn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),fe.on(this._element,wn,(t=>{fe.one(this._element,yn,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(Tn),this._resetAdjustments(),this._scrollBar.reset(),fe.trigger(this._element,gn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(fe.trigger(this._element,mn).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(On)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(On),this._queueCallback((()=>{this._element.classList.remove(On),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=Kt()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=Kt()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=Ln.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}fe.on(document,An,'[data-bs-toggle="modal"]',(function(t){const e=we.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),fe.one(e,_n,(t=>{t.defaultPrevented||fe.one(e,gn,(()=>{Bt(this)&&this.focus()}))}));const i=we.findOne(".modal.show");i&&Ln.getInstance(i).hide(),Ln.getOrCreateInstance(e).toggle(this)})),Ee(Ln),Qt(Ln);const Sn=".bs.offcanvas",Dn=".data-api",$n=`load${Sn}${Dn}`,In="show",Nn="showing",Pn="hiding",Mn=".offcanvas.show",jn=`show${Sn}`,Fn=`shown${Sn}`,Hn=`hide${Sn}`,Bn=`hidePrevented${Sn}`,Wn=`hidden${Sn}`,zn=`resize${Sn}`,Rn=`click${Sn}${Dn}`,qn=`keydown.dismiss${Sn}`,Vn={backdrop:!0,keyboard:!0,scroll:!1},Yn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class Kn extends ve{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return Vn}static get DefaultType(){return Yn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||fe.trigger(this._element,jn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new un).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Nn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(In),this._element.classList.remove(Nn),fe.trigger(this._element,Fn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(fe.trigger(this._element,Hn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add(Pn),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(In,Pn),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new un).reset(),fe.trigger(this._element,Wn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Zi({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():fe.trigger(this._element,Bn)}:null})}_initializeFocusTrap(){return new an({trapElement:this._element})}_addEventListeners(){fe.on(this._element,qn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():fe.trigger(this._element,Bn))}))}static jQueryInterface(t){return this.each((function(){const e=Kn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}fe.on(document,Rn,'[data-bs-toggle="offcanvas"]',(function(t){const e=we.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),Wt(this))return;fe.one(e,Wn,(()=>{Bt(this)&&this.focus()}));const i=we.findOne(Mn);i&&i!==e&&Kn.getInstance(i).hide(),Kn.getOrCreateInstance(e).toggle(this)})),fe.on(window,$n,(()=>{for(const t of we.find(Mn))Kn.getOrCreateInstance(t).show()})),fe.on(window,zn,(()=>{for(const t of we.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&Kn.getOrCreateInstance(t).hide()})),Ee(Kn),Qt(Kn);const Qn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],dd:[],div:[],dl:[],dt:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Xn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Un=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Gn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Xn.has(i)||Boolean(Un.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Jn={allowList:Qn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Zn={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},ts={entry:"(string|element|function|null)",selector:"(string|element)"};class es extends be{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Jn}static get DefaultType(){return Zn}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},ts)}_setContent(t,e,i){const n=we.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?Ft(e)?this._putElementInTemplate(Ht(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Gn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return Xt(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const is=new Set(["sanitize","allowList","sanitizeFn"]),ns="fade",ss="show",os=".tooltip-inner",rs=".modal",as="hide.bs.modal",ls="hover",cs="focus",hs={AUTO:"auto",TOP:"top",RIGHT:Kt()?"left":"right",BOTTOM:"bottom",LEFT:Kt()?"right":"left"},ds={allowList:Qn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},us={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class fs extends ve{constructor(t,i){if(void 0===e)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,i),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return ds}static get DefaultType(){return us}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),fe.off(this._element.closest(rs),as,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=fe.trigger(this._element,this.constructor.eventName("show")),e=(zt(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),fe.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(ss),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.on(t,"mouseover",Rt);this._queueCallback((()=>{fe.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!fe.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(ss),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.off(t,"mouseover",Rt);this._activeTrigger.click=!1,this._activeTrigger[cs]=!1,this._activeTrigger[ls]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),fe.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ns,ss),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ns),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new es({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{[os]:this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ns)}_isShown(){return this.tip&&this.tip.classList.contains(ss)}_createPopper(t){const e=Xt(this._config.placement,[this,t,this._element]),i=hs[e.toUpperCase()];return Dt(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return Xt(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...Xt(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)fe.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ls?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ls?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");fe.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?cs:ls]=!0,e._enter()})),fe.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?cs:ls]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},fe.on(this._element.closest(rs),as,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=_e.getDataAttributes(this._element);for(const t of Object.keys(e))is.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:Ht(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=fs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(fs);const ps=".popover-header",ms=".popover-body",gs={...fs.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},_s={...fs.DefaultType,content:"(null|string|element|function)"};class bs extends fs{static get Default(){return gs}static get DefaultType(){return _s}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{[ps]:this._getTitle(),[ms]:this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=bs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(bs);const vs=".bs.scrollspy",ys=`activate${vs}`,ws=`click${vs}`,Es=`load${vs}.data-api`,As="active",Ts="[href]",Cs=".nav-link",Os=`${Cs}, .nav-item > ${Cs}, .list-group-item`,xs={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},ks={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Ls extends ve{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return xs}static get DefaultType(){return ks}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=Ht(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(fe.off(this._config.target,ws),fe.on(this._config.target,ws,Ts,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=we.find(Ts,this._config.target);for(const e of t){if(!e.hash||Wt(e))continue;const t=we.findOne(decodeURI(e.hash),this._element);Bt(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(As),this._activateParents(t),fe.trigger(this._element,ys,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))we.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(As);else for(const e of we.parents(t,".nav, .list-group"))for(const t of we.prev(e,Os))t.classList.add(As)}_clearActiveClass(t){t.classList.remove(As);const e=we.find(`${Ts}.${As}`,t);for(const t of e)t.classList.remove(As)}static jQueryInterface(t){return this.each((function(){const e=Ls.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}fe.on(window,Es,(()=>{for(const t of we.find('[data-bs-spy="scroll"]'))Ls.getOrCreateInstance(t)})),Qt(Ls);const Ss=".bs.tab",Ds=`hide${Ss}`,$s=`hidden${Ss}`,Is=`show${Ss}`,Ns=`shown${Ss}`,Ps=`click${Ss}`,Ms=`keydown${Ss}`,js=`load${Ss}`,Fs="ArrowLeft",Hs="ArrowRight",Bs="ArrowUp",Ws="ArrowDown",zs="Home",Rs="End",qs="active",Vs="fade",Ys="show",Ks=".dropdown-toggle",Qs=`:not(${Ks})`,Xs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',Us=`.nav-link${Qs}, .list-group-item${Qs}, [role="tab"]${Qs}, ${Xs}`,Gs=`.${qs}[data-bs-toggle="tab"], .${qs}[data-bs-toggle="pill"], .${qs}[data-bs-toggle="list"]`;class Js extends ve{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),fe.on(this._element,Ms,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?fe.trigger(e,Ds,{relatedTarget:t}):null;fe.trigger(t,Is,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(qs),this._activate(we.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),fe.trigger(t,Ns,{relatedTarget:e})):t.classList.add(Ys)}),t,t.classList.contains(Vs)))}_deactivate(t,e){t&&(t.classList.remove(qs),t.blur(),this._deactivate(we.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),fe.trigger(t,$s,{relatedTarget:e})):t.classList.remove(Ys)}),t,t.classList.contains(Vs)))}_keydown(t){if(![Fs,Hs,Bs,Ws,zs,Rs].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!Wt(t)));let i;if([zs,Rs].includes(t.key))i=e[t.key===zs?0:e.length-1];else{const n=[Hs,Ws].includes(t.key);i=Gt(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Js.getOrCreateInstance(i).show())}_getChildren(){return we.find(Us,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=we.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=we.findOne(t,i);s&&s.classList.toggle(n,e)};n(Ks,qs),n(".dropdown-menu",Ys),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(qs)}_getInnerElement(t){return t.matches(Us)?t:we.findOne(Us,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Js.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}fe.on(document,Ps,Xs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),Wt(this)||Js.getOrCreateInstance(this).show()})),fe.on(window,js,(()=>{for(const t of we.find(Gs))Js.getOrCreateInstance(t)})),Qt(Js);const Zs=".bs.toast",to=`mouseover${Zs}`,eo=`mouseout${Zs}`,io=`focusin${Zs}`,no=`focusout${Zs}`,so=`hide${Zs}`,oo=`hidden${Zs}`,ro=`show${Zs}`,ao=`shown${Zs}`,lo="hide",co="show",ho="showing",uo={animation:"boolean",autohide:"boolean",delay:"number"},fo={animation:!0,autohide:!0,delay:5e3};class po extends ve{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return fo}static get DefaultType(){return uo}static get NAME(){return"toast"}show(){fe.trigger(this._element,ro).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(lo),qt(this._element),this._element.classList.add(co,ho),this._queueCallback((()=>{this._element.classList.remove(ho),fe.trigger(this._element,ao),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(fe.trigger(this._element,so).defaultPrevented||(this._element.classList.add(ho),this._queueCallback((()=>{this._element.classList.add(lo),this._element.classList.remove(ho,co),fe.trigger(this._element,oo)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(co),super.dispose()}isShown(){return this._element.classList.contains(co)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){fe.on(this._element,to,(t=>this._onInteraction(t,!0))),fe.on(this._element,eo,(t=>this._onInteraction(t,!1))),fe.on(this._element,io,(t=>this._onInteraction(t,!0))),fe.on(this._element,no,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=po.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}function mo(t){"loading"!=document.readyState?t():document.addEventListener("DOMContentLoaded",t)}Ee(po),Qt(po),mo((function(){[].slice.call(document.querySelectorAll('[data-bs-toggle="tooltip"]')).map((function(t){return new fs(t,{delay:{show:500,hide:100}})}))})),mo((function(){document.getElementById("pst-back-to-top").addEventListener("click",(function(){document.body.scrollTop=0,document.documentElement.scrollTop=0}))})),mo((function(){var t=document.getElementById("pst-back-to-top"),e=document.getElementsByClassName("bd-header")[0].getBoundingClientRect();window.addEventListener("scroll",(function(){this.oldScroll>this.scrollY&&this.scrollY>e.bottom?t.style.display="block":t.style.display="none",this.oldScroll=this.scrollY}))})),window.bootstrap=i})(); +//# sourceMappingURL=bootstrap.js.map \ No newline at end of file diff --git a/_static/scripts/bootstrap.js.LICENSE.txt b/_static/scripts/bootstrap.js.LICENSE.txt new file mode 100644 index 00000000..28755c2c --- /dev/null +++ b/_static/scripts/bootstrap.js.LICENSE.txt @@ -0,0 +1,5 @@ +/*! + * Bootstrap v5.3.3 (https://getbootstrap.com/) + * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ diff --git a/_static/scripts/bootstrap.js.map b/_static/scripts/bootstrap.js.map new file mode 100644 index 00000000..e9e81589 --- /dev/null +++ b/_static/scripts/bootstrap.js.map @@ -0,0 +1 @@ +{"version":3,"file":"scripts/bootstrap.js","mappings":";mBACA,IAAIA,EAAsB,CCA1BA,EAAwB,CAACC,EAASC,KACjC,IAAI,IAAIC,KAAOD,EACXF,EAAoBI,EAAEF,EAAYC,KAASH,EAAoBI,EAAEH,EAASE,IAC5EE,OAAOC,eAAeL,EAASE,EAAK,CAAEI,YAAY,EAAMC,IAAKN,EAAWC,IAE1E,ECNDH,EAAwB,CAACS,EAAKC,IAAUL,OAAOM,UAAUC,eAAeC,KAAKJ,EAAKC,GCClFV,EAAyBC,IACH,oBAAXa,QAA0BA,OAAOC,aAC1CV,OAAOC,eAAeL,EAASa,OAAOC,YAAa,CAAEC,MAAO,WAE7DX,OAAOC,eAAeL,EAAS,aAAc,CAAEe,OAAO,GAAO,01BCLvD,IAAI,EAAM,MACNC,EAAS,SACTC,EAAQ,QACRC,EAAO,OACPC,EAAO,OACPC,EAAiB,CAAC,EAAKJ,EAAQC,EAAOC,GACtCG,EAAQ,QACRC,EAAM,MACNC,EAAkB,kBAClBC,EAAW,WACXC,EAAS,SACTC,EAAY,YACZC,EAAmCP,EAAeQ,QAAO,SAAUC,EAAKC,GACjF,OAAOD,EAAIE,OAAO,CAACD,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAChE,GAAG,IACQ,EAA0B,GAAGS,OAAOX,EAAgB,CAACD,IAAOS,QAAO,SAAUC,EAAKC,GAC3F,OAAOD,EAAIE,OAAO,CAACD,EAAWA,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAC3E,GAAG,IAEQU,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAc,cACdC,EAAQ,QACRC,EAAa,aACbC,EAAiB,CAACT,EAAYC,EAAMC,EAAWC,EAAYC,EAAMC,EAAWC,EAAaC,EAAOC,GC9B5F,SAASE,EAAYC,GAClC,OAAOA,GAAWA,EAAQC,UAAY,IAAIC,cAAgB,IAC5D,CCFe,SAASC,EAAUC,GAChC,GAAY,MAARA,EACF,OAAOC,OAGT,GAAwB,oBAApBD,EAAKE,WAAkC,CACzC,IAAIC,EAAgBH,EAAKG,cACzB,OAAOA,GAAgBA,EAAcC,aAAwBH,MAC/D,CAEA,OAAOD,CACT,CCTA,SAASK,EAAUL,GAEjB,OAAOA,aADUD,EAAUC,GAAMM,SACIN,aAAgBM,OACvD,CAEA,SAASC,EAAcP,GAErB,OAAOA,aADUD,EAAUC,GAAMQ,aACIR,aAAgBQ,WACvD,CAEA,SAASC,EAAaT,GAEpB,MAA0B,oBAAfU,aAKJV,aADUD,EAAUC,GAAMU,YACIV,aAAgBU,WACvD,CCwDA,SACEC,KAAM,cACNC,SAAS,EACTC,MAAO,QACPC,GA5EF,SAAqBC,GACnB,IAAIC,EAAQD,EAAKC,MACjB3D,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIS,EAAQJ,EAAMK,OAAOV,IAAS,CAAC,EAC/BW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EACxCf,EAAUoB,EAAME,SAASP,GAExBJ,EAAcX,IAAaD,EAAYC,KAO5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUR,GACxC,IAAI3C,EAAQsD,EAAWX,IAET,IAAV3C,EACF4B,EAAQ4B,gBAAgBb,GAExBf,EAAQ6B,aAAad,GAAgB,IAAV3C,EAAiB,GAAKA,EAErD,IACF,GACF,EAoDE0D,OAlDF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MACdY,EAAgB,CAClBlD,OAAQ,CACNmD,SAAUb,EAAMc,QAAQC,SACxB5D,KAAM,IACN6D,IAAK,IACLC,OAAQ,KAEVC,MAAO,CACLL,SAAU,YAEZlD,UAAW,CAAC,GASd,OAPAtB,OAAOkE,OAAOP,EAAME,SAASxC,OAAO0C,MAAOQ,EAAclD,QACzDsC,EAAMK,OAASO,EAEXZ,EAAME,SAASgB,OACjB7E,OAAOkE,OAAOP,EAAME,SAASgB,MAAMd,MAAOQ,EAAcM,OAGnD,WACL7E,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIf,EAAUoB,EAAME,SAASP,GACzBW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EAGxCS,EAFkB/D,OAAO4D,KAAKD,EAAMK,OAAOzD,eAAe+C,GAAQK,EAAMK,OAAOV,GAAQiB,EAAcjB,IAE7E9B,QAAO,SAAUuC,EAAOe,GAElD,OADAf,EAAMe,GAAY,GACXf,CACT,GAAG,CAAC,GAECb,EAAcX,IAAaD,EAAYC,KAI5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUiB,GACxCxC,EAAQ4B,gBAAgBY,EAC1B,IACF,GACF,CACF,EASEC,SAAU,CAAC,kBCjFE,SAASC,EAAiBvD,GACvC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCHO,IAAI,EAAMC,KAAKC,IACX,EAAMD,KAAKE,IACXC,EAAQH,KAAKG,MCFT,SAASC,IACtB,IAAIC,EAASC,UAAUC,cAEvB,OAAc,MAAVF,GAAkBA,EAAOG,QAAUC,MAAMC,QAAQL,EAAOG,QACnDH,EAAOG,OAAOG,KAAI,SAAUC,GACjC,OAAOA,EAAKC,MAAQ,IAAMD,EAAKE,OACjC,IAAGC,KAAK,KAGHT,UAAUU,SACnB,CCTe,SAASC,IACtB,OAAQ,iCAAiCC,KAAKd,IAChD,CCCe,SAASe,EAAsB/D,EAASgE,EAAcC,QAC9C,IAAjBD,IACFA,GAAe,QAGO,IAApBC,IACFA,GAAkB,GAGpB,IAAIC,EAAalE,EAAQ+D,wBACrBI,EAAS,EACTC,EAAS,EAETJ,GAAgBrD,EAAcX,KAChCmE,EAASnE,EAAQqE,YAAc,GAAItB,EAAMmB,EAAWI,OAAStE,EAAQqE,aAAmB,EACxFD,EAASpE,EAAQuE,aAAe,GAAIxB,EAAMmB,EAAWM,QAAUxE,EAAQuE,cAAoB,GAG7F,IACIE,GADOhE,EAAUT,GAAWG,EAAUH,GAAWK,QAC3BoE,eAEtBC,GAAoBb,KAAsBI,EAC1CU,GAAKT,EAAW3F,MAAQmG,GAAoBD,EAAiBA,EAAeG,WAAa,IAAMT,EAC/FU,GAAKX,EAAW9B,KAAOsC,GAAoBD,EAAiBA,EAAeK,UAAY,IAAMV,EAC7FE,EAAQJ,EAAWI,MAAQH,EAC3BK,EAASN,EAAWM,OAASJ,EACjC,MAAO,CACLE,MAAOA,EACPE,OAAQA,EACRpC,IAAKyC,EACLvG,MAAOqG,EAAIL,EACXjG,OAAQwG,EAAIL,EACZjG,KAAMoG,EACNA,EAAGA,EACHE,EAAGA,EAEP,CCrCe,SAASE,EAAc/E,GACpC,IAAIkE,EAAaH,EAAsB/D,GAGnCsE,EAAQtE,EAAQqE,YAChBG,EAASxE,EAAQuE,aAUrB,OARI3B,KAAKoC,IAAId,EAAWI,MAAQA,IAAU,IACxCA,EAAQJ,EAAWI,OAGjB1B,KAAKoC,IAAId,EAAWM,OAASA,IAAW,IAC1CA,EAASN,EAAWM,QAGf,CACLG,EAAG3E,EAAQ4E,WACXC,EAAG7E,EAAQ8E,UACXR,MAAOA,EACPE,OAAQA,EAEZ,CCvBe,SAASS,EAASC,EAAQC,GACvC,IAAIC,EAAWD,EAAME,aAAeF,EAAME,cAE1C,GAAIH,EAAOD,SAASE,GAClB,OAAO,EAEJ,GAAIC,GAAYvE,EAAauE,GAAW,CACzC,IAAIE,EAAOH,EAEX,EAAG,CACD,GAAIG,GAAQJ,EAAOK,WAAWD,GAC5B,OAAO,EAITA,EAAOA,EAAKE,YAAcF,EAAKG,IACjC,OAASH,EACX,CAGF,OAAO,CACT,CCrBe,SAAS,EAAiBtF,GACvC,OAAOG,EAAUH,GAAS0F,iBAAiB1F,EAC7C,CCFe,SAAS2F,EAAe3F,GACrC,MAAO,CAAC,QAAS,KAAM,MAAM4F,QAAQ7F,EAAYC,KAAa,CAChE,CCFe,SAAS6F,EAAmB7F,GAEzC,QAASS,EAAUT,GAAWA,EAAQO,cACtCP,EAAQ8F,WAAazF,OAAOyF,UAAUC,eACxC,CCFe,SAASC,EAAchG,GACpC,MAA6B,SAAzBD,EAAYC,GACPA,EAMPA,EAAQiG,cACRjG,EAAQwF,aACR3E,EAAab,GAAWA,EAAQyF,KAAO,OAEvCI,EAAmB7F,EAGvB,CCVA,SAASkG,EAAoBlG,GAC3B,OAAKW,EAAcX,IACoB,UAAvC,EAAiBA,GAASiC,SAInBjC,EAAQmG,aAHN,IAIX,CAwCe,SAASC,EAAgBpG,GAItC,IAHA,IAAIK,EAASF,EAAUH,GACnBmG,EAAeD,EAAoBlG,GAEhCmG,GAAgBR,EAAeQ,IAA6D,WAA5C,EAAiBA,GAAclE,UACpFkE,EAAeD,EAAoBC,GAGrC,OAAIA,IAA+C,SAA9BpG,EAAYoG,IAA0D,SAA9BpG,EAAYoG,IAAwE,WAA5C,EAAiBA,GAAclE,UAC3H5B,EAGF8F,GAhDT,SAA4BnG,GAC1B,IAAIqG,EAAY,WAAWvC,KAAKd,KAGhC,GAFW,WAAWc,KAAKd,MAEfrC,EAAcX,IAII,UAFX,EAAiBA,GAEnBiC,SACb,OAAO,KAIX,IAAIqE,EAAcN,EAAchG,GAMhC,IAJIa,EAAayF,KACfA,EAAcA,EAAYb,MAGrB9E,EAAc2F,IAAgB,CAAC,OAAQ,QAAQV,QAAQ7F,EAAYuG,IAAgB,GAAG,CAC3F,IAAIC,EAAM,EAAiBD,GAI3B,GAAsB,SAAlBC,EAAIC,WAA4C,SAApBD,EAAIE,aAA0C,UAAhBF,EAAIG,UAAiF,IAA1D,CAAC,YAAa,eAAed,QAAQW,EAAII,aAAsBN,GAAgC,WAAnBE,EAAII,YAA2BN,GAAaE,EAAIK,QAAyB,SAAfL,EAAIK,OACjO,OAAON,EAEPA,EAAcA,EAAYd,UAE9B,CAEA,OAAO,IACT,CAgByBqB,CAAmB7G,IAAYK,CACxD,CCpEe,SAASyG,EAAyB3H,GAC/C,MAAO,CAAC,MAAO,UAAUyG,QAAQzG,IAAc,EAAI,IAAM,GAC3D,CCDO,SAAS4H,EAAOjE,EAAK1E,EAAOyE,GACjC,OAAO,EAAQC,EAAK,EAAQ1E,EAAOyE,GACrC,CCFe,SAASmE,EAAmBC,GACzC,OAAOxJ,OAAOkE,OAAO,CAAC,ECDf,CACLS,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GDHuC0I,EACjD,CEHe,SAASC,EAAgB9I,EAAOiD,GAC7C,OAAOA,EAAKpC,QAAO,SAAUkI,EAAS5J,GAEpC,OADA4J,EAAQ5J,GAAOa,EACR+I,CACT,GAAG,CAAC,EACN,CC4EA,SACEpG,KAAM,QACNC,SAAS,EACTC,MAAO,OACPC,GApEF,SAAeC,GACb,IAAIiG,EAEAhG,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZmB,EAAUf,EAAKe,QACfmF,EAAejG,EAAME,SAASgB,MAC9BgF,EAAgBlG,EAAMmG,cAAcD,cACpCE,EAAgB9E,EAAiBtB,EAAMjC,WACvCsI,EAAOX,EAAyBU,GAEhCE,EADa,CAACnJ,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAClC,SAAW,QAElC,GAAKH,GAAiBC,EAAtB,CAIA,IAAIL,EAxBgB,SAAyBU,EAASvG,GAItD,OAAO4F,EAAsC,iBAH7CW,EAA6B,mBAAZA,EAAyBA,EAAQlK,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CAC/EzI,UAAWiC,EAAMjC,aACbwI,GACkDA,EAAUT,EAAgBS,EAASlJ,GAC7F,CAmBsBoJ,CAAgB3F,EAAQyF,QAASvG,GACjD0G,EAAY/C,EAAcsC,GAC1BU,EAAmB,MAATN,EAAe,EAAMlJ,EAC/ByJ,EAAmB,MAATP,EAAepJ,EAASC,EAClC2J,EAAU7G,EAAMwG,MAAM7I,UAAU2I,GAAOtG,EAAMwG,MAAM7I,UAAU0I,GAAQH,EAAcG,GAAQrG,EAAMwG,MAAM9I,OAAO4I,GAC9GQ,EAAYZ,EAAcG,GAAQrG,EAAMwG,MAAM7I,UAAU0I,GACxDU,EAAoB/B,EAAgBiB,GACpCe,EAAaD,EAA6B,MAATV,EAAeU,EAAkBE,cAAgB,EAAIF,EAAkBG,aAAe,EAAI,EAC3HC,EAAoBN,EAAU,EAAIC,EAAY,EAG9CpF,EAAMmE,EAAcc,GACpBlF,EAAMuF,EAAaN,EAAUJ,GAAOT,EAAce,GAClDQ,EAASJ,EAAa,EAAIN,EAAUJ,GAAO,EAAIa,EAC/CE,EAAS1B,EAAOjE,EAAK0F,EAAQ3F,GAE7B6F,EAAWjB,EACfrG,EAAMmG,cAAcxG,KAASqG,EAAwB,CAAC,GAAyBsB,GAAYD,EAAQrB,EAAsBuB,aAAeF,EAASD,EAAQpB,EAnBzJ,CAoBF,EAkCEtF,OAhCF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MAEdwH,EADU7G,EAAMG,QACWlC,QAC3BqH,OAAoC,IAArBuB,EAA8B,sBAAwBA,EAErD,MAAhBvB,IAKwB,iBAAjBA,IACTA,EAAejG,EAAME,SAASxC,OAAO+J,cAAcxB,MAOhDpC,EAAS7D,EAAME,SAASxC,OAAQuI,KAIrCjG,EAAME,SAASgB,MAAQ+E,EACzB,EASE5E,SAAU,CAAC,iBACXqG,iBAAkB,CAAC,oBCxFN,SAASC,EAAa5J,GACnC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCOA,IAAIqG,GAAa,CACf5G,IAAK,OACL9D,MAAO,OACPD,OAAQ,OACRE,KAAM,QAeD,SAAS0K,GAAYlH,GAC1B,IAAImH,EAEApK,EAASiD,EAAMjD,OACfqK,EAAapH,EAAMoH,WACnBhK,EAAY4C,EAAM5C,UAClBiK,EAAYrH,EAAMqH,UAClBC,EAAUtH,EAAMsH,QAChBpH,EAAWF,EAAME,SACjBqH,EAAkBvH,EAAMuH,gBACxBC,EAAWxH,EAAMwH,SACjBC,EAAezH,EAAMyH,aACrBC,EAAU1H,EAAM0H,QAChBC,EAAaL,EAAQ1E,EACrBA,OAAmB,IAAf+E,EAAwB,EAAIA,EAChCC,EAAaN,EAAQxE,EACrBA,OAAmB,IAAf8E,EAAwB,EAAIA,EAEhCC,EAAgC,mBAAjBJ,EAA8BA,EAAa,CAC5D7E,EAAGA,EACHE,IACG,CACHF,EAAGA,EACHE,GAGFF,EAAIiF,EAAMjF,EACVE,EAAI+E,EAAM/E,EACV,IAAIgF,EAAOR,EAAQrL,eAAe,KAC9B8L,EAAOT,EAAQrL,eAAe,KAC9B+L,EAAQxL,EACRyL,EAAQ,EACRC,EAAM5J,OAEV,GAAIkJ,EAAU,CACZ,IAAIpD,EAAeC,EAAgBtH,GAC/BoL,EAAa,eACbC,EAAY,cAEZhE,IAAiBhG,EAAUrB,IAGmB,WAA5C,EAFJqH,EAAeN,EAAmB/G,IAECmD,UAAsC,aAAbA,IAC1DiI,EAAa,eACbC,EAAY,gBAOZhL,IAAc,IAAQA,IAAcZ,GAAQY,IAAcb,IAAU8K,IAAczK,KACpFqL,EAAQ3L,EAGRwG,IAFc4E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeD,OACzF2B,EAAa+D,IACEf,EAAW3E,OAC1BK,GAAKyE,EAAkB,GAAK,GAG1BnK,IAAcZ,IAASY,IAAc,GAAOA,IAAcd,GAAW+K,IAAczK,KACrFoL,EAAQzL,EAGRqG,IAFc8E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeH,MACzF6B,EAAagE,IACEhB,EAAW7E,MAC1BK,GAAK2E,EAAkB,GAAK,EAEhC,CAEA,IAgBMc,EAhBFC,EAAe5M,OAAOkE,OAAO,CAC/BM,SAAUA,GACTsH,GAAYP,IAEXsB,GAAyB,IAAjBd,EAlFd,SAA2BrI,EAAM8I,GAC/B,IAAItF,EAAIxD,EAAKwD,EACTE,EAAI1D,EAAK0D,EACT0F,EAAMN,EAAIO,kBAAoB,EAClC,MAAO,CACL7F,EAAG5B,EAAM4B,EAAI4F,GAAOA,GAAO,EAC3B1F,EAAG9B,EAAM8B,EAAI0F,GAAOA,GAAO,EAE/B,CA0EsCE,CAAkB,CACpD9F,EAAGA,EACHE,GACC1E,EAAUrB,IAAW,CACtB6F,EAAGA,EACHE,GAMF,OAHAF,EAAI2F,EAAM3F,EACVE,EAAIyF,EAAMzF,EAENyE,EAGK7L,OAAOkE,OAAO,CAAC,EAAG0I,IAAeD,EAAiB,CAAC,GAAkBJ,GAASF,EAAO,IAAM,GAAIM,EAAeL,GAASF,EAAO,IAAM,GAAIO,EAAe5D,WAAayD,EAAIO,kBAAoB,IAAM,EAAI,aAAe7F,EAAI,OAASE,EAAI,MAAQ,eAAiBF,EAAI,OAASE,EAAI,SAAUuF,IAG5R3M,OAAOkE,OAAO,CAAC,EAAG0I,IAAenB,EAAkB,CAAC,GAAmBc,GAASF,EAAOjF,EAAI,KAAO,GAAIqE,EAAgBa,GAASF,EAAOlF,EAAI,KAAO,GAAIuE,EAAgB1C,UAAY,GAAI0C,GAC9L,CA4CA,UACEnI,KAAM,gBACNC,SAAS,EACTC,MAAO,cACPC,GA9CF,SAAuBwJ,GACrB,IAAItJ,EAAQsJ,EAAMtJ,MACdc,EAAUwI,EAAMxI,QAChByI,EAAwBzI,EAAQoH,gBAChCA,OAA4C,IAA1BqB,GAA0CA,EAC5DC,EAAoB1I,EAAQqH,SAC5BA,OAAiC,IAAtBqB,GAAsCA,EACjDC,EAAwB3I,EAAQsH,aAChCA,OAAyC,IAA1BqB,GAA0CA,EACzDR,EAAe,CACjBlL,UAAWuD,EAAiBtB,EAAMjC,WAClCiK,UAAWL,EAAa3H,EAAMjC,WAC9BL,OAAQsC,EAAME,SAASxC,OACvBqK,WAAY/H,EAAMwG,MAAM9I,OACxBwK,gBAAiBA,EACjBG,QAAoC,UAA3BrI,EAAMc,QAAQC,UAGgB,MAArCf,EAAMmG,cAAcD,gBACtBlG,EAAMK,OAAO3C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAO3C,OAAQmK,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACvGhB,QAASjI,EAAMmG,cAAcD,cAC7BrF,SAAUb,EAAMc,QAAQC,SACxBoH,SAAUA,EACVC,aAAcA,OAIe,MAA7BpI,EAAMmG,cAAcjF,QACtBlB,EAAMK,OAAOa,MAAQ7E,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAOa,MAAO2G,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACrGhB,QAASjI,EAAMmG,cAAcjF,MAC7BL,SAAU,WACVsH,UAAU,EACVC,aAAcA,OAIlBpI,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,wBAAyBsC,EAAMjC,WAEnC,EAQE2L,KAAM,CAAC,GCrKT,IAAIC,GAAU,CACZA,SAAS,GAsCX,UACEhK,KAAM,iBACNC,SAAS,EACTC,MAAO,QACPC,GAAI,WAAe,EACnBY,OAxCF,SAAgBX,GACd,IAAIC,EAAQD,EAAKC,MACb4J,EAAW7J,EAAK6J,SAChB9I,EAAUf,EAAKe,QACf+I,EAAkB/I,EAAQgJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAkBjJ,EAAQkJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7C9K,EAASF,EAAUiB,EAAME,SAASxC,QAClCuM,EAAgB,GAAGjM,OAAOgC,EAAMiK,cAActM,UAAWqC,EAAMiK,cAAcvM,QAYjF,OAVIoM,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaC,iBAAiB,SAAUP,EAASQ,OAAQT,GAC3D,IAGEK,GACF/K,EAAOkL,iBAAiB,SAAUP,EAASQ,OAAQT,IAG9C,WACDG,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaG,oBAAoB,SAAUT,EAASQ,OAAQT,GAC9D,IAGEK,GACF/K,EAAOoL,oBAAoB,SAAUT,EAASQ,OAAQT,GAE1D,CACF,EASED,KAAM,CAAC,GC/CT,IAAIY,GAAO,CACTnN,KAAM,QACND,MAAO,OACPD,OAAQ,MACR+D,IAAK,UAEQ,SAASuJ,GAAqBxM,GAC3C,OAAOA,EAAUyM,QAAQ,0BAA0B,SAAUC,GAC3D,OAAOH,GAAKG,EACd,GACF,CCVA,IAAI,GAAO,CACTnN,MAAO,MACPC,IAAK,SAEQ,SAASmN,GAA8B3M,GACpD,OAAOA,EAAUyM,QAAQ,cAAc,SAAUC,GAC/C,OAAO,GAAKA,EACd,GACF,CCPe,SAASE,GAAgB3L,GACtC,IAAI6J,EAAM9J,EAAUC,GAGpB,MAAO,CACL4L,WAHe/B,EAAIgC,YAInBC,UAHcjC,EAAIkC,YAKtB,CCNe,SAASC,GAAoBpM,GAQ1C,OAAO+D,EAAsB8B,EAAmB7F,IAAUzB,KAAOwN,GAAgB/L,GAASgM,UAC5F,CCXe,SAASK,GAAerM,GAErC,IAAIsM,EAAoB,EAAiBtM,GACrCuM,EAAWD,EAAkBC,SAC7BC,EAAYF,EAAkBE,UAC9BC,EAAYH,EAAkBG,UAElC,MAAO,6BAA6B3I,KAAKyI,EAAWE,EAAYD,EAClE,CCLe,SAASE,GAAgBtM,GACtC,MAAI,CAAC,OAAQ,OAAQ,aAAawF,QAAQ7F,EAAYK,KAAU,EAEvDA,EAAKG,cAAcoM,KAGxBhM,EAAcP,IAASiM,GAAejM,GACjCA,EAGFsM,GAAgB1G,EAAc5F,GACvC,CCJe,SAASwM,GAAkB5M,EAAS6M,GACjD,IAAIC,OAES,IAATD,IACFA,EAAO,IAGT,IAAIvB,EAAeoB,GAAgB1M,GAC/B+M,EAASzB,KAAqE,OAAlDwB,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,MACpH1C,EAAM9J,EAAUmL,GAChB0B,EAASD,EAAS,CAAC9C,GAAK7K,OAAO6K,EAAIxF,gBAAkB,GAAI4H,GAAef,GAAgBA,EAAe,IAAMA,EAC7G2B,EAAcJ,EAAKzN,OAAO4N,GAC9B,OAAOD,EAASE,EAChBA,EAAY7N,OAAOwN,GAAkB5G,EAAcgH,IACrD,CCzBe,SAASE,GAAiBC,GACvC,OAAO1P,OAAOkE,OAAO,CAAC,EAAGwL,EAAM,CAC7B5O,KAAM4O,EAAKxI,EACXvC,IAAK+K,EAAKtI,EACVvG,MAAO6O,EAAKxI,EAAIwI,EAAK7I,MACrBjG,OAAQ8O,EAAKtI,EAAIsI,EAAK3I,QAE1B,CCqBA,SAAS4I,GAA2BpN,EAASqN,EAAgBlL,GAC3D,OAAOkL,IAAmBxO,EAAWqO,GCzBxB,SAAyBlN,EAASmC,GAC/C,IAAI8H,EAAM9J,EAAUH,GAChBsN,EAAOzH,EAAmB7F,GAC1ByE,EAAiBwF,EAAIxF,eACrBH,EAAQgJ,EAAKhF,YACb9D,EAAS8I,EAAKjF,aACd1D,EAAI,EACJE,EAAI,EAER,GAAIJ,EAAgB,CAClBH,EAAQG,EAAeH,MACvBE,EAASC,EAAeD,OACxB,IAAI+I,EAAiB1J,KAEjB0J,IAAmBA,GAA+B,UAAbpL,KACvCwC,EAAIF,EAAeG,WACnBC,EAAIJ,EAAeK,UAEvB,CAEA,MAAO,CACLR,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EAAIyH,GAAoBpM,GAC3B6E,EAAGA,EAEP,CDDwD2I,CAAgBxN,EAASmC,IAAa1B,EAAU4M,GAdxG,SAAoCrN,EAASmC,GAC3C,IAAIgL,EAAOpJ,EAAsB/D,GAAS,EAAoB,UAAbmC,GASjD,OARAgL,EAAK/K,IAAM+K,EAAK/K,IAAMpC,EAAQyN,UAC9BN,EAAK5O,KAAO4O,EAAK5O,KAAOyB,EAAQ0N,WAChCP,EAAK9O,OAAS8O,EAAK/K,IAAMpC,EAAQqI,aACjC8E,EAAK7O,MAAQ6O,EAAK5O,KAAOyB,EAAQsI,YACjC6E,EAAK7I,MAAQtE,EAAQsI,YACrB6E,EAAK3I,OAASxE,EAAQqI,aACtB8E,EAAKxI,EAAIwI,EAAK5O,KACd4O,EAAKtI,EAAIsI,EAAK/K,IACP+K,CACT,CAG0HQ,CAA2BN,EAAgBlL,GAAY+K,GEtBlK,SAAyBlN,GACtC,IAAI8M,EAEAQ,EAAOzH,EAAmB7F,GAC1B4N,EAAY7B,GAAgB/L,GAC5B2M,EAA0D,OAAlDG,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,KAChGrI,EAAQ,EAAIgJ,EAAKO,YAAaP,EAAKhF,YAAaqE,EAAOA,EAAKkB,YAAc,EAAGlB,EAAOA,EAAKrE,YAAc,GACvG9D,EAAS,EAAI8I,EAAKQ,aAAcR,EAAKjF,aAAcsE,EAAOA,EAAKmB,aAAe,EAAGnB,EAAOA,EAAKtE,aAAe,GAC5G1D,GAAKiJ,EAAU5B,WAAaI,GAAoBpM,GAChD6E,GAAK+I,EAAU1B,UAMnB,MAJiD,QAA7C,EAAiBS,GAAQW,GAAMS,YACjCpJ,GAAK,EAAI2I,EAAKhF,YAAaqE,EAAOA,EAAKrE,YAAc,GAAKhE,GAGrD,CACLA,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EACHE,EAAGA,EAEP,CFCkMmJ,CAAgBnI,EAAmB7F,IACrO,CG1Be,SAASiO,GAAe9M,GACrC,IAOIkI,EAPAtK,EAAYoC,EAAKpC,UACjBiB,EAAUmB,EAAKnB,QACfb,EAAYgC,EAAKhC,UACjBqI,EAAgBrI,EAAYuD,EAAiBvD,GAAa,KAC1DiK,EAAYjK,EAAY4J,EAAa5J,GAAa,KAClD+O,EAAUnP,EAAU4F,EAAI5F,EAAUuF,MAAQ,EAAItE,EAAQsE,MAAQ,EAC9D6J,EAAUpP,EAAU8F,EAAI9F,EAAUyF,OAAS,EAAIxE,EAAQwE,OAAS,EAGpE,OAAQgD,GACN,KAAK,EACH6B,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI7E,EAAQwE,QAE3B,MAEF,KAAKnG,EACHgL,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI9F,EAAUyF,QAE7B,MAEF,KAAKlG,EACH+K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI5F,EAAUuF,MAC3BO,EAAGsJ,GAEL,MAEF,KAAK5P,EACH8K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI3E,EAAQsE,MACzBO,EAAGsJ,GAEL,MAEF,QACE9E,EAAU,CACR1E,EAAG5F,EAAU4F,EACbE,EAAG9F,EAAU8F,GAInB,IAAIuJ,EAAW5G,EAAgBV,EAAyBU,GAAiB,KAEzE,GAAgB,MAAZ4G,EAAkB,CACpB,IAAI1G,EAAmB,MAAb0G,EAAmB,SAAW,QAExC,OAAQhF,GACN,KAAK1K,EACH2K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAC7E,MAEF,KAAK/I,EACH0K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAKnF,CAEA,OAAO2B,CACT,CC3De,SAASgF,GAAejN,EAAOc,QAC5B,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACXqM,EAAqBD,EAASnP,UAC9BA,OAAmC,IAAvBoP,EAAgCnN,EAAMjC,UAAYoP,EAC9DC,EAAoBF,EAASnM,SAC7BA,OAAiC,IAAtBqM,EAA+BpN,EAAMe,SAAWqM,EAC3DC,EAAoBH,EAASI,SAC7BA,OAAiC,IAAtBD,EAA+B7P,EAAkB6P,EAC5DE,EAAwBL,EAASM,aACjCA,OAAyC,IAA1BD,EAAmC9P,EAAW8P,EAC7DE,EAAwBP,EAASQ,eACjCA,OAA2C,IAA1BD,EAAmC/P,EAAS+P,EAC7DE,EAAuBT,EAASU,YAChCA,OAAuC,IAAzBD,GAA0CA,EACxDE,EAAmBX,EAAS3G,QAC5BA,OAA+B,IAArBsH,EAA8B,EAAIA,EAC5ChI,EAAgBD,EAAsC,iBAAZW,EAAuBA,EAAUT,EAAgBS,EAASlJ,IACpGyQ,EAAaJ,IAAmBhQ,EAASC,EAAYD,EACrDqK,EAAa/H,EAAMwG,MAAM9I,OACzBkB,EAAUoB,EAAME,SAAS0N,EAAcE,EAAaJ,GACpDK,EJkBS,SAAyBnP,EAAS0O,EAAUE,EAAczM,GACvE,IAAIiN,EAAmC,oBAAbV,EAlB5B,SAA4B1O,GAC1B,IAAIpB,EAAkBgO,GAAkB5G,EAAchG,IAElDqP,EADoB,CAAC,WAAY,SAASzJ,QAAQ,EAAiB5F,GAASiC,WAAa,GACnDtB,EAAcX,GAAWoG,EAAgBpG,GAAWA,EAE9F,OAAKS,EAAU4O,GAKRzQ,EAAgBgI,QAAO,SAAUyG,GACtC,OAAO5M,EAAU4M,IAAmBpI,EAASoI,EAAgBgC,IAAmD,SAAhCtP,EAAYsN,EAC9F,IANS,EAOX,CAK6DiC,CAAmBtP,GAAW,GAAGZ,OAAOsP,GAC/F9P,EAAkB,GAAGQ,OAAOgQ,EAAqB,CAACR,IAClDW,EAAsB3Q,EAAgB,GACtC4Q,EAAe5Q,EAAgBK,QAAO,SAAUwQ,EAASpC,GAC3D,IAAIF,EAAOC,GAA2BpN,EAASqN,EAAgBlL,GAK/D,OAJAsN,EAAQrN,IAAM,EAAI+K,EAAK/K,IAAKqN,EAAQrN,KACpCqN,EAAQnR,MAAQ,EAAI6O,EAAK7O,MAAOmR,EAAQnR,OACxCmR,EAAQpR,OAAS,EAAI8O,EAAK9O,OAAQoR,EAAQpR,QAC1CoR,EAAQlR,KAAO,EAAI4O,EAAK5O,KAAMkR,EAAQlR,MAC/BkR,CACT,GAAGrC,GAA2BpN,EAASuP,EAAqBpN,IAK5D,OAJAqN,EAAalL,MAAQkL,EAAalR,MAAQkR,EAAajR,KACvDiR,EAAahL,OAASgL,EAAanR,OAASmR,EAAapN,IACzDoN,EAAa7K,EAAI6K,EAAajR,KAC9BiR,EAAa3K,EAAI2K,EAAapN,IACvBoN,CACT,CInC2BE,CAAgBjP,EAAUT,GAAWA,EAAUA,EAAQ2P,gBAAkB9J,EAAmBzE,EAAME,SAASxC,QAAS4P,EAAUE,EAAczM,GACjKyN,EAAsB7L,EAAsB3C,EAAME,SAASvC,WAC3DuI,EAAgB2G,GAAe,CACjClP,UAAW6Q,EACX5P,QAASmJ,EACThH,SAAU,WACVhD,UAAWA,IAET0Q,EAAmB3C,GAAiBzP,OAAOkE,OAAO,CAAC,EAAGwH,EAAY7B,IAClEwI,EAAoBhB,IAAmBhQ,EAAS+Q,EAAmBD,EAGnEG,EAAkB,CACpB3N,IAAK+M,EAAmB/M,IAAM0N,EAAkB1N,IAAM6E,EAAc7E,IACpE/D,OAAQyR,EAAkBzR,OAAS8Q,EAAmB9Q,OAAS4I,EAAc5I,OAC7EE,KAAM4Q,EAAmB5Q,KAAOuR,EAAkBvR,KAAO0I,EAAc1I,KACvED,MAAOwR,EAAkBxR,MAAQ6Q,EAAmB7Q,MAAQ2I,EAAc3I,OAExE0R,EAAa5O,EAAMmG,cAAckB,OAErC,GAAIqG,IAAmBhQ,GAAUkR,EAAY,CAC3C,IAAIvH,EAASuH,EAAW7Q,GACxB1B,OAAO4D,KAAK0O,GAAiBxO,SAAQ,SAAUhE,GAC7C,IAAI0S,EAAW,CAAC3R,EAAOD,GAAQuH,QAAQrI,IAAQ,EAAI,GAAK,EACpDkK,EAAO,CAAC,EAAKpJ,GAAQuH,QAAQrI,IAAQ,EAAI,IAAM,IACnDwS,EAAgBxS,IAAQkL,EAAOhB,GAAQwI,CACzC,GACF,CAEA,OAAOF,CACT,CCyEA,UACEhP,KAAM,OACNC,SAAS,EACTC,MAAO,OACPC,GA5HF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KAEhB,IAAIK,EAAMmG,cAAcxG,GAAMmP,MAA9B,CAoCA,IAhCA,IAAIC,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAqCA,EACpDG,EAA8BtO,EAAQuO,mBACtC9I,EAAUzF,EAAQyF,QAClB+G,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtB0B,EAAwBxO,EAAQyO,eAChCA,OAA2C,IAA1BD,GAA0CA,EAC3DE,EAAwB1O,EAAQ0O,sBAChCC,EAAqBzP,EAAMc,QAAQ/C,UACnCqI,EAAgB9E,EAAiBmO,GAEjCJ,EAAqBD,IADHhJ,IAAkBqJ,GACqCF,EAjC/E,SAAuCxR,GACrC,GAAIuD,EAAiBvD,KAAeX,EAClC,MAAO,GAGT,IAAIsS,EAAoBnF,GAAqBxM,GAC7C,MAAO,CAAC2M,GAA8B3M,GAAY2R,EAAmBhF,GAA8BgF,GACrG,CA0B6IC,CAA8BF,GAA3E,CAAClF,GAAqBkF,KAChHG,EAAa,CAACH,GAAoBzR,OAAOqR,GAAoBxR,QAAO,SAAUC,EAAKC,GACrF,OAAOD,EAAIE,OAAOsD,EAAiBvD,KAAeX,ECvCvC,SAA8B4C,EAAOc,QAClC,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACX/C,EAAYmP,EAASnP,UACrBuP,EAAWJ,EAASI,SACpBE,EAAeN,EAASM,aACxBjH,EAAU2G,EAAS3G,QACnBgJ,EAAiBrC,EAASqC,eAC1BM,EAAwB3C,EAASsC,sBACjCA,OAAkD,IAA1BK,EAAmC,EAAgBA,EAC3E7H,EAAYL,EAAa5J,GACzB6R,EAAa5H,EAAYuH,EAAiB3R,EAAsBA,EAAoB4H,QAAO,SAAUzH,GACvG,OAAO4J,EAAa5J,KAAeiK,CACrC,IAAK3K,EACDyS,EAAoBF,EAAWpK,QAAO,SAAUzH,GAClD,OAAOyR,EAAsBhL,QAAQzG,IAAc,CACrD,IAEiC,IAA7B+R,EAAkBC,SACpBD,EAAoBF,GAItB,IAAII,EAAYF,EAAkBjS,QAAO,SAAUC,EAAKC,GAOtD,OANAD,EAAIC,GAAakP,GAAejN,EAAO,CACrCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,IACRjF,EAAiBvD,IACbD,CACT,GAAG,CAAC,GACJ,OAAOzB,OAAO4D,KAAK+P,GAAWC,MAAK,SAAUC,EAAGC,GAC9C,OAAOH,EAAUE,GAAKF,EAAUG,EAClC,GACF,CDC6DC,CAAqBpQ,EAAO,CACnFjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTgJ,eAAgBA,EAChBC,sBAAuBA,IACpBzR,EACP,GAAG,IACCsS,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzB4S,EAAY,IAAIC,IAChBC,GAAqB,EACrBC,EAAwBb,EAAW,GAE9Bc,EAAI,EAAGA,EAAId,EAAWG,OAAQW,IAAK,CAC1C,IAAI3S,EAAY6R,EAAWc,GAEvBC,EAAiBrP,EAAiBvD,GAElC6S,EAAmBjJ,EAAa5J,KAAeT,EAC/CuT,EAAa,CAAC,EAAK5T,GAAQuH,QAAQmM,IAAmB,EACtDrK,EAAMuK,EAAa,QAAU,SAC7B1F,EAAW8B,GAAejN,EAAO,CACnCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdI,YAAaA,EACbrH,QAASA,IAEPuK,EAAoBD,EAAaD,EAAmB1T,EAAQC,EAAOyT,EAAmB3T,EAAS,EAE/FoT,EAAc/J,GAAOyB,EAAWzB,KAClCwK,EAAoBvG,GAAqBuG,IAG3C,IAAIC,EAAmBxG,GAAqBuG,GACxCE,EAAS,GAUb,GARIhC,GACFgC,EAAOC,KAAK9F,EAASwF,IAAmB,GAGtCxB,GACF6B,EAAOC,KAAK9F,EAAS2F,IAAsB,EAAG3F,EAAS4F,IAAqB,GAG1EC,EAAOE,OAAM,SAAUC,GACzB,OAAOA,CACT,IAAI,CACFV,EAAwB1S,EACxByS,GAAqB,EACrB,KACF,CAEAF,EAAUc,IAAIrT,EAAWiT,EAC3B,CAEA,GAAIR,EAqBF,IAnBA,IAEIa,EAAQ,SAAeC,GACzB,IAAIC,EAAmB3B,EAAW4B,MAAK,SAAUzT,GAC/C,IAAIiT,EAASV,EAAU9T,IAAIuB,GAE3B,GAAIiT,EACF,OAAOA,EAAOS,MAAM,EAAGH,GAAIJ,OAAM,SAAUC,GACzC,OAAOA,CACT,GAEJ,IAEA,GAAII,EAEF,OADAd,EAAwBc,EACjB,OAEX,EAESD,EAnBY/B,EAAiB,EAAI,EAmBZ+B,EAAK,GAGpB,UAFFD,EAAMC,GADmBA,KAOpCtR,EAAMjC,YAAc0S,IACtBzQ,EAAMmG,cAAcxG,GAAMmP,OAAQ,EAClC9O,EAAMjC,UAAY0S,EAClBzQ,EAAM0R,OAAQ,EA5GhB,CA8GF,EAQEhK,iBAAkB,CAAC,UACnBgC,KAAM,CACJoF,OAAO,IE7IX,SAAS6C,GAAexG,EAAUY,EAAM6F,GAQtC,YAPyB,IAArBA,IACFA,EAAmB,CACjBrO,EAAG,EACHE,EAAG,IAIA,CACLzC,IAAKmK,EAASnK,IAAM+K,EAAK3I,OAASwO,EAAiBnO,EACnDvG,MAAOiO,EAASjO,MAAQ6O,EAAK7I,MAAQ0O,EAAiBrO,EACtDtG,OAAQkO,EAASlO,OAAS8O,EAAK3I,OAASwO,EAAiBnO,EACzDtG,KAAMgO,EAAShO,KAAO4O,EAAK7I,MAAQ0O,EAAiBrO,EAExD,CAEA,SAASsO,GAAsB1G,GAC7B,MAAO,CAAC,EAAKjO,EAAOD,EAAQE,GAAM2U,MAAK,SAAUC,GAC/C,OAAO5G,EAAS4G,IAAS,CAC3B,GACF,CA+BA,UACEpS,KAAM,OACNC,SAAS,EACTC,MAAO,OACP6H,iBAAkB,CAAC,mBACnB5H,GAlCF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZ0Q,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBkU,EAAmB5R,EAAMmG,cAAc6L,gBACvCC,EAAoBhF,GAAejN,EAAO,CAC5C0N,eAAgB,cAEdwE,EAAoBjF,GAAejN,EAAO,CAC5C4N,aAAa,IAEXuE,EAA2BR,GAAeM,EAAmB5B,GAC7D+B,EAAsBT,GAAeO,EAAmBnK,EAAY6J,GACpES,EAAoBR,GAAsBM,GAC1CG,EAAmBT,GAAsBO,GAC7CpS,EAAMmG,cAAcxG,GAAQ,CAC1BwS,yBAA0BA,EAC1BC,oBAAqBA,EACrBC,kBAAmBA,EACnBC,iBAAkBA,GAEpBtS,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,+BAAgC2U,EAChC,sBAAuBC,GAE3B,GCJA,IACE3S,KAAM,SACNC,SAAS,EACTC,MAAO,OACPwB,SAAU,CAAC,iBACXvB,GA5BF,SAAgBa,GACd,IAAIX,EAAQW,EAAMX,MACdc,EAAUH,EAAMG,QAChBnB,EAAOgB,EAAMhB,KACb4S,EAAkBzR,EAAQuG,OAC1BA,OAA6B,IAApBkL,EAA6B,CAAC,EAAG,GAAKA,EAC/C7I,EAAO,EAAW7L,QAAO,SAAUC,EAAKC,GAE1C,OADAD,EAAIC,GA5BD,SAAiCA,EAAWyI,EAAOa,GACxD,IAAIjB,EAAgB9E,EAAiBvD,GACjCyU,EAAiB,CAACrV,EAAM,GAAKqH,QAAQ4B,IAAkB,GAAK,EAAI,EAEhErG,EAAyB,mBAAXsH,EAAwBA,EAAOhL,OAAOkE,OAAO,CAAC,EAAGiG,EAAO,CACxEzI,UAAWA,KACPsJ,EACFoL,EAAW1S,EAAK,GAChB2S,EAAW3S,EAAK,GAIpB,OAFA0S,EAAWA,GAAY,EACvBC,GAAYA,GAAY,GAAKF,EACtB,CAACrV,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAAI,CACjD7C,EAAGmP,EACHjP,EAAGgP,GACD,CACFlP,EAAGkP,EACHhP,EAAGiP,EAEP,CASqBC,CAAwB5U,EAAWiC,EAAMwG,MAAOa,GAC1DvJ,CACT,GAAG,CAAC,GACA8U,EAAwBlJ,EAAK1J,EAAMjC,WACnCwF,EAAIqP,EAAsBrP,EAC1BE,EAAImP,EAAsBnP,EAEW,MAArCzD,EAAMmG,cAAcD,gBACtBlG,EAAMmG,cAAcD,cAAc3C,GAAKA,EACvCvD,EAAMmG,cAAcD,cAAczC,GAAKA,GAGzCzD,EAAMmG,cAAcxG,GAAQ+J,CAC9B,GC1BA,IACE/J,KAAM,gBACNC,SAAS,EACTC,MAAO,OACPC,GApBF,SAAuBC,GACrB,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KAKhBK,EAAMmG,cAAcxG,GAAQkN,GAAe,CACzClP,UAAWqC,EAAMwG,MAAM7I,UACvBiB,QAASoB,EAAMwG,MAAM9I,OACrBqD,SAAU,WACVhD,UAAWiC,EAAMjC,WAErB,EAQE2L,KAAM,CAAC,GCgHT,IACE/J,KAAM,kBACNC,SAAS,EACTC,MAAO,OACPC,GA/HF,SAAyBC,GACvB,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KACZoP,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAsCA,EACrD3B,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtBrH,EAAUzF,EAAQyF,QAClBsM,EAAkB/R,EAAQgS,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAwBjS,EAAQkS,aAChCA,OAAyC,IAA1BD,EAAmC,EAAIA,EACtD5H,EAAW8B,GAAejN,EAAO,CACnCsN,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTqH,YAAaA,IAEXxH,EAAgB9E,EAAiBtB,EAAMjC,WACvCiK,EAAYL,EAAa3H,EAAMjC,WAC/BkV,GAAmBjL,EACnBgF,EAAWtH,EAAyBU,GACpC8I,ECrCY,MDqCSlC,ECrCH,IAAM,IDsCxB9G,EAAgBlG,EAAMmG,cAAcD,cACpCmK,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBwV,EAA4C,mBAAjBF,EAA8BA,EAAa3W,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CACvGzI,UAAWiC,EAAMjC,aACbiV,EACFG,EAA2D,iBAAtBD,EAAiC,CACxElG,SAAUkG,EACVhE,QAASgE,GACP7W,OAAOkE,OAAO,CAChByM,SAAU,EACVkC,QAAS,GACRgE,GACCE,EAAsBpT,EAAMmG,cAAckB,OAASrH,EAAMmG,cAAckB,OAAOrH,EAAMjC,WAAa,KACjG2L,EAAO,CACTnG,EAAG,EACHE,EAAG,GAGL,GAAKyC,EAAL,CAIA,GAAI8I,EAAe,CACjB,IAAIqE,EAEAC,EAAwB,MAAbtG,EAAmB,EAAM7P,EACpCoW,EAAuB,MAAbvG,EAAmB/P,EAASC,EACtCoJ,EAAmB,MAAb0G,EAAmB,SAAW,QACpC3F,EAASnB,EAAc8G,GACvBtL,EAAM2F,EAAS8D,EAASmI,GACxB7R,EAAM4F,EAAS8D,EAASoI,GACxBC,EAAWV,GAAU/K,EAAWzB,GAAO,EAAI,EAC3CmN,EAASzL,IAAc1K,EAAQ+S,EAAc/J,GAAOyB,EAAWzB,GAC/DoN,EAAS1L,IAAc1K,GAASyK,EAAWzB,IAAQ+J,EAAc/J,GAGjEL,EAAejG,EAAME,SAASgB,MAC9BwF,EAAYoM,GAAU7M,EAAetC,EAAcsC,GAAgB,CACrE/C,MAAO,EACPE,OAAQ,GAENuQ,GAAqB3T,EAAMmG,cAAc,oBAAsBnG,EAAMmG,cAAc,oBAAoBI,QxBhFtG,CACLvF,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GwB6EFyW,GAAkBD,GAAmBL,GACrCO,GAAkBF,GAAmBJ,GAMrCO,GAAWnO,EAAO,EAAG0K,EAAc/J,GAAMI,EAAUJ,IACnDyN,GAAYd,EAAkB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWF,GAAkBT,EAA4BnG,SAAWyG,EAASK,GAAWF,GAAkBT,EAA4BnG,SACxMgH,GAAYf,GAAmB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWD,GAAkBV,EAA4BnG,SAAW0G,EAASI,GAAWD,GAAkBV,EAA4BnG,SACzMjG,GAAoB/G,EAAME,SAASgB,OAAS8D,EAAgBhF,EAAME,SAASgB,OAC3E+S,GAAelN,GAAiC,MAAbiG,EAAmBjG,GAAkBsF,WAAa,EAAItF,GAAkBuF,YAAc,EAAI,EAC7H4H,GAAwH,OAAjGb,EAA+C,MAAvBD,OAA8B,EAASA,EAAoBpG,IAAqBqG,EAAwB,EAEvJc,GAAY9M,EAAS2M,GAAYE,GACjCE,GAAkBzO,EAAOmN,EAAS,EAAQpR,EAF9B2F,EAAS0M,GAAYG,GAAsBD,IAEKvS,EAAK2F,EAAQyL,EAAS,EAAQrR,EAAK0S,IAAa1S,GAChHyE,EAAc8G,GAAYoH,GAC1B1K,EAAKsD,GAAYoH,GAAkB/M,CACrC,CAEA,GAAI8H,EAAc,CAChB,IAAIkF,GAEAC,GAAyB,MAAbtH,EAAmB,EAAM7P,EAErCoX,GAAwB,MAAbvH,EAAmB/P,EAASC,EAEvCsX,GAAUtO,EAAcgJ,GAExBuF,GAAmB,MAAZvF,EAAkB,SAAW,QAEpCwF,GAAOF,GAAUrJ,EAASmJ,IAE1BK,GAAOH,GAAUrJ,EAASoJ,IAE1BK,IAAuD,IAAxC,CAAC,EAAKzX,GAAMqH,QAAQ4B,GAEnCyO,GAAyH,OAAjGR,GAAgD,MAAvBjB,OAA8B,EAASA,EAAoBlE,IAAoBmF,GAAyB,EAEzJS,GAAaF,GAAeF,GAAOF,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAEzI6F,GAAaH,GAAeJ,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAAUyF,GAE5IK,GAAmBlC,GAAU8B,G1BzH9B,SAAwBlT,EAAK1E,EAAOyE,GACzC,IAAIwT,EAAItP,EAAOjE,EAAK1E,EAAOyE,GAC3B,OAAOwT,EAAIxT,EAAMA,EAAMwT,CACzB,C0BsHoDC,CAAeJ,GAAYN,GAASO,IAAcpP,EAAOmN,EAASgC,GAAaJ,GAAMF,GAAS1B,EAASiC,GAAaJ,IAEpKzO,EAAcgJ,GAAW8F,GACzBtL,EAAKwF,GAAW8F,GAAmBR,EACrC,CAEAxU,EAAMmG,cAAcxG,GAAQ+J,CAvE5B,CAwEF,EAQEhC,iBAAkB,CAAC,WE1HN,SAASyN,GAAiBC,EAAyBrQ,EAAcsD,QAC9D,IAAZA,IACFA,GAAU,GAGZ,ICnBoCrJ,ECJOJ,EFuBvCyW,EAA0B9V,EAAcwF,GACxCuQ,EAAuB/V,EAAcwF,IAf3C,SAAyBnG,GACvB,IAAImN,EAAOnN,EAAQ+D,wBACfI,EAASpB,EAAMoK,EAAK7I,OAAStE,EAAQqE,aAAe,EACpDD,EAASrB,EAAMoK,EAAK3I,QAAUxE,EAAQuE,cAAgB,EAC1D,OAAkB,IAAXJ,GAA2B,IAAXC,CACzB,CAU4DuS,CAAgBxQ,GACtEJ,EAAkBF,EAAmBM,GACrCgH,EAAOpJ,EAAsByS,EAAyBE,EAAsBjN,GAC5EyB,EAAS,CACXc,WAAY,EACZE,UAAW,GAET7C,EAAU,CACZ1E,EAAG,EACHE,EAAG,GAkBL,OAfI4R,IAA4BA,IAA4BhN,MACxB,SAA9B1J,EAAYoG,IAChBkG,GAAetG,MACbmF,GCnCgC9K,EDmCT+F,KClCdhG,EAAUC,IAAUO,EAAcP,GCJxC,CACL4L,YAFyChM,EDQbI,GCNR4L,WACpBE,UAAWlM,EAAQkM,WDGZH,GAAgB3L,IDoCnBO,EAAcwF,KAChBkD,EAAUtF,EAAsBoC,GAAc,IACtCxB,GAAKwB,EAAauH,WAC1BrE,EAAQxE,GAAKsB,EAAasH,WACjB1H,IACTsD,EAAQ1E,EAAIyH,GAAoBrG,KAI7B,CACLpB,EAAGwI,EAAK5O,KAAO2M,EAAOc,WAAa3C,EAAQ1E,EAC3CE,EAAGsI,EAAK/K,IAAM8I,EAAOgB,UAAY7C,EAAQxE,EACzCP,MAAO6I,EAAK7I,MACZE,OAAQ2I,EAAK3I,OAEjB,CGvDA,SAASoS,GAAMC,GACb,IAAItT,EAAM,IAAIoO,IACVmF,EAAU,IAAIC,IACdC,EAAS,GAKb,SAAS3F,EAAK4F,GACZH,EAAQI,IAAID,EAASlW,MACN,GAAG3B,OAAO6X,EAASxU,UAAY,GAAIwU,EAASnO,kBAAoB,IACtEvH,SAAQ,SAAU4V,GACzB,IAAKL,EAAQM,IAAID,GAAM,CACrB,IAAIE,EAAc9T,EAAI3F,IAAIuZ,GAEtBE,GACFhG,EAAKgG,EAET,CACF,IACAL,EAAO3E,KAAK4E,EACd,CAQA,OAzBAJ,EAAUtV,SAAQ,SAAU0V,GAC1B1T,EAAIiP,IAAIyE,EAASlW,KAAMkW,EACzB,IAiBAJ,EAAUtV,SAAQ,SAAU0V,GACrBH,EAAQM,IAAIH,EAASlW,OAExBsQ,EAAK4F,EAET,IACOD,CACT,CCvBA,IAAIM,GAAkB,CACpBnY,UAAW,SACX0X,UAAW,GACX1U,SAAU,YAGZ,SAASoV,KACP,IAAK,IAAI1B,EAAO2B,UAAUrG,OAAQsG,EAAO,IAAIpU,MAAMwS,GAAO6B,EAAO,EAAGA,EAAO7B,EAAM6B,IAC/ED,EAAKC,GAAQF,UAAUE,GAGzB,OAAQD,EAAKvE,MAAK,SAAUlT,GAC1B,QAASA,GAAoD,mBAAlCA,EAAQ+D,sBACrC,GACF,CAEO,SAAS4T,GAAgBC,QACL,IAArBA,IACFA,EAAmB,CAAC,GAGtB,IAAIC,EAAoBD,EACpBE,EAAwBD,EAAkBE,iBAC1CA,OAA6C,IAA1BD,EAAmC,GAAKA,EAC3DE,EAAyBH,EAAkBI,eAC3CA,OAA4C,IAA3BD,EAAoCV,GAAkBU,EAC3E,OAAO,SAAsBjZ,EAAWD,EAAQoD,QAC9B,IAAZA,IACFA,EAAU+V,GAGZ,ICxC6B/W,EAC3BgX,EDuCE9W,EAAQ,CACVjC,UAAW,SACXgZ,iBAAkB,GAClBjW,QAASzE,OAAOkE,OAAO,CAAC,EAAG2V,GAAiBW,GAC5C1Q,cAAe,CAAC,EAChBjG,SAAU,CACRvC,UAAWA,EACXD,OAAQA,GAEV4C,WAAY,CAAC,EACbD,OAAQ,CAAC,GAEP2W,EAAmB,GACnBC,GAAc,EACdrN,EAAW,CACb5J,MAAOA,EACPkX,WAAY,SAAoBC,GAC9B,IAAIrW,EAAsC,mBAArBqW,EAAkCA,EAAiBnX,EAAMc,SAAWqW,EACzFC,IACApX,EAAMc,QAAUzE,OAAOkE,OAAO,CAAC,EAAGsW,EAAgB7W,EAAMc,QAASA,GACjEd,EAAMiK,cAAgB,CACpBtM,UAAW0B,EAAU1B,GAAa6N,GAAkB7N,GAAaA,EAAU4Q,eAAiB/C,GAAkB7N,EAAU4Q,gBAAkB,GAC1I7Q,OAAQ8N,GAAkB9N,IAI5B,IElE4B+X,EAC9B4B,EFiEMN,EDhCG,SAAwBtB,GAErC,IAAIsB,EAAmBvB,GAAMC,GAE7B,OAAO/W,EAAeb,QAAO,SAAUC,EAAK+B,GAC1C,OAAO/B,EAAIE,OAAO+Y,EAAiBvR,QAAO,SAAUqQ,GAClD,OAAOA,EAAShW,QAAUA,CAC5B,IACF,GAAG,GACL,CCuB+ByX,EElEK7B,EFkEsB,GAAGzX,OAAO2Y,EAAkB3W,EAAMc,QAAQ2U,WEjE9F4B,EAAS5B,EAAU5X,QAAO,SAAUwZ,EAAQE,GAC9C,IAAIC,EAAWH,EAAOE,EAAQ5X,MAK9B,OAJA0X,EAAOE,EAAQ5X,MAAQ6X,EAAWnb,OAAOkE,OAAO,CAAC,EAAGiX,EAAUD,EAAS,CACrEzW,QAASzE,OAAOkE,OAAO,CAAC,EAAGiX,EAAS1W,QAASyW,EAAQzW,SACrD4I,KAAMrN,OAAOkE,OAAO,CAAC,EAAGiX,EAAS9N,KAAM6N,EAAQ7N,QAC5C6N,EACEF,CACT,GAAG,CAAC,GAEGhb,OAAO4D,KAAKoX,GAAQlV,KAAI,SAAUhG,GACvC,OAAOkb,EAAOlb,EAChB,MF4DM,OAJA6D,EAAM+W,iBAAmBA,EAAiBvR,QAAO,SAAUiS,GACzD,OAAOA,EAAE7X,OACX,IA+FFI,EAAM+W,iBAAiB5W,SAAQ,SAAUJ,GACvC,IAAIJ,EAAOI,EAAKJ,KACZ+X,EAAe3X,EAAKe,QACpBA,OAA2B,IAAjB4W,EAA0B,CAAC,EAAIA,EACzChX,EAASX,EAAKW,OAElB,GAAsB,mBAAXA,EAAuB,CAChC,IAAIiX,EAAYjX,EAAO,CACrBV,MAAOA,EACPL,KAAMA,EACNiK,SAAUA,EACV9I,QAASA,IAKXkW,EAAiB/F,KAAK0G,GAFT,WAAmB,EAGlC,CACF,IA/GS/N,EAASQ,QAClB,EAMAwN,YAAa,WACX,IAAIX,EAAJ,CAIA,IAAIY,EAAkB7X,EAAME,SACxBvC,EAAYka,EAAgBla,UAC5BD,EAASma,EAAgBna,OAG7B,GAAKyY,GAAiBxY,EAAWD,GAAjC,CAKAsC,EAAMwG,MAAQ,CACZ7I,UAAWwX,GAAiBxX,EAAWqH,EAAgBtH,GAAoC,UAA3BsC,EAAMc,QAAQC,UAC9ErD,OAAQiG,EAAcjG,IAOxBsC,EAAM0R,OAAQ,EACd1R,EAAMjC,UAAYiC,EAAMc,QAAQ/C,UAKhCiC,EAAM+W,iBAAiB5W,SAAQ,SAAU0V,GACvC,OAAO7V,EAAMmG,cAAc0P,EAASlW,MAAQtD,OAAOkE,OAAO,CAAC,EAAGsV,EAASnM,KACzE,IAEA,IAAK,IAAIoO,EAAQ,EAAGA,EAAQ9X,EAAM+W,iBAAiBhH,OAAQ+H,IACzD,IAAoB,IAAhB9X,EAAM0R,MAAV,CAMA,IAAIqG,EAAwB/X,EAAM+W,iBAAiBe,GAC/ChY,EAAKiY,EAAsBjY,GAC3BkY,EAAyBD,EAAsBjX,QAC/CoM,OAAsC,IAA3B8K,EAAoC,CAAC,EAAIA,EACpDrY,EAAOoY,EAAsBpY,KAEf,mBAAPG,IACTE,EAAQF,EAAG,CACTE,MAAOA,EACPc,QAASoM,EACTvN,KAAMA,EACNiK,SAAUA,KACN5J,EAdR,MAHEA,EAAM0R,OAAQ,EACdoG,GAAS,CAzBb,CATA,CAqDF,EAGA1N,QC1I2BtK,ED0IV,WACf,OAAO,IAAImY,SAAQ,SAAUC,GAC3BtO,EAASgO,cACTM,EAAQlY,EACV,GACF,EC7IG,WAUL,OATK8W,IACHA,EAAU,IAAImB,SAAQ,SAAUC,GAC9BD,QAAQC,UAAUC,MAAK,WACrBrB,OAAUsB,EACVF,EAAQpY,IACV,GACF,KAGKgX,CACT,GDmIIuB,QAAS,WACPjB,IACAH,GAAc,CAChB,GAGF,IAAKd,GAAiBxY,EAAWD,GAC/B,OAAOkM,EAmCT,SAASwN,IACPJ,EAAiB7W,SAAQ,SAAUL,GACjC,OAAOA,GACT,IACAkX,EAAmB,EACrB,CAEA,OAvCApN,EAASsN,WAAWpW,GAASqX,MAAK,SAAUnY,IACrCiX,GAAenW,EAAQwX,eAC1BxX,EAAQwX,cAActY,EAE1B,IAmCO4J,CACT,CACF,CACO,IAAI2O,GAA4BhC,KGzLnC,GAA4BA,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,EAAa,GAAQ,GAAM,GAAiB,EAAO,MCJrH,GAA4BjC,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,KCatE,MAAMC,GAAa,IAAIlI,IACjBmI,GAAO,CACX,GAAAtH,CAAIxS,EAASzC,EAAKyN,GACX6O,GAAWzC,IAAIpX,IAClB6Z,GAAWrH,IAAIxS,EAAS,IAAI2R,KAE9B,MAAMoI,EAAcF,GAAWjc,IAAIoC,GAI9B+Z,EAAY3C,IAAI7Z,IAA6B,IAArBwc,EAAYC,KAKzCD,EAAYvH,IAAIjV,EAAKyN,GAHnBiP,QAAQC,MAAM,+EAA+E7W,MAAM8W,KAAKJ,EAAY1Y,QAAQ,MAIhI,EACAzD,IAAG,CAACoC,EAASzC,IACPsc,GAAWzC,IAAIpX,IACV6Z,GAAWjc,IAAIoC,GAASpC,IAAIL,IAE9B,KAET,MAAA6c,CAAOpa,EAASzC,GACd,IAAKsc,GAAWzC,IAAIpX,GAClB,OAEF,MAAM+Z,EAAcF,GAAWjc,IAAIoC,GACnC+Z,EAAYM,OAAO9c,GAGM,IAArBwc,EAAYC,MACdH,GAAWQ,OAAOra,EAEtB,GAYIsa,GAAiB,gBAOjBC,GAAgBC,IAChBA,GAAYna,OAAOoa,KAAOpa,OAAOoa,IAAIC,SAEvCF,EAAWA,EAAS5O,QAAQ,iBAAiB,CAAC+O,EAAOC,IAAO,IAAIH,IAAIC,OAAOE,QAEtEJ,GA4CHK,GAAuB7a,IAC3BA,EAAQ8a,cAAc,IAAIC,MAAMT,IAAgB,EAE5C,GAAYU,MACXA,GAA4B,iBAAXA,UAGO,IAAlBA,EAAOC,SAChBD,EAASA,EAAO,SAEgB,IAApBA,EAAOE,UAEjBC,GAAaH,GAEb,GAAUA,GACLA,EAAOC,OAASD,EAAO,GAAKA,EAEf,iBAAXA,GAAuBA,EAAO7J,OAAS,EACzCrL,SAAS+C,cAAc0R,GAAcS,IAEvC,KAEHI,GAAYpb,IAChB,IAAK,GAAUA,IAAgD,IAApCA,EAAQqb,iBAAiBlK,OAClD,OAAO,EAET,MAAMmK,EAAgF,YAA7D5V,iBAAiB1F,GAASub,iBAAiB,cAE9DC,EAAgBxb,EAAQyb,QAAQ,uBACtC,IAAKD,EACH,OAAOF,EAET,GAAIE,IAAkBxb,EAAS,CAC7B,MAAM0b,EAAU1b,EAAQyb,QAAQ,WAChC,GAAIC,GAAWA,EAAQlW,aAAegW,EACpC,OAAO,EAET,GAAgB,OAAZE,EACF,OAAO,CAEX,CACA,OAAOJ,CAAgB,EAEnBK,GAAa3b,IACZA,GAAWA,EAAQkb,WAAaU,KAAKC,gBAGtC7b,EAAQ8b,UAAU7W,SAAS,mBAGC,IAArBjF,EAAQ+b,SACV/b,EAAQ+b,SAEV/b,EAAQgc,aAAa,aAAoD,UAArChc,EAAQic,aAAa,aAE5DC,GAAiBlc,IACrB,IAAK8F,SAASC,gBAAgBoW,aAC5B,OAAO,KAIT,GAAmC,mBAAxBnc,EAAQqF,YAA4B,CAC7C,MAAM+W,EAAOpc,EAAQqF,cACrB,OAAO+W,aAAgBtb,WAAasb,EAAO,IAC7C,CACA,OAAIpc,aAAmBc,WACdd,EAIJA,EAAQwF,WAGN0W,GAAelc,EAAQwF,YAFrB,IAEgC,EAErC6W,GAAO,OAUPC,GAAStc,IACbA,EAAQuE,YAAY,EAEhBgY,GAAY,IACZlc,OAAOmc,SAAW1W,SAAS6G,KAAKqP,aAAa,qBACxC3b,OAAOmc,OAET,KAEHC,GAA4B,GAgB5BC,GAAQ,IAAuC,QAAjC5W,SAASC,gBAAgB4W,IACvCC,GAAqBC,IAhBAC,QAiBN,KACjB,MAAMC,EAAIR,KAEV,GAAIQ,EAAG,CACL,MAAMhc,EAAO8b,EAAOG,KACdC,EAAqBF,EAAE7b,GAAGH,GAChCgc,EAAE7b,GAAGH,GAAQ8b,EAAOK,gBACpBH,EAAE7b,GAAGH,GAAMoc,YAAcN,EACzBE,EAAE7b,GAAGH,GAAMqc,WAAa,KACtBL,EAAE7b,GAAGH,GAAQkc,EACNJ,EAAOK,gBAElB,GA5B0B,YAAxBpX,SAASuX,YAENZ,GAA0BtL,QAC7BrL,SAASyF,iBAAiB,oBAAoB,KAC5C,IAAK,MAAMuR,KAAYL,GACrBK,GACF,IAGJL,GAA0BpK,KAAKyK,IAE/BA,GAkBA,EAEEQ,GAAU,CAACC,EAAkB9F,EAAO,GAAI+F,EAAeD,IACxB,mBAArBA,EAAkCA,KAAoB9F,GAAQ+F,EAExEC,GAAyB,CAACX,EAAUY,EAAmBC,GAAoB,KAC/E,IAAKA,EAEH,YADAL,GAAQR,GAGV,MACMc,EA/JiC5d,KACvC,IAAKA,EACH,OAAO,EAIT,IAAI,mBACF6d,EAAkB,gBAClBC,GACEzd,OAAOqF,iBAAiB1F,GAC5B,MAAM+d,EAA0BC,OAAOC,WAAWJ,GAC5CK,EAAuBF,OAAOC,WAAWH,GAG/C,OAAKC,GAA4BG,GAKjCL,EAAqBA,EAAmBlb,MAAM,KAAK,GACnDmb,EAAkBA,EAAgBnb,MAAM,KAAK,GAtDf,KAuDtBqb,OAAOC,WAAWJ,GAAsBG,OAAOC,WAAWH,KANzD,CAMoG,EA0IpFK,CAAiCT,GADlC,EAExB,IAAIU,GAAS,EACb,MAAMC,EAAU,EACdrR,aAEIA,IAAW0Q,IAGfU,GAAS,EACTV,EAAkBjS,oBAAoB6O,GAAgB+D,GACtDf,GAAQR,GAAS,EAEnBY,EAAkBnS,iBAAiB+O,GAAgB+D,GACnDC,YAAW,KACJF,GACHvD,GAAqB6C,EACvB,GACCE,EAAiB,EAYhBW,GAAuB,CAAC1R,EAAM2R,EAAeC,EAAeC,KAChE,MAAMC,EAAa9R,EAAKsE,OACxB,IAAI+H,EAAQrM,EAAKjH,QAAQ4Y,GAIzB,OAAe,IAAXtF,GACMuF,GAAiBC,EAAiB7R,EAAK8R,EAAa,GAAK9R,EAAK,IAExEqM,GAASuF,EAAgB,GAAK,EAC1BC,IACFxF,GAASA,EAAQyF,GAAcA,GAE1B9R,EAAKjK,KAAKC,IAAI,EAAGD,KAAKE,IAAIoW,EAAOyF,EAAa,KAAI,EAerDC,GAAiB,qBACjBC,GAAiB,OACjBC,GAAgB,SAChBC,GAAgB,CAAC,EACvB,IAAIC,GAAW,EACf,MAAMC,GAAe,CACnBC,WAAY,YACZC,WAAY,YAERC,GAAe,IAAIrI,IAAI,CAAC,QAAS,WAAY,UAAW,YAAa,cAAe,aAAc,iBAAkB,YAAa,WAAY,YAAa,cAAe,YAAa,UAAW,WAAY,QAAS,oBAAqB,aAAc,YAAa,WAAY,cAAe,cAAe,cAAe,YAAa,eAAgB,gBAAiB,eAAgB,gBAAiB,aAAc,QAAS,OAAQ,SAAU,QAAS,SAAU,SAAU,UAAW,WAAY,OAAQ,SAAU,eAAgB,SAAU,OAAQ,mBAAoB,mBAAoB,QAAS,QAAS,WAM/lB,SAASsI,GAAarf,EAASsf,GAC7B,OAAOA,GAAO,GAAGA,MAAQN,QAAgBhf,EAAQgf,UAAYA,IAC/D,CACA,SAASO,GAAiBvf,GACxB,MAAMsf,EAAMD,GAAarf,GAGzB,OAFAA,EAAQgf,SAAWM,EACnBP,GAAcO,GAAOP,GAAcO,IAAQ,CAAC,EACrCP,GAAcO,EACvB,CAiCA,SAASE,GAAYC,EAAQC,EAAUC,EAAqB,MAC1D,OAAOliB,OAAOmiB,OAAOH,GAAQ7M,MAAKiN,GAASA,EAAMH,WAAaA,GAAYG,EAAMF,qBAAuBA,GACzG,CACA,SAASG,GAAoBC,EAAmB1B,EAAS2B,GACvD,MAAMC,EAAiC,iBAAZ5B,EAErBqB,EAAWO,EAAcD,EAAqB3B,GAAW2B,EAC/D,IAAIE,EAAYC,GAAaJ,GAI7B,OAHKX,GAAahI,IAAI8I,KACpBA,EAAYH,GAEP,CAACE,EAAaP,EAAUQ,EACjC,CACA,SAASE,GAAWpgB,EAAS+f,EAAmB1B,EAAS2B,EAAoBK,GAC3E,GAAiC,iBAAtBN,IAAmC/f,EAC5C,OAEF,IAAKigB,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GAIzF,GAAID,KAAqBd,GAAc,CACrC,MAAMqB,EAAepf,GACZ,SAAU2e,GACf,IAAKA,EAAMU,eAAiBV,EAAMU,gBAAkBV,EAAMW,iBAAmBX,EAAMW,eAAevb,SAAS4a,EAAMU,eAC/G,OAAOrf,EAAGjD,KAAKwiB,KAAMZ,EAEzB,EAEFH,EAAWY,EAAaZ,EAC1B,CACA,MAAMD,EAASF,GAAiBvf,GAC1B0gB,EAAWjB,EAAOS,KAAeT,EAAOS,GAAa,CAAC,GACtDS,EAAmBnB,GAAYkB,EAAUhB,EAAUO,EAAc5B,EAAU,MACjF,GAAIsC,EAEF,YADAA,EAAiBN,OAASM,EAAiBN,QAAUA,GAGvD,MAAMf,EAAMD,GAAaK,EAAUK,EAAkBnU,QAAQgT,GAAgB,KACvE1d,EAAK+e,EA5Db,SAAoCjgB,EAASwa,EAAUtZ,GACrD,OAAO,SAASmd,EAAQwB,GACtB,MAAMe,EAAc5gB,EAAQ6gB,iBAAiBrG,GAC7C,IAAK,IAAI,OACPxN,GACE6S,EAAO7S,GAAUA,IAAWyT,KAAMzT,EAASA,EAAOxH,WACpD,IAAK,MAAMsb,KAAcF,EACvB,GAAIE,IAAe9T,EASnB,OANA+T,GAAWlB,EAAO,CAChBW,eAAgBxT,IAEdqR,EAAQgC,QACVW,GAAaC,IAAIjhB,EAAS6f,EAAMqB,KAAM1G,EAAUtZ,GAE3CA,EAAGigB,MAAMnU,EAAQ,CAAC6S,GAG/B,CACF,CAwC2BuB,CAA2BphB,EAASqe,EAASqB,GAvExE,SAA0B1f,EAASkB,GACjC,OAAO,SAASmd,EAAQwB,GAOtB,OANAkB,GAAWlB,EAAO,CAChBW,eAAgBxgB,IAEdqe,EAAQgC,QACVW,GAAaC,IAAIjhB,EAAS6f,EAAMqB,KAAMhgB,GAEjCA,EAAGigB,MAAMnhB,EAAS,CAAC6f,GAC5B,CACF,CA6DoFwB,CAAiBrhB,EAAS0f,GAC5Gxe,EAAGye,mBAAqBM,EAAc5B,EAAU,KAChDnd,EAAGwe,SAAWA,EACdxe,EAAGmf,OAASA,EACZnf,EAAG8d,SAAWM,EACdoB,EAASpB,GAAOpe,EAChBlB,EAAQuL,iBAAiB2U,EAAWhf,EAAI+e,EAC1C,CACA,SAASqB,GAActhB,EAASyf,EAAQS,EAAW7B,EAASsB,GAC1D,MAAMze,EAAKse,GAAYC,EAAOS,GAAY7B,EAASsB,GAC9Cze,IAGLlB,EAAQyL,oBAAoByU,EAAWhf,EAAIqgB,QAAQ5B,WAC5CF,EAAOS,GAAWhf,EAAG8d,UAC9B,CACA,SAASwC,GAAyBxhB,EAASyf,EAAQS,EAAWuB,GAC5D,MAAMC,EAAoBjC,EAAOS,IAAc,CAAC,EAChD,IAAK,MAAOyB,EAAY9B,KAAUpiB,OAAOmkB,QAAQF,GAC3CC,EAAWE,SAASJ,IACtBH,GAActhB,EAASyf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAGtE,CACA,SAASQ,GAAaN,GAGpB,OADAA,EAAQA,EAAMjU,QAAQiT,GAAgB,IAC/BI,GAAaY,IAAUA,CAChC,CACA,MAAMmB,GAAe,CACnB,EAAAc,CAAG9hB,EAAS6f,EAAOxB,EAAS2B,GAC1BI,GAAWpgB,EAAS6f,EAAOxB,EAAS2B,GAAoB,EAC1D,EACA,GAAA+B,CAAI/hB,EAAS6f,EAAOxB,EAAS2B,GAC3BI,GAAWpgB,EAAS6f,EAAOxB,EAAS2B,GAAoB,EAC1D,EACA,GAAAiB,CAAIjhB,EAAS+f,EAAmB1B,EAAS2B,GACvC,GAAiC,iBAAtBD,IAAmC/f,EAC5C,OAEF,MAAOigB,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GACrFgC,EAAc9B,IAAcH,EAC5BN,EAASF,GAAiBvf,GAC1B0hB,EAAoBjC,EAAOS,IAAc,CAAC,EAC1C+B,EAAclC,EAAkBmC,WAAW,KACjD,QAAwB,IAAbxC,EAAX,CAQA,GAAIuC,EACF,IAAK,MAAME,KAAgB1kB,OAAO4D,KAAKoe,GACrC+B,GAAyBxhB,EAASyf,EAAQ0C,EAAcpC,EAAkBlN,MAAM,IAGpF,IAAK,MAAOuP,EAAavC,KAAUpiB,OAAOmkB,QAAQF,GAAoB,CACpE,MAAMC,EAAaS,EAAYxW,QAAQkT,GAAe,IACjDkD,IAAejC,EAAkB8B,SAASF,IAC7CL,GAActhB,EAASyf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAEpE,CAXA,KAPA,CAEE,IAAKliB,OAAO4D,KAAKqgB,GAAmBvQ,OAClC,OAEFmQ,GAActhB,EAASyf,EAAQS,EAAWR,EAAUO,EAAc5B,EAAU,KAE9E,CAYF,EACA,OAAAgE,CAAQriB,EAAS6f,EAAOpI,GACtB,GAAqB,iBAAVoI,IAAuB7f,EAChC,OAAO,KAET,MAAM+c,EAAIR,KAGV,IAAI+F,EAAc,KACdC,GAAU,EACVC,GAAiB,EACjBC,GAAmB,EAJH5C,IADFM,GAAaN,IAMZ9C,IACjBuF,EAAcvF,EAAEhC,MAAM8E,EAAOpI,GAC7BsF,EAAE/c,GAASqiB,QAAQC,GACnBC,GAAWD,EAAYI,uBACvBF,GAAkBF,EAAYK,gCAC9BF,EAAmBH,EAAYM,sBAEjC,MAAMC,EAAM9B,GAAW,IAAIhG,MAAM8E,EAAO,CACtC0C,UACAO,YAAY,IACVrL,GAUJ,OATIgL,GACFI,EAAIE,iBAEFP,GACFxiB,EAAQ8a,cAAc+H,GAEpBA,EAAIJ,kBAAoBH,GAC1BA,EAAYS,iBAEPF,CACT,GAEF,SAAS9B,GAAWljB,EAAKmlB,EAAO,CAAC,GAC/B,IAAK,MAAOzlB,EAAKa,KAAUX,OAAOmkB,QAAQoB,GACxC,IACEnlB,EAAIN,GAAOa,CACb,CAAE,MAAO6kB,GACPxlB,OAAOC,eAAeG,EAAKN,EAAK,CAC9B2lB,cAAc,EACdtlB,IAAG,IACMQ,GAGb,CAEF,OAAOP,CACT,CASA,SAASslB,GAAc/kB,GACrB,GAAc,SAAVA,EACF,OAAO,EAET,GAAc,UAAVA,EACF,OAAO,EAET,GAAIA,IAAU4f,OAAO5f,GAAOkC,WAC1B,OAAO0d,OAAO5f,GAEhB,GAAc,KAAVA,GAA0B,SAAVA,EAClB,OAAO,KAET,GAAqB,iBAAVA,EACT,OAAOA,EAET,IACE,OAAOglB,KAAKC,MAAMC,mBAAmBllB,GACvC,CAAE,MAAO6kB,GACP,OAAO7kB,CACT,CACF,CACA,SAASmlB,GAAiBhmB,GACxB,OAAOA,EAAIqO,QAAQ,UAAU4X,GAAO,IAAIA,EAAItjB,iBAC9C,CACA,MAAMujB,GAAc,CAClB,gBAAAC,CAAiB1jB,EAASzC,EAAKa,GAC7B4B,EAAQ6B,aAAa,WAAW0hB,GAAiBhmB,KAAQa,EAC3D,EACA,mBAAAulB,CAAoB3jB,EAASzC,GAC3ByC,EAAQ4B,gBAAgB,WAAW2hB,GAAiBhmB,KACtD,EACA,iBAAAqmB,CAAkB5jB,GAChB,IAAKA,EACH,MAAO,CAAC,EAEV,MAAM0B,EAAa,CAAC,EACdmiB,EAASpmB,OAAO4D,KAAKrB,EAAQ8jB,SAASld,QAAOrJ,GAAOA,EAAI2kB,WAAW,QAAU3kB,EAAI2kB,WAAW,cAClG,IAAK,MAAM3kB,KAAOsmB,EAAQ,CACxB,IAAIE,EAAUxmB,EAAIqO,QAAQ,MAAO,IACjCmY,EAAUA,EAAQC,OAAO,GAAG9jB,cAAgB6jB,EAAQlR,MAAM,EAAGkR,EAAQ5S,QACrEzP,EAAWqiB,GAAWZ,GAAcnjB,EAAQ8jB,QAAQvmB,GACtD,CACA,OAAOmE,CACT,EACAuiB,iBAAgB,CAACjkB,EAASzC,IACjB4lB,GAAcnjB,EAAQic,aAAa,WAAWsH,GAAiBhmB,QAgB1E,MAAM2mB,GAEJ,kBAAWC,GACT,MAAO,CAAC,CACV,CACA,sBAAWC,GACT,MAAO,CAAC,CACV,CACA,eAAWpH,GACT,MAAM,IAAIqH,MAAM,sEAClB,CACA,UAAAC,CAAWC,GAIT,OAHAA,EAAS9D,KAAK+D,gBAAgBD,GAC9BA,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CACA,iBAAAE,CAAkBF,GAChB,OAAOA,CACT,CACA,eAAAC,CAAgBD,EAAQvkB,GACtB,MAAM2kB,EAAa,GAAU3kB,GAAWyjB,GAAYQ,iBAAiBjkB,EAAS,UAAY,CAAC,EAE3F,MAAO,IACFygB,KAAKmE,YAAYT,WACM,iBAAfQ,EAA0BA,EAAa,CAAC,KAC/C,GAAU3kB,GAAWyjB,GAAYG,kBAAkB5jB,GAAW,CAAC,KAC7C,iBAAXukB,EAAsBA,EAAS,CAAC,EAE/C,CACA,gBAAAG,CAAiBH,EAAQM,EAAcpE,KAAKmE,YAAYR,aACtD,IAAK,MAAO7hB,EAAUuiB,KAAkBrnB,OAAOmkB,QAAQiD,GAAc,CACnE,MAAMzmB,EAAQmmB,EAAOhiB,GACfwiB,EAAY,GAAU3mB,GAAS,UAhiBrC4c,OADSA,EAiiB+C5c,GA/hBnD,GAAG4c,IAELvd,OAAOM,UAAUuC,SAASrC,KAAK+c,GAAQL,MAAM,eAAe,GAAGza,cA8hBlE,IAAK,IAAI8kB,OAAOF,GAAehhB,KAAKihB,GAClC,MAAM,IAAIE,UAAU,GAAGxE,KAAKmE,YAAY5H,KAAKkI,0BAA0B3iB,qBAA4BwiB,yBAAiCD,MAExI,CAriBW9J,KAsiBb,EAqBF,MAAMmK,WAAsBjB,GAC1B,WAAAU,CAAY5kB,EAASukB,GACnBa,SACAplB,EAAUmb,GAAWnb,MAIrBygB,KAAK4E,SAAWrlB,EAChBygB,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/BzK,GAAKtH,IAAIiO,KAAK4E,SAAU5E,KAAKmE,YAAYW,SAAU9E,MACrD,CAGA,OAAA+E,GACE1L,GAAKM,OAAOqG,KAAK4E,SAAU5E,KAAKmE,YAAYW,UAC5CvE,GAAaC,IAAIR,KAAK4E,SAAU5E,KAAKmE,YAAYa,WACjD,IAAK,MAAMC,KAAgBjoB,OAAOkoB,oBAAoBlF,MACpDA,KAAKiF,GAAgB,IAEzB,CACA,cAAAE,CAAe9I,EAAU9c,EAAS6lB,GAAa,GAC7CpI,GAAuBX,EAAU9c,EAAS6lB,EAC5C,CACA,UAAAvB,CAAWC,GAIT,OAHAA,EAAS9D,KAAK+D,gBAAgBD,EAAQ9D,KAAK4E,UAC3Cd,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CAGA,kBAAOuB,CAAY9lB,GACjB,OAAO8Z,GAAKlc,IAAIud,GAAWnb,GAAUygB,KAAK8E,SAC5C,CACA,0BAAOQ,CAAoB/lB,EAASukB,EAAS,CAAC,GAC5C,OAAO9D,KAAKqF,YAAY9lB,IAAY,IAAIygB,KAAKzgB,EAA2B,iBAAXukB,EAAsBA,EAAS,KAC9F,CACA,kBAAWyB,GACT,MA5CY,OA6Cd,CACA,mBAAWT,GACT,MAAO,MAAM9E,KAAKzD,MACpB,CACA,oBAAWyI,GACT,MAAO,IAAIhF,KAAK8E,UAClB,CACA,gBAAOU,CAAUllB,GACf,MAAO,GAAGA,IAAO0f,KAAKgF,WACxB,EAUF,MAAMS,GAAclmB,IAClB,IAAIwa,EAAWxa,EAAQic,aAAa,kBACpC,IAAKzB,GAAyB,MAAbA,EAAkB,CACjC,IAAI2L,EAAgBnmB,EAAQic,aAAa,QAMzC,IAAKkK,IAAkBA,EAActE,SAAS,OAASsE,EAAcjE,WAAW,KAC9E,OAAO,KAILiE,EAActE,SAAS,OAASsE,EAAcjE,WAAW,OAC3DiE,EAAgB,IAAIA,EAAcxjB,MAAM,KAAK,MAE/C6X,EAAW2L,GAAmC,MAAlBA,EAAwBA,EAAcC,OAAS,IAC7E,CACA,OAAO5L,EAAWA,EAAS7X,MAAM,KAAKY,KAAI8iB,GAAO9L,GAAc8L,KAAM1iB,KAAK,KAAO,IAAI,EAEjF2iB,GAAiB,CACrB1T,KAAI,CAAC4H,EAAUxa,EAAU8F,SAASC,kBACzB,GAAG3G,UAAUsB,QAAQ3C,UAAU8iB,iBAAiB5iB,KAAK+B,EAASwa,IAEvE+L,QAAO,CAAC/L,EAAUxa,EAAU8F,SAASC,kBAC5BrF,QAAQ3C,UAAU8K,cAAc5K,KAAK+B,EAASwa,GAEvDgM,SAAQ,CAACxmB,EAASwa,IACT,GAAGpb,UAAUY,EAAQwmB,UAAU5f,QAAOzB,GAASA,EAAMshB,QAAQjM,KAEtE,OAAAkM,CAAQ1mB,EAASwa,GACf,MAAMkM,EAAU,GAChB,IAAIC,EAAW3mB,EAAQwF,WAAWiW,QAAQjB,GAC1C,KAAOmM,GACLD,EAAQrU,KAAKsU,GACbA,EAAWA,EAASnhB,WAAWiW,QAAQjB,GAEzC,OAAOkM,CACT,EACA,IAAAE,CAAK5mB,EAASwa,GACZ,IAAIqM,EAAW7mB,EAAQ8mB,uBACvB,KAAOD,GAAU,CACf,GAAIA,EAASJ,QAAQjM,GACnB,MAAO,CAACqM,GAEVA,EAAWA,EAASC,sBACtB,CACA,MAAO,EACT,EAEA,IAAAxhB,CAAKtF,EAASwa,GACZ,IAAIlV,EAAOtF,EAAQ+mB,mBACnB,KAAOzhB,GAAM,CACX,GAAIA,EAAKmhB,QAAQjM,GACf,MAAO,CAAClV,GAEVA,EAAOA,EAAKyhB,kBACd,CACA,MAAO,EACT,EACA,iBAAAC,CAAkBhnB,GAChB,MAAMinB,EAAa,CAAC,IAAK,SAAU,QAAS,WAAY,SAAU,UAAW,aAAc,4BAA4B1jB,KAAIiX,GAAY,GAAGA,2BAAiC7W,KAAK,KAChL,OAAO8c,KAAK7N,KAAKqU,EAAYjnB,GAAS4G,QAAOsgB,IAAOvL,GAAWuL,IAAO9L,GAAU8L,IAClF,EACA,sBAAAC,CAAuBnnB,GACrB,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAIwa,GACK8L,GAAeC,QAAQ/L,GAAYA,EAErC,IACT,EACA,sBAAA4M,CAAuBpnB,GACrB,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAOwa,EAAW8L,GAAeC,QAAQ/L,GAAY,IACvD,EACA,+BAAA6M,CAAgCrnB,GAC9B,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAOwa,EAAW8L,GAAe1T,KAAK4H,GAAY,EACpD,GAUI8M,GAAuB,CAACC,EAAWC,EAAS,UAChD,MAAMC,EAAa,gBAAgBF,EAAU9B,YACvC1kB,EAAOwmB,EAAUvK,KACvBgE,GAAac,GAAGhc,SAAU2hB,EAAY,qBAAqB1mB,OAAU,SAAU8e,GAI7E,GAHI,CAAC,IAAK,QAAQgC,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,MACb,OAEF,MAAMzT,EAASsZ,GAAec,uBAAuB3G,OAASA,KAAKhF,QAAQ,IAAI1a,KAC9DwmB,EAAUxB,oBAAoB/Y,GAGtCwa,IACX,GAAE,EAiBEG,GAAc,YACdC,GAAc,QAAQD,KACtBE,GAAe,SAASF,KAQ9B,MAAMG,WAAc3C,GAElB,eAAWnI,GACT,MAfW,OAgBb,CAGA,KAAA+K,GAEE,GADmB/G,GAAaqB,QAAQ5B,KAAK4E,SAAUuC,IACxCnF,iBACb,OAEFhC,KAAK4E,SAASvJ,UAAU1B,OAlBF,QAmBtB,MAAMyL,EAAapF,KAAK4E,SAASvJ,UAAU7W,SApBrB,QAqBtBwb,KAAKmF,gBAAe,IAAMnF,KAAKuH,mBAAmBvH,KAAK4E,SAAUQ,EACnE,CAGA,eAAAmC,GACEvH,KAAK4E,SAASjL,SACd4G,GAAaqB,QAAQ5B,KAAK4E,SAAUwC,IACpCpH,KAAK+E,SACP,CAGA,sBAAOtI,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOgd,GAAM/B,oBAAoBtF,MACvC,GAAsB,iBAAX8D,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KAJb,CAKF,GACF,EAOF6G,GAAqBQ,GAAO,SAM5BlL,GAAmBkL,IAcnB,MAKMI,GAAyB,4BAO/B,MAAMC,WAAehD,GAEnB,eAAWnI,GACT,MAfW,QAgBb,CAGA,MAAAoL,GAEE3H,KAAK4E,SAASxjB,aAAa,eAAgB4e,KAAK4E,SAASvJ,UAAUsM,OAjB3C,UAkB1B,CAGA,sBAAOlL,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOqd,GAAOpC,oBAAoBtF,MACzB,WAAX8D,GACFzZ,EAAKyZ,IAET,GACF,EAOFvD,GAAac,GAAGhc,SAjCe,2BAiCmBoiB,IAAwBrI,IACxEA,EAAMkD,iBACN,MAAMsF,EAASxI,EAAM7S,OAAOyO,QAAQyM,IACvBC,GAAOpC,oBAAoBsC,GACnCD,QAAQ,IAOfxL,GAAmBuL,IAcnB,MACMG,GAAc,YACdC,GAAmB,aAAaD,KAChCE,GAAkB,YAAYF,KAC9BG,GAAiB,WAAWH,KAC5BI,GAAoB,cAAcJ,KAClCK,GAAkB,YAAYL,KAK9BM,GAAY,CAChBC,YAAa,KACbC,aAAc,KACdC,cAAe,MAEXC,GAAgB,CACpBH,YAAa,kBACbC,aAAc,kBACdC,cAAe,mBAOjB,MAAME,WAAc/E,GAClB,WAAAU,CAAY5kB,EAASukB,GACnBa,QACA3E,KAAK4E,SAAWrlB,EACXA,GAAYipB,GAAMC,gBAGvBzI,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAK0I,QAAU,EACf1I,KAAK2I,sBAAwB7H,QAAQlhB,OAAOgpB,cAC5C5I,KAAK6I,cACP,CAGA,kBAAWnF,GACT,OAAOyE,EACT,CACA,sBAAWxE,GACT,OAAO4E,EACT,CACA,eAAWhM,GACT,MA/CW,OAgDb,CAGA,OAAAwI,GACExE,GAAaC,IAAIR,KAAK4E,SAAUiD,GAClC,CAGA,MAAAiB,CAAO1J,GACAY,KAAK2I,sBAIN3I,KAAK+I,wBAAwB3J,KAC/BY,KAAK0I,QAAUtJ,EAAM4J,SAJrBhJ,KAAK0I,QAAUtJ,EAAM6J,QAAQ,GAAGD,OAMpC,CACA,IAAAE,CAAK9J,GACCY,KAAK+I,wBAAwB3J,KAC/BY,KAAK0I,QAAUtJ,EAAM4J,QAAUhJ,KAAK0I,SAEtC1I,KAAKmJ,eACLtM,GAAQmD,KAAK6E,QAAQuD,YACvB,CACA,KAAAgB,CAAMhK,GACJY,KAAK0I,QAAUtJ,EAAM6J,SAAW7J,EAAM6J,QAAQvY,OAAS,EAAI,EAAI0O,EAAM6J,QAAQ,GAAGD,QAAUhJ,KAAK0I,OACjG,CACA,YAAAS,GACE,MAAME,EAAYlnB,KAAKoC,IAAIyb,KAAK0I,SAChC,GAAIW,GAnEgB,GAoElB,OAEF,MAAM/b,EAAY+b,EAAYrJ,KAAK0I,QACnC1I,KAAK0I,QAAU,EACVpb,GAGLuP,GAAQvP,EAAY,EAAI0S,KAAK6E,QAAQyD,cAAgBtI,KAAK6E,QAAQwD,aACpE,CACA,WAAAQ,GACM7I,KAAK2I,uBACPpI,GAAac,GAAGrB,KAAK4E,SAAUqD,IAAmB7I,GAASY,KAAK8I,OAAO1J,KACvEmB,GAAac,GAAGrB,KAAK4E,SAAUsD,IAAiB9I,GAASY,KAAKkJ,KAAK9J,KACnEY,KAAK4E,SAASvJ,UAAU5E,IAlFG,mBAoF3B8J,GAAac,GAAGrB,KAAK4E,SAAUkD,IAAkB1I,GAASY,KAAK8I,OAAO1J,KACtEmB,GAAac,GAAGrB,KAAK4E,SAAUmD,IAAiB3I,GAASY,KAAKoJ,MAAMhK,KACpEmB,GAAac,GAAGrB,KAAK4E,SAAUoD,IAAgB5I,GAASY,KAAKkJ,KAAK9J,KAEtE,CACA,uBAAA2J,CAAwB3J,GACtB,OAAOY,KAAK2I,wBA3FS,QA2FiBvJ,EAAMkK,aA5FrB,UA4FyDlK,EAAMkK,YACxF,CAGA,kBAAOb,GACL,MAAO,iBAAkBpjB,SAASC,iBAAmB7C,UAAU8mB,eAAiB,CAClF,EAeF,MAEMC,GAAc,eACdC,GAAiB,YACjBC,GAAmB,YACnBC,GAAoB,aAGpBC,GAAa,OACbC,GAAa,OACbC,GAAiB,OACjBC,GAAkB,QAClBC,GAAc,QAAQR,KACtBS,GAAa,OAAOT,KACpBU,GAAkB,UAAUV,KAC5BW,GAAqB,aAAaX,KAClCY,GAAqB,aAAaZ,KAClCa,GAAmB,YAAYb,KAC/Bc,GAAwB,OAAOd,KAAcC,KAC7Cc,GAAyB,QAAQf,KAAcC,KAC/Ce,GAAsB,WACtBC,GAAsB,SAMtBC,GAAkB,UAClBC,GAAgB,iBAChBC,GAAuBF,GAAkBC,GAKzCE,GAAmB,CACvB,CAACnB,IAAmBK,GACpB,CAACJ,IAAoBG,IAEjBgB,GAAY,CAChBC,SAAU,IACVC,UAAU,EACVC,MAAO,QACPC,MAAM,EACNC,OAAO,EACPC,MAAM,GAEFC,GAAgB,CACpBN,SAAU,mBAEVC,SAAU,UACVC,MAAO,mBACPC,KAAM,mBACNC,MAAO,UACPC,KAAM,WAOR,MAAME,WAAiB5G,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKuL,UAAY,KACjBvL,KAAKwL,eAAiB,KACtBxL,KAAKyL,YAAa,EAClBzL,KAAK0L,aAAe,KACpB1L,KAAK2L,aAAe,KACpB3L,KAAK4L,mBAAqB/F,GAAeC,QArCjB,uBAqC8C9F,KAAK4E,UAC3E5E,KAAK6L,qBACD7L,KAAK6E,QAAQqG,OAASV,IACxBxK,KAAK8L,OAET,CAGA,kBAAWpI,GACT,OAAOoH,EACT,CACA,sBAAWnH,GACT,OAAO0H,EACT,CACA,eAAW9O,GACT,MAnFW,UAoFb,CAGA,IAAA1X,GACEmb,KAAK+L,OAAOnC,GACd,CACA,eAAAoC,IAIO3mB,SAAS4mB,QAAUtR,GAAUqF,KAAK4E,WACrC5E,KAAKnb,MAET,CACA,IAAAshB,GACEnG,KAAK+L,OAAOlC,GACd,CACA,KAAAoB,GACMjL,KAAKyL,YACPrR,GAAqB4F,KAAK4E,UAE5B5E,KAAKkM,gBACP,CACA,KAAAJ,GACE9L,KAAKkM,iBACLlM,KAAKmM,kBACLnM,KAAKuL,UAAYa,aAAY,IAAMpM,KAAKgM,mBAAmBhM,KAAK6E,QAAQkG,SAC1E,CACA,iBAAAsB,GACOrM,KAAK6E,QAAQqG,OAGdlL,KAAKyL,WACPlL,GAAae,IAAItB,KAAK4E,SAAUqF,IAAY,IAAMjK,KAAK8L,UAGzD9L,KAAK8L,QACP,CACA,EAAAQ,CAAG7T,GACD,MAAM8T,EAAQvM,KAAKwM,YACnB,GAAI/T,EAAQ8T,EAAM7b,OAAS,GAAK+H,EAAQ,EACtC,OAEF,GAAIuH,KAAKyL,WAEP,YADAlL,GAAae,IAAItB,KAAK4E,SAAUqF,IAAY,IAAMjK,KAAKsM,GAAG7T,KAG5D,MAAMgU,EAAczM,KAAK0M,cAAc1M,KAAK2M,cAC5C,GAAIF,IAAgBhU,EAClB,OAEF,MAAMtC,EAAQsC,EAAQgU,EAAc7C,GAAaC,GACjD7J,KAAK+L,OAAO5V,EAAOoW,EAAM9T,GAC3B,CACA,OAAAsM,GACM/E,KAAK2L,cACP3L,KAAK2L,aAAa5G,UAEpBJ,MAAMI,SACR,CAGA,iBAAAf,CAAkBF,GAEhB,OADAA,EAAO8I,gBAAkB9I,EAAOiH,SACzBjH,CACT,CACA,kBAAA+H,GACM7L,KAAK6E,QAAQmG,UACfzK,GAAac,GAAGrB,KAAK4E,SAAUsF,IAAiB9K,GAASY,KAAK6M,SAASzN,KAE9C,UAAvBY,KAAK6E,QAAQoG,QACf1K,GAAac,GAAGrB,KAAK4E,SAAUuF,IAAoB,IAAMnK,KAAKiL,UAC9D1K,GAAac,GAAGrB,KAAK4E,SAAUwF,IAAoB,IAAMpK,KAAKqM,uBAE5DrM,KAAK6E,QAAQsG,OAAS3C,GAAMC,eAC9BzI,KAAK8M,yBAET,CACA,uBAAAA,GACE,IAAK,MAAMC,KAAOlH,GAAe1T,KArIX,qBAqImC6N,KAAK4E,UAC5DrE,GAAac,GAAG0L,EAAK1C,IAAkBjL,GAASA,EAAMkD,mBAExD,MAmBM0K,EAAc,CAClB3E,aAAc,IAAMrI,KAAK+L,OAAO/L,KAAKiN,kBAAkBnD,KACvDxB,cAAe,IAAMtI,KAAK+L,OAAO/L,KAAKiN,kBAAkBlD,KACxD3B,YAtBkB,KACS,UAAvBpI,KAAK6E,QAAQoG,QAYjBjL,KAAKiL,QACDjL,KAAK0L,cACPwB,aAAalN,KAAK0L,cAEpB1L,KAAK0L,aAAe7N,YAAW,IAAMmC,KAAKqM,qBAjLjB,IAiL+DrM,KAAK6E,QAAQkG,UAAS,GAOhH/K,KAAK2L,aAAe,IAAInD,GAAMxI,KAAK4E,SAAUoI,EAC/C,CACA,QAAAH,CAASzN,GACP,GAAI,kBAAkB/b,KAAK+b,EAAM7S,OAAO0a,SACtC,OAEF,MAAM3Z,EAAYud,GAAiBzL,EAAMtiB,KACrCwQ,IACF8R,EAAMkD,iBACNtC,KAAK+L,OAAO/L,KAAKiN,kBAAkB3f,IAEvC,CACA,aAAAof,CAAcntB,GACZ,OAAOygB,KAAKwM,YAAYrnB,QAAQ5F,EAClC,CACA,0BAAA4tB,CAA2B1U,GACzB,IAAKuH,KAAK4L,mBACR,OAEF,MAAMwB,EAAkBvH,GAAeC,QAAQ4E,GAAiB1K,KAAK4L,oBACrEwB,EAAgB/R,UAAU1B,OAAO8Q,IACjC2C,EAAgBjsB,gBAAgB,gBAChC,MAAMksB,EAAqBxH,GAAeC,QAAQ,sBAAsBrN,MAAWuH,KAAK4L,oBACpFyB,IACFA,EAAmBhS,UAAU5E,IAAIgU,IACjC4C,EAAmBjsB,aAAa,eAAgB,QAEpD,CACA,eAAA+qB,GACE,MAAM5sB,EAAUygB,KAAKwL,gBAAkBxL,KAAK2M,aAC5C,IAAKptB,EACH,OAEF,MAAM+tB,EAAkB/P,OAAOgQ,SAAShuB,EAAQic,aAAa,oBAAqB,IAClFwE,KAAK6E,QAAQkG,SAAWuC,GAAmBtN,KAAK6E,QAAQ+H,eAC1D,CACA,MAAAb,CAAO5V,EAAO5W,EAAU,MACtB,GAAIygB,KAAKyL,WACP,OAEF,MAAM1N,EAAgBiC,KAAK2M,aACrBa,EAASrX,IAAUyT,GACnB6D,EAAcluB,GAAWue,GAAqBkC,KAAKwM,YAAazO,EAAeyP,EAAQxN,KAAK6E,QAAQuG,MAC1G,GAAIqC,IAAgB1P,EAClB,OAEF,MAAM2P,EAAmB1N,KAAK0M,cAAce,GACtCE,EAAenI,GACZjF,GAAaqB,QAAQ5B,KAAK4E,SAAUY,EAAW,CACpD1F,cAAe2N,EACfngB,UAAW0S,KAAK4N,kBAAkBzX,GAClCuD,KAAMsG,KAAK0M,cAAc3O,GACzBuO,GAAIoB,IAIR,GADmBC,EAAa3D,IACjBhI,iBACb,OAEF,IAAKjE,IAAkB0P,EAGrB,OAEF,MAAMI,EAAY/M,QAAQd,KAAKuL,WAC/BvL,KAAKiL,QACLjL,KAAKyL,YAAa,EAClBzL,KAAKmN,2BAA2BO,GAChC1N,KAAKwL,eAAiBiC,EACtB,MAAMK,EAAuBN,EA3OR,sBADF,oBA6ObO,EAAiBP,EA3OH,qBACA,qBA2OpBC,EAAYpS,UAAU5E,IAAIsX,GAC1BlS,GAAO4R,GACP1P,EAAc1C,UAAU5E,IAAIqX,GAC5BL,EAAYpS,UAAU5E,IAAIqX,GAQ1B9N,KAAKmF,gBAPoB,KACvBsI,EAAYpS,UAAU1B,OAAOmU,EAAsBC,GACnDN,EAAYpS,UAAU5E,IAAIgU,IAC1B1M,EAAc1C,UAAU1B,OAAO8Q,GAAqBsD,EAAgBD,GACpE9N,KAAKyL,YAAa,EAClBkC,EAAa1D,GAAW,GAEYlM,EAAeiC,KAAKgO,eACtDH,GACF7N,KAAK8L,OAET,CACA,WAAAkC,GACE,OAAOhO,KAAK4E,SAASvJ,UAAU7W,SAhQV,QAiQvB,CACA,UAAAmoB,GACE,OAAO9G,GAAeC,QAAQ8E,GAAsB5K,KAAK4E,SAC3D,CACA,SAAA4H,GACE,OAAO3G,GAAe1T,KAAKwY,GAAe3K,KAAK4E,SACjD,CACA,cAAAsH,GACMlM,KAAKuL,YACP0C,cAAcjO,KAAKuL,WACnBvL,KAAKuL,UAAY,KAErB,CACA,iBAAA0B,CAAkB3f,GAChB,OAAI2O,KACK3O,IAAcwc,GAAiBD,GAAaD,GAE9Ctc,IAAcwc,GAAiBF,GAAaC,EACrD,CACA,iBAAA+D,CAAkBzX,GAChB,OAAI8F,KACK9F,IAAU0T,GAAaC,GAAiBC,GAE1C5T,IAAU0T,GAAaE,GAAkBD,EAClD,CAGA,sBAAOrN,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOihB,GAAShG,oBAAoBtF,KAAM8D,GAChD,GAAsB,iBAAXA,GAIX,GAAsB,iBAAXA,EAAqB,CAC9B,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IACP,OAREzZ,EAAKiiB,GAAGxI,EASZ,GACF,EAOFvD,GAAac,GAAGhc,SAAUklB,GAvSE,uCAuS2C,SAAUnL,GAC/E,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MACrD,IAAKzT,IAAWA,EAAO8O,UAAU7W,SAASgmB,IACxC,OAEFpL,EAAMkD,iBACN,MAAM4L,EAAW5C,GAAShG,oBAAoB/Y,GACxC4hB,EAAanO,KAAKxE,aAAa,oBACrC,OAAI2S,GACFD,EAAS5B,GAAG6B,QACZD,EAAS7B,qBAGyC,SAAhDrJ,GAAYQ,iBAAiBxD,KAAM,UACrCkO,EAASrpB,YACTqpB,EAAS7B,sBAGX6B,EAAS/H,YACT+H,EAAS7B,oBACX,IACA9L,GAAac,GAAGzhB,OAAQ0qB,IAAuB,KAC7C,MAAM8D,EAAYvI,GAAe1T,KA5TR,6BA6TzB,IAAK,MAAM+b,KAAYE,EACrB9C,GAAShG,oBAAoB4I,EAC/B,IAOF/R,GAAmBmP,IAcnB,MAEM+C,GAAc,eAEdC,GAAe,OAAOD,KACtBE,GAAgB,QAAQF,KACxBG,GAAe,OAAOH,KACtBI,GAAiB,SAASJ,KAC1BK,GAAyB,QAAQL,cACjCM,GAAoB,OACpBC,GAAsB,WACtBC,GAAwB,aAExBC,GAA6B,WAAWF,OAAwBA,KAKhEG,GAAyB,8BACzBC,GAAY,CAChBvqB,OAAQ,KACRkjB,QAAQ,GAEJsH,GAAgB,CACpBxqB,OAAQ,iBACRkjB,OAAQ,WAOV,MAAMuH,WAAiBxK,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKmP,kBAAmB,EACxBnP,KAAKoP,cAAgB,GACrB,MAAMC,EAAaxJ,GAAe1T,KAAK4c,IACvC,IAAK,MAAMO,KAAQD,EAAY,CAC7B,MAAMtV,EAAW8L,GAAea,uBAAuB4I,GACjDC,EAAgB1J,GAAe1T,KAAK4H,GAAU5T,QAAOqpB,GAAgBA,IAAiBxP,KAAK4E,WAChF,OAAb7K,GAAqBwV,EAAc7e,QACrCsP,KAAKoP,cAAcxd,KAAK0d,EAE5B,CACAtP,KAAKyP,sBACAzP,KAAK6E,QAAQpgB,QAChBub,KAAK0P,0BAA0B1P,KAAKoP,cAAepP,KAAK2P,YAEtD3P,KAAK6E,QAAQ8C,QACf3H,KAAK2H,QAET,CAGA,kBAAWjE,GACT,OAAOsL,EACT,CACA,sBAAWrL,GACT,OAAOsL,EACT,CACA,eAAW1S,GACT,MA9DW,UA+Db,CAGA,MAAAoL,GACM3H,KAAK2P,WACP3P,KAAK4P,OAEL5P,KAAK6P,MAET,CACA,IAAAA,GACE,GAAI7P,KAAKmP,kBAAoBnP,KAAK2P,WAChC,OAEF,IAAIG,EAAiB,GAQrB,GALI9P,KAAK6E,QAAQpgB,SACfqrB,EAAiB9P,KAAK+P,uBAhEH,wCAgE4C5pB,QAAO5G,GAAWA,IAAYygB,KAAK4E,WAAU9hB,KAAIvD,GAAW2vB,GAAS5J,oBAAoB/lB,EAAS,CAC/JooB,QAAQ,OAGRmI,EAAepf,QAAUof,EAAe,GAAGX,iBAC7C,OAGF,GADmB5O,GAAaqB,QAAQ5B,KAAK4E,SAAU0J,IACxCtM,iBACb,OAEF,IAAK,MAAMgO,KAAkBF,EAC3BE,EAAeJ,OAEjB,MAAMK,EAAYjQ,KAAKkQ,gBACvBlQ,KAAK4E,SAASvJ,UAAU1B,OAAOiV,IAC/B5O,KAAK4E,SAASvJ,UAAU5E,IAAIoY,IAC5B7O,KAAK4E,SAAS7jB,MAAMkvB,GAAa,EACjCjQ,KAAK0P,0BAA0B1P,KAAKoP,eAAe,GACnDpP,KAAKmP,kBAAmB,EACxB,MAQMgB,EAAa,SADUF,EAAU,GAAGxL,cAAgBwL,EAAU7d,MAAM,KAE1E4N,KAAKmF,gBATY,KACfnF,KAAKmP,kBAAmB,EACxBnP,KAAK4E,SAASvJ,UAAU1B,OAAOkV,IAC/B7O,KAAK4E,SAASvJ,UAAU5E,IAAImY,GAAqBD,IACjD3O,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GACjC1P,GAAaqB,QAAQ5B,KAAK4E,SAAU2J,GAAc,GAItBvO,KAAK4E,UAAU,GAC7C5E,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GAAGjQ,KAAK4E,SAASuL,MACpD,CACA,IAAAP,GACE,GAAI5P,KAAKmP,mBAAqBnP,KAAK2P,WACjC,OAGF,GADmBpP,GAAaqB,QAAQ5B,KAAK4E,SAAU4J,IACxCxM,iBACb,OAEF,MAAMiO,EAAYjQ,KAAKkQ,gBACvBlQ,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GAAGjQ,KAAK4E,SAASthB,wBAAwB2sB,OAC1EpU,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIoY,IAC5B7O,KAAK4E,SAASvJ,UAAU1B,OAAOiV,GAAqBD,IACpD,IAAK,MAAM/M,KAAW5B,KAAKoP,cAAe,CACxC,MAAM7vB,EAAUsmB,GAAec,uBAAuB/E,GAClDriB,IAAYygB,KAAK2P,SAASpwB,IAC5BygB,KAAK0P,0BAA0B,CAAC9N,IAAU,EAE9C,CACA5B,KAAKmP,kBAAmB,EAOxBnP,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GACjCjQ,KAAKmF,gBAPY,KACfnF,KAAKmP,kBAAmB,EACxBnP,KAAK4E,SAASvJ,UAAU1B,OAAOkV,IAC/B7O,KAAK4E,SAASvJ,UAAU5E,IAAImY,IAC5BrO,GAAaqB,QAAQ5B,KAAK4E,SAAU6J,GAAe,GAGvBzO,KAAK4E,UAAU,EAC/C,CACA,QAAA+K,CAASpwB,EAAUygB,KAAK4E,UACtB,OAAOrlB,EAAQ8b,UAAU7W,SAASmqB,GACpC,CAGA,iBAAA3K,CAAkBF,GAGhB,OAFAA,EAAO6D,OAAS7G,QAAQgD,EAAO6D,QAC/B7D,EAAOrf,OAASiW,GAAWoJ,EAAOrf,QAC3Bqf,CACT,CACA,aAAAoM,GACE,OAAOlQ,KAAK4E,SAASvJ,UAAU7W,SA3IL,uBAChB,QACC,QA0Ib,CACA,mBAAAirB,GACE,IAAKzP,KAAK6E,QAAQpgB,OAChB,OAEF,MAAMshB,EAAW/F,KAAK+P,uBAAuBhB,IAC7C,IAAK,MAAMxvB,KAAWwmB,EAAU,CAC9B,MAAMqK,EAAWvK,GAAec,uBAAuBpnB,GACnD6wB,GACFpQ,KAAK0P,0BAA0B,CAACnwB,GAAUygB,KAAK2P,SAASS,GAE5D,CACF,CACA,sBAAAL,CAAuBhW,GACrB,MAAMgM,EAAWF,GAAe1T,KAAK2c,GAA4B9O,KAAK6E,QAAQpgB,QAE9E,OAAOohB,GAAe1T,KAAK4H,EAAUiG,KAAK6E,QAAQpgB,QAAQ0B,QAAO5G,IAAYwmB,EAAS3E,SAAS7hB,IACjG,CACA,yBAAAmwB,CAA0BW,EAAcC,GACtC,GAAKD,EAAa3f,OAGlB,IAAK,MAAMnR,KAAW8wB,EACpB9wB,EAAQ8b,UAAUsM,OArKK,aAqKyB2I,GAChD/wB,EAAQ6B,aAAa,gBAAiBkvB,EAE1C,CAGA,sBAAO7T,CAAgBqH,GACrB,MAAMe,EAAU,CAAC,EAIjB,MAHsB,iBAAXf,GAAuB,YAAYzgB,KAAKygB,KACjDe,EAAQ8C,QAAS,GAEZ3H,KAAKwH,MAAK,WACf,MAAMnd,EAAO6kB,GAAS5J,oBAAoBtF,KAAM6E,GAChD,GAAsB,iBAAXf,EAAqB,CAC9B,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IACP,CACF,GACF,EAOFvD,GAAac,GAAGhc,SAAUqpB,GAAwBK,IAAwB,SAAU3P,IAErD,MAAzBA,EAAM7S,OAAO0a,SAAmB7H,EAAMW,gBAAmD,MAAjCX,EAAMW,eAAekH,UAC/E7H,EAAMkD,iBAER,IAAK,MAAM/iB,KAAWsmB,GAAee,gCAAgC5G,MACnEkP,GAAS5J,oBAAoB/lB,EAAS,CACpCooB,QAAQ,IACPA,QAEP,IAMAxL,GAAmB+S,IAcnB,MAAMqB,GAAS,WAETC,GAAc,eACdC,GAAiB,YAGjBC,GAAiB,UACjBC,GAAmB,YAGnBC,GAAe,OAAOJ,KACtBK,GAAiB,SAASL,KAC1BM,GAAe,OAAON,KACtBO,GAAgB,QAAQP,KACxBQ,GAAyB,QAAQR,KAAcC,KAC/CQ,GAAyB,UAAUT,KAAcC,KACjDS,GAAuB,QAAQV,KAAcC,KAC7CU,GAAoB,OAMpBC,GAAyB,4DACzBC,GAA6B,GAAGD,MAA0BD,KAC1DG,GAAgB,iBAIhBC,GAAgBtV,KAAU,UAAY,YACtCuV,GAAmBvV,KAAU,YAAc,UAC3CwV,GAAmBxV,KAAU,aAAe,eAC5CyV,GAAsBzV,KAAU,eAAiB,aACjD0V,GAAkB1V,KAAU,aAAe,cAC3C2V,GAAiB3V,KAAU,cAAgB,aAG3C4V,GAAY,CAChBC,WAAW,EACX7jB,SAAU,kBACV8jB,QAAS,UACT/pB,OAAQ,CAAC,EAAG,GACZgqB,aAAc,KACd1zB,UAAW,UAEP2zB,GAAgB,CACpBH,UAAW,mBACX7jB,SAAU,mBACV8jB,QAAS,SACT/pB,OAAQ,0BACRgqB,aAAc,yBACd1zB,UAAW,2BAOb,MAAM4zB,WAAiBxN,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKmS,QAAU,KACfnS,KAAKoS,QAAUpS,KAAK4E,SAAS7f,WAE7Bib,KAAKqS,MAAQxM,GAAehhB,KAAKmb,KAAK4E,SAAU0M,IAAe,IAAMzL,GAAeM,KAAKnG,KAAK4E,SAAU0M,IAAe,IAAMzL,GAAeC,QAAQwL,GAAetR,KAAKoS,SACxKpS,KAAKsS,UAAYtS,KAAKuS,eACxB,CAGA,kBAAW7O,GACT,OAAOmO,EACT,CACA,sBAAWlO,GACT,OAAOsO,EACT,CACA,eAAW1V,GACT,OAAOgU,EACT,CAGA,MAAA5I,GACE,OAAO3H,KAAK2P,WAAa3P,KAAK4P,OAAS5P,KAAK6P,MAC9C,CACA,IAAAA,GACE,GAAI3U,GAAW8E,KAAK4E,WAAa5E,KAAK2P,WACpC,OAEF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAK4E,UAGtB,IADkBrE,GAAaqB,QAAQ5B,KAAK4E,SAAUkM,GAAchR,GACtDkC,iBAAd,CASA,GANAhC,KAAKwS,gBAMD,iBAAkBntB,SAASC,kBAAoB0a,KAAKoS,QAAQpX,QAzExC,eA0EtB,IAAK,MAAMzb,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAac,GAAG9hB,EAAS,YAAaqc,IAG1CoE,KAAK4E,SAAS6N,QACdzS,KAAK4E,SAASxjB,aAAa,iBAAiB,GAC5C4e,KAAKqS,MAAMhX,UAAU5E,IAAI0a,IACzBnR,KAAK4E,SAASvJ,UAAU5E,IAAI0a,IAC5B5Q,GAAaqB,QAAQ5B,KAAK4E,SAAUmM,GAAejR,EAhBnD,CAiBF,CACA,IAAA8P,GACE,GAAI1U,GAAW8E,KAAK4E,YAAc5E,KAAK2P,WACrC,OAEF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAK4E,UAEtB5E,KAAK0S,cAAc5S,EACrB,CACA,OAAAiF,GACM/E,KAAKmS,SACPnS,KAAKmS,QAAQnZ,UAEf2L,MAAMI,SACR,CACA,MAAAha,GACEiV,KAAKsS,UAAYtS,KAAKuS,gBAClBvS,KAAKmS,SACPnS,KAAKmS,QAAQpnB,QAEjB,CAGA,aAAA2nB,CAAc5S,GAEZ,IADkBS,GAAaqB,QAAQ5B,KAAK4E,SAAUgM,GAAc9Q,GACtDkC,iBAAd,CAMA,GAAI,iBAAkB3c,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAaC,IAAIjhB,EAAS,YAAaqc,IAGvCoE,KAAKmS,SACPnS,KAAKmS,QAAQnZ,UAEfgH,KAAKqS,MAAMhX,UAAU1B,OAAOwX,IAC5BnR,KAAK4E,SAASvJ,UAAU1B,OAAOwX,IAC/BnR,KAAK4E,SAASxjB,aAAa,gBAAiB,SAC5C4hB,GAAYE,oBAAoBlD,KAAKqS,MAAO,UAC5C9R,GAAaqB,QAAQ5B,KAAK4E,SAAUiM,GAAgB/Q,EAhBpD,CAiBF,CACA,UAAA+D,CAAWC,GAET,GAAgC,iBADhCA,EAASa,MAAMd,WAAWC,IACRxlB,YAA2B,GAAUwlB,EAAOxlB,YAAgE,mBAA3CwlB,EAAOxlB,UAAUgF,sBAElG,MAAM,IAAIkhB,UAAU,GAAG+L,GAAO9L,+GAEhC,OAAOX,CACT,CACA,aAAA0O,GACE,QAAsB,IAAX,EACT,MAAM,IAAIhO,UAAU,gEAEtB,IAAImO,EAAmB3S,KAAK4E,SACG,WAA3B5E,KAAK6E,QAAQvmB,UACfq0B,EAAmB3S,KAAKoS,QACf,GAAUpS,KAAK6E,QAAQvmB,WAChCq0B,EAAmBjY,GAAWsF,KAAK6E,QAAQvmB,WACA,iBAA3B0hB,KAAK6E,QAAQvmB,YAC7Bq0B,EAAmB3S,KAAK6E,QAAQvmB,WAElC,MAAM0zB,EAAehS,KAAK4S,mBAC1B5S,KAAKmS,QAAU,GAAoBQ,EAAkB3S,KAAKqS,MAAOL,EACnE,CACA,QAAArC,GACE,OAAO3P,KAAKqS,MAAMhX,UAAU7W,SAAS2sB,GACvC,CACA,aAAA0B,GACE,MAAMC,EAAiB9S,KAAKoS,QAC5B,GAAIU,EAAezX,UAAU7W,SArKN,WAsKrB,OAAOmtB,GAET,GAAImB,EAAezX,UAAU7W,SAvKJ,aAwKvB,OAAOotB,GAET,GAAIkB,EAAezX,UAAU7W,SAzKA,iBA0K3B,MA5JsB,MA8JxB,GAAIsuB,EAAezX,UAAU7W,SA3KE,mBA4K7B,MA9JyB,SAkK3B,MAAMuuB,EAAkF,QAA1E9tB,iBAAiB+a,KAAKqS,OAAOvX,iBAAiB,iBAAiB6K,OAC7E,OAAImN,EAAezX,UAAU7W,SArLP,UAsLbuuB,EAAQvB,GAAmBD,GAE7BwB,EAAQrB,GAAsBD,EACvC,CACA,aAAAc,GACE,OAAkD,OAA3CvS,KAAK4E,SAAS5J,QAnLD,UAoLtB,CACA,UAAAgY,GACE,MAAM,OACJhrB,GACEgY,KAAK6E,QACT,MAAsB,iBAAX7c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAAS4f,OAAOgQ,SAAS5vB,EAAO,MAEzC,mBAAXqK,EACFirB,GAAcjrB,EAAOirB,EAAYjT,KAAK4E,UAExC5c,CACT,CACA,gBAAA4qB,GACE,MAAMM,EAAwB,CAC5Bx0B,UAAWshB,KAAK6S,gBAChBzc,UAAW,CAAC,CACV9V,KAAM,kBACNmB,QAAS,CACPwM,SAAU+R,KAAK6E,QAAQ5W,WAExB,CACD3N,KAAM,SACNmB,QAAS,CACPuG,OAAQgY,KAAKgT,iBAanB,OAPIhT,KAAKsS,WAAsC,WAAzBtS,KAAK6E,QAAQkN,WACjC/O,GAAYC,iBAAiBjD,KAAKqS,MAAO,SAAU,UACnDa,EAAsB9c,UAAY,CAAC,CACjC9V,KAAM,cACNC,SAAS,KAGN,IACF2yB,KACArW,GAAQmD,KAAK6E,QAAQmN,aAAc,CAACkB,IAE3C,CACA,eAAAC,EAAgB,IACdr2B,EAAG,OACHyP,IAEA,MAAMggB,EAAQ1G,GAAe1T,KAhOF,8DAgO+B6N,KAAKqS,OAAOlsB,QAAO5G,GAAWob,GAAUpb,KAC7FgtB,EAAM7b,QAMXoN,GAAqByO,EAAOhgB,EAAQzP,IAAQ6zB,IAAmBpE,EAAMnL,SAAS7U,IAASkmB,OACzF,CAGA,sBAAOhW,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO6nB,GAAS5M,oBAAoBtF,KAAM8D,GAChD,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,CACA,iBAAOsP,CAAWhU,GAChB,GA5QuB,IA4QnBA,EAAMwI,QAAgD,UAAfxI,EAAMqB,MA/QnC,QA+QuDrB,EAAMtiB,IACzE,OAEF,MAAMu2B,EAAcxN,GAAe1T,KAAKkf,IACxC,IAAK,MAAM1J,KAAU0L,EAAa,CAChC,MAAMC,EAAUpB,GAAS7M,YAAYsC,GACrC,IAAK2L,IAAyC,IAA9BA,EAAQzO,QAAQiN,UAC9B,SAEF,MAAMyB,EAAenU,EAAMmU,eACrBC,EAAeD,EAAanS,SAASkS,EAAQjB,OACnD,GAAIkB,EAAanS,SAASkS,EAAQ1O,WAA2C,WAA9B0O,EAAQzO,QAAQiN,YAA2B0B,GAA8C,YAA9BF,EAAQzO,QAAQiN,WAA2B0B,EACnJ,SAIF,GAAIF,EAAQjB,MAAM7tB,SAAS4a,EAAM7S,UAA2B,UAAf6S,EAAMqB,MA/RvC,QA+R2DrB,EAAMtiB,KAAqB,qCAAqCuG,KAAK+b,EAAM7S,OAAO0a,UACvJ,SAEF,MAAMnH,EAAgB,CACpBA,cAAewT,EAAQ1O,UAEN,UAAfxF,EAAMqB,OACRX,EAAckH,WAAa5H,GAE7BkU,EAAQZ,cAAc5S,EACxB,CACF,CACA,4BAAO2T,CAAsBrU,GAI3B,MAAMsU,EAAU,kBAAkBrwB,KAAK+b,EAAM7S,OAAO0a,SAC9C0M,EAjTW,WAiTKvU,EAAMtiB,IACtB82B,EAAkB,CAAClD,GAAgBC,IAAkBvP,SAAShC,EAAMtiB,KAC1E,IAAK82B,IAAoBD,EACvB,OAEF,GAAID,IAAYC,EACd,OAEFvU,EAAMkD,iBAGN,MAAMuR,EAAkB7T,KAAKgG,QAAQoL,IAA0BpR,KAAO6F,GAAeM,KAAKnG,KAAMoR,IAAwB,IAAMvL,GAAehhB,KAAKmb,KAAMoR,IAAwB,IAAMvL,GAAeC,QAAQsL,GAAwBhS,EAAMW,eAAehb,YACpPwF,EAAW2nB,GAAS5M,oBAAoBuO,GAC9C,GAAID,EAIF,OAHAxU,EAAM0U,kBACNvpB,EAASslB,YACTtlB,EAAS4oB,gBAAgB/T,GAGvB7U,EAASolB,aAEXvQ,EAAM0U,kBACNvpB,EAASqlB,OACTiE,EAAgBpB,QAEpB,EAOFlS,GAAac,GAAGhc,SAAU4rB,GAAwBG,GAAwBc,GAASuB,uBACnFlT,GAAac,GAAGhc,SAAU4rB,GAAwBK,GAAeY,GAASuB,uBAC1ElT,GAAac,GAAGhc,SAAU2rB,GAAwBkB,GAASkB,YAC3D7S,GAAac,GAAGhc,SAAU6rB,GAAsBgB,GAASkB,YACzD7S,GAAac,GAAGhc,SAAU2rB,GAAwBI,IAAwB,SAAUhS,GAClFA,EAAMkD,iBACN4P,GAAS5M,oBAAoBtF,MAAM2H,QACrC,IAMAxL,GAAmB+V,IAcnB,MAAM6B,GAAS,WAETC,GAAoB,OACpBC,GAAkB,gBAAgBF,KAClCG,GAAY,CAChBC,UAAW,iBACXC,cAAe,KACfhP,YAAY,EACZzK,WAAW,EAEX0Z,YAAa,QAETC,GAAgB,CACpBH,UAAW,SACXC,cAAe,kBACfhP,WAAY,UACZzK,UAAW,UACX0Z,YAAa,oBAOf,MAAME,WAAiB9Q,GACrB,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAKwU,aAAc,EACnBxU,KAAK4E,SAAW,IAClB,CAGA,kBAAWlB,GACT,OAAOwQ,EACT,CACA,sBAAWvQ,GACT,OAAO2Q,EACT,CACA,eAAW/X,GACT,OAAOwX,EACT,CAGA,IAAAlE,CAAKxT,GACH,IAAK2D,KAAK6E,QAAQlK,UAEhB,YADAkC,GAAQR,GAGV2D,KAAKyU,UACL,MAAMl1B,EAAUygB,KAAK0U,cACjB1U,KAAK6E,QAAQO,YACfvJ,GAAOtc,GAETA,EAAQ8b,UAAU5E,IAAIud,IACtBhU,KAAK2U,mBAAkB,KACrB9X,GAAQR,EAAS,GAErB,CACA,IAAAuT,CAAKvT,GACE2D,KAAK6E,QAAQlK,WAIlBqF,KAAK0U,cAAcrZ,UAAU1B,OAAOqa,IACpChU,KAAK2U,mBAAkB,KACrB3U,KAAK+E,UACLlI,GAAQR,EAAS,KANjBQ,GAAQR,EAQZ,CACA,OAAA0I,GACO/E,KAAKwU,cAGVjU,GAAaC,IAAIR,KAAK4E,SAAUqP,IAChCjU,KAAK4E,SAASjL,SACdqG,KAAKwU,aAAc,EACrB,CAGA,WAAAE,GACE,IAAK1U,KAAK4E,SAAU,CAClB,MAAMgQ,EAAWvvB,SAASwvB,cAAc,OACxCD,EAAST,UAAYnU,KAAK6E,QAAQsP,UAC9BnU,KAAK6E,QAAQO,YACfwP,EAASvZ,UAAU5E,IApFD,QAsFpBuJ,KAAK4E,SAAWgQ,CAClB,CACA,OAAO5U,KAAK4E,QACd,CACA,iBAAAZ,CAAkBF,GAGhB,OADAA,EAAOuQ,YAAc3Z,GAAWoJ,EAAOuQ,aAChCvQ,CACT,CACA,OAAA2Q,GACE,GAAIzU,KAAKwU,YACP,OAEF,MAAMj1B,EAAUygB,KAAK0U,cACrB1U,KAAK6E,QAAQwP,YAAYS,OAAOv1B,GAChCghB,GAAac,GAAG9hB,EAAS00B,IAAiB,KACxCpX,GAAQmD,KAAK6E,QAAQuP,cAAc,IAErCpU,KAAKwU,aAAc,CACrB,CACA,iBAAAG,CAAkBtY,GAChBW,GAAuBX,EAAU2D,KAAK0U,cAAe1U,KAAK6E,QAAQO,WACpE,EAeF,MAEM2P,GAAc,gBACdC,GAAkB,UAAUD,KAC5BE,GAAoB,cAAcF,KAGlCG,GAAmB,WACnBC,GAAY,CAChBC,WAAW,EACXC,YAAa,MAETC,GAAgB,CACpBF,UAAW,UACXC,YAAa,WAOf,MAAME,WAAkB9R,GACtB,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAKwV,WAAY,EACjBxV,KAAKyV,qBAAuB,IAC9B,CAGA,kBAAW/R,GACT,OAAOyR,EACT,CACA,sBAAWxR,GACT,OAAO2R,EACT,CACA,eAAW/Y,GACT,MArCW,WAsCb,CAGA,QAAAmZ,GACM1V,KAAKwV,YAGLxV,KAAK6E,QAAQuQ,WACfpV,KAAK6E,QAAQwQ,YAAY5C,QAE3BlS,GAAaC,IAAInb,SAAU0vB,IAC3BxU,GAAac,GAAGhc,SAAU2vB,IAAiB5V,GAASY,KAAK2V,eAAevW,KACxEmB,GAAac,GAAGhc,SAAU4vB,IAAmB7V,GAASY,KAAK4V,eAAexW,KAC1EY,KAAKwV,WAAY,EACnB,CACA,UAAAK,GACO7V,KAAKwV,YAGVxV,KAAKwV,WAAY,EACjBjV,GAAaC,IAAInb,SAAU0vB,IAC7B,CAGA,cAAAY,CAAevW,GACb,MAAM,YACJiW,GACErV,KAAK6E,QACT,GAAIzF,EAAM7S,SAAWlH,UAAY+Z,EAAM7S,SAAW8oB,GAAeA,EAAY7wB,SAAS4a,EAAM7S,QAC1F,OAEF,MAAM1L,EAAWglB,GAAeU,kBAAkB8O,GAC1B,IAApBx0B,EAAS6P,OACX2kB,EAAY5C,QACHzS,KAAKyV,uBAAyBP,GACvCr0B,EAASA,EAAS6P,OAAS,GAAG+hB,QAE9B5xB,EAAS,GAAG4xB,OAEhB,CACA,cAAAmD,CAAexW,GAzED,QA0ERA,EAAMtiB,MAGVkjB,KAAKyV,qBAAuBrW,EAAM0W,SAAWZ,GA5EzB,UA6EtB,EAeF,MAAMa,GAAyB,oDACzBC,GAA0B,cAC1BC,GAAmB,gBACnBC,GAAkB,eAMxB,MAAMC,GACJ,WAAAhS,GACEnE,KAAK4E,SAAWvf,SAAS6G,IAC3B,CAGA,QAAAkqB,GAEE,MAAMC,EAAgBhxB,SAASC,gBAAgBuC,YAC/C,OAAO1F,KAAKoC,IAAI3E,OAAO02B,WAAaD,EACtC,CACA,IAAAzG,GACE,MAAM/rB,EAAQmc,KAAKoW,WACnBpW,KAAKuW,mBAELvW,KAAKwW,sBAAsBxW,KAAK4E,SAAUqR,IAAkBQ,GAAmBA,EAAkB5yB,IAEjGmc,KAAKwW,sBAAsBT,GAAwBE,IAAkBQ,GAAmBA,EAAkB5yB,IAC1Gmc,KAAKwW,sBAAsBR,GAAyBE,IAAiBO,GAAmBA,EAAkB5yB,GAC5G,CACA,KAAAwO,GACE2N,KAAK0W,wBAAwB1W,KAAK4E,SAAU,YAC5C5E,KAAK0W,wBAAwB1W,KAAK4E,SAAUqR,IAC5CjW,KAAK0W,wBAAwBX,GAAwBE,IACrDjW,KAAK0W,wBAAwBV,GAAyBE,GACxD,CACA,aAAAS,GACE,OAAO3W,KAAKoW,WAAa,CAC3B,CAGA,gBAAAG,GACEvW,KAAK4W,sBAAsB5W,KAAK4E,SAAU,YAC1C5E,KAAK4E,SAAS7jB,MAAM+K,SAAW,QACjC,CACA,qBAAA0qB,CAAsBzc,EAAU8c,EAAexa,GAC7C,MAAMya,EAAiB9W,KAAKoW,WAS5BpW,KAAK+W,2BAA2Bhd,GARHxa,IAC3B,GAAIA,IAAYygB,KAAK4E,UAAYhlB,OAAO02B,WAAa/2B,EAAQsI,YAAcivB,EACzE,OAEF9W,KAAK4W,sBAAsBr3B,EAASs3B,GACpC,MAAMJ,EAAkB72B,OAAOqF,iBAAiB1F,GAASub,iBAAiB+b,GAC1Et3B,EAAQwB,MAAMi2B,YAAYH,EAAe,GAAGxa,EAASkB,OAAOC,WAAWiZ,QAAsB,GAGjG,CACA,qBAAAG,CAAsBr3B,EAASs3B,GAC7B,MAAMI,EAAc13B,EAAQwB,MAAM+Z,iBAAiB+b,GAC/CI,GACFjU,GAAYC,iBAAiB1jB,EAASs3B,EAAeI,EAEzD,CACA,uBAAAP,CAAwB3c,EAAU8c,GAWhC7W,KAAK+W,2BAA2Bhd,GAVHxa,IAC3B,MAAM5B,EAAQqlB,GAAYQ,iBAAiBjkB,EAASs3B,GAEtC,OAAVl5B,GAIJqlB,GAAYE,oBAAoB3jB,EAASs3B,GACzCt3B,EAAQwB,MAAMi2B,YAAYH,EAAel5B,IAJvC4B,EAAQwB,MAAMm2B,eAAeL,EAIgB,GAGnD,CACA,0BAAAE,CAA2Bhd,EAAUod,GACnC,GAAI,GAAUpd,GACZod,EAASpd,QAGX,IAAK,MAAM6L,KAAOC,GAAe1T,KAAK4H,EAAUiG,KAAK4E,UACnDuS,EAASvR,EAEb,EAeF,MAEMwR,GAAc,YAGdC,GAAe,OAAOD,KACtBE,GAAyB,gBAAgBF,KACzCG,GAAiB,SAASH,KAC1BI,GAAe,OAAOJ,KACtBK,GAAgB,QAAQL,KACxBM,GAAiB,SAASN,KAC1BO,GAAsB,gBAAgBP,KACtCQ,GAA0B,oBAAoBR,KAC9CS,GAA0B,kBAAkBT,KAC5CU,GAAyB,QAAQV,cACjCW,GAAkB,aAElBC,GAAoB,OACpBC,GAAoB,eAKpBC,GAAY,CAChBtD,UAAU,EACVnC,OAAO,EACPzH,UAAU,GAENmN,GAAgB,CACpBvD,SAAU,mBACVnC,MAAO,UACPzH,SAAU,WAOZ,MAAMoN,WAAc1T,GAClB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKqY,QAAUxS,GAAeC,QArBV,gBAqBmC9F,KAAK4E,UAC5D5E,KAAKsY,UAAYtY,KAAKuY,sBACtBvY,KAAKwY,WAAaxY,KAAKyY,uBACvBzY,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK0Y,WAAa,IAAIvC,GACtBnW,KAAK6L,oBACP,CAGA,kBAAWnI,GACT,OAAOwU,EACT,CACA,sBAAWvU,GACT,OAAOwU,EACT,CACA,eAAW5b,GACT,MA1DW,OA2Db,CAGA,MAAAoL,CAAO7H,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CACA,IAAA+P,CAAK/P,GACCE,KAAK2P,UAAY3P,KAAKmP,kBAGR5O,GAAaqB,QAAQ5B,KAAK4E,SAAU4S,GAAc,CAClE1X,kBAEYkC,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK0Y,WAAW9I,OAChBvqB,SAAS6G,KAAKmP,UAAU5E,IAAIshB,IAC5B/X,KAAK2Y,gBACL3Y,KAAKsY,UAAUzI,MAAK,IAAM7P,KAAK4Y,aAAa9Y,KAC9C,CACA,IAAA8P,GACO5P,KAAK2P,WAAY3P,KAAKmP,mBAGT5O,GAAaqB,QAAQ5B,KAAK4E,SAAUyS,IACxCrV,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAKwY,WAAW3C,aAChB7V,KAAK4E,SAASvJ,UAAU1B,OAAOqe,IAC/BhY,KAAKmF,gBAAe,IAAMnF,KAAK6Y,cAAc7Y,KAAK4E,SAAU5E,KAAKgO,gBACnE,CACA,OAAAjJ,GACExE,GAAaC,IAAI5gB,OAAQw3B,IACzB7W,GAAaC,IAAIR,KAAKqY,QAASjB,IAC/BpX,KAAKsY,UAAUvT,UACf/E,KAAKwY,WAAW3C,aAChBlR,MAAMI,SACR,CACA,YAAA+T,GACE9Y,KAAK2Y,eACP,CAGA,mBAAAJ,GACE,OAAO,IAAIhE,GAAS,CAClB5Z,UAAWmG,QAAQd,KAAK6E,QAAQ+P,UAEhCxP,WAAYpF,KAAKgO,eAErB,CACA,oBAAAyK,GACE,OAAO,IAAIlD,GAAU,CACnBF,YAAarV,KAAK4E,UAEtB,CACA,YAAAgU,CAAa9Y,GAENza,SAAS6G,KAAK1H,SAASwb,KAAK4E,WAC/Bvf,SAAS6G,KAAK4oB,OAAO9U,KAAK4E,UAE5B5E,KAAK4E,SAAS7jB,MAAMgxB,QAAU,QAC9B/R,KAAK4E,SAASzjB,gBAAgB,eAC9B6e,KAAK4E,SAASxjB,aAAa,cAAc,GACzC4e,KAAK4E,SAASxjB,aAAa,OAAQ,UACnC4e,KAAK4E,SAASnZ,UAAY,EAC1B,MAAMstB,EAAYlT,GAAeC,QA7GT,cA6GsC9F,KAAKqY,SAC/DU,IACFA,EAAUttB,UAAY,GAExBoQ,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIuhB,IAU5BhY,KAAKmF,gBATsB,KACrBnF,KAAK6E,QAAQ4N,OACfzS,KAAKwY,WAAW9C,WAElB1V,KAAKmP,kBAAmB,EACxB5O,GAAaqB,QAAQ5B,KAAK4E,SAAU6S,GAAe,CACjD3X,iBACA,GAEoCE,KAAKqY,QAASrY,KAAKgO,cAC7D,CACA,kBAAAnC,GACEtL,GAAac,GAAGrB,KAAK4E,SAAUiT,IAAyBzY,IAhJvC,WAiJXA,EAAMtiB,MAGNkjB,KAAK6E,QAAQmG,SACfhL,KAAK4P,OAGP5P,KAAKgZ,6BAA4B,IAEnCzY,GAAac,GAAGzhB,OAAQ83B,IAAgB,KAClC1X,KAAK2P,WAAa3P,KAAKmP,kBACzBnP,KAAK2Y,eACP,IAEFpY,GAAac,GAAGrB,KAAK4E,SAAUgT,IAAyBxY,IAEtDmB,GAAae,IAAItB,KAAK4E,SAAU+S,IAAqBsB,IAC/CjZ,KAAK4E,WAAaxF,EAAM7S,QAAUyT,KAAK4E,WAAaqU,EAAO1sB,SAGjC,WAA1ByT,KAAK6E,QAAQ+P,SAIb5U,KAAK6E,QAAQ+P,UACf5U,KAAK4P,OAJL5P,KAAKgZ,6BAKP,GACA,GAEN,CACA,UAAAH,GACE7Y,KAAK4E,SAAS7jB,MAAMgxB,QAAU,OAC9B/R,KAAK4E,SAASxjB,aAAa,eAAe,GAC1C4e,KAAK4E,SAASzjB,gBAAgB,cAC9B6e,KAAK4E,SAASzjB,gBAAgB,QAC9B6e,KAAKmP,kBAAmB,EACxBnP,KAAKsY,UAAU1I,MAAK,KAClBvqB,SAAS6G,KAAKmP,UAAU1B,OAAOoe,IAC/B/X,KAAKkZ,oBACLlZ,KAAK0Y,WAAWrmB,QAChBkO,GAAaqB,QAAQ5B,KAAK4E,SAAU2S,GAAe,GAEvD,CACA,WAAAvJ,GACE,OAAOhO,KAAK4E,SAASvJ,UAAU7W,SAjLT,OAkLxB,CACA,0BAAAw0B,GAEE,GADkBzY,GAAaqB,QAAQ5B,KAAK4E,SAAU0S,IACxCtV,iBACZ,OAEF,MAAMmX,EAAqBnZ,KAAK4E,SAASvX,aAAehI,SAASC,gBAAgBsC,aAC3EwxB,EAAmBpZ,KAAK4E,SAAS7jB,MAAMiL,UAEpB,WAArBotB,GAAiCpZ,KAAK4E,SAASvJ,UAAU7W,SAASyzB,MAGjEkB,IACHnZ,KAAK4E,SAAS7jB,MAAMiL,UAAY,UAElCgU,KAAK4E,SAASvJ,UAAU5E,IAAIwhB,IAC5BjY,KAAKmF,gBAAe,KAClBnF,KAAK4E,SAASvJ,UAAU1B,OAAOse,IAC/BjY,KAAKmF,gBAAe,KAClBnF,KAAK4E,SAAS7jB,MAAMiL,UAAYotB,CAAgB,GAC/CpZ,KAAKqY,QAAQ,GACfrY,KAAKqY,SACRrY,KAAK4E,SAAS6N,QAChB,CAMA,aAAAkG,GACE,MAAMQ,EAAqBnZ,KAAK4E,SAASvX,aAAehI,SAASC,gBAAgBsC,aAC3EkvB,EAAiB9W,KAAK0Y,WAAWtC,WACjCiD,EAAoBvC,EAAiB,EAC3C,GAAIuC,IAAsBF,EAAoB,CAC5C,MAAMr3B,EAAWma,KAAU,cAAgB,eAC3C+D,KAAK4E,SAAS7jB,MAAMe,GAAY,GAAGg1B,KACrC,CACA,IAAKuC,GAAqBF,EAAoB,CAC5C,MAAMr3B,EAAWma,KAAU,eAAiB,cAC5C+D,KAAK4E,SAAS7jB,MAAMe,GAAY,GAAGg1B,KACrC,CACF,CACA,iBAAAoC,GACElZ,KAAK4E,SAAS7jB,MAAMu4B,YAAc,GAClCtZ,KAAK4E,SAAS7jB,MAAMw4B,aAAe,EACrC,CAGA,sBAAO9c,CAAgBqH,EAAQhE,GAC7B,OAAOE,KAAKwH,MAAK,WACf,MAAMnd,EAAO+tB,GAAM9S,oBAAoBtF,KAAM8D,GAC7C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQhE,EAJb,CAKF,GACF,EAOFS,GAAac,GAAGhc,SAAUyyB,GA9OK,4BA8O2C,SAAU1Y,GAClF,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MACjD,CAAC,IAAK,QAAQoB,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAER/B,GAAae,IAAI/U,EAAQirB,IAAcgC,IACjCA,EAAUxX,kBAIdzB,GAAae,IAAI/U,EAAQgrB,IAAgB,KACnC5c,GAAUqF,OACZA,KAAKyS,OACP,GACA,IAIJ,MAAMgH,EAAc5T,GAAeC,QAnQb,eAoQlB2T,GACFrB,GAAM/S,YAAYoU,GAAa7J,OAEpBwI,GAAM9S,oBAAoB/Y,GAClCob,OAAO3H,KACd,IACA6G,GAAqBuR,IAMrBjc,GAAmBic,IAcnB,MAEMsB,GAAc,gBACdC,GAAiB,YACjBC,GAAwB,OAAOF,KAAcC,KAE7CE,GAAoB,OACpBC,GAAuB,UACvBC,GAAoB,SAEpBC,GAAgB,kBAChBC,GAAe,OAAOP,KACtBQ,GAAgB,QAAQR,KACxBS,GAAe,OAAOT,KACtBU,GAAuB,gBAAgBV,KACvCW,GAAiB,SAASX,KAC1BY,GAAe,SAASZ,KACxBa,GAAyB,QAAQb,KAAcC,KAC/Ca,GAAwB,kBAAkBd,KAE1Ce,GAAY,CAChB7F,UAAU,EACV5J,UAAU,EACVvgB,QAAQ,GAEJiwB,GAAgB,CACpB9F,SAAU,mBACV5J,SAAU,UACVvgB,OAAQ,WAOV,MAAMkwB,WAAkBjW,GACtB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAK2P,UAAW,EAChB3P,KAAKsY,UAAYtY,KAAKuY,sBACtBvY,KAAKwY,WAAaxY,KAAKyY,uBACvBzY,KAAK6L,oBACP,CAGA,kBAAWnI,GACT,OAAO+W,EACT,CACA,sBAAW9W,GACT,OAAO+W,EACT,CACA,eAAWne,GACT,MApDW,WAqDb,CAGA,MAAAoL,CAAO7H,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CACA,IAAA+P,CAAK/P,GACCE,KAAK2P,UAGSpP,GAAaqB,QAAQ5B,KAAK4E,SAAUqV,GAAc,CAClEna,kBAEYkC,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKsY,UAAUzI,OACV7P,KAAK6E,QAAQpa,SAChB,IAAI0rB,IAAkBvG,OAExB5P,KAAK4E,SAASxjB,aAAa,cAAc,GACzC4e,KAAK4E,SAASxjB,aAAa,OAAQ,UACnC4e,KAAK4E,SAASvJ,UAAU5E,IAAIqjB,IAW5B9Z,KAAKmF,gBAVoB,KAClBnF,KAAK6E,QAAQpa,SAAUuV,KAAK6E,QAAQ+P,UACvC5U,KAAKwY,WAAW9C,WAElB1V,KAAK4E,SAASvJ,UAAU5E,IAAIojB,IAC5B7Z,KAAK4E,SAASvJ,UAAU1B,OAAOmgB,IAC/BvZ,GAAaqB,QAAQ5B,KAAK4E,SAAUsV,GAAe,CACjDpa,iBACA,GAEkCE,KAAK4E,UAAU,GACvD,CACA,IAAAgL,GACO5P,KAAK2P,WAGQpP,GAAaqB,QAAQ5B,KAAK4E,SAAUuV,IACxCnY,mBAGdhC,KAAKwY,WAAW3C,aAChB7V,KAAK4E,SAASgW,OACd5a,KAAK2P,UAAW,EAChB3P,KAAK4E,SAASvJ,UAAU5E,IAAIsjB,IAC5B/Z,KAAKsY,UAAU1I,OAUf5P,KAAKmF,gBAToB,KACvBnF,KAAK4E,SAASvJ,UAAU1B,OAAOkgB,GAAmBE,IAClD/Z,KAAK4E,SAASzjB,gBAAgB,cAC9B6e,KAAK4E,SAASzjB,gBAAgB,QACzB6e,KAAK6E,QAAQpa,SAChB,IAAI0rB,IAAkB9jB,QAExBkO,GAAaqB,QAAQ5B,KAAK4E,SAAUyV,GAAe,GAEfra,KAAK4E,UAAU,IACvD,CACA,OAAAG,GACE/E,KAAKsY,UAAUvT,UACf/E,KAAKwY,WAAW3C,aAChBlR,MAAMI,SACR,CAGA,mBAAAwT,GACE,MASM5d,EAAYmG,QAAQd,KAAK6E,QAAQ+P,UACvC,OAAO,IAAIL,GAAS,CAClBJ,UA3HsB,qBA4HtBxZ,YACAyK,YAAY,EACZiP,YAAarU,KAAK4E,SAAS7f,WAC3BqvB,cAAezZ,EAfK,KACU,WAA1BqF,KAAK6E,QAAQ+P,SAIjB5U,KAAK4P,OAHHrP,GAAaqB,QAAQ5B,KAAK4E,SAAUwV,GAG3B,EAUgC,MAE/C,CACA,oBAAA3B,GACE,OAAO,IAAIlD,GAAU,CACnBF,YAAarV,KAAK4E,UAEtB,CACA,kBAAAiH,GACEtL,GAAac,GAAGrB,KAAK4E,SAAU4V,IAAuBpb,IA5IvC,WA6ITA,EAAMtiB,MAGNkjB,KAAK6E,QAAQmG,SACfhL,KAAK4P,OAGPrP,GAAaqB,QAAQ5B,KAAK4E,SAAUwV,IAAqB,GAE7D,CAGA,sBAAO3d,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOswB,GAAUrV,oBAAoBtF,KAAM8D,GACjD,GAAsB,iBAAXA,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KAJb,CAKF,GACF,EAOFO,GAAac,GAAGhc,SAAUk1B,GA7JK,gCA6J2C,SAAUnb,GAClF,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MAIrD,GAHI,CAAC,IAAK,QAAQoB,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,MACb,OAEFO,GAAae,IAAI/U,EAAQ8tB,IAAgB,KAEnC1f,GAAUqF,OACZA,KAAKyS,OACP,IAIF,MAAMgH,EAAc5T,GAAeC,QAAQkU,IACvCP,GAAeA,IAAgBltB,GACjCouB,GAAUtV,YAAYoU,GAAa7J,OAExB+K,GAAUrV,oBAAoB/Y,GACtCob,OAAO3H,KACd,IACAO,GAAac,GAAGzhB,OAAQg6B,IAAuB,KAC7C,IAAK,MAAM7f,KAAY8L,GAAe1T,KAAK6nB,IACzCW,GAAUrV,oBAAoBvL,GAAU8V,MAC1C,IAEFtP,GAAac,GAAGzhB,OAAQ06B,IAAc,KACpC,IAAK,MAAM/6B,KAAWsmB,GAAe1T,KAAK,gDACG,UAAvClN,iBAAiB1F,GAASiC,UAC5Bm5B,GAAUrV,oBAAoB/lB,GAASqwB,MAE3C,IAEF/I,GAAqB8T,IAMrBxe,GAAmBwe,IAUnB,MACME,GAAmB,CAEvB,IAAK,CAAC,QAAS,MAAO,KAAM,OAAQ,OAHP,kBAI7BhqB,EAAG,CAAC,SAAU,OAAQ,QAAS,OAC/BiqB,KAAM,GACNhqB,EAAG,GACHiqB,GAAI,GACJC,IAAK,GACLC,KAAM,GACNC,GAAI,GACJC,IAAK,GACLC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJxqB,EAAG,GACH0b,IAAK,CAAC,MAAO,SAAU,MAAO,QAAS,QAAS,UAChD+O,GAAI,GACJC,GAAI,GACJC,EAAG,GACHC,IAAK,GACLC,EAAG,GACHC,MAAO,GACPC,KAAM,GACNC,IAAK,GACLC,IAAK,GACLC,OAAQ,GACRC,EAAG,GACHC,GAAI,IAIAC,GAAgB,IAAIpmB,IAAI,CAAC,aAAc,OAAQ,OAAQ,WAAY,WAAY,SAAU,MAAO,eAShGqmB,GAAmB,0DACnBC,GAAmB,CAAC76B,EAAW86B,KACnC,MAAMC,EAAgB/6B,EAAUvC,SAASC,cACzC,OAAIo9B,EAAqBzb,SAAS0b,IAC5BJ,GAAc/lB,IAAImmB,IACbhc,QAAQ6b,GAAiBt5B,KAAKtB,EAAUg7B,YAM5CF,EAAqB12B,QAAO62B,GAAkBA,aAA0BzY,SAAQ9R,MAAKwqB,GAASA,EAAM55B,KAAKy5B,IAAe,EA0C3HI,GAAY,CAChBC,UAAWtC,GACXuC,QAAS,CAAC,EAEVC,WAAY,GACZxwB,MAAM,EACNywB,UAAU,EACVC,WAAY,KACZC,SAAU,eAENC,GAAgB,CACpBN,UAAW,SACXC,QAAS,SACTC,WAAY,oBACZxwB,KAAM,UACNywB,SAAU,UACVC,WAAY,kBACZC,SAAU,UAENE,GAAqB,CACzBC,MAAO,iCACP5jB,SAAU,oBAOZ,MAAM6jB,WAAwBna,GAC5B,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,EACjC,CAGA,kBAAWJ,GACT,OAAOwZ,EACT,CACA,sBAAWvZ,GACT,OAAO8Z,EACT,CACA,eAAWlhB,GACT,MA3CW,iBA4Cb,CAGA,UAAAshB,GACE,OAAO7gC,OAAOmiB,OAAOa,KAAK6E,QAAQuY,SAASt6B,KAAIghB,GAAU9D,KAAK8d,yBAAyBha,KAAS3d,OAAO2a,QACzG,CACA,UAAAid,GACE,OAAO/d,KAAK6d,aAAantB,OAAS,CACpC,CACA,aAAAstB,CAAcZ,GAMZ,OALApd,KAAKie,cAAcb,GACnBpd,KAAK6E,QAAQuY,QAAU,IAClBpd,KAAK6E,QAAQuY,WACbA,GAEEpd,IACT,CACA,MAAAke,GACE,MAAMC,EAAkB94B,SAASwvB,cAAc,OAC/CsJ,EAAgBC,UAAYpe,KAAKqe,eAAere,KAAK6E,QAAQ2Y,UAC7D,IAAK,MAAOzjB,EAAUukB,KAASthC,OAAOmkB,QAAQnB,KAAK6E,QAAQuY,SACzDpd,KAAKue,YAAYJ,EAAiBG,EAAMvkB,GAE1C,MAAMyjB,EAAWW,EAAgBpY,SAAS,GACpCsX,EAAard,KAAK8d,yBAAyB9d,KAAK6E,QAAQwY,YAI9D,OAHIA,GACFG,EAASniB,UAAU5E,OAAO4mB,EAAWn7B,MAAM,MAEtCs7B,CACT,CAGA,gBAAAvZ,CAAiBH,GACfa,MAAMV,iBAAiBH,GACvB9D,KAAKie,cAAcna,EAAOsZ,QAC5B,CACA,aAAAa,CAAcO,GACZ,IAAK,MAAOzkB,EAAUqjB,KAAYpgC,OAAOmkB,QAAQqd,GAC/C7Z,MAAMV,iBAAiB,CACrBlK,WACA4jB,MAAOP,GACNM,GAEP,CACA,WAAAa,CAAYf,EAAUJ,EAASrjB,GAC7B,MAAM0kB,EAAkB5Y,GAAeC,QAAQ/L,EAAUyjB,GACpDiB,KAGLrB,EAAUpd,KAAK8d,yBAAyBV,IAKpC,GAAUA,GACZpd,KAAK0e,sBAAsBhkB,GAAW0iB,GAAUqB,GAG9Cze,KAAK6E,QAAQhY,KACf4xB,EAAgBL,UAAYpe,KAAKqe,eAAejB,GAGlDqB,EAAgBE,YAAcvB,EAX5BqB,EAAgB9kB,SAYpB,CACA,cAAA0kB,CAAeG,GACb,OAAOxe,KAAK6E,QAAQyY,SApJxB,SAAsBsB,EAAYzB,EAAW0B,GAC3C,IAAKD,EAAWluB,OACd,OAAOkuB,EAET,GAAIC,GAAgD,mBAArBA,EAC7B,OAAOA,EAAiBD,GAE1B,MACME,GADY,IAAIl/B,OAAOm/B,WACKC,gBAAgBJ,EAAY,aACxD/9B,EAAW,GAAGlC,UAAUmgC,EAAgB5yB,KAAKkU,iBAAiB,MACpE,IAAK,MAAM7gB,KAAWsB,EAAU,CAC9B,MAAMo+B,EAAc1/B,EAAQC,SAASC,cACrC,IAAKzC,OAAO4D,KAAKu8B,GAAW/b,SAAS6d,GAAc,CACjD1/B,EAAQoa,SACR,QACF,CACA,MAAMulB,EAAgB,GAAGvgC,UAAUY,EAAQ0B,YACrCk+B,EAAoB,GAAGxgC,OAAOw+B,EAAU,MAAQ,GAAIA,EAAU8B,IAAgB,IACpF,IAAK,MAAMl9B,KAAam9B,EACjBtC,GAAiB76B,EAAWo9B,IAC/B5/B,EAAQ4B,gBAAgBY,EAAUvC,SAGxC,CACA,OAAOs/B,EAAgB5yB,KAAKkyB,SAC9B,CA2HmCgB,CAAaZ,EAAKxe,KAAK6E,QAAQsY,UAAWnd,KAAK6E,QAAQ0Y,YAAciB,CACtG,CACA,wBAAAV,CAAyBU,GACvB,OAAO3hB,GAAQ2hB,EAAK,CAACxe,MACvB,CACA,qBAAA0e,CAAsBn/B,EAASk/B,GAC7B,GAAIze,KAAK6E,QAAQhY,KAGf,OAFA4xB,EAAgBL,UAAY,QAC5BK,EAAgB3J,OAAOv1B,GAGzBk/B,EAAgBE,YAAcp/B,EAAQo/B,WACxC,EAeF,MACMU,GAAwB,IAAI/oB,IAAI,CAAC,WAAY,YAAa,eAC1DgpB,GAAoB,OAEpBC,GAAoB,OACpBC,GAAyB,iBACzBC,GAAiB,SACjBC,GAAmB,gBACnBC,GAAgB,QAChBC,GAAgB,QAahBC,GAAgB,CACpBC,KAAM,OACNC,IAAK,MACLC,MAAO/jB,KAAU,OAAS,QAC1BgkB,OAAQ,SACRC,KAAMjkB,KAAU,QAAU,QAEtBkkB,GAAY,CAChBhD,UAAWtC,GACXuF,WAAW,EACXnyB,SAAU,kBACVoyB,WAAW,EACXC,YAAa,GACbC,MAAO,EACPvwB,mBAAoB,CAAC,MAAO,QAAS,SAAU,QAC/CnD,MAAM,EACN7E,OAAQ,CAAC,EAAG,GACZtJ,UAAW,MACXszB,aAAc,KACdsL,UAAU,EACVC,WAAY,KACZxjB,UAAU,EACVyjB,SAAU,+GACVgD,MAAO,GACP5e,QAAS,eAEL6e,GAAgB,CACpBtD,UAAW,SACXiD,UAAW,UACXnyB,SAAU,mBACVoyB,UAAW,2BACXC,YAAa,oBACbC,MAAO,kBACPvwB,mBAAoB,QACpBnD,KAAM,UACN7E,OAAQ,0BACRtJ,UAAW,oBACXszB,aAAc,yBACdsL,SAAU,UACVC,WAAY,kBACZxjB,SAAU,mBACVyjB,SAAU,SACVgD,MAAO,4BACP5e,QAAS,UAOX,MAAM8e,WAAgBhc,GACpB,WAAAP,CAAY5kB,EAASukB,GACnB,QAAsB,IAAX,EACT,MAAM,IAAIU,UAAU,+DAEtBG,MAAMplB,EAASukB,GAGf9D,KAAK2gB,YAAa,EAClB3gB,KAAK4gB,SAAW,EAChB5gB,KAAK6gB,WAAa,KAClB7gB,KAAK8gB,eAAiB,CAAC,EACvB9gB,KAAKmS,QAAU,KACfnS,KAAK+gB,iBAAmB,KACxB/gB,KAAKghB,YAAc,KAGnBhhB,KAAKihB,IAAM,KACXjhB,KAAKkhB,gBACAlhB,KAAK6E,QAAQ9K,UAChBiG,KAAKmhB,WAET,CAGA,kBAAWzd,GACT,OAAOyc,EACT,CACA,sBAAWxc,GACT,OAAO8c,EACT,CACA,eAAWlkB,GACT,MAxGW,SAyGb,CAGA,MAAA6kB,GACEphB,KAAK2gB,YAAa,CACpB,CACA,OAAAU,GACErhB,KAAK2gB,YAAa,CACpB,CACA,aAAAW,GACEthB,KAAK2gB,YAAc3gB,KAAK2gB,UAC1B,CACA,MAAAhZ,GACO3H,KAAK2gB,aAGV3gB,KAAK8gB,eAAeS,OAASvhB,KAAK8gB,eAAeS,MAC7CvhB,KAAK2P,WACP3P,KAAKwhB,SAGPxhB,KAAKyhB,SACP,CACA,OAAA1c,GACEmI,aAAalN,KAAK4gB,UAClBrgB,GAAaC,IAAIR,KAAK4E,SAAS5J,QAAQykB,IAAiBC,GAAkB1f,KAAK0hB,mBAC3E1hB,KAAK4E,SAASpJ,aAAa,2BAC7BwE,KAAK4E,SAASxjB,aAAa,QAAS4e,KAAK4E,SAASpJ,aAAa,2BAEjEwE,KAAK2hB,iBACLhd,MAAMI,SACR,CACA,IAAA8K,GACE,GAAoC,SAAhC7P,KAAK4E,SAAS7jB,MAAMgxB,QACtB,MAAM,IAAInO,MAAM,uCAElB,IAAM5D,KAAK4hB,mBAAoB5hB,KAAK2gB,WAClC,OAEF,MAAMnH,EAAYjZ,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAlItD,SAoIXqc,GADapmB,GAAeuE,KAAK4E,WACL5E,KAAK4E,SAAS9kB,cAAcwF,iBAAiBd,SAASwb,KAAK4E,UAC7F,GAAI4U,EAAUxX,mBAAqB6f,EACjC,OAIF7hB,KAAK2hB,iBACL,MAAMV,EAAMjhB,KAAK8hB,iBACjB9hB,KAAK4E,SAASxjB,aAAa,mBAAoB6/B,EAAIzlB,aAAa,OAChE,MAAM,UACJ6kB,GACErgB,KAAK6E,QAYT,GAXK7E,KAAK4E,SAAS9kB,cAAcwF,gBAAgBd,SAASwb,KAAKihB,OAC7DZ,EAAUvL,OAAOmM,GACjB1gB,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAhJpC,cAkJnBxF,KAAKmS,QAAUnS,KAAKwS,cAAcyO,GAClCA,EAAI5lB,UAAU5E,IAAI8oB,IAMd,iBAAkBl6B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAac,GAAG9hB,EAAS,YAAaqc,IAU1CoE,KAAKmF,gBAPY,KACf5E,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAhKrC,WAiKQ,IAApBxF,KAAK6gB,YACP7gB,KAAKwhB,SAEPxhB,KAAK6gB,YAAa,CAAK,GAEK7gB,KAAKihB,IAAKjhB,KAAKgO,cAC/C,CACA,IAAA4B,GACE,GAAK5P,KAAK2P,aAGQpP,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UA/KtD,SAgLHxD,iBAAd,CAQA,GALYhC,KAAK8hB,iBACbzmB,UAAU1B,OAAO4lB,IAIjB,iBAAkBl6B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAaC,IAAIjhB,EAAS,YAAaqc,IAG3CoE,KAAK8gB,eAA4B,OAAI,EACrC9gB,KAAK8gB,eAAelB,KAAiB,EACrC5f,KAAK8gB,eAAenB,KAAiB,EACrC3f,KAAK6gB,WAAa,KAYlB7gB,KAAKmF,gBAVY,KACXnF,KAAK+hB,yBAGJ/hB,KAAK6gB,YACR7gB,KAAK2hB,iBAEP3hB,KAAK4E,SAASzjB,gBAAgB,oBAC9Bof,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAzMpC,WAyM8D,GAEnDxF,KAAKihB,IAAKjhB,KAAKgO,cA1B7C,CA2BF,CACA,MAAAjjB,GACMiV,KAAKmS,SACPnS,KAAKmS,QAAQpnB,QAEjB,CAGA,cAAA62B,GACE,OAAO9gB,QAAQd,KAAKgiB,YACtB,CACA,cAAAF,GAIE,OAHK9hB,KAAKihB,MACRjhB,KAAKihB,IAAMjhB,KAAKiiB,kBAAkBjiB,KAAKghB,aAAehhB,KAAKkiB,2BAEtDliB,KAAKihB,GACd,CACA,iBAAAgB,CAAkB7E,GAChB,MAAM6D,EAAMjhB,KAAKmiB,oBAAoB/E,GAASc,SAG9C,IAAK+C,EACH,OAAO,KAETA,EAAI5lB,UAAU1B,OAAO2lB,GAAmBC,IAExC0B,EAAI5lB,UAAU5E,IAAI,MAAMuJ,KAAKmE,YAAY5H,aACzC,MAAM6lB,EAvuGKC,KACb,GACEA,GAAUlgC,KAAKmgC,MA/BH,IA+BSngC,KAAKogC,gBACnBl9B,SAASm9B,eAAeH,IACjC,OAAOA,CAAM,EAmuGGI,CAAOziB,KAAKmE,YAAY5H,MAAM1c,WAK5C,OAJAohC,EAAI7/B,aAAa,KAAMghC,GACnBpiB,KAAKgO,eACPiT,EAAI5lB,UAAU5E,IAAI6oB,IAEb2B,CACT,CACA,UAAAyB,CAAWtF,GACTpd,KAAKghB,YAAc5D,EACfpd,KAAK2P,aACP3P,KAAK2hB,iBACL3hB,KAAK6P,OAET,CACA,mBAAAsS,CAAoB/E,GAYlB,OAXIpd,KAAK+gB,iBACP/gB,KAAK+gB,iBAAiB/C,cAAcZ,GAEpCpd,KAAK+gB,iBAAmB,IAAInD,GAAgB,IACvC5d,KAAK6E,QAGRuY,UACAC,WAAYrd,KAAK8d,yBAAyB9d,KAAK6E,QAAQyb,eAGpDtgB,KAAK+gB,gBACd,CACA,sBAAAmB,GACE,MAAO,CACL,CAAC1C,IAAyBxf,KAAKgiB,YAEnC,CACA,SAAAA,GACE,OAAOhiB,KAAK8d,yBAAyB9d,KAAK6E,QAAQ2b,QAAUxgB,KAAK4E,SAASpJ,aAAa,yBACzF,CAGA,4BAAAmnB,CAA6BvjB,GAC3B,OAAOY,KAAKmE,YAAYmB,oBAAoBlG,EAAMW,eAAgBC,KAAK4iB,qBACzE,CACA,WAAA5U,GACE,OAAOhO,KAAK6E,QAAQub,WAAapgB,KAAKihB,KAAOjhB,KAAKihB,IAAI5lB,UAAU7W,SAAS86B,GAC3E,CACA,QAAA3P,GACE,OAAO3P,KAAKihB,KAAOjhB,KAAKihB,IAAI5lB,UAAU7W,SAAS+6B,GACjD,CACA,aAAA/M,CAAcyO,GACZ,MAAMviC,EAAYme,GAAQmD,KAAK6E,QAAQnmB,UAAW,CAACshB,KAAMihB,EAAKjhB,KAAK4E,WAC7Die,EAAahD,GAAcnhC,EAAU+lB,eAC3C,OAAO,GAAoBzE,KAAK4E,SAAUqc,EAAKjhB,KAAK4S,iBAAiBiQ,GACvE,CACA,UAAA7P,GACE,MAAM,OACJhrB,GACEgY,KAAK6E,QACT,MAAsB,iBAAX7c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAAS4f,OAAOgQ,SAAS5vB,EAAO,MAEzC,mBAAXqK,EACFirB,GAAcjrB,EAAOirB,EAAYjT,KAAK4E,UAExC5c,CACT,CACA,wBAAA81B,CAAyBU,GACvB,OAAO3hB,GAAQ2hB,EAAK,CAACxe,KAAK4E,UAC5B,CACA,gBAAAgO,CAAiBiQ,GACf,MAAM3P,EAAwB,CAC5Bx0B,UAAWmkC,EACXzsB,UAAW,CAAC,CACV9V,KAAM,OACNmB,QAAS,CACPuO,mBAAoBgQ,KAAK6E,QAAQ7U,qBAElC,CACD1P,KAAM,SACNmB,QAAS,CACPuG,OAAQgY,KAAKgT,eAEd,CACD1yB,KAAM,kBACNmB,QAAS,CACPwM,SAAU+R,KAAK6E,QAAQ5W,WAExB,CACD3N,KAAM,QACNmB,QAAS,CACPlC,QAAS,IAAIygB,KAAKmE,YAAY5H,eAE/B,CACDjc,KAAM,kBACNC,SAAS,EACTC,MAAO,aACPC,GAAI4J,IAGF2V,KAAK8hB,iBAAiB1gC,aAAa,wBAAyBiJ,EAAK1J,MAAMjC,UAAU,KAIvF,MAAO,IACFw0B,KACArW,GAAQmD,KAAK6E,QAAQmN,aAAc,CAACkB,IAE3C,CACA,aAAAgO,GACE,MAAM4B,EAAW9iB,KAAK6E,QAAQjD,QAAQ1f,MAAM,KAC5C,IAAK,MAAM0f,KAAWkhB,EACpB,GAAgB,UAAZlhB,EACFrB,GAAac,GAAGrB,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAjVlC,SAiV4DxF,KAAK6E,QAAQ9K,UAAUqF,IAC/EY,KAAK2iB,6BAA6BvjB,GAC1CuI,QAAQ,SAEb,GA3VU,WA2VN/F,EAA4B,CACrC,MAAMmhB,EAAUnhB,IAAY+d,GAAgB3f,KAAKmE,YAAYqB,UAnV5C,cAmV0ExF,KAAKmE,YAAYqB,UArV5F,WAsVVwd,EAAWphB,IAAY+d,GAAgB3f,KAAKmE,YAAYqB,UAnV7C,cAmV2ExF,KAAKmE,YAAYqB,UArV5F,YAsVjBjF,GAAac,GAAGrB,KAAK4E,SAAUme,EAAS/iB,KAAK6E,QAAQ9K,UAAUqF,IAC7D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAClDkU,EAAQwN,eAA8B,YAAf1hB,EAAMqB,KAAqBmf,GAAgBD,KAAiB,EACnFrM,EAAQmO,QAAQ,IAElBlhB,GAAac,GAAGrB,KAAK4E,SAAUoe,EAAUhjB,KAAK6E,QAAQ9K,UAAUqF,IAC9D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAClDkU,EAAQwN,eAA8B,aAAf1hB,EAAMqB,KAAsBmf,GAAgBD,IAAiBrM,EAAQ1O,SAASpgB,SAAS4a,EAAMU,eACpHwT,EAAQkO,QAAQ,GAEpB,CAEFxhB,KAAK0hB,kBAAoB,KACnB1hB,KAAK4E,UACP5E,KAAK4P,MACP,EAEFrP,GAAac,GAAGrB,KAAK4E,SAAS5J,QAAQykB,IAAiBC,GAAkB1f,KAAK0hB,kBAChF,CACA,SAAAP,GACE,MAAMX,EAAQxgB,KAAK4E,SAASpJ,aAAa,SACpCglB,IAGAxgB,KAAK4E,SAASpJ,aAAa,eAAkBwE,KAAK4E,SAAS+Z,YAAYhZ,QAC1E3F,KAAK4E,SAASxjB,aAAa,aAAco/B,GAE3CxgB,KAAK4E,SAASxjB,aAAa,yBAA0Bo/B,GACrDxgB,KAAK4E,SAASzjB,gBAAgB,SAChC,CACA,MAAAsgC,GACMzhB,KAAK2P,YAAc3P,KAAK6gB,WAC1B7gB,KAAK6gB,YAAa,GAGpB7gB,KAAK6gB,YAAa,EAClB7gB,KAAKijB,aAAY,KACXjjB,KAAK6gB,YACP7gB,KAAK6P,MACP,GACC7P,KAAK6E,QAAQ0b,MAAM1Q,MACxB,CACA,MAAA2R,GACMxhB,KAAK+hB,yBAGT/hB,KAAK6gB,YAAa,EAClB7gB,KAAKijB,aAAY,KACVjjB,KAAK6gB,YACR7gB,KAAK4P,MACP,GACC5P,KAAK6E,QAAQ0b,MAAM3Q,MACxB,CACA,WAAAqT,CAAYrlB,EAASslB,GACnBhW,aAAalN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW/iB,WAAWD,EAASslB,EACtC,CACA,oBAAAnB,GACE,OAAO/kC,OAAOmiB,OAAOa,KAAK8gB,gBAAgB1f,UAAS,EACrD,CACA,UAAAyC,CAAWC,GACT,MAAMqf,EAAiBngB,GAAYG,kBAAkBnD,KAAK4E,UAC1D,IAAK,MAAMwe,KAAiBpmC,OAAO4D,KAAKuiC,GAClC9D,GAAsB1oB,IAAIysB,WACrBD,EAAeC,GAU1B,OAPAtf,EAAS,IACJqf,KACmB,iBAAXrf,GAAuBA,EAASA,EAAS,CAAC,GAEvDA,EAAS9D,KAAK+D,gBAAgBD,GAC9BA,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CACA,iBAAAE,CAAkBF,GAchB,OAbAA,EAAOuc,WAAiC,IAArBvc,EAAOuc,UAAsBh7B,SAAS6G,KAAOwO,GAAWoJ,EAAOuc,WACtD,iBAAjBvc,EAAOyc,QAChBzc,EAAOyc,MAAQ,CACb1Q,KAAM/L,EAAOyc,MACb3Q,KAAM9L,EAAOyc,QAGW,iBAAjBzc,EAAO0c,QAChB1c,EAAO0c,MAAQ1c,EAAO0c,MAAM3gC,YAEA,iBAAnBikB,EAAOsZ,UAChBtZ,EAAOsZ,QAAUtZ,EAAOsZ,QAAQv9B,YAE3BikB,CACT,CACA,kBAAA8e,GACE,MAAM9e,EAAS,CAAC,EAChB,IAAK,MAAOhnB,EAAKa,KAAUX,OAAOmkB,QAAQnB,KAAK6E,SACzC7E,KAAKmE,YAAYT,QAAQ5mB,KAASa,IACpCmmB,EAAOhnB,GAAOa,GASlB,OANAmmB,EAAO/J,UAAW,EAClB+J,EAAOlC,QAAU,SAKVkC,CACT,CACA,cAAA6d,GACM3hB,KAAKmS,UACPnS,KAAKmS,QAAQnZ,UACbgH,KAAKmS,QAAU,MAEbnS,KAAKihB,MACPjhB,KAAKihB,IAAItnB,SACTqG,KAAKihB,IAAM,KAEf,CAGA,sBAAOxkB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOq2B,GAAQpb,oBAAoBtF,KAAM8D,GAC/C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOF3H,GAAmBukB,IAcnB,MACM2C,GAAiB,kBACjBC,GAAmB,gBACnBC,GAAY,IACb7C,GAAQhd,QACX0Z,QAAS,GACTp1B,OAAQ,CAAC,EAAG,GACZtJ,UAAW,QACX8+B,SAAU,8IACV5b,QAAS,SAEL4hB,GAAgB,IACjB9C,GAAQ/c,YACXyZ,QAAS,kCAOX,MAAMqG,WAAgB/C,GAEpB,kBAAWhd,GACT,OAAO6f,EACT,CACA,sBAAW5f,GACT,OAAO6f,EACT,CACA,eAAWjnB,GACT,MA7BW,SA8Bb,CAGA,cAAAqlB,GACE,OAAO5hB,KAAKgiB,aAAehiB,KAAK0jB,aAClC,CAGA,sBAAAxB,GACE,MAAO,CACL,CAACmB,IAAiBrjB,KAAKgiB,YACvB,CAACsB,IAAmBtjB,KAAK0jB,cAE7B,CACA,WAAAA,GACE,OAAO1jB,KAAK8d,yBAAyB9d,KAAK6E,QAAQuY,QACpD,CAGA,sBAAO3gB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOo5B,GAAQne,oBAAoBtF,KAAM8D,GAC/C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOF3H,GAAmBsnB,IAcnB,MAEME,GAAc,gBAEdC,GAAiB,WAAWD,KAC5BE,GAAc,QAAQF,KACtBG,GAAwB,OAAOH,cAE/BI,GAAsB,SAEtBC,GAAwB,SAExBC,GAAqB,YAGrBC,GAAsB,GAAGD,mBAA+CA,uBAGxEE,GAAY,CAChBn8B,OAAQ,KAERo8B,WAAY,eACZC,cAAc,EACd93B,OAAQ,KACR+3B,UAAW,CAAC,GAAK,GAAK,IAElBC,GAAgB,CACpBv8B,OAAQ,gBAERo8B,WAAY,SACZC,aAAc,UACd93B,OAAQ,UACR+3B,UAAW,SAOb,MAAME,WAAkB9f,GACtB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GAGf9D,KAAKykB,aAAe,IAAIvzB,IACxB8O,KAAK0kB,oBAAsB,IAAIxzB,IAC/B8O,KAAK2kB,aAA6D,YAA9C1/B,iBAAiB+a,KAAK4E,UAAU5Y,UAA0B,KAAOgU,KAAK4E,SAC1F5E,KAAK4kB,cAAgB,KACrB5kB,KAAK6kB,UAAY,KACjB7kB,KAAK8kB,oBAAsB,CACzBC,gBAAiB,EACjBC,gBAAiB,GAEnBhlB,KAAKilB,SACP,CAGA,kBAAWvhB,GACT,OAAOygB,EACT,CACA,sBAAWxgB,GACT,OAAO4gB,EACT,CACA,eAAWhoB,GACT,MAhEW,WAiEb,CAGA,OAAA0oB,GACEjlB,KAAKklB,mCACLllB,KAAKmlB,2BACDnlB,KAAK6kB,UACP7kB,KAAK6kB,UAAUO,aAEfplB,KAAK6kB,UAAY7kB,KAAKqlB,kBAExB,IAAK,MAAMC,KAAWtlB,KAAK0kB,oBAAoBvlB,SAC7Ca,KAAK6kB,UAAUU,QAAQD,EAE3B,CACA,OAAAvgB,GACE/E,KAAK6kB,UAAUO,aACfzgB,MAAMI,SACR,CAGA,iBAAAf,CAAkBF,GAShB,OAPAA,EAAOvX,OAASmO,GAAWoJ,EAAOvX,SAAWlH,SAAS6G,KAGtD4X,EAAOsgB,WAAatgB,EAAO9b,OAAS,GAAG8b,EAAO9b,oBAAsB8b,EAAOsgB,WAC3C,iBAArBtgB,EAAOwgB,YAChBxgB,EAAOwgB,UAAYxgB,EAAOwgB,UAAUpiC,MAAM,KAAKY,KAAInF,GAAS4f,OAAOC,WAAW7f,MAEzEmmB,CACT,CACA,wBAAAqhB,GACOnlB,KAAK6E,QAAQwf,eAKlB9jB,GAAaC,IAAIR,KAAK6E,QAAQtY,OAAQs3B,IACtCtjB,GAAac,GAAGrB,KAAK6E,QAAQtY,OAAQs3B,GAAaG,IAAuB5kB,IACvE,MAAMomB,EAAoBxlB,KAAK0kB,oBAAoBvnC,IAAIiiB,EAAM7S,OAAOtB,MACpE,GAAIu6B,EAAmB,CACrBpmB,EAAMkD,iBACN,MAAM3G,EAAOqE,KAAK2kB,cAAgB/kC,OAC5BmE,EAASyhC,EAAkBnhC,UAAY2b,KAAK4E,SAASvgB,UAC3D,GAAIsX,EAAK8pB,SAKP,YAJA9pB,EAAK8pB,SAAS,CACZ9jC,IAAKoC,EACL2hC,SAAU,WAMd/pB,EAAKlQ,UAAY1H,CACnB,KAEJ,CACA,eAAAshC,GACE,MAAM5jC,EAAU,CACdka,KAAMqE,KAAK2kB,aACXL,UAAWtkB,KAAK6E,QAAQyf,UACxBF,WAAYpkB,KAAK6E,QAAQuf,YAE3B,OAAO,IAAIuB,sBAAqBxkB,GAAWnB,KAAK4lB,kBAAkBzkB,IAAU1f,EAC9E,CAGA,iBAAAmkC,CAAkBzkB,GAChB,MAAM0kB,EAAgBlI,GAAS3d,KAAKykB,aAAatnC,IAAI,IAAIwgC,EAAMpxB,OAAO4N,MAChEub,EAAWiI,IACf3d,KAAK8kB,oBAAoBC,gBAAkBpH,EAAMpxB,OAAOlI,UACxD2b,KAAK8lB,SAASD,EAAclI,GAAO,EAE/BqH,GAAmBhlB,KAAK2kB,cAAgBt/B,SAASC,iBAAiBmG,UAClEs6B,EAAkBf,GAAmBhlB,KAAK8kB,oBAAoBE,gBACpEhlB,KAAK8kB,oBAAoBE,gBAAkBA,EAC3C,IAAK,MAAMrH,KAASxc,EAAS,CAC3B,IAAKwc,EAAMqI,eAAgB,CACzBhmB,KAAK4kB,cAAgB,KACrB5kB,KAAKimB,kBAAkBJ,EAAclI,IACrC,QACF,CACA,MAAMuI,EAA2BvI,EAAMpxB,OAAOlI,WAAa2b,KAAK8kB,oBAAoBC,gBAEpF,GAAIgB,GAAmBG,GAGrB,GAFAxQ,EAASiI,IAEJqH,EACH,YAMCe,GAAoBG,GACvBxQ,EAASiI,EAEb,CACF,CACA,gCAAAuH,GACEllB,KAAKykB,aAAe,IAAIvzB,IACxB8O,KAAK0kB,oBAAsB,IAAIxzB,IAC/B,MAAMi1B,EAActgB,GAAe1T,KAAK6xB,GAAuBhkB,KAAK6E,QAAQtY,QAC5E,IAAK,MAAM65B,KAAUD,EAAa,CAEhC,IAAKC,EAAOn7B,MAAQiQ,GAAWkrB,GAC7B,SAEF,MAAMZ,EAAoB3f,GAAeC,QAAQugB,UAAUD,EAAOn7B,MAAO+U,KAAK4E,UAG1EjK,GAAU6qB,KACZxlB,KAAKykB,aAAa1yB,IAAIs0B,UAAUD,EAAOn7B,MAAOm7B,GAC9CpmB,KAAK0kB,oBAAoB3yB,IAAIq0B,EAAOn7B,KAAMu6B,GAE9C,CACF,CACA,QAAAM,CAASv5B,GACHyT,KAAK4kB,gBAAkBr4B,IAG3ByT,KAAKimB,kBAAkBjmB,KAAK6E,QAAQtY,QACpCyT,KAAK4kB,cAAgBr4B,EACrBA,EAAO8O,UAAU5E,IAAIstB,IACrB/jB,KAAKsmB,iBAAiB/5B,GACtBgU,GAAaqB,QAAQ5B,KAAK4E,SAAUgf,GAAgB,CAClD9jB,cAAevT,IAEnB,CACA,gBAAA+5B,CAAiB/5B,GAEf,GAAIA,EAAO8O,UAAU7W,SA9LQ,iBA+L3BqhB,GAAeC,QArLc,mBAqLsBvZ,EAAOyO,QAtLtC,cAsLkEK,UAAU5E,IAAIstB,SAGtG,IAAK,MAAMwC,KAAa1gB,GAAeI,QAAQ1Z,EA9LnB,qBAiM1B,IAAK,MAAMxJ,KAAQ8iB,GAAeM,KAAKogB,EAAWrC,IAChDnhC,EAAKsY,UAAU5E,IAAIstB,GAGzB,CACA,iBAAAkC,CAAkBxhC,GAChBA,EAAO4W,UAAU1B,OAAOoqB,IACxB,MAAMyC,EAAc3gB,GAAe1T,KAAK,GAAG6xB,MAAyBD,KAAuBt/B,GAC3F,IAAK,MAAM9E,KAAQ6mC,EACjB7mC,EAAK0b,UAAU1B,OAAOoqB,GAE1B,CAGA,sBAAOtnB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOm6B,GAAUlf,oBAAoBtF,KAAM8D,GACjD,GAAsB,iBAAXA,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOFvD,GAAac,GAAGzhB,OAAQkkC,IAAuB,KAC7C,IAAK,MAAM2C,KAAO5gB,GAAe1T,KApOT,0BAqOtBqyB,GAAUlf,oBAAoBmhB,EAChC,IAOFtqB,GAAmBqoB,IAcnB,MAEMkC,GAAc,UACdC,GAAe,OAAOD,KACtBE,GAAiB,SAASF,KAC1BG,GAAe,OAAOH,KACtBI,GAAgB,QAAQJ,KACxBK,GAAuB,QAAQL,KAC/BM,GAAgB,UAAUN,KAC1BO,GAAsB,OAAOP,KAC7BQ,GAAiB,YACjBC,GAAkB,aAClBC,GAAe,UACfC,GAAiB,YACjBC,GAAW,OACXC,GAAU,MACVC,GAAoB,SACpBC,GAAoB,OACpBC,GAAoB,OAEpBC,GAA2B,mBAE3BC,GAA+B,QAAQD,MAIvCE,GAAuB,2EACvBC,GAAsB,YAFOF,uBAAiDA,mBAA6CA,OAE/EC,KAC5CE,GAA8B,IAAIP,8BAA6CA,+BAA8CA,4BAMnI,MAAMQ,WAAYtjB,GAChB,WAAAP,CAAY5kB,GACVolB,MAAMplB,GACNygB,KAAKoS,QAAUpS,KAAK4E,SAAS5J,QAdN,uCAelBgF,KAAKoS,UAOVpS,KAAKioB,sBAAsBjoB,KAAKoS,QAASpS,KAAKkoB,gBAC9C3nB,GAAac,GAAGrB,KAAK4E,SAAUoiB,IAAe5nB,GAASY,KAAK6M,SAASzN,KACvE,CAGA,eAAW7C,GACT,MAnDW,KAoDb,CAGA,IAAAsT,GAEE,MAAMsY,EAAYnoB,KAAK4E,SACvB,GAAI5E,KAAKooB,cAAcD,GACrB,OAIF,MAAME,EAASroB,KAAKsoB,iBACdC,EAAYF,EAAS9nB,GAAaqB,QAAQymB,EAAQ1B,GAAc,CACpE7mB,cAAeqoB,IACZ,KACa5nB,GAAaqB,QAAQumB,EAAWtB,GAAc,CAC9D/mB,cAAeuoB,IAEHrmB,kBAAoBumB,GAAaA,EAAUvmB,mBAGzDhC,KAAKwoB,YAAYH,EAAQF,GACzBnoB,KAAKyoB,UAAUN,EAAWE,GAC5B,CAGA,SAAAI,CAAUlpC,EAASmpC,GACZnpC,IAGLA,EAAQ8b,UAAU5E,IAAI+wB,IACtBxnB,KAAKyoB,UAAU5iB,GAAec,uBAAuBpnB,IAcrDygB,KAAKmF,gBAZY,KACsB,QAAjC5lB,EAAQic,aAAa,SAIzBjc,EAAQ4B,gBAAgB,YACxB5B,EAAQ6B,aAAa,iBAAiB,GACtC4e,KAAK2oB,gBAAgBppC,GAAS,GAC9BghB,GAAaqB,QAAQriB,EAASunC,GAAe,CAC3ChnB,cAAe4oB,KAPfnpC,EAAQ8b,UAAU5E,IAAIixB,GAQtB,GAE0BnoC,EAASA,EAAQ8b,UAAU7W,SAASijC,KACpE,CACA,WAAAe,CAAYjpC,EAASmpC,GACdnpC,IAGLA,EAAQ8b,UAAU1B,OAAO6tB,IACzBjoC,EAAQq7B,OACR5a,KAAKwoB,YAAY3iB,GAAec,uBAAuBpnB,IAcvDygB,KAAKmF,gBAZY,KACsB,QAAjC5lB,EAAQic,aAAa,SAIzBjc,EAAQ6B,aAAa,iBAAiB,GACtC7B,EAAQ6B,aAAa,WAAY,MACjC4e,KAAK2oB,gBAAgBppC,GAAS,GAC9BghB,GAAaqB,QAAQriB,EAASqnC,GAAgB,CAC5C9mB,cAAe4oB,KAPfnpC,EAAQ8b,UAAU1B,OAAO+tB,GAQzB,GAE0BnoC,EAASA,EAAQ8b,UAAU7W,SAASijC,KACpE,CACA,QAAA5a,CAASzN,GACP,IAAK,CAAC8nB,GAAgBC,GAAiBC,GAAcC,GAAgBC,GAAUC,IAASnmB,SAAShC,EAAMtiB,KACrG,OAEFsiB,EAAM0U,kBACN1U,EAAMkD,iBACN,MAAMyD,EAAW/F,KAAKkoB,eAAe/hC,QAAO5G,IAAY2b,GAAW3b,KACnE,IAAIqpC,EACJ,GAAI,CAACtB,GAAUC,IAASnmB,SAAShC,EAAMtiB,KACrC8rC,EAAoB7iB,EAAS3G,EAAMtiB,MAAQwqC,GAAW,EAAIvhB,EAASrV,OAAS,OACvE,CACL,MAAM8c,EAAS,CAAC2Z,GAAiBE,IAAgBjmB,SAAShC,EAAMtiB,KAChE8rC,EAAoB9qB,GAAqBiI,EAAU3G,EAAM7S,OAAQihB,GAAQ,EAC3E,CACIob,IACFA,EAAkBnW,MAAM,CACtBoW,eAAe,IAEjBb,GAAI1iB,oBAAoBsjB,GAAmB/Y,OAE/C,CACA,YAAAqY,GAEE,OAAOriB,GAAe1T,KAAK21B,GAAqB9nB,KAAKoS,QACvD,CACA,cAAAkW,GACE,OAAOtoB,KAAKkoB,eAAe/1B,MAAKzN,GAASsb,KAAKooB,cAAc1jC,MAAW,IACzE,CACA,qBAAAujC,CAAsBxjC,EAAQshB,GAC5B/F,KAAK8oB,yBAAyBrkC,EAAQ,OAAQ,WAC9C,IAAK,MAAMC,KAASqhB,EAClB/F,KAAK+oB,6BAA6BrkC,EAEtC,CACA,4BAAAqkC,CAA6BrkC,GAC3BA,EAAQsb,KAAKgpB,iBAAiBtkC,GAC9B,MAAMukC,EAAWjpB,KAAKooB,cAAc1jC,GAC9BwkC,EAAYlpB,KAAKmpB,iBAAiBzkC,GACxCA,EAAMtD,aAAa,gBAAiB6nC,GAChCC,IAAcxkC,GAChBsb,KAAK8oB,yBAAyBI,EAAW,OAAQ,gBAE9CD,GACHvkC,EAAMtD,aAAa,WAAY,MAEjC4e,KAAK8oB,yBAAyBpkC,EAAO,OAAQ,OAG7Csb,KAAKopB,mCAAmC1kC,EAC1C,CACA,kCAAA0kC,CAAmC1kC,GACjC,MAAM6H,EAASsZ,GAAec,uBAAuBjiB,GAChD6H,IAGLyT,KAAK8oB,yBAAyBv8B,EAAQ,OAAQ,YAC1C7H,EAAMyV,IACR6F,KAAK8oB,yBAAyBv8B,EAAQ,kBAAmB,GAAG7H,EAAMyV,MAEtE,CACA,eAAAwuB,CAAgBppC,EAAS8pC,GACvB,MAAMH,EAAYlpB,KAAKmpB,iBAAiB5pC,GACxC,IAAK2pC,EAAU7tB,UAAU7W,SApKN,YAqKjB,OAEF,MAAMmjB,EAAS,CAAC5N,EAAUoa,KACxB,MAAM50B,EAAUsmB,GAAeC,QAAQ/L,EAAUmvB,GAC7C3pC,GACFA,EAAQ8b,UAAUsM,OAAOwM,EAAWkV,EACtC,EAEF1hB,EAAOggB,GAA0BH,IACjC7f,EA5K2B,iBA4KI+f,IAC/BwB,EAAU9nC,aAAa,gBAAiBioC,EAC1C,CACA,wBAAAP,CAAyBvpC,EAASwC,EAAWpE,GACtC4B,EAAQgc,aAAaxZ,IACxBxC,EAAQ6B,aAAaW,EAAWpE,EAEpC,CACA,aAAAyqC,CAAc9Y,GACZ,OAAOA,EAAKjU,UAAU7W,SAASgjC,GACjC,CAGA,gBAAAwB,CAAiB1Z,GACf,OAAOA,EAAKtJ,QAAQ8hB,IAAuBxY,EAAOzJ,GAAeC,QAAQgiB,GAAqBxY,EAChG,CAGA,gBAAA6Z,CAAiB7Z,GACf,OAAOA,EAAKtU,QA5LO,gCA4LoBsU,CACzC,CAGA,sBAAO7S,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO29B,GAAI1iB,oBAAoBtF,MACrC,GAAsB,iBAAX8D,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOFvD,GAAac,GAAGhc,SAAU0hC,GAAsBc,IAAsB,SAAUzoB,GAC1E,CAAC,IAAK,QAAQgC,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,OAGfgoB,GAAI1iB,oBAAoBtF,MAAM6P,MAChC,IAKAtP,GAAac,GAAGzhB,OAAQqnC,IAAqB,KAC3C,IAAK,MAAM1nC,KAAWsmB,GAAe1T,KAAK41B,IACxCC,GAAI1iB,oBAAoB/lB,EAC1B,IAMF4c,GAAmB6rB,IAcnB,MAEMhjB,GAAY,YACZskB,GAAkB,YAAYtkB,KAC9BukB,GAAiB,WAAWvkB,KAC5BwkB,GAAgB,UAAUxkB,KAC1BykB,GAAiB,WAAWzkB,KAC5B0kB,GAAa,OAAO1kB,KACpB2kB,GAAe,SAAS3kB,KACxB4kB,GAAa,OAAO5kB,KACpB6kB,GAAc,QAAQ7kB,KAEtB8kB,GAAkB,OAClBC,GAAkB,OAClBC,GAAqB,UACrBrmB,GAAc,CAClByc,UAAW,UACX6J,SAAU,UACV1J,MAAO,UAEH7c,GAAU,CACd0c,WAAW,EACX6J,UAAU,EACV1J,MAAO,KAOT,MAAM2J,WAAcxlB,GAClB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAK4gB,SAAW,KAChB5gB,KAAKmqB,sBAAuB,EAC5BnqB,KAAKoqB,yBAA0B,EAC/BpqB,KAAKkhB,eACP,CAGA,kBAAWxd,GACT,OAAOA,EACT,CACA,sBAAWC,GACT,OAAOA,EACT,CACA,eAAWpH,GACT,MA/CS,OAgDX,CAGA,IAAAsT,GACoBtP,GAAaqB,QAAQ5B,KAAK4E,SAAUglB,IACxC5nB,mBAGdhC,KAAKqqB,gBACDrqB,KAAK6E,QAAQub,WACfpgB,KAAK4E,SAASvJ,UAAU5E,IA/CN,QAsDpBuJ,KAAK4E,SAASvJ,UAAU1B,OAAOmwB,IAC/BjuB,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIszB,GAAiBC,IAC7ChqB,KAAKmF,gBARY,KACfnF,KAAK4E,SAASvJ,UAAU1B,OAAOqwB,IAC/BzpB,GAAaqB,QAAQ5B,KAAK4E,SAAUilB,IACpC7pB,KAAKsqB,oBAAoB,GAKGtqB,KAAK4E,SAAU5E,KAAK6E,QAAQub,WAC5D,CACA,IAAAxQ,GACO5P,KAAKuqB,YAGQhqB,GAAaqB,QAAQ5B,KAAK4E,SAAU8kB,IACxC1nB,mBAQdhC,KAAK4E,SAASvJ,UAAU5E,IAAIuzB,IAC5BhqB,KAAKmF,gBANY,KACfnF,KAAK4E,SAASvJ,UAAU5E,IAAIqzB,IAC5B9pB,KAAK4E,SAASvJ,UAAU1B,OAAOqwB,GAAoBD,IACnDxpB,GAAaqB,QAAQ5B,KAAK4E,SAAU+kB,GAAa,GAGrB3pB,KAAK4E,SAAU5E,KAAK6E,QAAQub,YAC5D,CACA,OAAArb,GACE/E,KAAKqqB,gBACDrqB,KAAKuqB,WACPvqB,KAAK4E,SAASvJ,UAAU1B,OAAOowB,IAEjCplB,MAAMI,SACR,CACA,OAAAwlB,GACE,OAAOvqB,KAAK4E,SAASvJ,UAAU7W,SAASulC,GAC1C,CAIA,kBAAAO,GACOtqB,KAAK6E,QAAQolB,WAGdjqB,KAAKmqB,sBAAwBnqB,KAAKoqB,0BAGtCpqB,KAAK4gB,SAAW/iB,YAAW,KACzBmC,KAAK4P,MAAM,GACV5P,KAAK6E,QAAQ0b,QAClB,CACA,cAAAiK,CAAeprB,EAAOqrB,GACpB,OAAQrrB,EAAMqB,MACZ,IAAK,YACL,IAAK,WAEDT,KAAKmqB,qBAAuBM,EAC5B,MAEJ,IAAK,UACL,IAAK,WAEDzqB,KAAKoqB,wBAA0BK,EAIrC,GAAIA,EAEF,YADAzqB,KAAKqqB,gBAGP,MAAM5c,EAAcrO,EAAMU,cACtBE,KAAK4E,WAAa6I,GAAezN,KAAK4E,SAASpgB,SAASipB,IAG5DzN,KAAKsqB,oBACP,CACA,aAAApJ,GACE3gB,GAAac,GAAGrB,KAAK4E,SAAU0kB,IAAiBlqB,GAASY,KAAKwqB,eAAeprB,GAAO,KACpFmB,GAAac,GAAGrB,KAAK4E,SAAU2kB,IAAgBnqB,GAASY,KAAKwqB,eAAeprB,GAAO,KACnFmB,GAAac,GAAGrB,KAAK4E,SAAU4kB,IAAepqB,GAASY,KAAKwqB,eAAeprB,GAAO,KAClFmB,GAAac,GAAGrB,KAAK4E,SAAU6kB,IAAgBrqB,GAASY,KAAKwqB,eAAeprB,GAAO,IACrF,CACA,aAAAirB,GACEnd,aAAalN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW,IAClB,CAGA,sBAAOnkB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO6/B,GAAM5kB,oBAAoBtF,KAAM8D,GAC7C,GAAsB,iBAAXA,EAAqB,CAC9B,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KACf,CACF,GACF,ECr0IK,SAAS0qB,GAAcruB,GACD,WAAvBhX,SAASuX,WAAyBP,IACjChX,SAASyF,iBAAiB,mBAAoBuR,EACrD,CDy0IAwK,GAAqBqjB,IAMrB/tB,GAAmB+tB,IEpyInBQ,IAzCA,WAC2B,GAAGt4B,MAAM5U,KAChC6H,SAAS+a,iBAAiB,+BAETtd,KAAI,SAAU6nC,GAC/B,OAAO,IAAI,GAAkBA,EAAkB,CAC7CpK,MAAO,CAAE1Q,KAAM,IAAKD,KAAM,MAE9B,GACF,IAiCA8a,IA5BA,WACYrlC,SAASm9B,eAAe,mBAC9B13B,iBAAiB,SAAS,WAC5BzF,SAAS6G,KAAKT,UAAY,EAC1BpG,SAASC,gBAAgBmG,UAAY,CACvC,GACF,IAuBAi/B,IArBA,WACE,IAAIE,EAAMvlC,SAASm9B,eAAe,mBAC9BqI,EAASxlC,SACVylC,uBAAuB,aAAa,GACpCxnC,wBACH1D,OAAOkL,iBAAiB,UAAU,WAC5BkV,KAAK+qB,UAAY/qB,KAAKgrB,SAAWhrB,KAAKgrB,QAAUH,EAAOjtC,OACzDgtC,EAAI7pC,MAAMgxB,QAAU,QAEpB6Y,EAAI7pC,MAAMgxB,QAAU,OAEtB/R,KAAK+qB,UAAY/qB,KAAKgrB,OACxB,GACF,IAUAprC,OAAOqrC,UAAY","sources":["webpack://pydata_sphinx_theme/webpack/bootstrap","webpack://pydata_sphinx_theme/webpack/runtime/define property getters","webpack://pydata_sphinx_theme/webpack/runtime/hasOwnProperty shorthand","webpack://pydata_sphinx_theme/webpack/runtime/make namespace object","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/enums.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/instanceOf.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/applyStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getBasePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/math.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/userAgent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isLayoutViewport.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getBoundingClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getLayoutRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/contains.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getComputedStyle.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isTableElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getParentNode.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getOffsetParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getMainAxisFromPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/within.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergePaddingObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getFreshSideObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/expandToHashMap.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/arrow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getVariation.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/computeStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/eventListeners.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositeVariationPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScrollBarX.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/listScrollParents.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/rectToClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getClippingRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getViewportRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/detectOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/flip.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeAutoPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/hide.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/offset.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/popperOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/preventOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getAltAxis.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getCompositeRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getHTMLElementScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/orderModifiers.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/createPopper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/debounce.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergeByName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper-lite.js","webpack://pydata_sphinx_theme/./node_modules/bootstrap/dist/js/bootstrap.esm.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/mixin.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/bootstrap.js"],"sourcesContent":["// The require scope\nvar __webpack_require__ = {};\n\n","// define getter functions for harmony exports\n__webpack_require__.d = (exports, definition) => {\n\tfor(var key in definition) {\n\t\tif(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {\n\t\t\tObject.defineProperty(exports, key, { enumerable: true, get: definition[key] });\n\t\t}\n\t}\n};","__webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))","// define __esModule on exports\n__webpack_require__.r = (exports) => {\n\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n\t}\n\tObject.defineProperty(exports, '__esModule', { value: true });\n};","export var top = 'top';\nexport var bottom = 'bottom';\nexport var right = 'right';\nexport var left = 'left';\nexport var auto = 'auto';\nexport var basePlacements = [top, bottom, right, left];\nexport var start = 'start';\nexport var end = 'end';\nexport var clippingParents = 'clippingParents';\nexport var viewport = 'viewport';\nexport var popper = 'popper';\nexport var reference = 'reference';\nexport var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {\n return acc.concat([placement + \"-\" + start, placement + \"-\" + end]);\n}, []);\nexport var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {\n return acc.concat([placement, placement + \"-\" + start, placement + \"-\" + end]);\n}, []); // modifiers that need to read the DOM\n\nexport var beforeRead = 'beforeRead';\nexport var read = 'read';\nexport var afterRead = 'afterRead'; // pure-logic modifiers\n\nexport var beforeMain = 'beforeMain';\nexport var main = 'main';\nexport var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)\n\nexport var beforeWrite = 'beforeWrite';\nexport var write = 'write';\nexport var afterWrite = 'afterWrite';\nexport var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];","export default function getNodeName(element) {\n return element ? (element.nodeName || '').toLowerCase() : null;\n}","export default function getWindow(node) {\n if (node == null) {\n return window;\n }\n\n if (node.toString() !== '[object Window]') {\n var ownerDocument = node.ownerDocument;\n return ownerDocument ? ownerDocument.defaultView || window : window;\n }\n\n return node;\n}","import getWindow from \"./getWindow.js\";\n\nfunction isElement(node) {\n var OwnElement = getWindow(node).Element;\n return node instanceof OwnElement || node instanceof Element;\n}\n\nfunction isHTMLElement(node) {\n var OwnElement = getWindow(node).HTMLElement;\n return node instanceof OwnElement || node instanceof HTMLElement;\n}\n\nfunction isShadowRoot(node) {\n // IE 11 has no ShadowRoot\n if (typeof ShadowRoot === 'undefined') {\n return false;\n }\n\n var OwnElement = getWindow(node).ShadowRoot;\n return node instanceof OwnElement || node instanceof ShadowRoot;\n}\n\nexport { isElement, isHTMLElement, isShadowRoot };","import getNodeName from \"../dom-utils/getNodeName.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // This modifier takes the styles prepared by the `computeStyles` modifier\n// and applies them to the HTMLElements such as popper and arrow\n\nfunction applyStyles(_ref) {\n var state = _ref.state;\n Object.keys(state.elements).forEach(function (name) {\n var style = state.styles[name] || {};\n var attributes = state.attributes[name] || {};\n var element = state.elements[name]; // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n } // Flow doesn't support to extend this property, but it's the most\n // effective way to apply styles to an HTMLElement\n // $FlowFixMe[cannot-write]\n\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (name) {\n var value = attributes[name];\n\n if (value === false) {\n element.removeAttribute(name);\n } else {\n element.setAttribute(name, value === true ? '' : value);\n }\n });\n });\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state;\n var initialStyles = {\n popper: {\n position: state.options.strategy,\n left: '0',\n top: '0',\n margin: '0'\n },\n arrow: {\n position: 'absolute'\n },\n reference: {}\n };\n Object.assign(state.elements.popper.style, initialStyles.popper);\n state.styles = initialStyles;\n\n if (state.elements.arrow) {\n Object.assign(state.elements.arrow.style, initialStyles.arrow);\n }\n\n return function () {\n Object.keys(state.elements).forEach(function (name) {\n var element = state.elements[name];\n var attributes = state.attributes[name] || {};\n var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them\n\n var style = styleProperties.reduce(function (style, property) {\n style[property] = '';\n return style;\n }, {}); // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n }\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (attribute) {\n element.removeAttribute(attribute);\n });\n });\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'applyStyles',\n enabled: true,\n phase: 'write',\n fn: applyStyles,\n effect: effect,\n requires: ['computeStyles']\n};","import { auto } from \"../enums.js\";\nexport default function getBasePlacement(placement) {\n return placement.split('-')[0];\n}","export var max = Math.max;\nexport var min = Math.min;\nexport var round = Math.round;","export default function getUAString() {\n var uaData = navigator.userAgentData;\n\n if (uaData != null && uaData.brands && Array.isArray(uaData.brands)) {\n return uaData.brands.map(function (item) {\n return item.brand + \"/\" + item.version;\n }).join(' ');\n }\n\n return navigator.userAgent;\n}","import getUAString from \"../utils/userAgent.js\";\nexport default function isLayoutViewport() {\n return !/^((?!chrome|android).)*safari/i.test(getUAString());\n}","import { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport { round } from \"../utils/math.js\";\nimport getWindow from \"./getWindow.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getBoundingClientRect(element, includeScale, isFixedStrategy) {\n if (includeScale === void 0) {\n includeScale = false;\n }\n\n if (isFixedStrategy === void 0) {\n isFixedStrategy = false;\n }\n\n var clientRect = element.getBoundingClientRect();\n var scaleX = 1;\n var scaleY = 1;\n\n if (includeScale && isHTMLElement(element)) {\n scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1;\n scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1;\n }\n\n var _ref = isElement(element) ? getWindow(element) : window,\n visualViewport = _ref.visualViewport;\n\n var addVisualOffsets = !isLayoutViewport() && isFixedStrategy;\n var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX;\n var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY;\n var width = clientRect.width / scaleX;\n var height = clientRect.height / scaleY;\n return {\n width: width,\n height: height,\n top: y,\n right: x + width,\n bottom: y + height,\n left: x,\n x: x,\n y: y\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\"; // Returns the layout rect of an element relative to its offsetParent. Layout\n// means it doesn't take into account transforms.\n\nexport default function getLayoutRect(element) {\n var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.\n // Fixes https://github.com/popperjs/popper-core/issues/1223\n\n var width = element.offsetWidth;\n var height = element.offsetHeight;\n\n if (Math.abs(clientRect.width - width) <= 1) {\n width = clientRect.width;\n }\n\n if (Math.abs(clientRect.height - height) <= 1) {\n height = clientRect.height;\n }\n\n return {\n x: element.offsetLeft,\n y: element.offsetTop,\n width: width,\n height: height\n };\n}","import { isShadowRoot } from \"./instanceOf.js\";\nexport default function contains(parent, child) {\n var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method\n\n if (parent.contains(child)) {\n return true;\n } // then fallback to custom implementation with Shadow DOM support\n else if (rootNode && isShadowRoot(rootNode)) {\n var next = child;\n\n do {\n if (next && parent.isSameNode(next)) {\n return true;\n } // $FlowFixMe[prop-missing]: need a better way to handle this...\n\n\n next = next.parentNode || next.host;\n } while (next);\n } // Give up, the result is false\n\n\n return false;\n}","import getWindow from \"./getWindow.js\";\nexport default function getComputedStyle(element) {\n return getWindow(element).getComputedStyle(element);\n}","import getNodeName from \"./getNodeName.js\";\nexport default function isTableElement(element) {\n return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;\n}","import { isElement } from \"./instanceOf.js\";\nexport default function getDocumentElement(element) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]\n element.document) || window.document).documentElement;\n}","import getNodeName from \"./getNodeName.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport { isShadowRoot } from \"./instanceOf.js\";\nexport default function getParentNode(element) {\n if (getNodeName(element) === 'html') {\n return element;\n }\n\n return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle\n // $FlowFixMe[incompatible-return]\n // $FlowFixMe[prop-missing]\n element.assignedSlot || // step into the shadow DOM of the parent of a slotted node\n element.parentNode || ( // DOM Element detected\n isShadowRoot(element) ? element.host : null) || // ShadowRoot detected\n // $FlowFixMe[incompatible-call]: HTMLElement is a Node\n getDocumentElement(element) // fallback\n\n );\n}","import getWindow from \"./getWindow.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isHTMLElement, isShadowRoot } from \"./instanceOf.js\";\nimport isTableElement from \"./isTableElement.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getUAString from \"../utils/userAgent.js\";\n\nfunction getTrueOffsetParent(element) {\n if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837\n getComputedStyle(element).position === 'fixed') {\n return null;\n }\n\n return element.offsetParent;\n} // `.offsetParent` reports `null` for fixed elements, while absolute elements\n// return the containing block\n\n\nfunction getContainingBlock(element) {\n var isFirefox = /firefox/i.test(getUAString());\n var isIE = /Trident/i.test(getUAString());\n\n if (isIE && isHTMLElement(element)) {\n // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport\n var elementCss = getComputedStyle(element);\n\n if (elementCss.position === 'fixed') {\n return null;\n }\n }\n\n var currentNode = getParentNode(element);\n\n if (isShadowRoot(currentNode)) {\n currentNode = currentNode.host;\n }\n\n while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {\n var css = getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that\n // create a containing block.\n // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n\n if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {\n return currentNode;\n } else {\n currentNode = currentNode.parentNode;\n }\n }\n\n return null;\n} // Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\n\n\nexport default function getOffsetParent(element) {\n var window = getWindow(element);\n var offsetParent = getTrueOffsetParent(element);\n\n while (offsetParent && isTableElement(offsetParent) && getComputedStyle(offsetParent).position === 'static') {\n offsetParent = getTrueOffsetParent(offsetParent);\n }\n\n if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static')) {\n return window;\n }\n\n return offsetParent || getContainingBlock(element) || window;\n}","export default function getMainAxisFromPlacement(placement) {\n return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';\n}","import { max as mathMax, min as mathMin } from \"./math.js\";\nexport function within(min, value, max) {\n return mathMax(min, mathMin(value, max));\n}\nexport function withinMaxClamp(min, value, max) {\n var v = within(min, value, max);\n return v > max ? max : v;\n}","import getFreshSideObject from \"./getFreshSideObject.js\";\nexport default function mergePaddingObject(paddingObject) {\n return Object.assign({}, getFreshSideObject(), paddingObject);\n}","export default function getFreshSideObject() {\n return {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n };\n}","export default function expandToHashMap(value, keys) {\n return keys.reduce(function (hashMap, key) {\n hashMap[key] = value;\n return hashMap;\n }, {});\n}","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport contains from \"../dom-utils/contains.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport { within } from \"../utils/within.js\";\nimport mergePaddingObject from \"../utils/mergePaddingObject.js\";\nimport expandToHashMap from \"../utils/expandToHashMap.js\";\nimport { left, right, basePlacements, top, bottom } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar toPaddingObject = function toPaddingObject(padding, state) {\n padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {\n placement: state.placement\n })) : padding;\n return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n};\n\nfunction arrow(_ref) {\n var _state$modifiersData$;\n\n var state = _ref.state,\n name = _ref.name,\n options = _ref.options;\n var arrowElement = state.elements.arrow;\n var popperOffsets = state.modifiersData.popperOffsets;\n var basePlacement = getBasePlacement(state.placement);\n var axis = getMainAxisFromPlacement(basePlacement);\n var isVertical = [left, right].indexOf(basePlacement) >= 0;\n var len = isVertical ? 'height' : 'width';\n\n if (!arrowElement || !popperOffsets) {\n return;\n }\n\n var paddingObject = toPaddingObject(options.padding, state);\n var arrowRect = getLayoutRect(arrowElement);\n var minProp = axis === 'y' ? top : left;\n var maxProp = axis === 'y' ? bottom : right;\n var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];\n var startDiff = popperOffsets[axis] - state.rects.reference[axis];\n var arrowOffsetParent = getOffsetParent(arrowElement);\n var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;\n var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is\n // outside of the popper bounds\n\n var min = paddingObject[minProp];\n var max = clientSize - arrowRect[len] - paddingObject[maxProp];\n var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;\n var offset = within(min, center, max); // Prevents breaking syntax highlighting...\n\n var axisProp = axis;\n state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state,\n options = _ref2.options;\n var _options$element = options.element,\n arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;\n\n if (arrowElement == null) {\n return;\n } // CSS selector\n\n\n if (typeof arrowElement === 'string') {\n arrowElement = state.elements.popper.querySelector(arrowElement);\n\n if (!arrowElement) {\n return;\n }\n }\n\n if (!contains(state.elements.popper, arrowElement)) {\n return;\n }\n\n state.elements.arrow = arrowElement;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'arrow',\n enabled: true,\n phase: 'main',\n fn: arrow,\n effect: effect,\n requires: ['popperOffsets'],\n requiresIfExists: ['preventOverflow']\n};","export default function getVariation(placement) {\n return placement.split('-')[1];\n}","import { top, left, right, bottom, end } from \"../enums.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getWindow from \"../dom-utils/getWindow.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getComputedStyle from \"../dom-utils/getComputedStyle.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport { round } from \"../utils/math.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar unsetSides = {\n top: 'auto',\n right: 'auto',\n bottom: 'auto',\n left: 'auto'\n}; // Round the offsets to the nearest suitable subpixel based on the DPR.\n// Zooming can change the DPR, but it seems to report a value that will\n// cleanly divide the values into the appropriate subpixels.\n\nfunction roundOffsetsByDPR(_ref, win) {\n var x = _ref.x,\n y = _ref.y;\n var dpr = win.devicePixelRatio || 1;\n return {\n x: round(x * dpr) / dpr || 0,\n y: round(y * dpr) / dpr || 0\n };\n}\n\nexport function mapToStyles(_ref2) {\n var _Object$assign2;\n\n var popper = _ref2.popper,\n popperRect = _ref2.popperRect,\n placement = _ref2.placement,\n variation = _ref2.variation,\n offsets = _ref2.offsets,\n position = _ref2.position,\n gpuAcceleration = _ref2.gpuAcceleration,\n adaptive = _ref2.adaptive,\n roundOffsets = _ref2.roundOffsets,\n isFixed = _ref2.isFixed;\n var _offsets$x = offsets.x,\n x = _offsets$x === void 0 ? 0 : _offsets$x,\n _offsets$y = offsets.y,\n y = _offsets$y === void 0 ? 0 : _offsets$y;\n\n var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({\n x: x,\n y: y\n }) : {\n x: x,\n y: y\n };\n\n x = _ref3.x;\n y = _ref3.y;\n var hasX = offsets.hasOwnProperty('x');\n var hasY = offsets.hasOwnProperty('y');\n var sideX = left;\n var sideY = top;\n var win = window;\n\n if (adaptive) {\n var offsetParent = getOffsetParent(popper);\n var heightProp = 'clientHeight';\n var widthProp = 'clientWidth';\n\n if (offsetParent === getWindow(popper)) {\n offsetParent = getDocumentElement(popper);\n\n if (getComputedStyle(offsetParent).position !== 'static' && position === 'absolute') {\n heightProp = 'scrollHeight';\n widthProp = 'scrollWidth';\n }\n } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it\n\n\n offsetParent = offsetParent;\n\n if (placement === top || (placement === left || placement === right) && variation === end) {\n sideY = bottom;\n var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]\n offsetParent[heightProp];\n y -= offsetY - popperRect.height;\n y *= gpuAcceleration ? 1 : -1;\n }\n\n if (placement === left || (placement === top || placement === bottom) && variation === end) {\n sideX = right;\n var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]\n offsetParent[widthProp];\n x -= offsetX - popperRect.width;\n x *= gpuAcceleration ? 1 : -1;\n }\n }\n\n var commonStyles = Object.assign({\n position: position\n }, adaptive && unsetSides);\n\n var _ref4 = roundOffsets === true ? roundOffsetsByDPR({\n x: x,\n y: y\n }, getWindow(popper)) : {\n x: x,\n y: y\n };\n\n x = _ref4.x;\n y = _ref4.y;\n\n if (gpuAcceleration) {\n var _Object$assign;\n\n return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? \"translate(\" + x + \"px, \" + y + \"px)\" : \"translate3d(\" + x + \"px, \" + y + \"px, 0)\", _Object$assign));\n }\n\n return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + \"px\" : '', _Object$assign2[sideX] = hasX ? x + \"px\" : '', _Object$assign2.transform = '', _Object$assign2));\n}\n\nfunction computeStyles(_ref5) {\n var state = _ref5.state,\n options = _ref5.options;\n var _options$gpuAccelerat = options.gpuAcceleration,\n gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,\n _options$adaptive = options.adaptive,\n adaptive = _options$adaptive === void 0 ? true : _options$adaptive,\n _options$roundOffsets = options.roundOffsets,\n roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;\n var commonStyles = {\n placement: getBasePlacement(state.placement),\n variation: getVariation(state.placement),\n popper: state.elements.popper,\n popperRect: state.rects.popper,\n gpuAcceleration: gpuAcceleration,\n isFixed: state.options.strategy === 'fixed'\n };\n\n if (state.modifiersData.popperOffsets != null) {\n state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.popperOffsets,\n position: state.options.strategy,\n adaptive: adaptive,\n roundOffsets: roundOffsets\n })));\n }\n\n if (state.modifiersData.arrow != null) {\n state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.arrow,\n position: 'absolute',\n adaptive: false,\n roundOffsets: roundOffsets\n })));\n }\n\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-placement': state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'computeStyles',\n enabled: true,\n phase: 'beforeWrite',\n fn: computeStyles,\n data: {}\n};","import getWindow from \"../dom-utils/getWindow.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar passive = {\n passive: true\n};\n\nfunction effect(_ref) {\n var state = _ref.state,\n instance = _ref.instance,\n options = _ref.options;\n var _options$scroll = options.scroll,\n scroll = _options$scroll === void 0 ? true : _options$scroll,\n _options$resize = options.resize,\n resize = _options$resize === void 0 ? true : _options$resize;\n var window = getWindow(state.elements.popper);\n var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);\n\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.addEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.addEventListener('resize', instance.update, passive);\n }\n\n return function () {\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.removeEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.removeEventListener('resize', instance.update, passive);\n }\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'eventListeners',\n enabled: true,\n phase: 'write',\n fn: function fn() {},\n effect: effect,\n data: {}\n};","var hash = {\n left: 'right',\n right: 'left',\n bottom: 'top',\n top: 'bottom'\n};\nexport default function getOppositePlacement(placement) {\n return placement.replace(/left|right|bottom|top/g, function (matched) {\n return hash[matched];\n });\n}","var hash = {\n start: 'end',\n end: 'start'\n};\nexport default function getOppositeVariationPlacement(placement) {\n return placement.replace(/start|end/g, function (matched) {\n return hash[matched];\n });\n}","import getWindow from \"./getWindow.js\";\nexport default function getWindowScroll(node) {\n var win = getWindow(node);\n var scrollLeft = win.pageXOffset;\n var scrollTop = win.pageYOffset;\n return {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nexport default function getWindowScrollBarX(element) {\n // If has a CSS width greater than the viewport, then this will be\n // incorrect for RTL.\n // Popper 1 is broken in this case and never had a bug report so let's assume\n // it's not an issue. I don't think anyone ever specifies width on \n // anyway.\n // Browsers where the left scrollbar doesn't cause an issue report `0` for\n // this (e.g. Edge 2019, IE11, Safari)\n return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;\n}","import getComputedStyle from \"./getComputedStyle.js\";\nexport default function isScrollParent(element) {\n // Firefox wants us to check `-x` and `-y` variations as well\n var _getComputedStyle = getComputedStyle(element),\n overflow = _getComputedStyle.overflow,\n overflowX = _getComputedStyle.overflowX,\n overflowY = _getComputedStyle.overflowY;\n\n return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);\n}","import getParentNode from \"./getParentNode.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nexport default function getScrollParent(node) {\n if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return node.ownerDocument.body;\n }\n\n if (isHTMLElement(node) && isScrollParent(node)) {\n return node;\n }\n\n return getScrollParent(getParentNode(node));\n}","import getScrollParent from \"./getScrollParent.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getWindow from \"./getWindow.js\";\nimport isScrollParent from \"./isScrollParent.js\";\n/*\ngiven a DOM element, return the list of all scroll parents, up the list of ancesors\nuntil we get to the top window object. This list is what we attach scroll listeners\nto, because if any of these parent elements scroll, we'll need to re-calculate the\nreference element's position.\n*/\n\nexport default function listScrollParents(element, list) {\n var _element$ownerDocumen;\n\n if (list === void 0) {\n list = [];\n }\n\n var scrollParent = getScrollParent(element);\n var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);\n var win = getWindow(scrollParent);\n var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;\n var updatedList = list.concat(target);\n return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here\n updatedList.concat(listScrollParents(getParentNode(target)));\n}","export default function rectToClientRect(rect) {\n return Object.assign({}, rect, {\n left: rect.x,\n top: rect.y,\n right: rect.x + rect.width,\n bottom: rect.y + rect.height\n });\n}","import { viewport } from \"../enums.js\";\nimport getViewportRect from \"./getViewportRect.js\";\nimport getDocumentRect from \"./getDocumentRect.js\";\nimport listScrollParents from \"./listScrollParents.js\";\nimport getOffsetParent from \"./getOffsetParent.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport contains from \"./contains.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport rectToClientRect from \"../utils/rectToClientRect.js\";\nimport { max, min } from \"../utils/math.js\";\n\nfunction getInnerBoundingClientRect(element, strategy) {\n var rect = getBoundingClientRect(element, false, strategy === 'fixed');\n rect.top = rect.top + element.clientTop;\n rect.left = rect.left + element.clientLeft;\n rect.bottom = rect.top + element.clientHeight;\n rect.right = rect.left + element.clientWidth;\n rect.width = element.clientWidth;\n rect.height = element.clientHeight;\n rect.x = rect.left;\n rect.y = rect.top;\n return rect;\n}\n\nfunction getClientRectFromMixedType(element, clippingParent, strategy) {\n return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element)));\n} // A \"clipping parent\" is an overflowable container with the characteristic of\n// clipping (or hiding) overflowing elements with a position different from\n// `initial`\n\n\nfunction getClippingParents(element) {\n var clippingParents = listScrollParents(getParentNode(element));\n var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle(element).position) >= 0;\n var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element;\n\n if (!isElement(clipperElement)) {\n return [];\n } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414\n\n\n return clippingParents.filter(function (clippingParent) {\n return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';\n });\n} // Gets the maximum area that the element is visible in due to any number of\n// clipping parents\n\n\nexport default function getClippingRect(element, boundary, rootBoundary, strategy) {\n var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);\n var clippingParents = [].concat(mainClippingParents, [rootBoundary]);\n var firstClippingParent = clippingParents[0];\n var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {\n var rect = getClientRectFromMixedType(element, clippingParent, strategy);\n accRect.top = max(rect.top, accRect.top);\n accRect.right = min(rect.right, accRect.right);\n accRect.bottom = min(rect.bottom, accRect.bottom);\n accRect.left = max(rect.left, accRect.left);\n return accRect;\n }, getClientRectFromMixedType(element, firstClippingParent, strategy));\n clippingRect.width = clippingRect.right - clippingRect.left;\n clippingRect.height = clippingRect.bottom - clippingRect.top;\n clippingRect.x = clippingRect.left;\n clippingRect.y = clippingRect.top;\n return clippingRect;\n}","import getWindow from \"./getWindow.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getViewportRect(element, strategy) {\n var win = getWindow(element);\n var html = getDocumentElement(element);\n var visualViewport = win.visualViewport;\n var width = html.clientWidth;\n var height = html.clientHeight;\n var x = 0;\n var y = 0;\n\n if (visualViewport) {\n width = visualViewport.width;\n height = visualViewport.height;\n var layoutViewport = isLayoutViewport();\n\n if (layoutViewport || !layoutViewport && strategy === 'fixed') {\n x = visualViewport.offsetLeft;\n y = visualViewport.offsetTop;\n }\n }\n\n return {\n width: width,\n height: height,\n x: x + getWindowScrollBarX(element),\n y: y\n };\n}","import getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nimport { max } from \"../utils/math.js\"; // Gets the entire size of the scrollable document area, even extending outside\n// of the `` and `` rect bounds if horizontally scrollable\n\nexport default function getDocumentRect(element) {\n var _element$ownerDocumen;\n\n var html = getDocumentElement(element);\n var winScroll = getWindowScroll(element);\n var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;\n var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);\n var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);\n var x = -winScroll.scrollLeft + getWindowScrollBarX(element);\n var y = -winScroll.scrollTop;\n\n if (getComputedStyle(body || html).direction === 'rtl') {\n x += max(html.clientWidth, body ? body.clientWidth : 0) - width;\n }\n\n return {\n width: width,\n height: height,\n x: x,\n y: y\n };\n}","import getBasePlacement from \"./getBasePlacement.js\";\nimport getVariation from \"./getVariation.js\";\nimport getMainAxisFromPlacement from \"./getMainAxisFromPlacement.js\";\nimport { top, right, bottom, left, start, end } from \"../enums.js\";\nexport default function computeOffsets(_ref) {\n var reference = _ref.reference,\n element = _ref.element,\n placement = _ref.placement;\n var basePlacement = placement ? getBasePlacement(placement) : null;\n var variation = placement ? getVariation(placement) : null;\n var commonX = reference.x + reference.width / 2 - element.width / 2;\n var commonY = reference.y + reference.height / 2 - element.height / 2;\n var offsets;\n\n switch (basePlacement) {\n case top:\n offsets = {\n x: commonX,\n y: reference.y - element.height\n };\n break;\n\n case bottom:\n offsets = {\n x: commonX,\n y: reference.y + reference.height\n };\n break;\n\n case right:\n offsets = {\n x: reference.x + reference.width,\n y: commonY\n };\n break;\n\n case left:\n offsets = {\n x: reference.x - element.width,\n y: commonY\n };\n break;\n\n default:\n offsets = {\n x: reference.x,\n y: reference.y\n };\n }\n\n var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;\n\n if (mainAxis != null) {\n var len = mainAxis === 'y' ? 'height' : 'width';\n\n switch (variation) {\n case start:\n offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);\n break;\n\n case end:\n offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);\n break;\n\n default:\n }\n }\n\n return offsets;\n}","import getClippingRect from \"../dom-utils/getClippingRect.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getBoundingClientRect from \"../dom-utils/getBoundingClientRect.js\";\nimport computeOffsets from \"./computeOffsets.js\";\nimport rectToClientRect from \"./rectToClientRect.js\";\nimport { clippingParents, reference, popper, bottom, top, right, basePlacements, viewport } from \"../enums.js\";\nimport { isElement } from \"../dom-utils/instanceOf.js\";\nimport mergePaddingObject from \"./mergePaddingObject.js\";\nimport expandToHashMap from \"./expandToHashMap.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport default function detectOverflow(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n _options$placement = _options.placement,\n placement = _options$placement === void 0 ? state.placement : _options$placement,\n _options$strategy = _options.strategy,\n strategy = _options$strategy === void 0 ? state.strategy : _options$strategy,\n _options$boundary = _options.boundary,\n boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,\n _options$rootBoundary = _options.rootBoundary,\n rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,\n _options$elementConte = _options.elementContext,\n elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,\n _options$altBoundary = _options.altBoundary,\n altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,\n _options$padding = _options.padding,\n padding = _options$padding === void 0 ? 0 : _options$padding;\n var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n var altContext = elementContext === popper ? reference : popper;\n var popperRect = state.rects.popper;\n var element = state.elements[altBoundary ? altContext : elementContext];\n var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy);\n var referenceClientRect = getBoundingClientRect(state.elements.reference);\n var popperOffsets = computeOffsets({\n reference: referenceClientRect,\n element: popperRect,\n strategy: 'absolute',\n placement: placement\n });\n var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));\n var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect\n // 0 or negative = within the clipping rect\n\n var overflowOffsets = {\n top: clippingClientRect.top - elementClientRect.top + paddingObject.top,\n bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,\n left: clippingClientRect.left - elementClientRect.left + paddingObject.left,\n right: elementClientRect.right - clippingClientRect.right + paddingObject.right\n };\n var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element\n\n if (elementContext === popper && offsetData) {\n var offset = offsetData[placement];\n Object.keys(overflowOffsets).forEach(function (key) {\n var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;\n var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';\n overflowOffsets[key] += offset[axis] * multiply;\n });\n }\n\n return overflowOffsets;\n}","import getOppositePlacement from \"../utils/getOppositePlacement.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getOppositeVariationPlacement from \"../utils/getOppositeVariationPlacement.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport computeAutoPlacement from \"../utils/computeAutoPlacement.js\";\nimport { bottom, top, start, right, left, auto } from \"../enums.js\";\nimport getVariation from \"../utils/getVariation.js\"; // eslint-disable-next-line import/no-unused-modules\n\nfunction getExpandedFallbackPlacements(placement) {\n if (getBasePlacement(placement) === auto) {\n return [];\n }\n\n var oppositePlacement = getOppositePlacement(placement);\n return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];\n}\n\nfunction flip(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n\n if (state.modifiersData[name]._skip) {\n return;\n }\n\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,\n specifiedFallbackPlacements = options.fallbackPlacements,\n padding = options.padding,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n _options$flipVariatio = options.flipVariations,\n flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,\n allowedAutoPlacements = options.allowedAutoPlacements;\n var preferredPlacement = state.options.placement;\n var basePlacement = getBasePlacement(preferredPlacement);\n var isBasePlacement = basePlacement === preferredPlacement;\n var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));\n var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {\n return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n flipVariations: flipVariations,\n allowedAutoPlacements: allowedAutoPlacements\n }) : placement);\n }, []);\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var checksMap = new Map();\n var makeFallbackChecks = true;\n var firstFittingPlacement = placements[0];\n\n for (var i = 0; i < placements.length; i++) {\n var placement = placements[i];\n\n var _basePlacement = getBasePlacement(placement);\n\n var isStartVariation = getVariation(placement) === start;\n var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;\n var len = isVertical ? 'width' : 'height';\n var overflow = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n altBoundary: altBoundary,\n padding: padding\n });\n var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;\n\n if (referenceRect[len] > popperRect[len]) {\n mainVariationSide = getOppositePlacement(mainVariationSide);\n }\n\n var altVariationSide = getOppositePlacement(mainVariationSide);\n var checks = [];\n\n if (checkMainAxis) {\n checks.push(overflow[_basePlacement] <= 0);\n }\n\n if (checkAltAxis) {\n checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);\n }\n\n if (checks.every(function (check) {\n return check;\n })) {\n firstFittingPlacement = placement;\n makeFallbackChecks = false;\n break;\n }\n\n checksMap.set(placement, checks);\n }\n\n if (makeFallbackChecks) {\n // `2` may be desired in some cases – research later\n var numberOfChecks = flipVariations ? 3 : 1;\n\n var _loop = function _loop(_i) {\n var fittingPlacement = placements.find(function (placement) {\n var checks = checksMap.get(placement);\n\n if (checks) {\n return checks.slice(0, _i).every(function (check) {\n return check;\n });\n }\n });\n\n if (fittingPlacement) {\n firstFittingPlacement = fittingPlacement;\n return \"break\";\n }\n };\n\n for (var _i = numberOfChecks; _i > 0; _i--) {\n var _ret = _loop(_i);\n\n if (_ret === \"break\") break;\n }\n }\n\n if (state.placement !== firstFittingPlacement) {\n state.modifiersData[name]._skip = true;\n state.placement = firstFittingPlacement;\n state.reset = true;\n }\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'flip',\n enabled: true,\n phase: 'main',\n fn: flip,\n requiresIfExists: ['offset'],\n data: {\n _skip: false\n }\n};","import getVariation from \"./getVariation.js\";\nimport { variationPlacements, basePlacements, placements as allPlacements } from \"../enums.js\";\nimport detectOverflow from \"./detectOverflow.js\";\nimport getBasePlacement from \"./getBasePlacement.js\";\nexport default function computeAutoPlacement(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n placement = _options.placement,\n boundary = _options.boundary,\n rootBoundary = _options.rootBoundary,\n padding = _options.padding,\n flipVariations = _options.flipVariations,\n _options$allowedAutoP = _options.allowedAutoPlacements,\n allowedAutoPlacements = _options$allowedAutoP === void 0 ? allPlacements : _options$allowedAutoP;\n var variation = getVariation(placement);\n var placements = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {\n return getVariation(placement) === variation;\n }) : basePlacements;\n var allowedPlacements = placements.filter(function (placement) {\n return allowedAutoPlacements.indexOf(placement) >= 0;\n });\n\n if (allowedPlacements.length === 0) {\n allowedPlacements = placements;\n } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...\n\n\n var overflows = allowedPlacements.reduce(function (acc, placement) {\n acc[placement] = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding\n })[getBasePlacement(placement)];\n return acc;\n }, {});\n return Object.keys(overflows).sort(function (a, b) {\n return overflows[a] - overflows[b];\n });\n}","import { top, bottom, left, right } from \"../enums.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\n\nfunction getSideOffsets(overflow, rect, preventedOffsets) {\n if (preventedOffsets === void 0) {\n preventedOffsets = {\n x: 0,\n y: 0\n };\n }\n\n return {\n top: overflow.top - rect.height - preventedOffsets.y,\n right: overflow.right - rect.width + preventedOffsets.x,\n bottom: overflow.bottom - rect.height + preventedOffsets.y,\n left: overflow.left - rect.width - preventedOffsets.x\n };\n}\n\nfunction isAnySideFullyClipped(overflow) {\n return [top, right, bottom, left].some(function (side) {\n return overflow[side] >= 0;\n });\n}\n\nfunction hide(_ref) {\n var state = _ref.state,\n name = _ref.name;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var preventedOffsets = state.modifiersData.preventOverflow;\n var referenceOverflow = detectOverflow(state, {\n elementContext: 'reference'\n });\n var popperAltOverflow = detectOverflow(state, {\n altBoundary: true\n });\n var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);\n var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);\n var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);\n var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);\n state.modifiersData[name] = {\n referenceClippingOffsets: referenceClippingOffsets,\n popperEscapeOffsets: popperEscapeOffsets,\n isReferenceHidden: isReferenceHidden,\n hasPopperEscaped: hasPopperEscaped\n };\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-reference-hidden': isReferenceHidden,\n 'data-popper-escaped': hasPopperEscaped\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'hide',\n enabled: true,\n phase: 'main',\n requiresIfExists: ['preventOverflow'],\n fn: hide\n};","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport { top, left, right, placements } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport function distanceAndSkiddingToXY(placement, rects, offset) {\n var basePlacement = getBasePlacement(placement);\n var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;\n\n var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {\n placement: placement\n })) : offset,\n skidding = _ref[0],\n distance = _ref[1];\n\n skidding = skidding || 0;\n distance = (distance || 0) * invertDistance;\n return [left, right].indexOf(basePlacement) >= 0 ? {\n x: distance,\n y: skidding\n } : {\n x: skidding,\n y: distance\n };\n}\n\nfunction offset(_ref2) {\n var state = _ref2.state,\n options = _ref2.options,\n name = _ref2.name;\n var _options$offset = options.offset,\n offset = _options$offset === void 0 ? [0, 0] : _options$offset;\n var data = placements.reduce(function (acc, placement) {\n acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);\n return acc;\n }, {});\n var _data$state$placement = data[state.placement],\n x = _data$state$placement.x,\n y = _data$state$placement.y;\n\n if (state.modifiersData.popperOffsets != null) {\n state.modifiersData.popperOffsets.x += x;\n state.modifiersData.popperOffsets.y += y;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'offset',\n enabled: true,\n phase: 'main',\n requires: ['popperOffsets'],\n fn: offset\n};","import computeOffsets from \"../utils/computeOffsets.js\";\n\nfunction popperOffsets(_ref) {\n var state = _ref.state,\n name = _ref.name;\n // Offsets are the actual position the popper needs to have to be\n // properly positioned near its reference element\n // This is the most basic placement, and will be adjusted by\n // the modifiers in the next step\n state.modifiersData[name] = computeOffsets({\n reference: state.rects.reference,\n element: state.rects.popper,\n strategy: 'absolute',\n placement: state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'popperOffsets',\n enabled: true,\n phase: 'read',\n fn: popperOffsets,\n data: {}\n};","import { top, left, right, bottom, start } from \"../enums.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport getAltAxis from \"../utils/getAltAxis.js\";\nimport { within, withinMaxClamp } from \"../utils/within.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport getFreshSideObject from \"../utils/getFreshSideObject.js\";\nimport { min as mathMin, max as mathMax } from \"../utils/math.js\";\n\nfunction preventOverflow(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n padding = options.padding,\n _options$tether = options.tether,\n tether = _options$tether === void 0 ? true : _options$tether,\n _options$tetherOffset = options.tetherOffset,\n tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;\n var overflow = detectOverflow(state, {\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n altBoundary: altBoundary\n });\n var basePlacement = getBasePlacement(state.placement);\n var variation = getVariation(state.placement);\n var isBasePlacement = !variation;\n var mainAxis = getMainAxisFromPlacement(basePlacement);\n var altAxis = getAltAxis(mainAxis);\n var popperOffsets = state.modifiersData.popperOffsets;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {\n placement: state.placement\n })) : tetherOffset;\n var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {\n mainAxis: tetherOffsetValue,\n altAxis: tetherOffsetValue\n } : Object.assign({\n mainAxis: 0,\n altAxis: 0\n }, tetherOffsetValue);\n var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;\n var data = {\n x: 0,\n y: 0\n };\n\n if (!popperOffsets) {\n return;\n }\n\n if (checkMainAxis) {\n var _offsetModifierState$;\n\n var mainSide = mainAxis === 'y' ? top : left;\n var altSide = mainAxis === 'y' ? bottom : right;\n var len = mainAxis === 'y' ? 'height' : 'width';\n var offset = popperOffsets[mainAxis];\n var min = offset + overflow[mainSide];\n var max = offset - overflow[altSide];\n var additive = tether ? -popperRect[len] / 2 : 0;\n var minLen = variation === start ? referenceRect[len] : popperRect[len];\n var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go\n // outside the reference bounds\n\n var arrowElement = state.elements.arrow;\n var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {\n width: 0,\n height: 0\n };\n var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();\n var arrowPaddingMin = arrowPaddingObject[mainSide];\n var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want\n // to include its full size in the calculation. If the reference is small\n // and near the edge of a boundary, the popper can overflow even if the\n // reference is not overflowing as well (e.g. virtual elements with no\n // width or height)\n\n var arrowLen = within(0, referenceRect[len], arrowRect[len]);\n var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;\n var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;\n var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);\n var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;\n var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;\n var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;\n var tetherMax = offset + maxOffset - offsetModifierValue;\n var preventedOffset = within(tether ? mathMin(min, tetherMin) : min, offset, tether ? mathMax(max, tetherMax) : max);\n popperOffsets[mainAxis] = preventedOffset;\n data[mainAxis] = preventedOffset - offset;\n }\n\n if (checkAltAxis) {\n var _offsetModifierState$2;\n\n var _mainSide = mainAxis === 'x' ? top : left;\n\n var _altSide = mainAxis === 'x' ? bottom : right;\n\n var _offset = popperOffsets[altAxis];\n\n var _len = altAxis === 'y' ? 'height' : 'width';\n\n var _min = _offset + overflow[_mainSide];\n\n var _max = _offset - overflow[_altSide];\n\n var isOriginSide = [top, left].indexOf(basePlacement) !== -1;\n\n var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;\n\n var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;\n\n var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;\n\n var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);\n\n popperOffsets[altAxis] = _preventedOffset;\n data[altAxis] = _preventedOffset - _offset;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'preventOverflow',\n enabled: true,\n phase: 'main',\n fn: preventOverflow,\n requiresIfExists: ['offset']\n};","export default function getAltAxis(axis) {\n return axis === 'x' ? 'y' : 'x';\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getNodeScroll from \"./getNodeScroll.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport { round } from \"../utils/math.js\";\n\nfunction isElementScaled(element) {\n var rect = element.getBoundingClientRect();\n var scaleX = round(rect.width) / element.offsetWidth || 1;\n var scaleY = round(rect.height) / element.offsetHeight || 1;\n return scaleX !== 1 || scaleY !== 1;\n} // Returns the composite rect of an element relative to its offsetParent.\n// Composite means it takes into account transforms as well as layout.\n\n\nexport default function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {\n if (isFixed === void 0) {\n isFixed = false;\n }\n\n var isOffsetParentAnElement = isHTMLElement(offsetParent);\n var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent);\n var documentElement = getDocumentElement(offsetParent);\n var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed);\n var scroll = {\n scrollLeft: 0,\n scrollTop: 0\n };\n var offsets = {\n x: 0,\n y: 0\n };\n\n if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078\n isScrollParent(documentElement)) {\n scroll = getNodeScroll(offsetParent);\n }\n\n if (isHTMLElement(offsetParent)) {\n offsets = getBoundingClientRect(offsetParent, true);\n offsets.x += offsetParent.clientLeft;\n offsets.y += offsetParent.clientTop;\n } else if (documentElement) {\n offsets.x = getWindowScrollBarX(documentElement);\n }\n }\n\n return {\n x: rect.left + scroll.scrollLeft - offsets.x,\n y: rect.top + scroll.scrollTop - offsets.y,\n width: rect.width,\n height: rect.height\n };\n}","import getWindowScroll from \"./getWindowScroll.js\";\nimport getWindow from \"./getWindow.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getHTMLElementScroll from \"./getHTMLElementScroll.js\";\nexport default function getNodeScroll(node) {\n if (node === getWindow(node) || !isHTMLElement(node)) {\n return getWindowScroll(node);\n } else {\n return getHTMLElementScroll(node);\n }\n}","export default function getHTMLElementScroll(element) {\n return {\n scrollLeft: element.scrollLeft,\n scrollTop: element.scrollTop\n };\n}","import { modifierPhases } from \"../enums.js\"; // source: https://stackoverflow.com/questions/49875255\n\nfunction order(modifiers) {\n var map = new Map();\n var visited = new Set();\n var result = [];\n modifiers.forEach(function (modifier) {\n map.set(modifier.name, modifier);\n }); // On visiting object, check for its dependencies and visit them recursively\n\n function sort(modifier) {\n visited.add(modifier.name);\n var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);\n requires.forEach(function (dep) {\n if (!visited.has(dep)) {\n var depModifier = map.get(dep);\n\n if (depModifier) {\n sort(depModifier);\n }\n }\n });\n result.push(modifier);\n }\n\n modifiers.forEach(function (modifier) {\n if (!visited.has(modifier.name)) {\n // check for visited object\n sort(modifier);\n }\n });\n return result;\n}\n\nexport default function orderModifiers(modifiers) {\n // order based on dependencies\n var orderedModifiers = order(modifiers); // order based on phase\n\n return modifierPhases.reduce(function (acc, phase) {\n return acc.concat(orderedModifiers.filter(function (modifier) {\n return modifier.phase === phase;\n }));\n }, []);\n}","import getCompositeRect from \"./dom-utils/getCompositeRect.js\";\nimport getLayoutRect from \"./dom-utils/getLayoutRect.js\";\nimport listScrollParents from \"./dom-utils/listScrollParents.js\";\nimport getOffsetParent from \"./dom-utils/getOffsetParent.js\";\nimport orderModifiers from \"./utils/orderModifiers.js\";\nimport debounce from \"./utils/debounce.js\";\nimport mergeByName from \"./utils/mergeByName.js\";\nimport detectOverflow from \"./utils/detectOverflow.js\";\nimport { isElement } from \"./dom-utils/instanceOf.js\";\nvar DEFAULT_OPTIONS = {\n placement: 'bottom',\n modifiers: [],\n strategy: 'absolute'\n};\n\nfunction areValidElements() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n return !args.some(function (element) {\n return !(element && typeof element.getBoundingClientRect === 'function');\n });\n}\n\nexport function popperGenerator(generatorOptions) {\n if (generatorOptions === void 0) {\n generatorOptions = {};\n }\n\n var _generatorOptions = generatorOptions,\n _generatorOptions$def = _generatorOptions.defaultModifiers,\n defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,\n _generatorOptions$def2 = _generatorOptions.defaultOptions,\n defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;\n return function createPopper(reference, popper, options) {\n if (options === void 0) {\n options = defaultOptions;\n }\n\n var state = {\n placement: 'bottom',\n orderedModifiers: [],\n options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),\n modifiersData: {},\n elements: {\n reference: reference,\n popper: popper\n },\n attributes: {},\n styles: {}\n };\n var effectCleanupFns = [];\n var isDestroyed = false;\n var instance = {\n state: state,\n setOptions: function setOptions(setOptionsAction) {\n var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;\n cleanupModifierEffects();\n state.options = Object.assign({}, defaultOptions, state.options, options);\n state.scrollParents = {\n reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],\n popper: listScrollParents(popper)\n }; // Orders the modifiers based on their dependencies and `phase`\n // properties\n\n var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers\n\n state.orderedModifiers = orderedModifiers.filter(function (m) {\n return m.enabled;\n });\n runModifierEffects();\n return instance.update();\n },\n // Sync update – it will always be executed, even if not necessary. This\n // is useful for low frequency updates where sync behavior simplifies the\n // logic.\n // For high frequency updates (e.g. `resize` and `scroll` events), always\n // prefer the async Popper#update method\n forceUpdate: function forceUpdate() {\n if (isDestroyed) {\n return;\n }\n\n var _state$elements = state.elements,\n reference = _state$elements.reference,\n popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements\n // anymore\n\n if (!areValidElements(reference, popper)) {\n return;\n } // Store the reference and popper rects to be read by modifiers\n\n\n state.rects = {\n reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),\n popper: getLayoutRect(popper)\n }; // Modifiers have the ability to reset the current update cycle. The\n // most common use case for this is the `flip` modifier changing the\n // placement, which then needs to re-run all the modifiers, because the\n // logic was previously ran for the previous placement and is therefore\n // stale/incorrect\n\n state.reset = false;\n state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier\n // is filled with the initial data specified by the modifier. This means\n // it doesn't persist and is fresh on each update.\n // To ensure persistent data, use `${name}#persistent`\n\n state.orderedModifiers.forEach(function (modifier) {\n return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);\n });\n\n for (var index = 0; index < state.orderedModifiers.length; index++) {\n if (state.reset === true) {\n state.reset = false;\n index = -1;\n continue;\n }\n\n var _state$orderedModifie = state.orderedModifiers[index],\n fn = _state$orderedModifie.fn,\n _state$orderedModifie2 = _state$orderedModifie.options,\n _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,\n name = _state$orderedModifie.name;\n\n if (typeof fn === 'function') {\n state = fn({\n state: state,\n options: _options,\n name: name,\n instance: instance\n }) || state;\n }\n }\n },\n // Async and optimistically optimized update – it will not be executed if\n // not necessary (debounced to run at most once-per-tick)\n update: debounce(function () {\n return new Promise(function (resolve) {\n instance.forceUpdate();\n resolve(state);\n });\n }),\n destroy: function destroy() {\n cleanupModifierEffects();\n isDestroyed = true;\n }\n };\n\n if (!areValidElements(reference, popper)) {\n return instance;\n }\n\n instance.setOptions(options).then(function (state) {\n if (!isDestroyed && options.onFirstUpdate) {\n options.onFirstUpdate(state);\n }\n }); // Modifiers have the ability to execute arbitrary code before the first\n // update cycle runs. They will be executed in the same order as the update\n // cycle. This is useful when a modifier adds some persistent data that\n // other modifiers need to use, but the modifier is run after the dependent\n // one.\n\n function runModifierEffects() {\n state.orderedModifiers.forEach(function (_ref) {\n var name = _ref.name,\n _ref$options = _ref.options,\n options = _ref$options === void 0 ? {} : _ref$options,\n effect = _ref.effect;\n\n if (typeof effect === 'function') {\n var cleanupFn = effect({\n state: state,\n name: name,\n instance: instance,\n options: options\n });\n\n var noopFn = function noopFn() {};\n\n effectCleanupFns.push(cleanupFn || noopFn);\n }\n });\n }\n\n function cleanupModifierEffects() {\n effectCleanupFns.forEach(function (fn) {\n return fn();\n });\n effectCleanupFns = [];\n }\n\n return instance;\n };\n}\nexport var createPopper = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules\n\nexport { detectOverflow };","export default function debounce(fn) {\n var pending;\n return function () {\n if (!pending) {\n pending = new Promise(function (resolve) {\n Promise.resolve().then(function () {\n pending = undefined;\n resolve(fn());\n });\n });\n }\n\n return pending;\n };\n}","export default function mergeByName(modifiers) {\n var merged = modifiers.reduce(function (merged, current) {\n var existing = merged[current.name];\n merged[current.name] = existing ? Object.assign({}, existing, current, {\n options: Object.assign({}, existing.options, current.options),\n data: Object.assign({}, existing.data, current.data)\n }) : current;\n return merged;\n }, {}); // IE11 does not support Object.values\n\n return Object.keys(merged).map(function (key) {\n return merged[key];\n });\n}","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nimport offset from \"./modifiers/offset.js\";\nimport flip from \"./modifiers/flip.js\";\nimport preventOverflow from \"./modifiers/preventOverflow.js\";\nimport arrow from \"./modifiers/arrow.js\";\nimport hide from \"./modifiers/hide.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles, offset, flip, preventOverflow, arrow, hide];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow }; // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper as createPopperLite } from \"./popper-lite.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport * from \"./modifiers/index.js\";","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow };","/*!\n * Bootstrap v5.3.3 (https://getbootstrap.com/)\n * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n */\nimport * as Popper from '@popperjs/core';\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/data.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n/**\n * Constants\n */\n\nconst elementMap = new Map();\nconst Data = {\n set(element, key, instance) {\n if (!elementMap.has(element)) {\n elementMap.set(element, new Map());\n }\n const instanceMap = elementMap.get(element);\n\n // make it clear we only want one instance per element\n // can be removed later when multiple key/instances are fine to be used\n if (!instanceMap.has(key) && instanceMap.size !== 0) {\n // eslint-disable-next-line no-console\n console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`);\n return;\n }\n instanceMap.set(key, instance);\n },\n get(element, key) {\n if (elementMap.has(element)) {\n return elementMap.get(element).get(key) || null;\n }\n return null;\n },\n remove(element, key) {\n if (!elementMap.has(element)) {\n return;\n }\n const instanceMap = elementMap.get(element);\n instanceMap.delete(key);\n\n // free up element references if there are no instances left for an element\n if (instanceMap.size === 0) {\n elementMap.delete(element);\n }\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/index.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst MAX_UID = 1000000;\nconst MILLISECONDS_MULTIPLIER = 1000;\nconst TRANSITION_END = 'transitionend';\n\n/**\n * Properly escape IDs selectors to handle weird IDs\n * @param {string} selector\n * @returns {string}\n */\nconst parseSelector = selector => {\n if (selector && window.CSS && window.CSS.escape) {\n // document.querySelector needs escaping to handle IDs (html5+) containing for instance /\n selector = selector.replace(/#([^\\s\"#']+)/g, (match, id) => `#${CSS.escape(id)}`);\n }\n return selector;\n};\n\n// Shout-out Angus Croll (https://goo.gl/pxwQGp)\nconst toType = object => {\n if (object === null || object === undefined) {\n return `${object}`;\n }\n return Object.prototype.toString.call(object).match(/\\s([a-z]+)/i)[1].toLowerCase();\n};\n\n/**\n * Public Util API\n */\n\nconst getUID = prefix => {\n do {\n prefix += Math.floor(Math.random() * MAX_UID);\n } while (document.getElementById(prefix));\n return prefix;\n};\nconst getTransitionDurationFromElement = element => {\n if (!element) {\n return 0;\n }\n\n // Get transition-duration of the element\n let {\n transitionDuration,\n transitionDelay\n } = window.getComputedStyle(element);\n const floatTransitionDuration = Number.parseFloat(transitionDuration);\n const floatTransitionDelay = Number.parseFloat(transitionDelay);\n\n // Return 0 if element or transition duration is not found\n if (!floatTransitionDuration && !floatTransitionDelay) {\n return 0;\n }\n\n // If multiple durations are defined, take the first\n transitionDuration = transitionDuration.split(',')[0];\n transitionDelay = transitionDelay.split(',')[0];\n return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;\n};\nconst triggerTransitionEnd = element => {\n element.dispatchEvent(new Event(TRANSITION_END));\n};\nconst isElement = object => {\n if (!object || typeof object !== 'object') {\n return false;\n }\n if (typeof object.jquery !== 'undefined') {\n object = object[0];\n }\n return typeof object.nodeType !== 'undefined';\n};\nconst getElement = object => {\n // it's a jQuery object or a node element\n if (isElement(object)) {\n return object.jquery ? object[0] : object;\n }\n if (typeof object === 'string' && object.length > 0) {\n return document.querySelector(parseSelector(object));\n }\n return null;\n};\nconst isVisible = element => {\n if (!isElement(element) || element.getClientRects().length === 0) {\n return false;\n }\n const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible';\n // Handle `details` element as its content may falsie appear visible when it is closed\n const closedDetails = element.closest('details:not([open])');\n if (!closedDetails) {\n return elementIsVisible;\n }\n if (closedDetails !== element) {\n const summary = element.closest('summary');\n if (summary && summary.parentNode !== closedDetails) {\n return false;\n }\n if (summary === null) {\n return false;\n }\n }\n return elementIsVisible;\n};\nconst isDisabled = element => {\n if (!element || element.nodeType !== Node.ELEMENT_NODE) {\n return true;\n }\n if (element.classList.contains('disabled')) {\n return true;\n }\n if (typeof element.disabled !== 'undefined') {\n return element.disabled;\n }\n return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false';\n};\nconst findShadowRoot = element => {\n if (!document.documentElement.attachShadow) {\n return null;\n }\n\n // Can find the shadow root otherwise it'll return the document\n if (typeof element.getRootNode === 'function') {\n const root = element.getRootNode();\n return root instanceof ShadowRoot ? root : null;\n }\n if (element instanceof ShadowRoot) {\n return element;\n }\n\n // when we don't find a shadow root\n if (!element.parentNode) {\n return null;\n }\n return findShadowRoot(element.parentNode);\n};\nconst noop = () => {};\n\n/**\n * Trick to restart an element's animation\n *\n * @param {HTMLElement} element\n * @return void\n *\n * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation\n */\nconst reflow = element => {\n element.offsetHeight; // eslint-disable-line no-unused-expressions\n};\nconst getjQuery = () => {\n if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) {\n return window.jQuery;\n }\n return null;\n};\nconst DOMContentLoadedCallbacks = [];\nconst onDOMContentLoaded = callback => {\n if (document.readyState === 'loading') {\n // add listener on the first call when the document is in loading state\n if (!DOMContentLoadedCallbacks.length) {\n document.addEventListener('DOMContentLoaded', () => {\n for (const callback of DOMContentLoadedCallbacks) {\n callback();\n }\n });\n }\n DOMContentLoadedCallbacks.push(callback);\n } else {\n callback();\n }\n};\nconst isRTL = () => document.documentElement.dir === 'rtl';\nconst defineJQueryPlugin = plugin => {\n onDOMContentLoaded(() => {\n const $ = getjQuery();\n /* istanbul ignore if */\n if ($) {\n const name = plugin.NAME;\n const JQUERY_NO_CONFLICT = $.fn[name];\n $.fn[name] = plugin.jQueryInterface;\n $.fn[name].Constructor = plugin;\n $.fn[name].noConflict = () => {\n $.fn[name] = JQUERY_NO_CONFLICT;\n return plugin.jQueryInterface;\n };\n }\n });\n};\nconst execute = (possibleCallback, args = [], defaultValue = possibleCallback) => {\n return typeof possibleCallback === 'function' ? possibleCallback(...args) : defaultValue;\n};\nconst executeAfterTransition = (callback, transitionElement, waitForTransition = true) => {\n if (!waitForTransition) {\n execute(callback);\n return;\n }\n const durationPadding = 5;\n const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding;\n let called = false;\n const handler = ({\n target\n }) => {\n if (target !== transitionElement) {\n return;\n }\n called = true;\n transitionElement.removeEventListener(TRANSITION_END, handler);\n execute(callback);\n };\n transitionElement.addEventListener(TRANSITION_END, handler);\n setTimeout(() => {\n if (!called) {\n triggerTransitionEnd(transitionElement);\n }\n }, emulatedDuration);\n};\n\n/**\n * Return the previous/next element of a list.\n *\n * @param {array} list The list of elements\n * @param activeElement The active element\n * @param shouldGetNext Choose to get next or previous element\n * @param isCycleAllowed\n * @return {Element|elem} The proper element\n */\nconst getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => {\n const listLength = list.length;\n let index = list.indexOf(activeElement);\n\n // if the element does not exist in the list return an element\n // depending on the direction and if cycle is allowed\n if (index === -1) {\n return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0];\n }\n index += shouldGetNext ? 1 : -1;\n if (isCycleAllowed) {\n index = (index + listLength) % listLength;\n }\n return list[Math.max(0, Math.min(index, listLength - 1))];\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/event-handler.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst namespaceRegex = /[^.]*(?=\\..*)\\.|.*/;\nconst stripNameRegex = /\\..*/;\nconst stripUidRegex = /::\\d+$/;\nconst eventRegistry = {}; // Events storage\nlet uidEvent = 1;\nconst customEvents = {\n mouseenter: 'mouseover',\n mouseleave: 'mouseout'\n};\nconst nativeEvents = new Set(['click', 'dblclick', 'mouseup', 'mousedown', 'contextmenu', 'mousewheel', 'DOMMouseScroll', 'mouseover', 'mouseout', 'mousemove', 'selectstart', 'selectend', 'keydown', 'keypress', 'keyup', 'orientationchange', 'touchstart', 'touchmove', 'touchend', 'touchcancel', 'pointerdown', 'pointermove', 'pointerup', 'pointerleave', 'pointercancel', 'gesturestart', 'gesturechange', 'gestureend', 'focus', 'blur', 'change', 'reset', 'select', 'submit', 'focusin', 'focusout', 'load', 'unload', 'beforeunload', 'resize', 'move', 'DOMContentLoaded', 'readystatechange', 'error', 'abort', 'scroll']);\n\n/**\n * Private methods\n */\n\nfunction makeEventUid(element, uid) {\n return uid && `${uid}::${uidEvent++}` || element.uidEvent || uidEvent++;\n}\nfunction getElementEvents(element) {\n const uid = makeEventUid(element);\n element.uidEvent = uid;\n eventRegistry[uid] = eventRegistry[uid] || {};\n return eventRegistry[uid];\n}\nfunction bootstrapHandler(element, fn) {\n return function handler(event) {\n hydrateObj(event, {\n delegateTarget: element\n });\n if (handler.oneOff) {\n EventHandler.off(element, event.type, fn);\n }\n return fn.apply(element, [event]);\n };\n}\nfunction bootstrapDelegationHandler(element, selector, fn) {\n return function handler(event) {\n const domElements = element.querySelectorAll(selector);\n for (let {\n target\n } = event; target && target !== this; target = target.parentNode) {\n for (const domElement of domElements) {\n if (domElement !== target) {\n continue;\n }\n hydrateObj(event, {\n delegateTarget: target\n });\n if (handler.oneOff) {\n EventHandler.off(element, event.type, selector, fn);\n }\n return fn.apply(target, [event]);\n }\n }\n };\n}\nfunction findHandler(events, callable, delegationSelector = null) {\n return Object.values(events).find(event => event.callable === callable && event.delegationSelector === delegationSelector);\n}\nfunction normalizeParameters(originalTypeEvent, handler, delegationFunction) {\n const isDelegated = typeof handler === 'string';\n // TODO: tooltip passes `false` instead of selector, so we need to check\n const callable = isDelegated ? delegationFunction : handler || delegationFunction;\n let typeEvent = getTypeEvent(originalTypeEvent);\n if (!nativeEvents.has(typeEvent)) {\n typeEvent = originalTypeEvent;\n }\n return [isDelegated, callable, typeEvent];\n}\nfunction addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n\n // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position\n // this prevents the handler from being dispatched the same way as mouseover or mouseout does\n if (originalTypeEvent in customEvents) {\n const wrapFunction = fn => {\n return function (event) {\n if (!event.relatedTarget || event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget)) {\n return fn.call(this, event);\n }\n };\n };\n callable = wrapFunction(callable);\n }\n const events = getElementEvents(element);\n const handlers = events[typeEvent] || (events[typeEvent] = {});\n const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null);\n if (previousFunction) {\n previousFunction.oneOff = previousFunction.oneOff && oneOff;\n return;\n }\n const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, ''));\n const fn = isDelegated ? bootstrapDelegationHandler(element, handler, callable) : bootstrapHandler(element, callable);\n fn.delegationSelector = isDelegated ? handler : null;\n fn.callable = callable;\n fn.oneOff = oneOff;\n fn.uidEvent = uid;\n handlers[uid] = fn;\n element.addEventListener(typeEvent, fn, isDelegated);\n}\nfunction removeHandler(element, events, typeEvent, handler, delegationSelector) {\n const fn = findHandler(events[typeEvent], handler, delegationSelector);\n if (!fn) {\n return;\n }\n element.removeEventListener(typeEvent, fn, Boolean(delegationSelector));\n delete events[typeEvent][fn.uidEvent];\n}\nfunction removeNamespacedHandlers(element, events, typeEvent, namespace) {\n const storeElementEvent = events[typeEvent] || {};\n for (const [handlerKey, event] of Object.entries(storeElementEvent)) {\n if (handlerKey.includes(namespace)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n}\nfunction getTypeEvent(event) {\n // allow to get the native events from namespaced events ('click.bs.button' --> 'click')\n event = event.replace(stripNameRegex, '');\n return customEvents[event] || event;\n}\nconst EventHandler = {\n on(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, false);\n },\n one(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, true);\n },\n off(element, originalTypeEvent, handler, delegationFunction) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n const inNamespace = typeEvent !== originalTypeEvent;\n const events = getElementEvents(element);\n const storeElementEvent = events[typeEvent] || {};\n const isNamespace = originalTypeEvent.startsWith('.');\n if (typeof callable !== 'undefined') {\n // Simplest case: handler is passed, remove that listener ONLY.\n if (!Object.keys(storeElementEvent).length) {\n return;\n }\n removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null);\n return;\n }\n if (isNamespace) {\n for (const elementEvent of Object.keys(events)) {\n removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1));\n }\n }\n for (const [keyHandlers, event] of Object.entries(storeElementEvent)) {\n const handlerKey = keyHandlers.replace(stripUidRegex, '');\n if (!inNamespace || originalTypeEvent.includes(handlerKey)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n },\n trigger(element, event, args) {\n if (typeof event !== 'string' || !element) {\n return null;\n }\n const $ = getjQuery();\n const typeEvent = getTypeEvent(event);\n const inNamespace = event !== typeEvent;\n let jQueryEvent = null;\n let bubbles = true;\n let nativeDispatch = true;\n let defaultPrevented = false;\n if (inNamespace && $) {\n jQueryEvent = $.Event(event, args);\n $(element).trigger(jQueryEvent);\n bubbles = !jQueryEvent.isPropagationStopped();\n nativeDispatch = !jQueryEvent.isImmediatePropagationStopped();\n defaultPrevented = jQueryEvent.isDefaultPrevented();\n }\n const evt = hydrateObj(new Event(event, {\n bubbles,\n cancelable: true\n }), args);\n if (defaultPrevented) {\n evt.preventDefault();\n }\n if (nativeDispatch) {\n element.dispatchEvent(evt);\n }\n if (evt.defaultPrevented && jQueryEvent) {\n jQueryEvent.preventDefault();\n }\n return evt;\n }\n};\nfunction hydrateObj(obj, meta = {}) {\n for (const [key, value] of Object.entries(meta)) {\n try {\n obj[key] = value;\n } catch (_unused) {\n Object.defineProperty(obj, key, {\n configurable: true,\n get() {\n return value;\n }\n });\n }\n }\n return obj;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/manipulator.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nfunction normalizeData(value) {\n if (value === 'true') {\n return true;\n }\n if (value === 'false') {\n return false;\n }\n if (value === Number(value).toString()) {\n return Number(value);\n }\n if (value === '' || value === 'null') {\n return null;\n }\n if (typeof value !== 'string') {\n return value;\n }\n try {\n return JSON.parse(decodeURIComponent(value));\n } catch (_unused) {\n return value;\n }\n}\nfunction normalizeDataKey(key) {\n return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`);\n}\nconst Manipulator = {\n setDataAttribute(element, key, value) {\n element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value);\n },\n removeDataAttribute(element, key) {\n element.removeAttribute(`data-bs-${normalizeDataKey(key)}`);\n },\n getDataAttributes(element) {\n if (!element) {\n return {};\n }\n const attributes = {};\n const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig'));\n for (const key of bsKeys) {\n let pureKey = key.replace(/^bs/, '');\n pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length);\n attributes[pureKey] = normalizeData(element.dataset[key]);\n }\n return attributes;\n },\n getDataAttribute(element, key) {\n return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`));\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/config.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Class definition\n */\n\nclass Config {\n // Getters\n static get Default() {\n return {};\n }\n static get DefaultType() {\n return {};\n }\n static get NAME() {\n throw new Error('You have to implement the static method \"NAME\", for each component!');\n }\n _getConfig(config) {\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n _configAfterMerge(config) {\n return config;\n }\n _mergeConfigObj(config, element) {\n const jsonConfig = isElement(element) ? Manipulator.getDataAttribute(element, 'config') : {}; // try to parse\n\n return {\n ...this.constructor.Default,\n ...(typeof jsonConfig === 'object' ? jsonConfig : {}),\n ...(isElement(element) ? Manipulator.getDataAttributes(element) : {}),\n ...(typeof config === 'object' ? config : {})\n };\n }\n _typeCheckConfig(config, configTypes = this.constructor.DefaultType) {\n for (const [property, expectedTypes] of Object.entries(configTypes)) {\n const value = config[property];\n const valueType = isElement(value) ? 'element' : toType(value);\n if (!new RegExp(expectedTypes).test(valueType)) {\n throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option \"${property}\" provided type \"${valueType}\" but expected type \"${expectedTypes}\".`);\n }\n }\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap base-component.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst VERSION = '5.3.3';\n\n/**\n * Class definition\n */\n\nclass BaseComponent extends Config {\n constructor(element, config) {\n super();\n element = getElement(element);\n if (!element) {\n return;\n }\n this._element = element;\n this._config = this._getConfig(config);\n Data.set(this._element, this.constructor.DATA_KEY, this);\n }\n\n // Public\n dispose() {\n Data.remove(this._element, this.constructor.DATA_KEY);\n EventHandler.off(this._element, this.constructor.EVENT_KEY);\n for (const propertyName of Object.getOwnPropertyNames(this)) {\n this[propertyName] = null;\n }\n }\n _queueCallback(callback, element, isAnimated = true) {\n executeAfterTransition(callback, element, isAnimated);\n }\n _getConfig(config) {\n config = this._mergeConfigObj(config, this._element);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n\n // Static\n static getInstance(element) {\n return Data.get(getElement(element), this.DATA_KEY);\n }\n static getOrCreateInstance(element, config = {}) {\n return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null);\n }\n static get VERSION() {\n return VERSION;\n }\n static get DATA_KEY() {\n return `bs.${this.NAME}`;\n }\n static get EVENT_KEY() {\n return `.${this.DATA_KEY}`;\n }\n static eventName(name) {\n return `${name}${this.EVENT_KEY}`;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/selector-engine.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst getSelector = element => {\n let selector = element.getAttribute('data-bs-target');\n if (!selector || selector === '#') {\n let hrefAttribute = element.getAttribute('href');\n\n // The only valid content that could double as a selector are IDs or classes,\n // so everything starting with `#` or `.`. If a \"real\" URL is used as the selector,\n // `document.querySelector` will rightfully complain it is invalid.\n // See https://github.com/twbs/bootstrap/issues/32273\n if (!hrefAttribute || !hrefAttribute.includes('#') && !hrefAttribute.startsWith('.')) {\n return null;\n }\n\n // Just in case some CMS puts out a full URL with the anchor appended\n if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) {\n hrefAttribute = `#${hrefAttribute.split('#')[1]}`;\n }\n selector = hrefAttribute && hrefAttribute !== '#' ? hrefAttribute.trim() : null;\n }\n return selector ? selector.split(',').map(sel => parseSelector(sel)).join(',') : null;\n};\nconst SelectorEngine = {\n find(selector, element = document.documentElement) {\n return [].concat(...Element.prototype.querySelectorAll.call(element, selector));\n },\n findOne(selector, element = document.documentElement) {\n return Element.prototype.querySelector.call(element, selector);\n },\n children(element, selector) {\n return [].concat(...element.children).filter(child => child.matches(selector));\n },\n parents(element, selector) {\n const parents = [];\n let ancestor = element.parentNode.closest(selector);\n while (ancestor) {\n parents.push(ancestor);\n ancestor = ancestor.parentNode.closest(selector);\n }\n return parents;\n },\n prev(element, selector) {\n let previous = element.previousElementSibling;\n while (previous) {\n if (previous.matches(selector)) {\n return [previous];\n }\n previous = previous.previousElementSibling;\n }\n return [];\n },\n // TODO: this is now unused; remove later along with prev()\n next(element, selector) {\n let next = element.nextElementSibling;\n while (next) {\n if (next.matches(selector)) {\n return [next];\n }\n next = next.nextElementSibling;\n }\n return [];\n },\n focusableChildren(element) {\n const focusables = ['a', 'button', 'input', 'textarea', 'select', 'details', '[tabindex]', '[contenteditable=\"true\"]'].map(selector => `${selector}:not([tabindex^=\"-\"])`).join(',');\n return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el));\n },\n getSelectorFromElement(element) {\n const selector = getSelector(element);\n if (selector) {\n return SelectorEngine.findOne(selector) ? selector : null;\n }\n return null;\n },\n getElementFromSelector(element) {\n const selector = getSelector(element);\n return selector ? SelectorEngine.findOne(selector) : null;\n },\n getMultipleElementsFromSelector(element) {\n const selector = getSelector(element);\n return selector ? SelectorEngine.find(selector) : [];\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/component-functions.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst enableDismissTrigger = (component, method = 'hide') => {\n const clickEvent = `click.dismiss${component.EVENT_KEY}`;\n const name = component.NAME;\n EventHandler.on(document, clickEvent, `[data-bs-dismiss=\"${name}\"]`, function (event) {\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n if (isDisabled(this)) {\n return;\n }\n const target = SelectorEngine.getElementFromSelector(this) || this.closest(`.${name}`);\n const instance = component.getOrCreateInstance(target);\n\n // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method\n instance[method]();\n });\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap alert.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$f = 'alert';\nconst DATA_KEY$a = 'bs.alert';\nconst EVENT_KEY$b = `.${DATA_KEY$a}`;\nconst EVENT_CLOSE = `close${EVENT_KEY$b}`;\nconst EVENT_CLOSED = `closed${EVENT_KEY$b}`;\nconst CLASS_NAME_FADE$5 = 'fade';\nconst CLASS_NAME_SHOW$8 = 'show';\n\n/**\n * Class definition\n */\n\nclass Alert extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$f;\n }\n\n // Public\n close() {\n const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE);\n if (closeEvent.defaultPrevented) {\n return;\n }\n this._element.classList.remove(CLASS_NAME_SHOW$8);\n const isAnimated = this._element.classList.contains(CLASS_NAME_FADE$5);\n this._queueCallback(() => this._destroyElement(), this._element, isAnimated);\n }\n\n // Private\n _destroyElement() {\n this._element.remove();\n EventHandler.trigger(this._element, EVENT_CLOSED);\n this.dispose();\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Alert.getOrCreateInstance(this);\n if (typeof config !== 'string') {\n return;\n }\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](this);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nenableDismissTrigger(Alert, 'close');\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Alert);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap button.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$e = 'button';\nconst DATA_KEY$9 = 'bs.button';\nconst EVENT_KEY$a = `.${DATA_KEY$9}`;\nconst DATA_API_KEY$6 = '.data-api';\nconst CLASS_NAME_ACTIVE$3 = 'active';\nconst SELECTOR_DATA_TOGGLE$5 = '[data-bs-toggle=\"button\"]';\nconst EVENT_CLICK_DATA_API$6 = `click${EVENT_KEY$a}${DATA_API_KEY$6}`;\n\n/**\n * Class definition\n */\n\nclass Button extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$e;\n }\n\n // Public\n toggle() {\n // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method\n this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE$3));\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Button.getOrCreateInstance(this);\n if (config === 'toggle') {\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$6, SELECTOR_DATA_TOGGLE$5, event => {\n event.preventDefault();\n const button = event.target.closest(SELECTOR_DATA_TOGGLE$5);\n const data = Button.getOrCreateInstance(button);\n data.toggle();\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Button);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/swipe.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$d = 'swipe';\nconst EVENT_KEY$9 = '.bs.swipe';\nconst EVENT_TOUCHSTART = `touchstart${EVENT_KEY$9}`;\nconst EVENT_TOUCHMOVE = `touchmove${EVENT_KEY$9}`;\nconst EVENT_TOUCHEND = `touchend${EVENT_KEY$9}`;\nconst EVENT_POINTERDOWN = `pointerdown${EVENT_KEY$9}`;\nconst EVENT_POINTERUP = `pointerup${EVENT_KEY$9}`;\nconst POINTER_TYPE_TOUCH = 'touch';\nconst POINTER_TYPE_PEN = 'pen';\nconst CLASS_NAME_POINTER_EVENT = 'pointer-event';\nconst SWIPE_THRESHOLD = 40;\nconst Default$c = {\n endCallback: null,\n leftCallback: null,\n rightCallback: null\n};\nconst DefaultType$c = {\n endCallback: '(function|null)',\n leftCallback: '(function|null)',\n rightCallback: '(function|null)'\n};\n\n/**\n * Class definition\n */\n\nclass Swipe extends Config {\n constructor(element, config) {\n super();\n this._element = element;\n if (!element || !Swipe.isSupported()) {\n return;\n }\n this._config = this._getConfig(config);\n this._deltaX = 0;\n this._supportPointerEvents = Boolean(window.PointerEvent);\n this._initEvents();\n }\n\n // Getters\n static get Default() {\n return Default$c;\n }\n static get DefaultType() {\n return DefaultType$c;\n }\n static get NAME() {\n return NAME$d;\n }\n\n // Public\n dispose() {\n EventHandler.off(this._element, EVENT_KEY$9);\n }\n\n // Private\n _start(event) {\n if (!this._supportPointerEvents) {\n this._deltaX = event.touches[0].clientX;\n return;\n }\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX;\n }\n }\n _end(event) {\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX - this._deltaX;\n }\n this._handleSwipe();\n execute(this._config.endCallback);\n }\n _move(event) {\n this._deltaX = event.touches && event.touches.length > 1 ? 0 : event.touches[0].clientX - this._deltaX;\n }\n _handleSwipe() {\n const absDeltaX = Math.abs(this._deltaX);\n if (absDeltaX <= SWIPE_THRESHOLD) {\n return;\n }\n const direction = absDeltaX / this._deltaX;\n this._deltaX = 0;\n if (!direction) {\n return;\n }\n execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback);\n }\n _initEvents() {\n if (this._supportPointerEvents) {\n EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event));\n EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event));\n this._element.classList.add(CLASS_NAME_POINTER_EVENT);\n } else {\n EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event));\n EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event));\n EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event));\n }\n }\n _eventIsPointerPenTouch(event) {\n return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH);\n }\n\n // Static\n static isSupported() {\n return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap carousel.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$c = 'carousel';\nconst DATA_KEY$8 = 'bs.carousel';\nconst EVENT_KEY$8 = `.${DATA_KEY$8}`;\nconst DATA_API_KEY$5 = '.data-api';\nconst ARROW_LEFT_KEY$1 = 'ArrowLeft';\nconst ARROW_RIGHT_KEY$1 = 'ArrowRight';\nconst TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch\n\nconst ORDER_NEXT = 'next';\nconst ORDER_PREV = 'prev';\nconst DIRECTION_LEFT = 'left';\nconst DIRECTION_RIGHT = 'right';\nconst EVENT_SLIDE = `slide${EVENT_KEY$8}`;\nconst EVENT_SLID = `slid${EVENT_KEY$8}`;\nconst EVENT_KEYDOWN$1 = `keydown${EVENT_KEY$8}`;\nconst EVENT_MOUSEENTER$1 = `mouseenter${EVENT_KEY$8}`;\nconst EVENT_MOUSELEAVE$1 = `mouseleave${EVENT_KEY$8}`;\nconst EVENT_DRAG_START = `dragstart${EVENT_KEY$8}`;\nconst EVENT_LOAD_DATA_API$3 = `load${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst EVENT_CLICK_DATA_API$5 = `click${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst CLASS_NAME_CAROUSEL = 'carousel';\nconst CLASS_NAME_ACTIVE$2 = 'active';\nconst CLASS_NAME_SLIDE = 'slide';\nconst CLASS_NAME_END = 'carousel-item-end';\nconst CLASS_NAME_START = 'carousel-item-start';\nconst CLASS_NAME_NEXT = 'carousel-item-next';\nconst CLASS_NAME_PREV = 'carousel-item-prev';\nconst SELECTOR_ACTIVE = '.active';\nconst SELECTOR_ITEM = '.carousel-item';\nconst SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM;\nconst SELECTOR_ITEM_IMG = '.carousel-item img';\nconst SELECTOR_INDICATORS = '.carousel-indicators';\nconst SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]';\nconst SELECTOR_DATA_RIDE = '[data-bs-ride=\"carousel\"]';\nconst KEY_TO_DIRECTION = {\n [ARROW_LEFT_KEY$1]: DIRECTION_RIGHT,\n [ARROW_RIGHT_KEY$1]: DIRECTION_LEFT\n};\nconst Default$b = {\n interval: 5000,\n keyboard: true,\n pause: 'hover',\n ride: false,\n touch: true,\n wrap: true\n};\nconst DefaultType$b = {\n interval: '(number|boolean)',\n // TODO:v6 remove boolean support\n keyboard: 'boolean',\n pause: '(string|boolean)',\n ride: '(boolean|string)',\n touch: 'boolean',\n wrap: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Carousel extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._interval = null;\n this._activeElement = null;\n this._isSliding = false;\n this.touchTimeout = null;\n this._swipeHelper = null;\n this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element);\n this._addEventListeners();\n if (this._config.ride === CLASS_NAME_CAROUSEL) {\n this.cycle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$b;\n }\n static get DefaultType() {\n return DefaultType$b;\n }\n static get NAME() {\n return NAME$c;\n }\n\n // Public\n next() {\n this._slide(ORDER_NEXT);\n }\n nextWhenVisible() {\n // FIXME TODO use `document.visibilityState`\n // Don't call next when the page isn't visible\n // or the carousel or its parent isn't visible\n if (!document.hidden && isVisible(this._element)) {\n this.next();\n }\n }\n prev() {\n this._slide(ORDER_PREV);\n }\n pause() {\n if (this._isSliding) {\n triggerTransitionEnd(this._element);\n }\n this._clearInterval();\n }\n cycle() {\n this._clearInterval();\n this._updateInterval();\n this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval);\n }\n _maybeEnableCycle() {\n if (!this._config.ride) {\n return;\n }\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.cycle());\n return;\n }\n this.cycle();\n }\n to(index) {\n const items = this._getItems();\n if (index > items.length - 1 || index < 0) {\n return;\n }\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.to(index));\n return;\n }\n const activeIndex = this._getItemIndex(this._getActive());\n if (activeIndex === index) {\n return;\n }\n const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV;\n this._slide(order, items[index]);\n }\n dispose() {\n if (this._swipeHelper) {\n this._swipeHelper.dispose();\n }\n super.dispose();\n }\n\n // Private\n _configAfterMerge(config) {\n config.defaultInterval = config.interval;\n return config;\n }\n _addEventListeners() {\n if (this._config.keyboard) {\n EventHandler.on(this._element, EVENT_KEYDOWN$1, event => this._keydown(event));\n }\n if (this._config.pause === 'hover') {\n EventHandler.on(this._element, EVENT_MOUSEENTER$1, () => this.pause());\n EventHandler.on(this._element, EVENT_MOUSELEAVE$1, () => this._maybeEnableCycle());\n }\n if (this._config.touch && Swipe.isSupported()) {\n this._addTouchEventListeners();\n }\n }\n _addTouchEventListeners() {\n for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) {\n EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault());\n }\n const endCallBack = () => {\n if (this._config.pause !== 'hover') {\n return;\n }\n\n // If it's a touch-enabled device, mouseenter/leave are fired as\n // part of the mouse compatibility events on first tap - the carousel\n // would stop cycling until user tapped out of it;\n // here, we listen for touchend, explicitly pause the carousel\n // (as if it's the second time we tap on it, mouseenter compat event\n // is NOT fired) and after a timeout (to allow for mouse compatibility\n // events to fire) we explicitly restart cycling\n\n this.pause();\n if (this.touchTimeout) {\n clearTimeout(this.touchTimeout);\n }\n this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval);\n };\n const swipeConfig = {\n leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)),\n rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)),\n endCallback: endCallBack\n };\n this._swipeHelper = new Swipe(this._element, swipeConfig);\n }\n _keydown(event) {\n if (/input|textarea/i.test(event.target.tagName)) {\n return;\n }\n const direction = KEY_TO_DIRECTION[event.key];\n if (direction) {\n event.preventDefault();\n this._slide(this._directionToOrder(direction));\n }\n }\n _getItemIndex(element) {\n return this._getItems().indexOf(element);\n }\n _setActiveIndicatorElement(index) {\n if (!this._indicatorsElement) {\n return;\n }\n const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement);\n activeIndicator.classList.remove(CLASS_NAME_ACTIVE$2);\n activeIndicator.removeAttribute('aria-current');\n const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to=\"${index}\"]`, this._indicatorsElement);\n if (newActiveIndicator) {\n newActiveIndicator.classList.add(CLASS_NAME_ACTIVE$2);\n newActiveIndicator.setAttribute('aria-current', 'true');\n }\n }\n _updateInterval() {\n const element = this._activeElement || this._getActive();\n if (!element) {\n return;\n }\n const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10);\n this._config.interval = elementInterval || this._config.defaultInterval;\n }\n _slide(order, element = null) {\n if (this._isSliding) {\n return;\n }\n const activeElement = this._getActive();\n const isNext = order === ORDER_NEXT;\n const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap);\n if (nextElement === activeElement) {\n return;\n }\n const nextElementIndex = this._getItemIndex(nextElement);\n const triggerEvent = eventName => {\n return EventHandler.trigger(this._element, eventName, {\n relatedTarget: nextElement,\n direction: this._orderToDirection(order),\n from: this._getItemIndex(activeElement),\n to: nextElementIndex\n });\n };\n const slideEvent = triggerEvent(EVENT_SLIDE);\n if (slideEvent.defaultPrevented) {\n return;\n }\n if (!activeElement || !nextElement) {\n // Some weirdness is happening, so we bail\n // TODO: change tests that use empty divs to avoid this check\n return;\n }\n const isCycling = Boolean(this._interval);\n this.pause();\n this._isSliding = true;\n this._setActiveIndicatorElement(nextElementIndex);\n this._activeElement = nextElement;\n const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END;\n const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV;\n nextElement.classList.add(orderClassName);\n reflow(nextElement);\n activeElement.classList.add(directionalClassName);\n nextElement.classList.add(directionalClassName);\n const completeCallBack = () => {\n nextElement.classList.remove(directionalClassName, orderClassName);\n nextElement.classList.add(CLASS_NAME_ACTIVE$2);\n activeElement.classList.remove(CLASS_NAME_ACTIVE$2, orderClassName, directionalClassName);\n this._isSliding = false;\n triggerEvent(EVENT_SLID);\n };\n this._queueCallback(completeCallBack, activeElement, this._isAnimated());\n if (isCycling) {\n this.cycle();\n }\n }\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_SLIDE);\n }\n _getActive() {\n return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element);\n }\n _getItems() {\n return SelectorEngine.find(SELECTOR_ITEM, this._element);\n }\n _clearInterval() {\n if (this._interval) {\n clearInterval(this._interval);\n this._interval = null;\n }\n }\n _directionToOrder(direction) {\n if (isRTL()) {\n return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT;\n }\n return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV;\n }\n _orderToDirection(order) {\n if (isRTL()) {\n return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT;\n }\n return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT;\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Carousel.getOrCreateInstance(this, config);\n if (typeof config === 'number') {\n data.to(config);\n return;\n }\n if (typeof config === 'string') {\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$5, SELECTOR_DATA_SLIDE, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) {\n return;\n }\n event.preventDefault();\n const carousel = Carousel.getOrCreateInstance(target);\n const slideIndex = this.getAttribute('data-bs-slide-to');\n if (slideIndex) {\n carousel.to(slideIndex);\n carousel._maybeEnableCycle();\n return;\n }\n if (Manipulator.getDataAttribute(this, 'slide') === 'next') {\n carousel.next();\n carousel._maybeEnableCycle();\n return;\n }\n carousel.prev();\n carousel._maybeEnableCycle();\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$3, () => {\n const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE);\n for (const carousel of carousels) {\n Carousel.getOrCreateInstance(carousel);\n }\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Carousel);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap collapse.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$b = 'collapse';\nconst DATA_KEY$7 = 'bs.collapse';\nconst EVENT_KEY$7 = `.${DATA_KEY$7}`;\nconst DATA_API_KEY$4 = '.data-api';\nconst EVENT_SHOW$6 = `show${EVENT_KEY$7}`;\nconst EVENT_SHOWN$6 = `shown${EVENT_KEY$7}`;\nconst EVENT_HIDE$6 = `hide${EVENT_KEY$7}`;\nconst EVENT_HIDDEN$6 = `hidden${EVENT_KEY$7}`;\nconst EVENT_CLICK_DATA_API$4 = `click${EVENT_KEY$7}${DATA_API_KEY$4}`;\nconst CLASS_NAME_SHOW$7 = 'show';\nconst CLASS_NAME_COLLAPSE = 'collapse';\nconst CLASS_NAME_COLLAPSING = 'collapsing';\nconst CLASS_NAME_COLLAPSED = 'collapsed';\nconst CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`;\nconst CLASS_NAME_HORIZONTAL = 'collapse-horizontal';\nconst WIDTH = 'width';\nconst HEIGHT = 'height';\nconst SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing';\nconst SELECTOR_DATA_TOGGLE$4 = '[data-bs-toggle=\"collapse\"]';\nconst Default$a = {\n parent: null,\n toggle: true\n};\nconst DefaultType$a = {\n parent: '(null|element)',\n toggle: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Collapse extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isTransitioning = false;\n this._triggerArray = [];\n const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE$4);\n for (const elem of toggleList) {\n const selector = SelectorEngine.getSelectorFromElement(elem);\n const filterElement = SelectorEngine.find(selector).filter(foundElement => foundElement === this._element);\n if (selector !== null && filterElement.length) {\n this._triggerArray.push(elem);\n }\n }\n this._initializeChildren();\n if (!this._config.parent) {\n this._addAriaAndCollapsedClass(this._triggerArray, this._isShown());\n }\n if (this._config.toggle) {\n this.toggle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$a;\n }\n static get DefaultType() {\n return DefaultType$a;\n }\n static get NAME() {\n return NAME$b;\n }\n\n // Public\n toggle() {\n if (this._isShown()) {\n this.hide();\n } else {\n this.show();\n }\n }\n show() {\n if (this._isTransitioning || this._isShown()) {\n return;\n }\n let activeChildren = [];\n\n // find active children\n if (this._config.parent) {\n activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES).filter(element => element !== this._element).map(element => Collapse.getOrCreateInstance(element, {\n toggle: false\n }));\n }\n if (activeChildren.length && activeChildren[0]._isTransitioning) {\n return;\n }\n const startEvent = EventHandler.trigger(this._element, EVENT_SHOW$6);\n if (startEvent.defaultPrevented) {\n return;\n }\n for (const activeInstance of activeChildren) {\n activeInstance.hide();\n }\n const dimension = this._getDimension();\n this._element.classList.remove(CLASS_NAME_COLLAPSE);\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n this._element.style[dimension] = 0;\n this._addAriaAndCollapsedClass(this._triggerArray, true);\n this._isTransitioning = true;\n const complete = () => {\n this._isTransitioning = false;\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n this._element.style[dimension] = '';\n EventHandler.trigger(this._element, EVENT_SHOWN$6);\n };\n const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);\n const scrollSize = `scroll${capitalizedDimension}`;\n this._queueCallback(complete, this._element, true);\n this._element.style[dimension] = `${this._element[scrollSize]}px`;\n }\n hide() {\n if (this._isTransitioning || !this._isShown()) {\n return;\n }\n const startEvent = EventHandler.trigger(this._element, EVENT_HIDE$6);\n if (startEvent.defaultPrevented) {\n return;\n }\n const dimension = this._getDimension();\n this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`;\n reflow(this._element);\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n for (const trigger of this._triggerArray) {\n const element = SelectorEngine.getElementFromSelector(trigger);\n if (element && !this._isShown(element)) {\n this._addAriaAndCollapsedClass([trigger], false);\n }\n }\n this._isTransitioning = true;\n const complete = () => {\n this._isTransitioning = false;\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n this._element.classList.add(CLASS_NAME_COLLAPSE);\n EventHandler.trigger(this._element, EVENT_HIDDEN$6);\n };\n this._element.style[dimension] = '';\n this._queueCallback(complete, this._element, true);\n }\n _isShown(element = this._element) {\n return element.classList.contains(CLASS_NAME_SHOW$7);\n }\n\n // Private\n _configAfterMerge(config) {\n config.toggle = Boolean(config.toggle); // Coerce string values\n config.parent = getElement(config.parent);\n return config;\n }\n _getDimension() {\n return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT;\n }\n _initializeChildren() {\n if (!this._config.parent) {\n return;\n }\n const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE$4);\n for (const element of children) {\n const selected = SelectorEngine.getElementFromSelector(element);\n if (selected) {\n this._addAriaAndCollapsedClass([element], this._isShown(selected));\n }\n }\n }\n _getFirstLevelChildren(selector) {\n const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent);\n // remove children if greater depth\n return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element));\n }\n _addAriaAndCollapsedClass(triggerArray, isOpen) {\n if (!triggerArray.length) {\n return;\n }\n for (const element of triggerArray) {\n element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen);\n element.setAttribute('aria-expanded', isOpen);\n }\n }\n\n // Static\n static jQueryInterface(config) {\n const _config = {};\n if (typeof config === 'string' && /show|hide/.test(config)) {\n _config.toggle = false;\n }\n return this.each(function () {\n const data = Collapse.getOrCreateInstance(this, _config);\n if (typeof config === 'string') {\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$4, SELECTOR_DATA_TOGGLE$4, function (event) {\n // preventDefault only for elements (which change the URL) not inside the collapsible element\n if (event.target.tagName === 'A' || event.delegateTarget && event.delegateTarget.tagName === 'A') {\n event.preventDefault();\n }\n for (const element of SelectorEngine.getMultipleElementsFromSelector(this)) {\n Collapse.getOrCreateInstance(element, {\n toggle: false\n }).toggle();\n }\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Collapse);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dropdown.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$a = 'dropdown';\nconst DATA_KEY$6 = 'bs.dropdown';\nconst EVENT_KEY$6 = `.${DATA_KEY$6}`;\nconst DATA_API_KEY$3 = '.data-api';\nconst ESCAPE_KEY$2 = 'Escape';\nconst TAB_KEY$1 = 'Tab';\nconst ARROW_UP_KEY$1 = 'ArrowUp';\nconst ARROW_DOWN_KEY$1 = 'ArrowDown';\nconst RIGHT_MOUSE_BUTTON = 2; // MouseEvent.button value for the secondary button, usually the right button\n\nconst EVENT_HIDE$5 = `hide${EVENT_KEY$6}`;\nconst EVENT_HIDDEN$5 = `hidden${EVENT_KEY$6}`;\nconst EVENT_SHOW$5 = `show${EVENT_KEY$6}`;\nconst EVENT_SHOWN$5 = `shown${EVENT_KEY$6}`;\nconst EVENT_CLICK_DATA_API$3 = `click${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst CLASS_NAME_SHOW$6 = 'show';\nconst CLASS_NAME_DROPUP = 'dropup';\nconst CLASS_NAME_DROPEND = 'dropend';\nconst CLASS_NAME_DROPSTART = 'dropstart';\nconst CLASS_NAME_DROPUP_CENTER = 'dropup-center';\nconst CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center';\nconst SELECTOR_DATA_TOGGLE$3 = '[data-bs-toggle=\"dropdown\"]:not(.disabled):not(:disabled)';\nconst SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE$3}.${CLASS_NAME_SHOW$6}`;\nconst SELECTOR_MENU = '.dropdown-menu';\nconst SELECTOR_NAVBAR = '.navbar';\nconst SELECTOR_NAVBAR_NAV = '.navbar-nav';\nconst SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)';\nconst PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start';\nconst PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end';\nconst PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start';\nconst PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end';\nconst PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start';\nconst PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start';\nconst PLACEMENT_TOPCENTER = 'top';\nconst PLACEMENT_BOTTOMCENTER = 'bottom';\nconst Default$9 = {\n autoClose: true,\n boundary: 'clippingParents',\n display: 'dynamic',\n offset: [0, 2],\n popperConfig: null,\n reference: 'toggle'\n};\nconst DefaultType$9 = {\n autoClose: '(boolean|string)',\n boundary: '(string|element)',\n display: 'string',\n offset: '(array|string|function)',\n popperConfig: '(null|object|function)',\n reference: '(string|element|object)'\n};\n\n/**\n * Class definition\n */\n\nclass Dropdown extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._popper = null;\n this._parent = this._element.parentNode; // dropdown wrapper\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] || SelectorEngine.prev(this._element, SELECTOR_MENU)[0] || SelectorEngine.findOne(SELECTOR_MENU, this._parent);\n this._inNavbar = this._detectNavbar();\n }\n\n // Getters\n static get Default() {\n return Default$9;\n }\n static get DefaultType() {\n return DefaultType$9;\n }\n static get NAME() {\n return NAME$a;\n }\n\n // Public\n toggle() {\n return this._isShown() ? this.hide() : this.show();\n }\n show() {\n if (isDisabled(this._element) || this._isShown()) {\n return;\n }\n const relatedTarget = {\n relatedTarget: this._element\n };\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$5, relatedTarget);\n if (showEvent.defaultPrevented) {\n return;\n }\n this._createPopper();\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n this._element.focus();\n this._element.setAttribute('aria-expanded', true);\n this._menu.classList.add(CLASS_NAME_SHOW$6);\n this._element.classList.add(CLASS_NAME_SHOW$6);\n EventHandler.trigger(this._element, EVENT_SHOWN$5, relatedTarget);\n }\n hide() {\n if (isDisabled(this._element) || !this._isShown()) {\n return;\n }\n const relatedTarget = {\n relatedTarget: this._element\n };\n this._completeHide(relatedTarget);\n }\n dispose() {\n if (this._popper) {\n this._popper.destroy();\n }\n super.dispose();\n }\n update() {\n this._inNavbar = this._detectNavbar();\n if (this._popper) {\n this._popper.update();\n }\n }\n\n // Private\n _completeHide(relatedTarget) {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$5, relatedTarget);\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n if (this._popper) {\n this._popper.destroy();\n }\n this._menu.classList.remove(CLASS_NAME_SHOW$6);\n this._element.classList.remove(CLASS_NAME_SHOW$6);\n this._element.setAttribute('aria-expanded', 'false');\n Manipulator.removeDataAttribute(this._menu, 'popper');\n EventHandler.trigger(this._element, EVENT_HIDDEN$5, relatedTarget);\n }\n _getConfig(config) {\n config = super._getConfig(config);\n if (typeof config.reference === 'object' && !isElement(config.reference) && typeof config.reference.getBoundingClientRect !== 'function') {\n // Popper virtual elements require a getBoundingClientRect method\n throw new TypeError(`${NAME$a.toUpperCase()}: Option \"reference\" provided type \"object\" without a required \"getBoundingClientRect\" method.`);\n }\n return config;\n }\n _createPopper() {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s dropdowns require Popper (https://popper.js.org)');\n }\n let referenceElement = this._element;\n if (this._config.reference === 'parent') {\n referenceElement = this._parent;\n } else if (isElement(this._config.reference)) {\n referenceElement = getElement(this._config.reference);\n } else if (typeof this._config.reference === 'object') {\n referenceElement = this._config.reference;\n }\n const popperConfig = this._getPopperConfig();\n this._popper = Popper.createPopper(referenceElement, this._menu, popperConfig);\n }\n _isShown() {\n return this._menu.classList.contains(CLASS_NAME_SHOW$6);\n }\n _getPlacement() {\n const parentDropdown = this._parent;\n if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) {\n return PLACEMENT_RIGHT;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) {\n return PLACEMENT_LEFT;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) {\n return PLACEMENT_TOPCENTER;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) {\n return PLACEMENT_BOTTOMCENTER;\n }\n\n // We need to trim the value because custom properties can also include spaces\n const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end';\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) {\n return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP;\n }\n return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM;\n }\n _detectNavbar() {\n return this._element.closest(SELECTOR_NAVBAR) !== null;\n }\n _getOffset() {\n const {\n offset\n } = this._config;\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n return offset;\n }\n _getPopperConfig() {\n const defaultBsPopperConfig = {\n placement: this._getPlacement(),\n modifiers: [{\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }]\n };\n\n // Disable Popper if we have a static display or Dropdown is in Navbar\n if (this._inNavbar || this._config.display === 'static') {\n Manipulator.setDataAttribute(this._menu, 'popper', 'static'); // TODO: v6 remove\n defaultBsPopperConfig.modifiers = [{\n name: 'applyStyles',\n enabled: false\n }];\n }\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n };\n }\n _selectMenuItem({\n key,\n target\n }) {\n const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element));\n if (!items.length) {\n return;\n }\n\n // if target isn't included in items (e.g. when expanding the dropdown)\n // allow cycling to get the last item in case key equals ARROW_UP_KEY\n getNextActiveElement(items, target, key === ARROW_DOWN_KEY$1, !items.includes(target)).focus();\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Dropdown.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n static clearMenus(event) {\n if (event.button === RIGHT_MOUSE_BUTTON || event.type === 'keyup' && event.key !== TAB_KEY$1) {\n return;\n }\n const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN);\n for (const toggle of openToggles) {\n const context = Dropdown.getInstance(toggle);\n if (!context || context._config.autoClose === false) {\n continue;\n }\n const composedPath = event.composedPath();\n const isMenuTarget = composedPath.includes(context._menu);\n if (composedPath.includes(context._element) || context._config.autoClose === 'inside' && !isMenuTarget || context._config.autoClose === 'outside' && isMenuTarget) {\n continue;\n }\n\n // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu\n if (context._menu.contains(event.target) && (event.type === 'keyup' && event.key === TAB_KEY$1 || /input|select|option|textarea|form/i.test(event.target.tagName))) {\n continue;\n }\n const relatedTarget = {\n relatedTarget: context._element\n };\n if (event.type === 'click') {\n relatedTarget.clickEvent = event;\n }\n context._completeHide(relatedTarget);\n }\n }\n static dataApiKeydownHandler(event) {\n // If not an UP | DOWN | ESCAPE key => not a dropdown command\n // If input/textarea && if key is other than ESCAPE => not a dropdown command\n\n const isInput = /input|textarea/i.test(event.target.tagName);\n const isEscapeEvent = event.key === ESCAPE_KEY$2;\n const isUpOrDownEvent = [ARROW_UP_KEY$1, ARROW_DOWN_KEY$1].includes(event.key);\n if (!isUpOrDownEvent && !isEscapeEvent) {\n return;\n }\n if (isInput && !isEscapeEvent) {\n return;\n }\n event.preventDefault();\n\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE$3) ? this : SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.next(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.findOne(SELECTOR_DATA_TOGGLE$3, event.delegateTarget.parentNode);\n const instance = Dropdown.getOrCreateInstance(getToggleButton);\n if (isUpOrDownEvent) {\n event.stopPropagation();\n instance.show();\n instance._selectMenuItem(event);\n return;\n }\n if (instance._isShown()) {\n // else is escape and we check if it is shown\n event.stopPropagation();\n instance.hide();\n getToggleButton.focus();\n }\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE$3, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, SELECTOR_DATA_TOGGLE$3, function (event) {\n event.preventDefault();\n Dropdown.getOrCreateInstance(this).toggle();\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Dropdown);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/backdrop.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$9 = 'backdrop';\nconst CLASS_NAME_FADE$4 = 'fade';\nconst CLASS_NAME_SHOW$5 = 'show';\nconst EVENT_MOUSEDOWN = `mousedown.bs.${NAME$9}`;\nconst Default$8 = {\n className: 'modal-backdrop',\n clickCallback: null,\n isAnimated: false,\n isVisible: true,\n // if false, we use the backdrop helper without adding any element to the dom\n rootElement: 'body' // give the choice to place backdrop under different elements\n};\nconst DefaultType$8 = {\n className: 'string',\n clickCallback: '(function|null)',\n isAnimated: 'boolean',\n isVisible: 'boolean',\n rootElement: '(element|string)'\n};\n\n/**\n * Class definition\n */\n\nclass Backdrop extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isAppended = false;\n this._element = null;\n }\n\n // Getters\n static get Default() {\n return Default$8;\n }\n static get DefaultType() {\n return DefaultType$8;\n }\n static get NAME() {\n return NAME$9;\n }\n\n // Public\n show(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n this._append();\n const element = this._getElement();\n if (this._config.isAnimated) {\n reflow(element);\n }\n element.classList.add(CLASS_NAME_SHOW$5);\n this._emulateAnimation(() => {\n execute(callback);\n });\n }\n hide(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n this._getElement().classList.remove(CLASS_NAME_SHOW$5);\n this._emulateAnimation(() => {\n this.dispose();\n execute(callback);\n });\n }\n dispose() {\n if (!this._isAppended) {\n return;\n }\n EventHandler.off(this._element, EVENT_MOUSEDOWN);\n this._element.remove();\n this._isAppended = false;\n }\n\n // Private\n _getElement() {\n if (!this._element) {\n const backdrop = document.createElement('div');\n backdrop.className = this._config.className;\n if (this._config.isAnimated) {\n backdrop.classList.add(CLASS_NAME_FADE$4);\n }\n this._element = backdrop;\n }\n return this._element;\n }\n _configAfterMerge(config) {\n // use getElement() with the default \"body\" to get a fresh Element on each instantiation\n config.rootElement = getElement(config.rootElement);\n return config;\n }\n _append() {\n if (this._isAppended) {\n return;\n }\n const element = this._getElement();\n this._config.rootElement.append(element);\n EventHandler.on(element, EVENT_MOUSEDOWN, () => {\n execute(this._config.clickCallback);\n });\n this._isAppended = true;\n }\n _emulateAnimation(callback) {\n executeAfterTransition(callback, this._getElement(), this._config.isAnimated);\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/focustrap.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$8 = 'focustrap';\nconst DATA_KEY$5 = 'bs.focustrap';\nconst EVENT_KEY$5 = `.${DATA_KEY$5}`;\nconst EVENT_FOCUSIN$2 = `focusin${EVENT_KEY$5}`;\nconst EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY$5}`;\nconst TAB_KEY = 'Tab';\nconst TAB_NAV_FORWARD = 'forward';\nconst TAB_NAV_BACKWARD = 'backward';\nconst Default$7 = {\n autofocus: true,\n trapElement: null // The element to trap focus inside of\n};\nconst DefaultType$7 = {\n autofocus: 'boolean',\n trapElement: 'element'\n};\n\n/**\n * Class definition\n */\n\nclass FocusTrap extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isActive = false;\n this._lastTabNavDirection = null;\n }\n\n // Getters\n static get Default() {\n return Default$7;\n }\n static get DefaultType() {\n return DefaultType$7;\n }\n static get NAME() {\n return NAME$8;\n }\n\n // Public\n activate() {\n if (this._isActive) {\n return;\n }\n if (this._config.autofocus) {\n this._config.trapElement.focus();\n }\n EventHandler.off(document, EVENT_KEY$5); // guard against infinite focus loop\n EventHandler.on(document, EVENT_FOCUSIN$2, event => this._handleFocusin(event));\n EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event));\n this._isActive = true;\n }\n deactivate() {\n if (!this._isActive) {\n return;\n }\n this._isActive = false;\n EventHandler.off(document, EVENT_KEY$5);\n }\n\n // Private\n _handleFocusin(event) {\n const {\n trapElement\n } = this._config;\n if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) {\n return;\n }\n const elements = SelectorEngine.focusableChildren(trapElement);\n if (elements.length === 0) {\n trapElement.focus();\n } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) {\n elements[elements.length - 1].focus();\n } else {\n elements[0].focus();\n }\n }\n _handleKeydown(event) {\n if (event.key !== TAB_KEY) {\n return;\n }\n this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/scrollBar.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top';\nconst SELECTOR_STICKY_CONTENT = '.sticky-top';\nconst PROPERTY_PADDING = 'padding-right';\nconst PROPERTY_MARGIN = 'margin-right';\n\n/**\n * Class definition\n */\n\nclass ScrollBarHelper {\n constructor() {\n this._element = document.body;\n }\n\n // Public\n getWidth() {\n // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes\n const documentWidth = document.documentElement.clientWidth;\n return Math.abs(window.innerWidth - documentWidth);\n }\n hide() {\n const width = this.getWidth();\n this._disableOverFlow();\n // give padding to element to balance the hidden scrollbar width\n this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth\n this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width);\n }\n reset() {\n this._resetElementAttributes(this._element, 'overflow');\n this._resetElementAttributes(this._element, PROPERTY_PADDING);\n this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING);\n this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN);\n }\n isOverflowing() {\n return this.getWidth() > 0;\n }\n\n // Private\n _disableOverFlow() {\n this._saveInitialAttribute(this._element, 'overflow');\n this._element.style.overflow = 'hidden';\n }\n _setElementAttributes(selector, styleProperty, callback) {\n const scrollbarWidth = this.getWidth();\n const manipulationCallBack = element => {\n if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) {\n return;\n }\n this._saveInitialAttribute(element, styleProperty);\n const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty);\n element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`);\n };\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n _saveInitialAttribute(element, styleProperty) {\n const actualValue = element.style.getPropertyValue(styleProperty);\n if (actualValue) {\n Manipulator.setDataAttribute(element, styleProperty, actualValue);\n }\n }\n _resetElementAttributes(selector, styleProperty) {\n const manipulationCallBack = element => {\n const value = Manipulator.getDataAttribute(element, styleProperty);\n // We only want to remove the property if the value is `null`; the value can also be zero\n if (value === null) {\n element.style.removeProperty(styleProperty);\n return;\n }\n Manipulator.removeDataAttribute(element, styleProperty);\n element.style.setProperty(styleProperty, value);\n };\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n _applyManipulationCallback(selector, callBack) {\n if (isElement(selector)) {\n callBack(selector);\n return;\n }\n for (const sel of SelectorEngine.find(selector, this._element)) {\n callBack(sel);\n }\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap modal.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$7 = 'modal';\nconst DATA_KEY$4 = 'bs.modal';\nconst EVENT_KEY$4 = `.${DATA_KEY$4}`;\nconst DATA_API_KEY$2 = '.data-api';\nconst ESCAPE_KEY$1 = 'Escape';\nconst EVENT_HIDE$4 = `hide${EVENT_KEY$4}`;\nconst EVENT_HIDE_PREVENTED$1 = `hidePrevented${EVENT_KEY$4}`;\nconst EVENT_HIDDEN$4 = `hidden${EVENT_KEY$4}`;\nconst EVENT_SHOW$4 = `show${EVENT_KEY$4}`;\nconst EVENT_SHOWN$4 = `shown${EVENT_KEY$4}`;\nconst EVENT_RESIZE$1 = `resize${EVENT_KEY$4}`;\nconst EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY$4}`;\nconst EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY$4}`;\nconst EVENT_KEYDOWN_DISMISS$1 = `keydown.dismiss${EVENT_KEY$4}`;\nconst EVENT_CLICK_DATA_API$2 = `click${EVENT_KEY$4}${DATA_API_KEY$2}`;\nconst CLASS_NAME_OPEN = 'modal-open';\nconst CLASS_NAME_FADE$3 = 'fade';\nconst CLASS_NAME_SHOW$4 = 'show';\nconst CLASS_NAME_STATIC = 'modal-static';\nconst OPEN_SELECTOR$1 = '.modal.show';\nconst SELECTOR_DIALOG = '.modal-dialog';\nconst SELECTOR_MODAL_BODY = '.modal-body';\nconst SELECTOR_DATA_TOGGLE$2 = '[data-bs-toggle=\"modal\"]';\nconst Default$6 = {\n backdrop: true,\n focus: true,\n keyboard: true\n};\nconst DefaultType$6 = {\n backdrop: '(boolean|string)',\n focus: 'boolean',\n keyboard: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Modal extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element);\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._isShown = false;\n this._isTransitioning = false;\n this._scrollBar = new ScrollBarHelper();\n this._addEventListeners();\n }\n\n // Getters\n static get Default() {\n return Default$6;\n }\n static get DefaultType() {\n return DefaultType$6;\n }\n static get NAME() {\n return NAME$7;\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n show(relatedTarget) {\n if (this._isShown || this._isTransitioning) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$4, {\n relatedTarget\n });\n if (showEvent.defaultPrevented) {\n return;\n }\n this._isShown = true;\n this._isTransitioning = true;\n this._scrollBar.hide();\n document.body.classList.add(CLASS_NAME_OPEN);\n this._adjustDialog();\n this._backdrop.show(() => this._showElement(relatedTarget));\n }\n hide() {\n if (!this._isShown || this._isTransitioning) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$4);\n if (hideEvent.defaultPrevented) {\n return;\n }\n this._isShown = false;\n this._isTransitioning = true;\n this._focustrap.deactivate();\n this._element.classList.remove(CLASS_NAME_SHOW$4);\n this._queueCallback(() => this._hideModal(), this._element, this._isAnimated());\n }\n dispose() {\n EventHandler.off(window, EVENT_KEY$4);\n EventHandler.off(this._dialog, EVENT_KEY$4);\n this._backdrop.dispose();\n this._focustrap.deactivate();\n super.dispose();\n }\n handleUpdate() {\n this._adjustDialog();\n }\n\n // Private\n _initializeBackDrop() {\n return new Backdrop({\n isVisible: Boolean(this._config.backdrop),\n // 'static' option will be translated to true, and booleans will keep their value,\n isAnimated: this._isAnimated()\n });\n }\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n _showElement(relatedTarget) {\n // try to append dynamic modal\n if (!document.body.contains(this._element)) {\n document.body.append(this._element);\n }\n this._element.style.display = 'block';\n this._element.removeAttribute('aria-hidden');\n this._element.setAttribute('aria-modal', true);\n this._element.setAttribute('role', 'dialog');\n this._element.scrollTop = 0;\n const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog);\n if (modalBody) {\n modalBody.scrollTop = 0;\n }\n reflow(this._element);\n this._element.classList.add(CLASS_NAME_SHOW$4);\n const transitionComplete = () => {\n if (this._config.focus) {\n this._focustrap.activate();\n }\n this._isTransitioning = false;\n EventHandler.trigger(this._element, EVENT_SHOWN$4, {\n relatedTarget\n });\n };\n this._queueCallback(transitionComplete, this._dialog, this._isAnimated());\n }\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS$1, event => {\n if (event.key !== ESCAPE_KEY$1) {\n return;\n }\n if (this._config.keyboard) {\n this.hide();\n return;\n }\n this._triggerBackdropTransition();\n });\n EventHandler.on(window, EVENT_RESIZE$1, () => {\n if (this._isShown && !this._isTransitioning) {\n this._adjustDialog();\n }\n });\n EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => {\n // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks\n EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => {\n if (this._element !== event.target || this._element !== event2.target) {\n return;\n }\n if (this._config.backdrop === 'static') {\n this._triggerBackdropTransition();\n return;\n }\n if (this._config.backdrop) {\n this.hide();\n }\n });\n });\n }\n _hideModal() {\n this._element.style.display = 'none';\n this._element.setAttribute('aria-hidden', true);\n this._element.removeAttribute('aria-modal');\n this._element.removeAttribute('role');\n this._isTransitioning = false;\n this._backdrop.hide(() => {\n document.body.classList.remove(CLASS_NAME_OPEN);\n this._resetAdjustments();\n this._scrollBar.reset();\n EventHandler.trigger(this._element, EVENT_HIDDEN$4);\n });\n }\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_FADE$3);\n }\n _triggerBackdropTransition() {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED$1);\n if (hideEvent.defaultPrevented) {\n return;\n }\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const initialOverflowY = this._element.style.overflowY;\n // return if the following background transition hasn't yet completed\n if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) {\n return;\n }\n if (!isModalOverflowing) {\n this._element.style.overflowY = 'hidden';\n }\n this._element.classList.add(CLASS_NAME_STATIC);\n this._queueCallback(() => {\n this._element.classList.remove(CLASS_NAME_STATIC);\n this._queueCallback(() => {\n this._element.style.overflowY = initialOverflowY;\n }, this._dialog);\n }, this._dialog);\n this._element.focus();\n }\n\n /**\n * The following methods are used to handle overflowing modals\n */\n\n _adjustDialog() {\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const scrollbarWidth = this._scrollBar.getWidth();\n const isBodyOverflowing = scrollbarWidth > 0;\n if (isBodyOverflowing && !isModalOverflowing) {\n const property = isRTL() ? 'paddingLeft' : 'paddingRight';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n if (!isBodyOverflowing && isModalOverflowing) {\n const property = isRTL() ? 'paddingRight' : 'paddingLeft';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n }\n _resetAdjustments() {\n this._element.style.paddingLeft = '';\n this._element.style.paddingRight = '';\n }\n\n // Static\n static jQueryInterface(config, relatedTarget) {\n return this.each(function () {\n const data = Modal.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](relatedTarget);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$2, SELECTOR_DATA_TOGGLE$2, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n EventHandler.one(target, EVENT_SHOW$4, showEvent => {\n if (showEvent.defaultPrevented) {\n // only register focus restorer if modal will actually get shown\n return;\n }\n EventHandler.one(target, EVENT_HIDDEN$4, () => {\n if (isVisible(this)) {\n this.focus();\n }\n });\n });\n\n // avoid conflict when clicking modal toggler while another one is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR$1);\n if (alreadyOpen) {\n Modal.getInstance(alreadyOpen).hide();\n }\n const data = Modal.getOrCreateInstance(target);\n data.toggle(this);\n});\nenableDismissTrigger(Modal);\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Modal);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap offcanvas.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$6 = 'offcanvas';\nconst DATA_KEY$3 = 'bs.offcanvas';\nconst EVENT_KEY$3 = `.${DATA_KEY$3}`;\nconst DATA_API_KEY$1 = '.data-api';\nconst EVENT_LOAD_DATA_API$2 = `load${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst ESCAPE_KEY = 'Escape';\nconst CLASS_NAME_SHOW$3 = 'show';\nconst CLASS_NAME_SHOWING$1 = 'showing';\nconst CLASS_NAME_HIDING = 'hiding';\nconst CLASS_NAME_BACKDROP = 'offcanvas-backdrop';\nconst OPEN_SELECTOR = '.offcanvas.show';\nconst EVENT_SHOW$3 = `show${EVENT_KEY$3}`;\nconst EVENT_SHOWN$3 = `shown${EVENT_KEY$3}`;\nconst EVENT_HIDE$3 = `hide${EVENT_KEY$3}`;\nconst EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY$3}`;\nconst EVENT_HIDDEN$3 = `hidden${EVENT_KEY$3}`;\nconst EVENT_RESIZE = `resize${EVENT_KEY$3}`;\nconst EVENT_CLICK_DATA_API$1 = `click${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY$3}`;\nconst SELECTOR_DATA_TOGGLE$1 = '[data-bs-toggle=\"offcanvas\"]';\nconst Default$5 = {\n backdrop: true,\n keyboard: true,\n scroll: false\n};\nconst DefaultType$5 = {\n backdrop: '(boolean|string)',\n keyboard: 'boolean',\n scroll: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Offcanvas extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isShown = false;\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._addEventListeners();\n }\n\n // Getters\n static get Default() {\n return Default$5;\n }\n static get DefaultType() {\n return DefaultType$5;\n }\n static get NAME() {\n return NAME$6;\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n show(relatedTarget) {\n if (this._isShown) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$3, {\n relatedTarget\n });\n if (showEvent.defaultPrevented) {\n return;\n }\n this._isShown = true;\n this._backdrop.show();\n if (!this._config.scroll) {\n new ScrollBarHelper().hide();\n }\n this._element.setAttribute('aria-modal', true);\n this._element.setAttribute('role', 'dialog');\n this._element.classList.add(CLASS_NAME_SHOWING$1);\n const completeCallBack = () => {\n if (!this._config.scroll || this._config.backdrop) {\n this._focustrap.activate();\n }\n this._element.classList.add(CLASS_NAME_SHOW$3);\n this._element.classList.remove(CLASS_NAME_SHOWING$1);\n EventHandler.trigger(this._element, EVENT_SHOWN$3, {\n relatedTarget\n });\n };\n this._queueCallback(completeCallBack, this._element, true);\n }\n hide() {\n if (!this._isShown) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$3);\n if (hideEvent.defaultPrevented) {\n return;\n }\n this._focustrap.deactivate();\n this._element.blur();\n this._isShown = false;\n this._element.classList.add(CLASS_NAME_HIDING);\n this._backdrop.hide();\n const completeCallback = () => {\n this._element.classList.remove(CLASS_NAME_SHOW$3, CLASS_NAME_HIDING);\n this._element.removeAttribute('aria-modal');\n this._element.removeAttribute('role');\n if (!this._config.scroll) {\n new ScrollBarHelper().reset();\n }\n EventHandler.trigger(this._element, EVENT_HIDDEN$3);\n };\n this._queueCallback(completeCallback, this._element, true);\n }\n dispose() {\n this._backdrop.dispose();\n this._focustrap.deactivate();\n super.dispose();\n }\n\n // Private\n _initializeBackDrop() {\n const clickCallback = () => {\n if (this._config.backdrop === 'static') {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n return;\n }\n this.hide();\n };\n\n // 'static' option will be translated to true, and booleans will keep their value\n const isVisible = Boolean(this._config.backdrop);\n return new Backdrop({\n className: CLASS_NAME_BACKDROP,\n isVisible,\n isAnimated: true,\n rootElement: this._element.parentNode,\n clickCallback: isVisible ? clickCallback : null\n });\n }\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {\n if (event.key !== ESCAPE_KEY) {\n return;\n }\n if (this._config.keyboard) {\n this.hide();\n return;\n }\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n });\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Offcanvas.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](this);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$1, SELECTOR_DATA_TOGGLE$1, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n if (isDisabled(this)) {\n return;\n }\n EventHandler.one(target, EVENT_HIDDEN$3, () => {\n // focus on trigger when it is closed\n if (isVisible(this)) {\n this.focus();\n }\n });\n\n // avoid conflict when clicking a toggler of an offcanvas, while another is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR);\n if (alreadyOpen && alreadyOpen !== target) {\n Offcanvas.getInstance(alreadyOpen).hide();\n }\n const data = Offcanvas.getOrCreateInstance(target);\n data.toggle(this);\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$2, () => {\n for (const selector of SelectorEngine.find(OPEN_SELECTOR)) {\n Offcanvas.getOrCreateInstance(selector).show();\n }\n});\nEventHandler.on(window, EVENT_RESIZE, () => {\n for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) {\n if (getComputedStyle(element).position !== 'fixed') {\n Offcanvas.getOrCreateInstance(element).hide();\n }\n }\n});\nenableDismissTrigger(Offcanvas);\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Offcanvas);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/sanitizer.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n// js-docs-start allow-list\nconst ARIA_ATTRIBUTE_PATTERN = /^aria-[\\w-]*$/i;\nconst DefaultAllowlist = {\n // Global attributes allowed on any supplied element below.\n '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],\n a: ['target', 'href', 'title', 'rel'],\n area: [],\n b: [],\n br: [],\n col: [],\n code: [],\n dd: [],\n div: [],\n dl: [],\n dt: [],\n em: [],\n hr: [],\n h1: [],\n h2: [],\n h3: [],\n h4: [],\n h5: [],\n h6: [],\n i: [],\n img: ['src', 'srcset', 'alt', 'title', 'width', 'height'],\n li: [],\n ol: [],\n p: [],\n pre: [],\n s: [],\n small: [],\n span: [],\n sub: [],\n sup: [],\n strong: [],\n u: [],\n ul: []\n};\n// js-docs-end allow-list\n\nconst uriAttributes = new Set(['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']);\n\n/**\n * A pattern that recognizes URLs that are safe wrt. XSS in URL navigation\n * contexts.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/15.2.8/packages/core/src/sanitization/url_sanitizer.ts#L38\n */\n// eslint-disable-next-line unicorn/better-regex\nconst SAFE_URL_PATTERN = /^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i;\nconst allowedAttribute = (attribute, allowedAttributeList) => {\n const attributeName = attribute.nodeName.toLowerCase();\n if (allowedAttributeList.includes(attributeName)) {\n if (uriAttributes.has(attributeName)) {\n return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue));\n }\n return true;\n }\n\n // Check if a regular expression validates the attribute.\n return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp).some(regex => regex.test(attributeName));\n};\nfunction sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) {\n if (!unsafeHtml.length) {\n return unsafeHtml;\n }\n if (sanitizeFunction && typeof sanitizeFunction === 'function') {\n return sanitizeFunction(unsafeHtml);\n }\n const domParser = new window.DOMParser();\n const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html');\n const elements = [].concat(...createdDocument.body.querySelectorAll('*'));\n for (const element of elements) {\n const elementName = element.nodeName.toLowerCase();\n if (!Object.keys(allowList).includes(elementName)) {\n element.remove();\n continue;\n }\n const attributeList = [].concat(...element.attributes);\n const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || []);\n for (const attribute of attributeList) {\n if (!allowedAttribute(attribute, allowedAttributes)) {\n element.removeAttribute(attribute.nodeName);\n }\n }\n }\n return createdDocument.body.innerHTML;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/template-factory.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$5 = 'TemplateFactory';\nconst Default$4 = {\n allowList: DefaultAllowlist,\n content: {},\n // { selector : text , selector2 : text2 , }\n extraClass: '',\n html: false,\n sanitize: true,\n sanitizeFn: null,\n template: '
'\n};\nconst DefaultType$4 = {\n allowList: 'object',\n content: 'object',\n extraClass: '(string|function)',\n html: 'boolean',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n template: 'string'\n};\nconst DefaultContentType = {\n entry: '(string|element|function|null)',\n selector: '(string|element)'\n};\n\n/**\n * Class definition\n */\n\nclass TemplateFactory extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n }\n\n // Getters\n static get Default() {\n return Default$4;\n }\n static get DefaultType() {\n return DefaultType$4;\n }\n static get NAME() {\n return NAME$5;\n }\n\n // Public\n getContent() {\n return Object.values(this._config.content).map(config => this._resolvePossibleFunction(config)).filter(Boolean);\n }\n hasContent() {\n return this.getContent().length > 0;\n }\n changeContent(content) {\n this._checkContent(content);\n this._config.content = {\n ...this._config.content,\n ...content\n };\n return this;\n }\n toHtml() {\n const templateWrapper = document.createElement('div');\n templateWrapper.innerHTML = this._maybeSanitize(this._config.template);\n for (const [selector, text] of Object.entries(this._config.content)) {\n this._setContent(templateWrapper, text, selector);\n }\n const template = templateWrapper.children[0];\n const extraClass = this._resolvePossibleFunction(this._config.extraClass);\n if (extraClass) {\n template.classList.add(...extraClass.split(' '));\n }\n return template;\n }\n\n // Private\n _typeCheckConfig(config) {\n super._typeCheckConfig(config);\n this._checkContent(config.content);\n }\n _checkContent(arg) {\n for (const [selector, content] of Object.entries(arg)) {\n super._typeCheckConfig({\n selector,\n entry: content\n }, DefaultContentType);\n }\n }\n _setContent(template, content, selector) {\n const templateElement = SelectorEngine.findOne(selector, template);\n if (!templateElement) {\n return;\n }\n content = this._resolvePossibleFunction(content);\n if (!content) {\n templateElement.remove();\n return;\n }\n if (isElement(content)) {\n this._putElementInTemplate(getElement(content), templateElement);\n return;\n }\n if (this._config.html) {\n templateElement.innerHTML = this._maybeSanitize(content);\n return;\n }\n templateElement.textContent = content;\n }\n _maybeSanitize(arg) {\n return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg;\n }\n _resolvePossibleFunction(arg) {\n return execute(arg, [this]);\n }\n _putElementInTemplate(element, templateElement) {\n if (this._config.html) {\n templateElement.innerHTML = '';\n templateElement.append(element);\n return;\n }\n templateElement.textContent = element.textContent;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap tooltip.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$4 = 'tooltip';\nconst DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn']);\nconst CLASS_NAME_FADE$2 = 'fade';\nconst CLASS_NAME_MODAL = 'modal';\nconst CLASS_NAME_SHOW$2 = 'show';\nconst SELECTOR_TOOLTIP_INNER = '.tooltip-inner';\nconst SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`;\nconst EVENT_MODAL_HIDE = 'hide.bs.modal';\nconst TRIGGER_HOVER = 'hover';\nconst TRIGGER_FOCUS = 'focus';\nconst TRIGGER_CLICK = 'click';\nconst TRIGGER_MANUAL = 'manual';\nconst EVENT_HIDE$2 = 'hide';\nconst EVENT_HIDDEN$2 = 'hidden';\nconst EVENT_SHOW$2 = 'show';\nconst EVENT_SHOWN$2 = 'shown';\nconst EVENT_INSERTED = 'inserted';\nconst EVENT_CLICK$1 = 'click';\nconst EVENT_FOCUSIN$1 = 'focusin';\nconst EVENT_FOCUSOUT$1 = 'focusout';\nconst EVENT_MOUSEENTER = 'mouseenter';\nconst EVENT_MOUSELEAVE = 'mouseleave';\nconst AttachmentMap = {\n AUTO: 'auto',\n TOP: 'top',\n RIGHT: isRTL() ? 'left' : 'right',\n BOTTOM: 'bottom',\n LEFT: isRTL() ? 'right' : 'left'\n};\nconst Default$3 = {\n allowList: DefaultAllowlist,\n animation: true,\n boundary: 'clippingParents',\n container: false,\n customClass: '',\n delay: 0,\n fallbackPlacements: ['top', 'right', 'bottom', 'left'],\n html: false,\n offset: [0, 6],\n placement: 'top',\n popperConfig: null,\n sanitize: true,\n sanitizeFn: null,\n selector: false,\n template: '
' + '
' + '
' + '
',\n title: '',\n trigger: 'hover focus'\n};\nconst DefaultType$3 = {\n allowList: 'object',\n animation: 'boolean',\n boundary: '(string|element)',\n container: '(string|element|boolean)',\n customClass: '(string|function)',\n delay: '(number|object)',\n fallbackPlacements: 'array',\n html: 'boolean',\n offset: '(array|string|function)',\n placement: '(string|function)',\n popperConfig: '(null|object|function)',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n selector: '(string|boolean)',\n template: 'string',\n title: '(string|element|function)',\n trigger: 'string'\n};\n\n/**\n * Class definition\n */\n\nclass Tooltip extends BaseComponent {\n constructor(element, config) {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s tooltips require Popper (https://popper.js.org)');\n }\n super(element, config);\n\n // Private\n this._isEnabled = true;\n this._timeout = 0;\n this._isHovered = null;\n this._activeTrigger = {};\n this._popper = null;\n this._templateFactory = null;\n this._newContent = null;\n\n // Protected\n this.tip = null;\n this._setListeners();\n if (!this._config.selector) {\n this._fixTitle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$3;\n }\n static get DefaultType() {\n return DefaultType$3;\n }\n static get NAME() {\n return NAME$4;\n }\n\n // Public\n enable() {\n this._isEnabled = true;\n }\n disable() {\n this._isEnabled = false;\n }\n toggleEnabled() {\n this._isEnabled = !this._isEnabled;\n }\n toggle() {\n if (!this._isEnabled) {\n return;\n }\n this._activeTrigger.click = !this._activeTrigger.click;\n if (this._isShown()) {\n this._leave();\n return;\n }\n this._enter();\n }\n dispose() {\n clearTimeout(this._timeout);\n EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n if (this._element.getAttribute('data-bs-original-title')) {\n this._element.setAttribute('title', this._element.getAttribute('data-bs-original-title'));\n }\n this._disposePopper();\n super.dispose();\n }\n show() {\n if (this._element.style.display === 'none') {\n throw new Error('Please use show on visible elements');\n }\n if (!(this._isWithContent() && this._isEnabled)) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW$2));\n const shadowRoot = findShadowRoot(this._element);\n const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element);\n if (showEvent.defaultPrevented || !isInTheDom) {\n return;\n }\n\n // TODO: v6 remove this or make it optional\n this._disposePopper();\n const tip = this._getTipElement();\n this._element.setAttribute('aria-describedby', tip.getAttribute('id'));\n const {\n container\n } = this._config;\n if (!this._element.ownerDocument.documentElement.contains(this.tip)) {\n container.append(tip);\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED));\n }\n this._popper = this._createPopper(tip);\n tip.classList.add(CLASS_NAME_SHOW$2);\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n const complete = () => {\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN$2));\n if (this._isHovered === false) {\n this._leave();\n }\n this._isHovered = false;\n };\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n hide() {\n if (!this._isShown()) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE$2));\n if (hideEvent.defaultPrevented) {\n return;\n }\n const tip = this._getTipElement();\n tip.classList.remove(CLASS_NAME_SHOW$2);\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n this._activeTrigger[TRIGGER_CLICK] = false;\n this._activeTrigger[TRIGGER_FOCUS] = false;\n this._activeTrigger[TRIGGER_HOVER] = false;\n this._isHovered = null; // it is a trick to support manual triggering\n\n const complete = () => {\n if (this._isWithActiveTrigger()) {\n return;\n }\n if (!this._isHovered) {\n this._disposePopper();\n }\n this._element.removeAttribute('aria-describedby');\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN$2));\n };\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n update() {\n if (this._popper) {\n this._popper.update();\n }\n }\n\n // Protected\n _isWithContent() {\n return Boolean(this._getTitle());\n }\n _getTipElement() {\n if (!this.tip) {\n this.tip = this._createTipElement(this._newContent || this._getContentForTemplate());\n }\n return this.tip;\n }\n _createTipElement(content) {\n const tip = this._getTemplateFactory(content).toHtml();\n\n // TODO: remove this check in v6\n if (!tip) {\n return null;\n }\n tip.classList.remove(CLASS_NAME_FADE$2, CLASS_NAME_SHOW$2);\n // TODO: v6 the following can be achieved with CSS only\n tip.classList.add(`bs-${this.constructor.NAME}-auto`);\n const tipId = getUID(this.constructor.NAME).toString();\n tip.setAttribute('id', tipId);\n if (this._isAnimated()) {\n tip.classList.add(CLASS_NAME_FADE$2);\n }\n return tip;\n }\n setContent(content) {\n this._newContent = content;\n if (this._isShown()) {\n this._disposePopper();\n this.show();\n }\n }\n _getTemplateFactory(content) {\n if (this._templateFactory) {\n this._templateFactory.changeContent(content);\n } else {\n this._templateFactory = new TemplateFactory({\n ...this._config,\n // the `content` var has to be after `this._config`\n // to override config.content in case of popover\n content,\n extraClass: this._resolvePossibleFunction(this._config.customClass)\n });\n }\n return this._templateFactory;\n }\n _getContentForTemplate() {\n return {\n [SELECTOR_TOOLTIP_INNER]: this._getTitle()\n };\n }\n _getTitle() {\n return this._resolvePossibleFunction(this._config.title) || this._element.getAttribute('data-bs-original-title');\n }\n\n // Private\n _initializeOnDelegatedTarget(event) {\n return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig());\n }\n _isAnimated() {\n return this._config.animation || this.tip && this.tip.classList.contains(CLASS_NAME_FADE$2);\n }\n _isShown() {\n return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW$2);\n }\n _createPopper(tip) {\n const placement = execute(this._config.placement, [this, tip, this._element]);\n const attachment = AttachmentMap[placement.toUpperCase()];\n return Popper.createPopper(this._element, tip, this._getPopperConfig(attachment));\n }\n _getOffset() {\n const {\n offset\n } = this._config;\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n return offset;\n }\n _resolvePossibleFunction(arg) {\n return execute(arg, [this._element]);\n }\n _getPopperConfig(attachment) {\n const defaultBsPopperConfig = {\n placement: attachment,\n modifiers: [{\n name: 'flip',\n options: {\n fallbackPlacements: this._config.fallbackPlacements\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }, {\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'arrow',\n options: {\n element: `.${this.constructor.NAME}-arrow`\n }\n }, {\n name: 'preSetPlacement',\n enabled: true,\n phase: 'beforeMain',\n fn: data => {\n // Pre-set Popper's placement attribute in order to read the arrow sizes properly.\n // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement\n this._getTipElement().setAttribute('data-popper-placement', data.state.placement);\n }\n }]\n };\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n };\n }\n _setListeners() {\n const triggers = this._config.trigger.split(' ');\n for (const trigger of triggers) {\n if (trigger === 'click') {\n EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK$1), this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context.toggle();\n });\n } else if (trigger !== TRIGGER_MANUAL) {\n const eventIn = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSEENTER) : this.constructor.eventName(EVENT_FOCUSIN$1);\n const eventOut = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSELEAVE) : this.constructor.eventName(EVENT_FOCUSOUT$1);\n EventHandler.on(this._element, eventIn, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true;\n context._enter();\n });\n EventHandler.on(this._element, eventOut, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] = context._element.contains(event.relatedTarget);\n context._leave();\n });\n }\n }\n this._hideModalHandler = () => {\n if (this._element) {\n this.hide();\n }\n };\n EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n }\n _fixTitle() {\n const title = this._element.getAttribute('title');\n if (!title) {\n return;\n }\n if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) {\n this._element.setAttribute('aria-label', title);\n }\n this._element.setAttribute('data-bs-original-title', title); // DO NOT USE IT. Is only for backwards compatibility\n this._element.removeAttribute('title');\n }\n _enter() {\n if (this._isShown() || this._isHovered) {\n this._isHovered = true;\n return;\n }\n this._isHovered = true;\n this._setTimeout(() => {\n if (this._isHovered) {\n this.show();\n }\n }, this._config.delay.show);\n }\n _leave() {\n if (this._isWithActiveTrigger()) {\n return;\n }\n this._isHovered = false;\n this._setTimeout(() => {\n if (!this._isHovered) {\n this.hide();\n }\n }, this._config.delay.hide);\n }\n _setTimeout(handler, timeout) {\n clearTimeout(this._timeout);\n this._timeout = setTimeout(handler, timeout);\n }\n _isWithActiveTrigger() {\n return Object.values(this._activeTrigger).includes(true);\n }\n _getConfig(config) {\n const dataAttributes = Manipulator.getDataAttributes(this._element);\n for (const dataAttribute of Object.keys(dataAttributes)) {\n if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) {\n delete dataAttributes[dataAttribute];\n }\n }\n config = {\n ...dataAttributes,\n ...(typeof config === 'object' && config ? config : {})\n };\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n _configAfterMerge(config) {\n config.container = config.container === false ? document.body : getElement(config.container);\n if (typeof config.delay === 'number') {\n config.delay = {\n show: config.delay,\n hide: config.delay\n };\n }\n if (typeof config.title === 'number') {\n config.title = config.title.toString();\n }\n if (typeof config.content === 'number') {\n config.content = config.content.toString();\n }\n return config;\n }\n _getDelegateConfig() {\n const config = {};\n for (const [key, value] of Object.entries(this._config)) {\n if (this.constructor.Default[key] !== value) {\n config[key] = value;\n }\n }\n config.selector = false;\n config.trigger = 'manual';\n\n // In the future can be replaced with:\n // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]])\n // `Object.fromEntries(keysWithDifferentValues)`\n return config;\n }\n _disposePopper() {\n if (this._popper) {\n this._popper.destroy();\n this._popper = null;\n }\n if (this.tip) {\n this.tip.remove();\n this.tip = null;\n }\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Tooltip.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Tooltip);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap popover.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$3 = 'popover';\nconst SELECTOR_TITLE = '.popover-header';\nconst SELECTOR_CONTENT = '.popover-body';\nconst Default$2 = {\n ...Tooltip.Default,\n content: '',\n offset: [0, 8],\n placement: 'right',\n template: '
' + '
' + '

' + '
' + '
',\n trigger: 'click'\n};\nconst DefaultType$2 = {\n ...Tooltip.DefaultType,\n content: '(null|string|element|function)'\n};\n\n/**\n * Class definition\n */\n\nclass Popover extends Tooltip {\n // Getters\n static get Default() {\n return Default$2;\n }\n static get DefaultType() {\n return DefaultType$2;\n }\n static get NAME() {\n return NAME$3;\n }\n\n // Overrides\n _isWithContent() {\n return this._getTitle() || this._getContent();\n }\n\n // Private\n _getContentForTemplate() {\n return {\n [SELECTOR_TITLE]: this._getTitle(),\n [SELECTOR_CONTENT]: this._getContent()\n };\n }\n _getContent() {\n return this._resolvePossibleFunction(this._config.content);\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Popover.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Popover);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap scrollspy.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$2 = 'scrollspy';\nconst DATA_KEY$2 = 'bs.scrollspy';\nconst EVENT_KEY$2 = `.${DATA_KEY$2}`;\nconst DATA_API_KEY = '.data-api';\nconst EVENT_ACTIVATE = `activate${EVENT_KEY$2}`;\nconst EVENT_CLICK = `click${EVENT_KEY$2}`;\nconst EVENT_LOAD_DATA_API$1 = `load${EVENT_KEY$2}${DATA_API_KEY}`;\nconst CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item';\nconst CLASS_NAME_ACTIVE$1 = 'active';\nconst SELECTOR_DATA_SPY = '[data-bs-spy=\"scroll\"]';\nconst SELECTOR_TARGET_LINKS = '[href]';\nconst SELECTOR_NAV_LIST_GROUP = '.nav, .list-group';\nconst SELECTOR_NAV_LINKS = '.nav-link';\nconst SELECTOR_NAV_ITEMS = '.nav-item';\nconst SELECTOR_LIST_ITEMS = '.list-group-item';\nconst SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`;\nconst SELECTOR_DROPDOWN = '.dropdown';\nconst SELECTOR_DROPDOWN_TOGGLE$1 = '.dropdown-toggle';\nconst Default$1 = {\n offset: null,\n // TODO: v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: '0px 0px -25%',\n smoothScroll: false,\n target: null,\n threshold: [0.1, 0.5, 1]\n};\nconst DefaultType$1 = {\n offset: '(number|null)',\n // TODO v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: 'string',\n smoothScroll: 'boolean',\n target: 'element',\n threshold: 'array'\n};\n\n/**\n * Class definition\n */\n\nclass ScrollSpy extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n\n // this._element is the observablesContainer and config.target the menu links wrapper\n this._targetLinks = new Map();\n this._observableSections = new Map();\n this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element;\n this._activeTarget = null;\n this._observer = null;\n this._previousScrollData = {\n visibleEntryTop: 0,\n parentScrollTop: 0\n };\n this.refresh(); // initialize\n }\n\n // Getters\n static get Default() {\n return Default$1;\n }\n static get DefaultType() {\n return DefaultType$1;\n }\n static get NAME() {\n return NAME$2;\n }\n\n // Public\n refresh() {\n this._initializeTargetsAndObservables();\n this._maybeEnableSmoothScroll();\n if (this._observer) {\n this._observer.disconnect();\n } else {\n this._observer = this._getNewObserver();\n }\n for (const section of this._observableSections.values()) {\n this._observer.observe(section);\n }\n }\n dispose() {\n this._observer.disconnect();\n super.dispose();\n }\n\n // Private\n _configAfterMerge(config) {\n // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case\n config.target = getElement(config.target) || document.body;\n\n // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only\n config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin;\n if (typeof config.threshold === 'string') {\n config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value));\n }\n return config;\n }\n _maybeEnableSmoothScroll() {\n if (!this._config.smoothScroll) {\n return;\n }\n\n // unregister any previous listeners\n EventHandler.off(this._config.target, EVENT_CLICK);\n EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => {\n const observableSection = this._observableSections.get(event.target.hash);\n if (observableSection) {\n event.preventDefault();\n const root = this._rootElement || window;\n const height = observableSection.offsetTop - this._element.offsetTop;\n if (root.scrollTo) {\n root.scrollTo({\n top: height,\n behavior: 'smooth'\n });\n return;\n }\n\n // Chrome 60 doesn't support `scrollTo`\n root.scrollTop = height;\n }\n });\n }\n _getNewObserver() {\n const options = {\n root: this._rootElement,\n threshold: this._config.threshold,\n rootMargin: this._config.rootMargin\n };\n return new IntersectionObserver(entries => this._observerCallback(entries), options);\n }\n\n // The logic of selection\n _observerCallback(entries) {\n const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`);\n const activate = entry => {\n this._previousScrollData.visibleEntryTop = entry.target.offsetTop;\n this._process(targetElement(entry));\n };\n const parentScrollTop = (this._rootElement || document.documentElement).scrollTop;\n const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop;\n this._previousScrollData.parentScrollTop = parentScrollTop;\n for (const entry of entries) {\n if (!entry.isIntersecting) {\n this._activeTarget = null;\n this._clearActiveClass(targetElement(entry));\n continue;\n }\n const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop;\n // if we are scrolling down, pick the bigger offsetTop\n if (userScrollsDown && entryIsLowerThanPrevious) {\n activate(entry);\n // if parent isn't scrolled, let's keep the first visible item, breaking the iteration\n if (!parentScrollTop) {\n return;\n }\n continue;\n }\n\n // if we are scrolling up, pick the smallest offsetTop\n if (!userScrollsDown && !entryIsLowerThanPrevious) {\n activate(entry);\n }\n }\n }\n _initializeTargetsAndObservables() {\n this._targetLinks = new Map();\n this._observableSections = new Map();\n const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target);\n for (const anchor of targetLinks) {\n // ensure that the anchor has an id and is not disabled\n if (!anchor.hash || isDisabled(anchor)) {\n continue;\n }\n const observableSection = SelectorEngine.findOne(decodeURI(anchor.hash), this._element);\n\n // ensure that the observableSection exists & is visible\n if (isVisible(observableSection)) {\n this._targetLinks.set(decodeURI(anchor.hash), anchor);\n this._observableSections.set(anchor.hash, observableSection);\n }\n }\n }\n _process(target) {\n if (this._activeTarget === target) {\n return;\n }\n this._clearActiveClass(this._config.target);\n this._activeTarget = target;\n target.classList.add(CLASS_NAME_ACTIVE$1);\n this._activateParents(target);\n EventHandler.trigger(this._element, EVENT_ACTIVATE, {\n relatedTarget: target\n });\n }\n _activateParents(target) {\n // Activate dropdown parents\n if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) {\n SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE$1, target.closest(SELECTOR_DROPDOWN)).classList.add(CLASS_NAME_ACTIVE$1);\n return;\n }\n for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) {\n // Set triggered links parents as active\n // With both
    and