From 114e7b37e082e7b0fbfb6cf8ab4af4b5bb81c3cb Mon Sep 17 00:00:00 2001 From: Grant Firl Date: Thu, 17 Oct 2024 15:12:39 -0400 Subject: [PATCH 1/5] changes for the SCM to work with ufs/dev PR#183 and GFS_Debug.F90 schemes; allocate the Interstitial DDT as an array of size n_threads --- .gitmodules | 2 +- ccpp/config/ccpp_prebuild_config.py | 3 +- ccpp/physics | 2 +- scm/src/GFS_typedefs.F90 | 143 ++- scm/src/GFS_typedefs.meta | 1541 ++++++++++++++------------- scm/src/scm.F90 | 15 +- scm/src/scm_output.F90 | 60 +- scm/src/scm_setup.F90 | 27 +- scm/src/scm_type_defs.F90 | 12 +- scm/src/scm_type_defs.meta | 8 +- scm/src/suite_info.py | 1 + test/rt_test_cases.py | 1 + 12 files changed, 945 insertions(+), 870 deletions(-) diff --git a/.gitmodules b/.gitmodules index 373d68a92..e0d1393f1 100644 --- a/.gitmodules +++ b/.gitmodules @@ -5,7 +5,7 @@ [submodule "ccpp-physics"] path = ccpp/physics url = https://github.com/grantfirl/ccpp-physics - branch = ufs-dev-PR219 + branch = ufs-dev-PR183 [submodule "CMakeModules"] path = CMakeModules url = https://github.com/noaa-emc/CMakeModules diff --git a/ccpp/config/ccpp_prebuild_config.py b/ccpp/config/ccpp_prebuild_config.py index d68aaf98b..d115f34cf 100755 --- a/ccpp/config/ccpp_prebuild_config.py +++ b/ccpp/config/ccpp_prebuild_config.py @@ -50,7 +50,7 @@ 'ty_ozphys' : '', }, 'CCPP_typedefs' : { - 'GFS_interstitial_type' : 'physics%Interstitial', + 'GFS_interstitial_type' : 'physics%Interstitial(cdata%thrd_no)', 'CCPP_typedefs' : '', }, 'GFS_typedefs' : { @@ -94,6 +94,7 @@ 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_PBL_generic_post.F90' , 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_SCNV_generic_pre.F90' , 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_SCNV_generic_post.F90' , + 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_debug.F90' , 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_phys_time_vary.scm.F90' , 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_rad_time_vary.scm.F90' , 'ccpp/physics/physics/Interstitials/UFS_SCM_NEPTUNE/GFS_radiation_surface.F90' , diff --git a/ccpp/physics b/ccpp/physics index ca3b61fb8..bbe11c3b6 160000 --- a/ccpp/physics +++ b/ccpp/physics @@ -1 +1 @@ -Subproject commit ca3b61fb886055556da8ff975a3834b6b6a4e260 +Subproject commit bbe11c3b60e1c65b9518b8d318534c5cb2728967 diff --git a/scm/src/GFS_typedefs.F90 b/scm/src/GFS_typedefs.F90 index 35f325f03..7966fc2ca 100644 --- a/scm/src/GFS_typedefs.F90 +++ b/scm/src/GFS_typedefs.F90 @@ -742,7 +742,11 @@ module GFS_typedefs integer :: nblks !< for explicit data blocking: number of blocks integer, pointer :: blksz(:) !< for explicit data blocking: block sizes of all blocks integer :: ncols !< total number of columns for all blocks - + ! + integer :: nchunks !< number of chunks of an array that are used in the CCPP run phase + integer, pointer :: chunk_begin(:) !< first indices of chunks of an array for the CCPP run phase + integer, pointer :: chunk_end(:) !< last indices of chunks of an array for the CCPP run phase + ! integer :: fire_aux_data_levels !< vertical levels of fire auxiliary data !--- coupling parameters @@ -1652,50 +1656,50 @@ module GFS_typedefs !! type GFS_grid_type - real (kind=kind_phys), pointer :: xlon (:) => null() !< grid longitude in radians, ok for both 0->2pi - !! or -pi -> +pi ranges - real (kind=kind_phys), pointer :: xlat (:) => null() !< grid latitude in radians, default to pi/2 -> - !! -pi/2 range, otherwise adj in subr called - real (kind=kind_phys), pointer :: xlat_d (:) => null() !< grid latitude in degrees, default to 90 -> - !! -90 range, otherwise adj in subr called - real (kind=kind_phys), pointer :: xlon_d (:) => null() !< grid longitude in degrees, default to 0 -> - !! 360 range, otherwise adj in subr called - real (kind=kind_phys), pointer :: sinlat (:) => null() !< sine of the grids corresponding latitudes - real (kind=kind_phys), pointer :: coslat (:) => null() !< cosine of the grids corresponding latitudes - real (kind=kind_phys), pointer :: area (:) => null() !< area of the grid cell - real (kind=kind_phys), pointer :: dx (:) => null() !< relative dx for the grid cell + real (kind=kind_phys), pointer :: xlon (:) !< grid longitude in radians, ok for both 0->2pi + !! or -pi -> +pi ranges + real (kind=kind_phys), pointer :: xlat (:) !< grid latitude in radians, default to pi/2 -> + !! -pi/2 range, otherwise adj in subr called + real (kind=kind_phys), pointer :: xlat_d (:) !< grid latitude in degrees, default to 90 -> + !! -90 range, otherwise adj in subr called + real (kind=kind_phys), pointer :: xlon_d (:) !< grid longitude in degrees, default to 0 -> + !! 360 range, otherwise adj in subr called + real (kind=kind_phys), pointer :: sinlat (:) !< sine of the grids corresponding latitudes + real (kind=kind_phys), pointer :: coslat (:) !< cosine of the grids corresponding latitudes + real (kind=kind_phys), pointer :: area (:) !< area of the grid cell + real (kind=kind_phys), pointer :: dx (:) !< relative dx for the grid cell !--- grid-related interpolation data for prognostic ozone - real (kind=kind_phys), pointer :: ddy_o3 (:) => null() !< interpolation weight for ozone - integer, pointer :: jindx1_o3 (:) => null() !< interpolation low index for ozone - integer, pointer :: jindx2_o3 (:) => null() !< interpolation high index for ozone + real (kind=kind_phys), pointer :: ddy_o3 (:) !< interpolation weight for ozone + integer, pointer :: jindx1_o3 (:) !< interpolation low index for ozone + integer, pointer :: jindx2_o3 (:) !< interpolation high index for ozone !--- grid-related interpolation data for stratosphere water - real (kind=kind_phys), pointer :: ddy_h (:) => null() !< interpolation weight for h2o - integer, pointer :: jindx1_h (:) => null() !< interpolation low index for h2o - integer, pointer :: jindx2_h (:) => null() !< interpolation high index for h2o + real (kind=kind_phys), pointer :: ddy_h (:) !< interpolation weight for h2o + integer, pointer :: jindx1_h (:) !< interpolation low index for h2o + integer, pointer :: jindx2_h (:) !< interpolation high index for h2o !--- grid-related interpolation data for prognostic iccn - real (kind=kind_phys), pointer :: ddy_ci (:) => null() !< interpolation weight for iccn - integer, pointer :: jindx1_ci (:) => null() !< interpolation low index for iccn - integer, pointer :: jindx2_ci (:) => null() !< interpolation high index for iccn - real (kind=kind_phys), pointer :: ddx_ci (:) => null() !< interpolation weight for iccn - integer, pointer :: iindx1_ci (:) => null() !< interpolation low index for iccn - integer, pointer :: iindx2_ci (:) => null() !< interpolation high index for iccn + real (kind=kind_phys), pointer :: ddy_ci (:) !< interpolation weight for iccn + integer, pointer :: jindx1_ci (:) !< interpolation low index for iccn + integer, pointer :: jindx2_ci (:) !< interpolation high index for iccn + real (kind=kind_phys), pointer :: ddx_ci (:) !< interpolation weight for iccn + integer, pointer :: iindx1_ci (:) !< interpolation low index for iccn + integer, pointer :: iindx2_ci (:) !< interpolation high index for iccn !--- grid-related interpolation data for prescribed aerosols - real (kind=kind_phys), pointer :: ddy_aer (:) => null() !< interpolation weight for iaerclm - integer, pointer :: jindx1_aer (:) => null() !< interpolation low index for iaerclm - integer, pointer :: jindx2_aer (:) => null() !< interpolation high index for iaerclm - real (kind=kind_phys), pointer :: ddx_aer (:) => null() !< interpolation weight for iaerclm - integer, pointer :: iindx1_aer (:) => null() !< interpolation low index for iaerclm - integer, pointer :: iindx2_aer (:) => null() !< interpolation high index for iaerclm + real (kind=kind_phys), pointer :: ddy_aer (:) !< interpolation weight for iaerclm + integer, pointer :: jindx1_aer (:) !< interpolation low index for iaerclm + integer, pointer :: jindx2_aer (:) !< interpolation high index for iaerclm + real (kind=kind_phys), pointer :: ddx_aer (:) !< interpolation weight for iaerclm + integer, pointer :: iindx1_aer (:) !< interpolation low index for iaerclm + integer, pointer :: iindx2_aer (:) !< interpolation high index for iaerclm !--- grid-related interpolation data for cires_ugwp_v1 - real (kind=kind_phys), pointer :: ddy_j1tau (:) => null() !< interpolation weight for tau_ugwp - real (kind=kind_phys), pointer :: ddy_j2tau (:) => null() !< interpolation weight for tau_ugwp - integer, pointer :: jindx1_tau (:) => null() !< interpolation low index for tau_ugwp - integer, pointer :: jindx2_tau (:) => null() !< interpolation high index for tau_ugwp + real (kind=kind_phys), pointer :: ddy_j1tau (:) !< interpolation weight for tau_ugwp + real (kind=kind_phys), pointer :: ddy_j2tau (:) !< interpolation weight for tau_ugwp + integer, pointer :: jindx1_tau (:) !< interpolation low index for tau_ugwp + integer, pointer :: jindx2_tau (:) !< interpolation high index for tau_ugwp contains procedure :: create => grid_create !< allocate array data @@ -2195,12 +2199,14 @@ module GFS_typedefs !------------------------ ! GFS_statein_type%create !------------------------ - subroutine statein_create (Statein, IM, Model) + subroutine statein_create (Statein, Model) implicit none class(GFS_statein_type) :: Statein - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model + integer :: IM + + IM = Model%ncols !--- level geopotential and pressures allocate (Statein%phii (IM,Model%levs+1)) @@ -2262,13 +2268,15 @@ end subroutine statein_create !------------------------- ! GFS_stateout_type%create !------------------------- - subroutine stateout_create (Stateout, IM, Model) + subroutine stateout_create (Stateout, Model) implicit none class(GFS_stateout_type) :: Stateout - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model + integer :: IM + + IM = Model%ncols allocate (Stateout%gu0 (IM,Model%levs)) allocate (Stateout%gv0 (IM,Model%levs)) @@ -2286,13 +2294,15 @@ end subroutine stateout_create !------------------------ ! GFS_sfcprop_type%create !------------------------ - subroutine sfcprop_create (Sfcprop, IM, Model) + subroutine sfcprop_create (Sfcprop, Model) implicit none class(GFS_sfcprop_type) :: Sfcprop - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model + integer :: IM + + IM = Model%ncols !--- physics and radiation allocate (Sfcprop%slmsk (IM)) @@ -2861,13 +2871,15 @@ end subroutine sfcprop_create !------------------------- ! GFS_coupling_type%create !------------------------- - subroutine coupling_create (Coupling, IM, Model) + subroutine coupling_create (Coupling, Model) implicit none class(GFS_coupling_type) :: Coupling - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model + integer :: IM + + IM = Model%ncols !--- radiation out !--- physics in @@ -4387,7 +4399,17 @@ subroutine control_initialize (Model, nlunit, fn_nml, me, master, & allocate(Model%blksz(1:Model%nblks)) Model%blksz = blksz Model%ncols = sum(Model%blksz) - + ! DH* + Model%nchunks = size(blksz) + allocate(Model%chunk_begin(Model%nchunks)) + allocate(Model%chunk_end(Model%nchunks)) + Model%chunk_begin(1) = 1 + Model%chunk_end(1) = Model%chunk_begin(1) + blksz(1) - 1 + do i=2,Model%nchunks + Model%chunk_begin(i) = Model%chunk_end(i-1) + 1 + Model%chunk_end(i) = Model%chunk_begin(i) + blksz(i) - 1 + end do + !--- coupling parameters Model%cplflx = cplflx Model%cplice = cplice @@ -7074,14 +7096,15 @@ end subroutine control_print !---------------- ! GFS_grid%create !---------------- - subroutine grid_create (Grid, IM, Model) + subroutine grid_create (Grid, Model) implicit none class(GFS_grid_type) :: Grid - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model + integer :: IM + IM = Model%ncols allocate (Grid%xlon (IM)) allocate (Grid%xlat (IM)) allocate (Grid%xlat_d (IM)) @@ -7175,14 +7198,15 @@ end subroutine grid_create !-------------------- ! GFS_tbd_type%create !-------------------- - subroutine tbd_create (Tbd, IM, Model) + subroutine tbd_create (Tbd, Model) implicit none class(GFS_tbd_type) :: Tbd - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model + integer :: IM + IM = Model%ncols !--- In !--- sub-grid cloud radiation if ( Model%isubc_lw == 2 .or. Model%isubc_sw == 2 ) then @@ -7216,19 +7240,16 @@ subroutine tbd_create (Tbd, IM, Model) Tbd%ozpl = clear_val !--- ccn and in needs - ! DH* allocate only for MG? *DH allocate (Tbd%in_nm (IM,Model%levs)) allocate (Tbd%ccn_nm (IM,Model%levs)) Tbd%in_nm = clear_val Tbd%ccn_nm = clear_val !--- aerosol fields - ! DH* allocate only for MG? *DH allocate (Tbd%aer_nm (IM,Model%levs,ntrcaer)) Tbd%aer_nm = clear_val !--- tau_amf for NGWs - ! DH* allocate only for UGWP ? *DH allocate (Tbd%tau_amf(im) ) Tbd%tau_amf = clear_val @@ -7372,13 +7393,15 @@ end subroutine tbd_create !------------------------ ! GFS_cldprop_type%create !------------------------ - subroutine cldprop_create (Cldprop, IM, Model) + subroutine cldprop_create (Cldprop, Model) implicit none class(GFS_cldprop_type) :: Cldprop - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model + integer :: IM + + IM = Model%ncols allocate (Cldprop%cv (IM)) allocate (Cldprop%cvt (IM)) @@ -7394,13 +7417,15 @@ end subroutine cldprop_create !****************************************** ! GFS_radtend_type%create !****************************************** - subroutine radtend_create (Radtend, IM, Model) + subroutine radtend_create (Radtend, Model) implicit none class(GFS_radtend_type) :: Radtend - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model + integer :: IM + + IM = Model%ncols !--- Out (radiation only) allocate (Radtend%sfcfsw (IM)) @@ -7672,16 +7697,16 @@ end subroutine label_dtend_cause !---------------- ! GFS_diag%create !---------------- - subroutine diag_create (Diag, IM, Model) + subroutine diag_create (Diag, Model) use parse_tracers, only: get_tracer_index class(GFS_diag_type) :: Diag - integer, intent(in) :: IM type(GFS_control_type), intent(in) :: Model - -! + integer :: IM logical, save :: linit logical :: have_pbl, have_dcnv, have_scnv, have_mp, have_oz_phys + IM = Model%ncols + if(Model%print_diff_pgr) then allocate(Diag%old_pgr(IM)) Diag%old_pgr = clear_val diff --git a/scm/src/GFS_typedefs.meta b/scm/src/GFS_typedefs.meta index 2e74c0e7a..0b990e645 100644 --- a/scm/src/GFS_typedefs.meta +++ b/scm/src/GFS_typedefs.meta @@ -10,112 +10,112 @@ standard_name = geopotential_at_interface long_name = geopotential at model layer interfaces units = m2 s-2 - dimensions = (horizontal_loop_extent,vertical_interface_dimension) + dimensions = (horizontal_dimension,vertical_interface_dimension) type = real kind = kind_phys [prsi] standard_name = air_pressure_at_interface long_name = air pressure at model layer interfaces units = Pa - dimensions = (horizontal_loop_extent,vertical_interface_dimension) + dimensions = (horizontal_dimension,vertical_interface_dimension) type = real kind = kind_phys [prsi(:,1)] standard_name = air_pressure_at_lowest_model_interface long_name = air pressure at lowest model interface units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [prsik] standard_name = dimensionless_exner_function_at_interface long_name = dimensionless Exner function at model layer interfaces units = none - dimensions = (horizontal_loop_extent,vertical_interface_dimension) + dimensions = (horizontal_dimension,vertical_interface_dimension) type = real kind = kind_phys [prsik(:,1)] standard_name = surface_dimensionless_exner_function long_name = dimensionless Exner function at lowest model interface units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [phil] standard_name = geopotential long_name = geopotential at model layer centers units = m2 s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [prsl] standard_name = air_pressure long_name = mean layer pressure units = Pa - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [prsl(:,1)] standard_name = air_pressure_at_surface_adjacent_layer long_name = mean pressure at lowest model layer units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [prslk] standard_name = dimensionless_exner_function long_name = dimensionless Exner function at model layer centers units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [prslk(:,1)] standard_name = dimensionless_exner_function_at_surface_adjacent_layer long_name = dimensionless Exner function at lowest model layer units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [pgr] standard_name = surface_air_pressure long_name = surface pressure units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ugrs] standard_name = x_wind long_name = zonal wind units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [ugrs(:,1)] standard_name = x_wind_at_surface_adjacent_layer long_name = zonal wind at lowest model layer units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [vgrs] standard_name = y_wind long_name = meridional wind units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [vgrs(:,1)] standard_name = y_wind_at_surface_adjacent_layer long_name = meridional wind at lowest model layer units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [wgrs] standard_name = unsmoothed_nonhydrostatic_upward_air_velocity long_name = unsmoothed non-hydrostatic upward air velocity units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_lightning_threat_index_calculations) @@ -123,91 +123,91 @@ standard_name = lagrangian_tendency_of_air_pressure long_name = layer mean vertical velocity units = Pa s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [tgrs] standard_name = air_temperature long_name = model layer mean temperature units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [tgrs(:,1)] standard_name = air_temperature_at_surface_adjacent_layer long_name = mean temperature at lowest model layer units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [qgrs] standard_name = tracer_concentration long_name = model layer mean tracer concentration units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_tracers) + dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_tracers) type = real kind = kind_phys [qgrs(:,:,index_of_specific_humidity_in_tracer_concentration_array)] standard_name = specific_humidity long_name = water vapor specific humidity units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,1,index_of_specific_humidity_in_tracer_concentration_array)] standard_name = specific_humidity_at_surface_adjacent_layer long_name = water vapor specific humidity at lowest model layer units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_cloud_liquid_water_mixing_ratio_in_tracer_concentration_array)] standard_name = cloud_liquid_water_mixing_ratio long_name = ratio of mass of cloud water to mass of dry air plus vapor (without condensates) units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,1,index_of_cloud_liquid_water_mixing_ratio_in_tracer_concentration_array)] standard_name = cloud_liquid_water_mixing_ratio_at_surface_adjacent_layer long_name = ratio of mass of cloud water to mass of dry air plus vapor (without condensates) at lowest model layer units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_cloud_ice_mixing_ratio_in_tracer_concentration_array)] standard_name = cloud_ice_mixing_ratio long_name = ratio of mass of ice water to mass of dry air plus vapor (without condensates) units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_rain_mixing_ratio_in_tracer_concentration_array)] standard_name = rain_mixing_ratio long_name = ratio of mass of rain water to mass of dry air plus vapor (without condensates) units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_snow_mixing_ratio_in_tracer_concentration_array)] standard_name = snow_mixing_ratio long_name = ratio of mass of snow water to mass of dry air plus vapor (without condensates) units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_graupel_mixing_ratio_in_tracer_concentration_array)] standard_name = graupel_mixing_ratio long_name = ratio of mass of graupel to mass of dry air plus vapor (without condensates) units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_hail_mixing_ratio_in_tracer_concentration_array)] standard_name = hail_mixing_ratio long_name = ratio of mass of hail to mass of dry air plus vapor (without condensates) units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_hail_mixing_ratio_in_tracer_concentration_array > 0) @@ -215,14 +215,14 @@ standard_name = ozone_mixing_ratio long_name = ozone mixing ratio units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_mass_number_concentration_of_hygroscopic_aerosols_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_hygroscopic_aerosols long_name = number concentration of water-friendly aerosols units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) active = (index_of_mass_number_concentration_of_hygroscopic_aerosols_in_tracer_concentration_array > 0) type = real kind = kind_phys @@ -230,7 +230,7 @@ standard_name = mass_number_concentration_of_nonhygroscopic_ice_nucleating_aerosols long_name = number concentration of ice-friendly aerosols units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) active = (index_of_mass_number_concentration_of_nonhygroscopic_ice_nucleating_aerosols_in_tracer_concentration_array > 0) type = real kind = kind_phys @@ -238,7 +238,7 @@ standard_name = mass_number_concentration_of_cloud_liquid_water_particles_in_air long_name = number concentration of cloud droplets (liquid) units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_mass_number_concentration_of_cloud_droplets_in_tracer_concentration_array > 0) @@ -246,35 +246,35 @@ standard_name = mass_number_concentration_of_cloud_ice_water_crystals_in_air long_name = number concentration of ice units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_mass_number_concentration_of_rain_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_rain_water_in_air long_name = number concentration of rain units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_mass_number_concentration_of_snow_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_snow_in_air long_name = number concentration of snow units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_mass_number_concentration_of_graupel_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_graupel_in_air long_name = number concentration of graupel units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_mass_number_concentration_of_hail_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_hail_in_air long_name = number concentration of hail units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_mass_number_concentration_of_hail_in_tracer_concentration_array > 0) @@ -282,7 +282,7 @@ standard_name = reflectivity_of_rain_in_air long_name = reflectivity of rain units = m6 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_reflectivity_of_rain_in_tracer_concentration_array > 0) @@ -290,7 +290,7 @@ standard_name = reflectivity_of_graupel_in_air long_name = reflectivity of graupel units = m6 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_reflectivity_of_graupel_in_tracer_concentration_array > 0) @@ -298,7 +298,7 @@ standard_name = reflectivity_of_hail_in_air long_name = reflectivity of hail units = m6 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_reflectivity_of_hail_in_tracer_concentration_array > 0) @@ -306,7 +306,7 @@ standard_name = cloud_condensation_nuclei_number_concentration long_name = number concentration of cloud condensation nuclei units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_cloud_condensation_nuclei_number_concentration_in_tracer_concentration_array > 0 ) @@ -314,7 +314,7 @@ standard_name = activated_cloud_condensation_nuclei_number_concentration long_name = number concentration of activated cloud condensation nuclei units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_activated_cloud_condensation_nuclei_number_concentration_in_tracer_concentration_array > 0 ) @@ -322,7 +322,7 @@ standard_name = graupel_volume long_name = graupel particle volume units = m3 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_graupel_volume_in_tracer_concentration_array > 0 ) @@ -330,7 +330,7 @@ standard_name = hail_volume long_name = hail particle volume units = m3 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_hail_volume_in_tracer_concentration_array > 0 ) @@ -338,14 +338,14 @@ standard_name = turbulent_kinetic_energy long_name = turbulent kinetic energy units = J - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_of_updraft_area_fraction_in_tracer_concentration_array)] standard_name = prognostic_updraft_area_fraction_in_convection long_name = convective updraft area fraction units = frac - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_updraft_area_fraction_in_tracer_concentration_array > 0 ) @@ -353,21 +353,21 @@ standard_name = smoke_tracer_concentration long_name = concentration of smoke units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [qgrs(:,:,index_for_dust_in_tracer_concentration_array)] standard_name = dust_tracer_concentration long_name = concentration of dust units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [diss_est] standard_name = dissipation_estimate_of_air_temperature_at_model_layers long_name = dissipation estimate model layer mean temperature units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys @@ -384,112 +384,112 @@ standard_name = x_wind_of_new_state long_name = zonal wind updated by physics units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gu0(:,1)] standard_name = x_wind_of_new_state_at_surface_adjacent_layer long_name = zonal wind at lowest model layer updated by physics units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [gv0] standard_name = y_wind_of_new_state long_name = meridional wind updated by physics units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gv0(:,1)] standard_name = y_wind_of_new_state_at_surface_adjacent_layer long_name = meridional wind at lowest model layer updated by physics units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [gt0] standard_name = air_temperature_of_new_state long_name = temperature updated by physics units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gt0(:,1)] standard_name = air_temperature_of_new_state_at_surface_adjacent_layer long_name = temperature at lowest model layer updated by physics units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [gq0] standard_name = tracer_concentration_of_new_state long_name = tracer concentration updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_tracers) + dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_tracers) type = real kind = kind_phys [gq0(:,:,index_of_specific_humidity_in_tracer_concentration_array)] standard_name = specific_humidity_of_new_state long_name = water vapor specific humidity updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,1,index_of_specific_humidity_in_tracer_concentration_array)] standard_name = specific_humidity_of_new_state_at_surface_adjacent_layer long_name = water vapor specific humidity at lowest model layer updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [gq0(:,:,index_of_ozone_mixing_ratio_in_tracer_concentration_array)] standard_name = ozone_concentration_of_new_state long_name = ozone concentration updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_cloud_liquid_water_mixing_ratio_in_tracer_concentration_array)] standard_name = cloud_liquid_water_mixing_ratio_of_new_state long_name = ratio of mass of cloud water to mass of dry air plus vapor (without condensates) updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_cloud_ice_mixing_ratio_in_tracer_concentration_array)] standard_name = cloud_ice_mixing_ratio_of_new_state long_name = ratio of mass of ice water to mass of dry air plus vapor (without condensates) updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_rain_mixing_ratio_in_tracer_concentration_array)] standard_name = rain_mixing_ratio_of_new_state long_name = ratio of mass of rain water to mass of dry air plus vapor (without condensates) updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_snow_mixing_ratio_in_tracer_concentration_array)] standard_name = snow_mixing_ratio_of_new_state long_name = ratio of mass of snow water to mass of dry air plus vapor (without condensates) updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_graupel_mixing_ratio_in_tracer_concentration_array)] standard_name = graupel_mixing_ratio_of_new_state long_name = ratio of mass of graupel to mass of dry air plus vapor (without condensates) updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_hail_mixing_ratio_in_tracer_concentration_array)] standard_name = hail_mixing_ratio_of_new_state long_name = ratio of mass of hail to mass of dry air plus vapor (without condensates) updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_hail_mixing_ratio_in_tracer_concentration_array > 0 ) @@ -497,14 +497,14 @@ standard_name = mass_weighted_rime_factor_of_new_state long_name = mass weighted rime factor updated by physics units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_mass_number_concentration_of_hygroscopic_aerosols_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_hygroscopic_aerosols_of_new_state long_name = number concentration of water-friendly aerosols updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_mass_number_concentration_of_hygroscopic_aerosols_in_tracer_concentration_array > 0) @@ -512,7 +512,7 @@ standard_name = mass_number_concentration_of_nonhygroscopic_ice_nucleating_aerosols_of_new_state long_name = number concentration of ice-friendly aerosols updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_mass_number_concentration_of_nonhygroscopic_ice_nucleating_aerosols_in_tracer_concentration_array > 0) @@ -520,7 +520,7 @@ standard_name = mass_number_concentration_of_cloud_liquid_water_particles_in_air_of_new_state long_name = number concentration of cloud droplets updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_mass_number_concentration_of_cloud_droplets_in_tracer_concentration_array > 0) @@ -528,35 +528,35 @@ standard_name = mass_number_concentration_of_cloud_ice_water_crystals_in_air_of_new_state long_name = number concentration of ice updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_mass_number_concentration_of_rain_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_rain_of_new_state long_name = number concentration of rain updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_mass_number_concentration_of_snow_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_snow_of_new_state long_name = number concentration of snow updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_mass_number_concentration_of_graupel_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_graupel_of_new_state long_name = number concentration of graupel updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_mass_number_concentration_of_hail_in_tracer_concentration_array)] standard_name = mass_number_concentration_of_hail_of_new_state long_name = number concentration of hail updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_mass_number_concentration_of_hail_in_tracer_concentration_array > 0 ) @@ -564,7 +564,7 @@ standard_name = cloud_condensation_nuclei_number_concentration_of_new_state long_name = number concentration of cloud condensation nuclei updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_cloud_condensation_nuclei_number_concentration_in_tracer_concentration_array > 0 ) @@ -572,7 +572,7 @@ standard_name = activated_cloud_condensation_nuclei_number_concentration_of_new_state long_name = number concentration of cloud condensation nuclei updated by physics units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_activated_cloud_condensation_nuclei_number_concentration_in_tracer_concentration_array > 0 ) @@ -580,7 +580,7 @@ standard_name = graupel_volume_of_new_state long_name = graupel volume updated by physics units = m3 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_graupel_volume_in_tracer_concentration_array > 0 ) @@ -588,7 +588,7 @@ standard_name = hail_volume_of_new_state long_name = hail volume updated by physics units = m3 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_hail_volume_in_tracer_concentration_array > 0 ) @@ -596,7 +596,7 @@ standard_name = reflectivity_of_rain_of_new_state long_name = reflectivity of rain updated by physics units = m6 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_reflectivity_of_rain_in_tracer_concentration_array > 0 ) @@ -604,7 +604,7 @@ standard_name = reflectivity_of_graupel_of_new_state long_name = reflectivity of graupel updated by physics units = m6 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_reflectivity_of_graupel_in_tracer_concentration_array > 0 ) @@ -612,7 +612,7 @@ standard_name = reflectivity_of_hail_of_new_state long_name = reflectivity of hail updated by physics units = m6 kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_reflectivity_of_hail_in_tracer_concentration_array > 0 ) @@ -620,17 +620,18 @@ standard_name = cloud_area_fraction_in_atmosphere_layer_of_new_state long_name = cloud fraction updated by physics units = frac - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [gq0(:,:,index_of_updraft_area_fraction_in_tracer_concentration_array)] standard_name = updraft_area_fraction_updated_by_physics long_name = convective updraft area fraction updated by physics units = frac - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( index_of_updraft_area_fraction_in_tracer_concentration_array > 0 ) + ######################################################################## [ccpp-table-properties] name = GFS_sfcprop_type @@ -644,56 +645,56 @@ standard_name = area_type long_name = landmask: sea/land/ice=0/1/2 units = flag - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [oceanfrac] standard_name = sea_area_fraction long_name = fraction of horizontal grid area occupied by ocean units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [landfrac] standard_name = land_area_fraction long_name = fraction of horizontal grid area occupied by land units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [vegtype_frac] standard_name = fraction_of_vegetation_category long_name = fraction of horizontal grid area occupied by given vegetation category units = frac - dimensions = (horizontal_loop_extent,number_of_vegetation_categories) + dimensions = (horizontal_dimension,number_of_vegetation_categories) type = real kind = kind_phys [soiltype_frac] standard_name = fraction_of_soil_category long_name = fraction of horizontal grid area occupied by given soil category units = frac - dimensions = (horizontal_loop_extent,number_of_soil_categories) + dimensions = (horizontal_dimension,number_of_soil_categories) type = real kind = kind_phys [lakefrac] standard_name = lake_area_fraction long_name = fraction of horizontal grid area occupied by lake units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [lakedepth] standard_name = lake_depth long_name = lake depth units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [clm_lakedepth] standard_name = clm_lake_depth long_name = clm internal copy of lake depth with 10.0 replaced by default lake depth units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2) @@ -701,13 +702,13 @@ standard_name = flag_for_using_lake_model long_name = flag indicating lake points using a lake model units = flag - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [lake_t2m] standard_name = temperature_at_2m_from_clm_lake long_name = temperature at 2m from clm lake units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2) @@ -715,7 +716,7 @@ standard_name = specific_humidity_at_2m_from_clm_lake long_name = specific humidity at 2m from clm lake units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2) @@ -723,7 +724,7 @@ standard_name = mixed_layer_depth_of_lakes long_name = depth of lake mixing layer units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0) @@ -731,7 +732,7 @@ standard_name = lake_mixed_layer_temperature long_name = temperature of lake mixing layer units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0) @@ -739,7 +740,7 @@ standard_name = mean_temperature_of_the_water_column long_name = thee mean temperature of the water column units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0) @@ -747,7 +748,7 @@ standard_name = the_thermally_active_layer_depth_of_the_bottom_sediment long_name = the depth of the thermally active layer of the bottom sediment units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0) @@ -755,7 +756,7 @@ standard_name = temperature_at_the_bottom_of_the_sediment_upper_layer long_name = the temperature at the bottom of the sediment upper layer units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0) @@ -763,7 +764,7 @@ standard_name = lake_bottom_temperature long_name = the temperature at the water-bottom sediment interface units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0) @@ -771,7 +772,7 @@ standard_name = temperature_for_bottom_layer_of_water long_name = the temperature at the lake bottom layer water units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0) @@ -779,7 +780,7 @@ standard_name = shape_factor_of_water_temperature_vertical_profile long_name = the shape factor of water temperature vertical profile units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 1 .and. control_for_lake_model_execution_method > 0) @@ -787,7 +788,7 @@ standard_name = temperature_of_snow_on_lake long_name = temperature of snow on a lake units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_execution_method > 0) @@ -795,147 +796,147 @@ standard_name = surface_skin_temperature long_name = surface skin temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tsfco] standard_name = sea_surface_temperature long_name = sea surface temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [usfco] standard_name = x_ocean_current long_name = zonal current at ocean surface units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [vsfco] standard_name = y_ocean_current long_name = meridional current at ocean surface units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tsfcl] standard_name = surface_skin_temperature_over_land long_name = surface skin temperature over land units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tisfc] standard_name = surface_skin_temperature_over_ice long_name = surface skin temperature over ice units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tiice] standard_name = temperature_in_ice_layer long_name = sea ice internal temperature units = K - dimensions = (horizontal_loop_extent,vertical_dimension_of_sea_ice) + dimensions = (horizontal_dimension,vertical_dimension_of_sea_ice) type = real kind = kind_phys [snowd] standard_name = lwe_surface_snow long_name = water equivalent snow depth units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zorl] standard_name = surface_roughness_length long_name = surface roughness length units = cm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zorlw] standard_name = surface_roughness_length_over_water long_name = surface roughness length over water units = cm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zorll] standard_name = surface_roughness_length_over_land long_name = surface roughness length over land units = cm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zorli] standard_name = surface_roughness_length_over_ice long_name = surface roughness length over ice units = cm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zorlwav] standard_name = surface_roughness_length_from_wave_model long_name = surface roughness length from wave model units = cm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [fice] standard_name = sea_ice_area_fraction_of_sea_area_fraction long_name = ice fraction over open water units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [snodl] standard_name = surface_snow_thickness_water_equivalent_over_land long_name = water equivalent snow depth over land units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [weasdl] standard_name = water_equivalent_accumulated_snow_depth_over_land long_name = water equiv of acc snow depth over land units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [snodi] standard_name = surface_snow_thickness_water_equivalent_over_ice long_name = water equivalent snow depth over ice units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [weasdi] standard_name = water_equivalent_accumulated_snow_depth_over_ice long_name = water equiv of acc snow depth over land units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [hprime] standard_name = statistical_measures_of_subgrid_orography_collection_array long_name = orographic metrics units = mixed - dimensions = (horizontal_loop_extent,number_of_statistical_measures_of_subgrid_orography) + dimensions = (horizontal_dimension,number_of_statistical_measures_of_subgrid_orography) type = real kind = kind_phys [hprime(:,1)] standard_name = standard_deviation_of_subgrid_orography long_name = standard deviation of subgrid height_above_mean_sea_level units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dust12m_in] standard_name = fengsha_dust12m_input long_name = fengsha dust input units = various - dimensions = (horizontal_loop_extent,12,5) + dimensions = (horizontal_dimension,12,5) type = real kind = kind_phys active = (do_smoke_coupling) @@ -943,7 +944,7 @@ standard_name = anthropogenic_background_input long_name = anthropogenic background input units = various - dimensions = (horizontal_loop_extent,1) + dimensions = (horizontal_dimension,1) type = real kind = kind_phys active = (do_smoke_coupling) @@ -951,7 +952,7 @@ standard_name = emission_smoke_RRFS long_name = emission fire RRFS units = various - dimensions = (horizontal_loop_extent,24,2) + dimensions = (horizontal_dimension,24,2) type = real kind = kind_phys active = (do_smoke_coupling) @@ -959,7 +960,7 @@ standard_name = emission_smoke_prvd_RRFS long_name = emission fire RRFS daily units = various - dimensions = (horizontal_loop_extent,4) + dimensions = (horizontal_dimension,4) type = real kind = kind_phys active = (do_smoke_coupling) @@ -967,7 +968,7 @@ standard_name = baseline_surface_roughness_length long_name = baseline surface roughness length for momentum in meter units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -975,28 +976,28 @@ standard_name = baseline_surface_longwave_emissivity long_name = baseline surface lw emissivity in fraction units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sncovr] standard_name = surface_snow_area_fraction_over_land long_name = surface snow area fraction units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sncovr_ice] standard_name = surface_snow_area_fraction_over_ice long_name = surface snow area fraction over ice units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [fire_heat_flux] standard_name = surface_fire_heat_flux long_name = heat flux of fire at the surface units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1004,7 +1005,7 @@ standard_name = fraction_of_grid_cell_burning long_name = ration of the burnt area to the grid cell area units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1012,35 +1013,35 @@ standard_name = upper_bound_of_max_albedo_assuming_deep_snow long_name = maximum snow albedo units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [emis_lnd] standard_name = surface_longwave_emissivity_over_land long_name = surface lw emissivity in fraction over land units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [emis_ice] standard_name = surface_longwave_emissivity_over_ice long_name = surface lw emissivity in fraction over ice units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [emis_wat] standard_name = surface_longwave_emissivity_over_water long_name = surface lw emissivity in fraction over water units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sfalb_lnd] standard_name = surface_diffused_shortwave_albedo_over_land long_name = mean surface diffused sw albedo over land units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1048,7 +1049,7 @@ standard_name = surface_diffused_shortwave_albedo_over_ice long_name = mean surface diffused sw albedo over ice units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1056,7 +1057,7 @@ standard_name = surface_snow_free_albedo_over_land long_name = surface snow-free albedo over ice units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1064,118 +1065,118 @@ standard_name = vis_albedo_weak_cosz long_name = mean vis albedo with weak cosz dependency units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [alnwf] standard_name = nir_albedo_weak_cosz long_name = mean nir albedo with weak cosz dependency units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [slope] standard_name = surface_slope_classification long_name = sfc slope type for lsm units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [slope_save] standard_name = surface_slope_classification_save long_name = sfc slope type for lsm save units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [shdmin] standard_name = min_vegetation_area_fraction long_name = min fractional coverage of green vegetation units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [shdmax] standard_name = max_vegetation_area_fraction long_name = max fractional coverage of green vegetation units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tg3] standard_name = deep_soil_temperature long_name = deep soil temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [vfrac] standard_name = vegetation_area_fraction long_name = areal fractional cover of green vegetation units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [vtype] standard_name = vegetation_type_classification long_name = vegetation type for lsm units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [vtype_save] standard_name = vegetation_type_classification_save long_name = vegetation type for lsm save units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [stype] standard_name = soil_type_classification long_name = soil type for lsm units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [stype_save] standard_name = soil_type_classification_save long_name = soil type for lsm save units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [scolor] standard_name = soil_color_classification long_name = soil color for lsm units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [scolor_save] standard_name = soil_color_classification_save long_name = soil color for lsm save units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [uustar] standard_name = surface_friction_velocity long_name = boundary layer parameter units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [oro] standard_name = height_above_mean_sea_level long_name = height_above_mean_sea_level units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [oro_uf] standard_name = unfiltered_height_above_mean_sea_level long_name = unfiltered height_above_mean_sea_level units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [maxupmf] standard_name = maximum_convective_updraft_mass_flux long_name = maximum convective updraft mass flux within a column units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection) @@ -1183,7 +1184,7 @@ standard_name = consecutive_calls_for_grell_freitas_convection long_name = Memory counter for GF units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection) @@ -1191,7 +1192,7 @@ standard_name = consecutive_calls_for_grell_freitas_mid_level_convection long_name = Memory counter for GF midlevel units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection) @@ -1199,63 +1200,63 @@ standard_name = specified_surface_upward_temperature_flux long_name = specified kinematic surface upward sensible heat flux units = K m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [spec_lh_flux] standard_name = specified_surface_upward_specific_humidity_flux long_name = specified kinematic surface upward latent heat flux units = kg kg-1 m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [hice] standard_name = sea_ice_thickness long_name = sea ice thickness units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [weasd] standard_name = lwe_thickness_of_surface_snow_amount long_name = water equiv of acc snow depth over land and sea ice units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [canopy] standard_name = canopy_water_amount long_name = canopy water amount units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ffmm] standard_name = Monin_Obukhov_similarity_function_for_momentum long_name = Monin-Obukhov similarity function for momentum units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ffhh] standard_name = Monin_Obukhov_similarity_function_for_heat long_name = Monin-Obukhov similarity function for heat units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [f10m] standard_name = ratio_of_wind_at_surface_adjacent_layer_to_wind_at_10m long_name = ratio of sigma level 1 wind and 10m wind units = ratio - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [rca] standard_name = aerodynamic_resistance_in_canopy long_name = canopy resistance units = s m-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noah_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1263,63 +1264,63 @@ standard_name = nonnegative_lwe_thickness_of_precipitation_amount_on_dynamics_timestep long_name = total precipitation amount in each time step units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [srflag] standard_name = precipitation_type long_name = snow/rain flag for precipitation units = flag - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [slc] standard_name = volume_fraction_of_unfrozen_water_in_soil long_name = liquid soil moisture units = frac - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil) + dimensions = (horizontal_dimension,vertical_dimension_of_soil) type = real kind = kind_phys [smc] standard_name = volume_fraction_of_condensed_water_in_soil long_name = total soil moisture units = frac - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil) + dimensions = (horizontal_dimension,vertical_dimension_of_soil) type = real kind = kind_phys [stc] standard_name = soil_temperature long_name = soil temperature units = K - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil) + dimensions = (horizontal_dimension,vertical_dimension_of_soil) type = real kind = kind_phys [t2m] standard_name = air_temperature_at_2m long_name = 2 meter temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [th2m] standard_name = air_potential_temperature_at_2m long_name = 2 meter potential temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [q2m] standard_name = specific_humidity_at_2m long_name = 2 meter specific humidity units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tref] standard_name = reference_sea_surface_temperature long_name = sea surface reference temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1327,7 +1328,7 @@ standard_name = molecular_sublayer_thickness_in_sea_water long_name = sub-layer cooling thickness units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1335,7 +1336,7 @@ standard_name = coefficient_c_0 long_name = coefficient 1 to calculate d(Tz)/d(Ts) units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1343,7 +1344,7 @@ standard_name = coefficient_c_d long_name = coefficient 2 to calculate d(Tz)/d(Ts) units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1351,7 +1352,7 @@ standard_name = coefficient_w_0 long_name = coefficient 3 to calculate d(Tz)/d(Ts) units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1359,7 +1360,7 @@ standard_name = coefficient_w_d long_name = coefficient 4 to calculate d(Tz)/d(Ts) units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1367,7 +1368,7 @@ standard_name = heat_content_in_diurnal_thermocline long_name = heat content in diurnal thermocline layer units = K m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1375,7 +1376,7 @@ standard_name = sea_water_salinity_in_diurnal_thermocline long_name = salinity content in diurnal thermocline layer units = ppt m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1383,7 +1384,7 @@ standard_name = x_current_in_diurnal_thermocline long_name = u-current content in diurnal thermocline layer units = m2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1391,7 +1392,7 @@ standard_name = y_current_in_diurnal_thermocline long_name = v-current content in diurnal thermocline layer units = m2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1399,7 +1400,7 @@ standard_name = diurnal_thermocline_layer_thickness long_name = diurnal thermocline layer thickness units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1407,7 +1408,7 @@ standard_name = ocean_mixed_layer_thickness long_name = mixed layer thickness units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1415,7 +1416,7 @@ standard_name = derivative_of_heat_content_in_diurnal_thermocline_wrt_surface_skin_temperature long_name = d(xt)/d(ts) units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1423,7 +1424,7 @@ standard_name = derivative_of_diurnal_thermocline_layer_thickness_wrt_surface_skin_temperature long_name = d(xz)/d(ts) units = m K-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1431,7 +1432,7 @@ standard_name = free_convection_layer_thickness_in_sea_water long_name = thickness of free convection layer (FCL) units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1439,7 +1440,7 @@ standard_name = control_for_diurnal_thermocline_calculation long_name = index to start dtlm run or not units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1447,7 +1448,7 @@ standard_name = molecular_sublayer_temperature_correction_in_sea_water long_name = sub-layer cooling amount units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1455,7 +1456,7 @@ standard_name = surface_sensible_heat_due_to_rainfall long_name = sensible heat flux due to rainfall units = W - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_nsstm > 0) @@ -1463,7 +1464,7 @@ standard_name = number_of_snow_layers long_name = number of snow layers units = count - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1471,7 +1472,7 @@ standard_name = canopy_temperature long_name = vegetation temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1479,7 +1480,7 @@ standard_name = ground_temperature long_name = ground temperature for noahmp units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1487,7 +1488,7 @@ standard_name = canopy_intercepted_ice_mass long_name = canopy intercepted ice mass units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1495,7 +1496,7 @@ standard_name = canopy_intercepted_liquid_water long_name = canopy intercepted liquid water units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1503,7 +1504,7 @@ standard_name = air_vapor_pressure_in_canopy long_name = canopy air vapor pressure units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1511,7 +1512,7 @@ standard_name = air_temperature_in_canopy long_name = canopy air temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1519,7 +1520,7 @@ standard_name = surface_drag_coefficient_for_momentum_for_noahmp long_name = surface drag coefficient for momentum for noahmp units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1527,7 +1528,7 @@ standard_name = surface_drag_coefficient_for_heat_and_moisture_for_noahmp long_name = surface exchange coeff heat & moisture for noahmp units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1535,7 +1536,7 @@ standard_name = wet_canopy_area_fraction long_name = area fraction of canopy that is wetted/snowed units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1543,7 +1544,7 @@ standard_name = lwe_thickness_of_snowfall_amount_on_previous_timestep long_name = snow mass at previous time step units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1551,7 +1552,7 @@ standard_name = surface_albedo_assuming_deep_snow_on_previous_timestep long_name = snow albedo at previous time step units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1559,7 +1560,7 @@ standard_name = lwe_snowfall_rate long_name = snow precipitation rate at surface units = mm s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1567,7 +1568,7 @@ standard_name = water_storage_in_lake long_name = lake water storage units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1575,7 +1576,7 @@ standard_name = water_table_depth long_name = water table depth units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1583,7 +1584,7 @@ standard_name = water_storage_in_aquifer long_name = water storage in aquifer units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1591,7 +1592,7 @@ standard_name = water_storage_in_aquifer_and_saturated_soil long_name = water storage in aquifer and saturated soil units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1599,7 +1600,7 @@ standard_name = temperature_in_surface_snow long_name = temperature_in_surface_snow units = K - dimensions = (horizontal_loop_extent, lower_bound_of_vertical_dimension_of_surface_snow:0) + dimensions = (horizontal_dimension, lower_bound_of_vertical_dimension_of_surface_snow:0) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1607,7 +1608,7 @@ standard_name = depth_from_snow_surface_at_bottom_interface long_name = depth from the top of the snow surface at the bottom of the layer units = m - dimensions = (horizontal_loop_extent, lower_bound_of_vertical_dimension_of_surface_snow:vertical_dimension_of_soil_internal_to_land_surface_scheme) + dimensions = (horizontal_dimension, lower_bound_of_vertical_dimension_of_surface_snow:vertical_dimension_of_soil_internal_to_land_surface_scheme) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1615,7 +1616,7 @@ standard_name = lwe_thickness_of_ice_in_surface_snow long_name = snow layer ice units = mm - dimensions = (horizontal_loop_extent, lower_bound_of_vertical_dimension_of_surface_snow:0) + dimensions = (horizontal_dimension, lower_bound_of_vertical_dimension_of_surface_snow:0) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1623,7 +1624,7 @@ standard_name = lwe_thickness_of_liquid_water_in_surface_snow long_name = snow layer liquid water units = mm - dimensions = (horizontal_loop_extent, lower_bound_of_vertical_dimension_of_surface_snow:0) + dimensions = (horizontal_dimension, lower_bound_of_vertical_dimension_of_surface_snow:0) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1631,7 +1632,7 @@ standard_name = leaf_mass_content long_name = leaf mass units = g m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1639,7 +1640,7 @@ standard_name = fine_root_mass_content long_name = fine root mass units = g m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1647,7 +1648,7 @@ standard_name = stem_mass_content long_name = stem mass units = g m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1655,7 +1656,7 @@ standard_name = wood_mass_content long_name = wood mass including woody roots units = g m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1663,7 +1664,7 @@ standard_name = slow_soil_pool_mass_content_of_carbon long_name = stable carbon in deep soil units = g m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1671,7 +1672,7 @@ standard_name = fast_soil_pool_mass_content_of_carbon long_name = short-lived carbon in shallow soil units = g m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1679,7 +1680,7 @@ standard_name = leaf_area_index long_name = leaf area index units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noah_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1687,7 +1688,7 @@ standard_name = stem_area_index long_name = stem area index units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1695,7 +1696,7 @@ standard_name = dimensionless_age_of_surface_snow long_name = non-dimensional snow age units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1703,7 +1704,7 @@ standard_name = volumetric_equilibrium_soil_moisture long_name = equilibrium soil water content units = m3 m-3 - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme) + dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1711,7 +1712,7 @@ standard_name = volumetric_soil_moisture_between_soil_bottom_and_water_table long_name = soil water content between the bottom of the soil and the water table units = m3 m-3 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1719,7 +1720,7 @@ standard_name = water_table_recharge_assuming_deep long_name = recharge to or from the water table when deep units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1727,7 +1728,7 @@ standard_name = water_table_recharge_assuming_shallow long_name = recharge to or from the water table when shallow units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -1735,35 +1736,35 @@ standard_name = surface_albedo_direct_visible_over_land long_name = direct surface albedo visible band over land units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [albdirnir_lnd] standard_name = surface_albedo_direct_NIR_over_land long_name = direct surface albedo NIR band over land units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [albdifvis_lnd] standard_name = surface_albedo_diffuse_visible_over_land long_name = diffuse surface albedo visible band over land units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [albdifnir_lnd] standard_name = surface_albedo_diffuse_NIR_over_land long_name = diffuse surface albedo NIR band over land units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [albdirvis_ice] standard_name = surface_albedo_direct_visible_over_ice long_name = direct surface albedo visible band over ice units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. flag_for_cice_albedo) @@ -1771,7 +1772,7 @@ standard_name = surface_albedo_diffuse_visible_over_ice long_name = diffuse surface albedo visible band over ice units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. flag_for_cice_albedo) @@ -1779,7 +1780,7 @@ standard_name = surface_albedo_direct_NIR_over_ice long_name = direct surface albedo NIR band over ice units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. flag_for_cice_albedo) @@ -1787,7 +1788,7 @@ standard_name = surface_albedo_diffuse_NIR_over_ice long_name = diffuse surface albedo NIR band over ice units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. flag_for_cice_albedo) @@ -1795,7 +1796,7 @@ standard_name = normalized_soil_wetness_for_land_surface_model long_name = normalized soil wetness for lsm units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1803,7 +1804,7 @@ standard_name = volume_fraction_of_unfrozen_soil_moisture_for_land_surface_model long_name = volume fraction of unfrozen soil moisture for lsm units = frac - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme) + dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1811,7 +1812,7 @@ standard_name = volume_fraction_of_frozen_soil_moisture_for_land_surface_model long_name = volume fraction of frozen soil moisture for lsm units = frac - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme) + dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1819,7 +1820,7 @@ standard_name = volume_fraction_of_soil_moisture_for_land_surface_model long_name = volumetric fraction of soil moisture for lsm units = frac - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme) + dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1827,7 +1828,7 @@ standard_name = soil_temperature_for_land_surface_model long_name = soil temperature for land surface model units = K - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme) + dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1835,7 +1836,7 @@ standard_name = cloud_condensed_water_mixing_ratio_at_surface_over_land long_name = moist cloud water mixing ratio at surface over land units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1843,7 +1844,7 @@ standard_name = cloud_condensed_water_mixing_ratio_at_surface_over_ice long_name = moist cloud water mixing ratio at surface over ice units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1851,7 +1852,7 @@ standard_name = water_vapor_mixing_ratio_at_surface_over_land long_name = water vapor mixing ratio at surface over land units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1859,7 +1860,7 @@ standard_name = water_vapor_mixing_ratio_at_surface_over_ice long_name = water vapor mixing ratio at surface over ice units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1867,7 +1868,7 @@ standard_name = control_for_frozen_soil_physics long_name = flag for frozen soil physics (RUC) units = flag - dimensions = (horizontal_loop_extent,vertical_dimension_of_soil_internal_to_land_surface_scheme) + dimensions = (horizontal_dimension,vertical_dimension_of_soil_internal_to_land_surface_scheme) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1875,7 +1876,7 @@ standard_name = lsm_internal_surface_frozen_precipitation_density long_name = density of frozen precipitation units = kg m-3 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1883,7 +1884,7 @@ standard_name = temperature_in_surface_snow_at_surface_adjacent_layer_over_land long_name = snow temperature at the bottom of the first snow layer over land units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1891,7 +1892,7 @@ standard_name = temperature_in_surface_snow_at_surface_adjacent_layer_over_ice long_name = snow temperature at the bottom of the first snow layer over ice units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1899,7 +1900,7 @@ standard_name = surface_snow_amount_assuming_variable_snow_density_over_land long_name = run-total snow accumulation on the ground with variable snow density over land units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1907,14 +1908,14 @@ standard_name = surface_snow_lwe_thickness_amount_over_land long_name = run-total snowfall water equivalent over land units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [snowfallac_ice] standard_name = surface_snow_amount_assuming_variable_snow_density_over_ice long_name = run-total snow accumulation on the ground with variable snow density over ice units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -1922,14 +1923,14 @@ standard_name = surface_snow_lwe_thickness_amount_over_ice long_name = run-total snowfall water equivalent over ice units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ustm] standard_name = surface_friction_velocity_for_momentum long_name = friction velocity isolated for momentum only units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme) @@ -1937,7 +1938,7 @@ standard_name = ratio_of_height_to_monin_obukhov_length long_name = monin obukhov surface stability parameter units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme) @@ -1945,7 +1946,7 @@ standard_name = surface_temperature_scale long_name = temperature flux divided by ustar (temperature scale) units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme) @@ -1953,28 +1954,28 @@ standard_name = reciprocal_of_obukhov_length long_name = one over obukhov length units = m-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [flhc] standard_name = surface_exchange_coefficient_for_heat long_name = surface exchange coefficient for heat units = W m-2 K-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [flqc] standard_name = surface_exchange_coefficient_for_moisture long_name = surface exchange coefficient for moisture units = kg m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [chs2] standard_name = surface_exchange_coefficient_for_heat_at_2m long_name = exchange coefficient for heat at 2 meters units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme) @@ -1982,7 +1983,7 @@ standard_name = surface_exchange_coefficient_for_moisture_at_2m long_name = exchange coefficient for moisture at 2 meters units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme) @@ -1990,7 +1991,7 @@ standard_name = surface_upward_latent_heat_flux long_name = latent heating at the surface (pos = up) units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_surface_layer_scheme) @@ -1998,28 +1999,28 @@ standard_name = surface_upward_specific_humidity_flux long_name = kinematic surface upward latent heat flux units = kg kg-1 m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [hflx] standard_name = surface_upward_temperature_flux long_name = kinematic surface upward sensible heat flux units = K m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [qss] standard_name = surface_specific_humidity long_name = surface air saturation specific humidity units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [raincprv] standard_name = lwe_thickness_of_convective_precipitation_amount_on_previous_timestep long_name = convective_precipitation_amount from previous timestep units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme .or. ( control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2) ) @@ -2027,7 +2028,7 @@ standard_name = lwe_thickness_of_explicit_precipitation_amount_on_previous_timestep long_name = explicit rainfall from previous timestep units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme .or. ( control_for_lake_model_execution_method > 0 .and. control_for_lake_model_selection == 2) ) @@ -2035,7 +2036,7 @@ standard_name = lwe_thickness_of_ice_precipitation_amount_on_previous_timestep long_name = ice amount from previous timestep units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -2043,7 +2044,7 @@ standard_name = snow_mass_on_previous_timestep long_name = snow amount from previous timestep units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -2051,7 +2052,7 @@ standard_name = lwe_thickness_of_graupel_amount_on_previous_timestep long_name = graupel amount from previous timestep units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme .or. control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -2059,7 +2060,7 @@ standard_name = convective_precipitation_rate_on_previous_timestep long_name = convective precipitation rate from previous timestep units = mm s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -2067,7 +2068,7 @@ standard_name = explicit_precipitation_rate_on_previous_timestep long_name = explicit rainfall rate previous timestep units = mm s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -2075,7 +2076,7 @@ standard_name = ice_precipitation_rate_on_previous_timestep long_name = ice precipitation rate from previous timestep units = mm s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -2083,7 +2084,7 @@ standard_name = snowfall_rate_on_previous_timestep long_name = snow precipitation rate from previous timestep units = mm s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -2091,7 +2092,7 @@ standard_name = graupel_precipitation_rate_on_previous_timestep long_name = graupel precipitation rate from previous timestep units = mm s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -2099,35 +2100,35 @@ standard_name = vis_albedo_strong_cosz long_name = mean vis albedo with strong cosz dependency units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [alnsf] standard_name = nir_albedo_strong_cosz long_name = mean nir albedo with strong cosz dependency units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [facsf] standard_name =strong_cosz_area_fraction long_name = fractional coverage with strong cosz dependency units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [facwf] standard_name = weak_cosz_area_fraction long_name = fractional coverage with weak cosz dependency units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [lake_albedo] standard_name = mid_day_surface_albedo_over_lake long_name = mid day surface albedo over lake units = fraction - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2135,7 +2136,7 @@ standard_name = lake_depth_before_correction long_name = lake depth_before_correction units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2143,7 +2144,7 @@ standard_name = water_equivalent_accumulated_snow_depth_in_clm_lake_model long_name = water equiv of acc snow depth over lake in clm lake model units = mm - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2151,7 +2152,7 @@ standard_name = actual_snow_depth_in_clm_lake_model long_name = actual acc snow depth over lake in clm lake model units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2159,7 +2160,7 @@ standard_name = snow_layers_in_clm_lake_model long_name = snow layers in clm lake model (treated as integer) units = count - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2167,7 +2168,7 @@ standard_name = snow_level_depth_in_clm_lake_model long_name = snow level depth in clm lake model units = m - dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2175,7 +2176,7 @@ standard_name = snow_level_thickness_in_clm_lake_model long_name = snow level thickness in clm lake model units = m - dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2183,7 +2184,7 @@ standard_name = snow_interface_depth_in_clm_lake_model long_name = snow interface_depth in clm lake model units = m - dimensions = (horizontal_loop_extent,snow_plus_soil_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,snow_plus_soil_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2191,7 +2192,7 @@ standard_name = volumetric_soil_water_in_clm_lake_model long_name = volumetric soil water in clm lake model units = m3 m-3 - dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2199,7 +2200,7 @@ standard_name = soil_liquid_water_content_in_clm_lake_model long_name = soil liquid water content in clm lake model units = kg m-3 - dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2207,7 +2208,7 @@ standard_name = soil_ice_water_content_in_clm_lake_model long_name = soil ice water content in clm lake model units = kg m-3 - dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2215,7 +2216,7 @@ standard_name = skin_temperature_from_lake_model long_name = skin temperature from lake model units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2223,7 +2224,7 @@ standard_name = soil_or_snow_layer_temperature_from_clm_lake_model long_name = soil or snow layer temperature from clm lake model units = K - dimensions = (horizontal_loop_extent,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,snow_plus_soil_minus_one_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2231,7 +2232,7 @@ standard_name = lake_layer_temperature_from_clm_lake_model long_name = lake layer temperature from clm lake model units = K - dimensions = (horizontal_loop_extent,lake_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,lake_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2239,7 +2240,7 @@ standard_name = top_level_eddy_conductivity_from_previous_timestep_in_clm_lake_model long_name = top level eddy conductivity from previous timestep in clm lake model units = kg m-3 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2247,14 +2248,14 @@ standard_name = lake_fractional_ice_cover_on_clm_lake_levels long_name = lake fractional ice cover on clm lake levels units = kg m-3 - dimensions = (horizontal_loop_extent,lake_vertical_dimension_for_clm_lake_model) + dimensions = (horizontal_dimension,lake_vertical_dimension_for_clm_lake_model) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) [lake_ht] standard_name = test_lake_ht long_name = test_lake_ht - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) units = unitless type = real kind = kind_phys @@ -2263,7 +2264,7 @@ standard_name = flag_for_clm_lake_initialization long_name = set to true in clm_lake_run after likeini is called for that gridpoint units = flag - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) @@ -2271,21 +2272,21 @@ standard_name = clm_lake_is_salty long_name = lake at this point is salty (1) or not (0) units = 1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) [lake_cannot_freeze] standard_name = clm_lake_cannot_freeze long_name = lake at this point is so salty it cannot freeze units = 1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (control_for_lake_model_selection == 2 .and. control_for_lake_model_execution_method > 0) [emdust] standard_name = emission_of_dust_for_smoke long_name = emission of dust for smoke units = ug m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2293,7 +2294,7 @@ standard_name = emission_of_sea_salt_for_mp_indir_fdb long_name = emission of sea salt for mp indirect feedabck units = ug m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2301,7 +2302,7 @@ standard_name = emission_of_anothropogenic_for_mp_indir_fdb long_name = emission of anothropogenic for mp indirect feedabck units = ug m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2309,7 +2310,7 @@ standard_name = surface_smoke_emission long_name = emission of surface smoke units = ug m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2317,7 +2318,7 @@ standard_name = frp_hourly long_name = hourly fire radiative power units = MW - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2325,7 +2326,7 @@ standard_name = fire_hist long_name = coefficient to scale the fire activity depending on the fire duration units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2333,7 +2334,7 @@ standard_name = coef_bb_dc long_name = coef to estimate the fire emission units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2341,14 +2342,14 @@ standard_name = fire_type long_name = type of fire units = 1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (do_smoke_coupling) [peak_hr] standard_name = peak_hr_fire long_name = time_of_peak_fire_emissions units = s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2356,7 +2357,7 @@ standard_name = sum_of_land_use_fractions_for_no_fire_pixels long_name = land use of no fire pixels for type units = 1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2364,7 +2365,7 @@ standard_name = sum_of_land_use_fractions_for_cropland_fire_pixels long_name = land use of fire pixels for type units = 1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2372,7 +2373,7 @@ standard_name = smoke_fire_auxiliary_input long_name = smoke fire auxiliary input variables units = various - dimensions = (horizontal_loop_extent,fire_auxiliary_data_extent) + dimensions = (horizontal_dimension,fire_auxiliary_data_extent) type = real kind = kind_phys active = (do_smoke_coupling) @@ -2390,91 +2391,91 @@ standard_name = surface_downwelling_direct_nir_shortwave_flux_on_radiation_timestep long_name = sfc nir beam sw downward flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [nirdfdi] standard_name = surface_downwelling_diffuse_nir_shortwave_flux_on_radiation_timestep long_name = sfc nir diff sw downward flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [visbmdi] standard_name = surface_downwelling_direct_uv_and_vis_shortwave_flux_on_radiation_timestep long_name = sfc uv+vis beam sw downward flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [visdfdi] standard_name = surface_downwelling_diffuse_uv_and_vis_shortwave_flux_on_radiation_timestep long_name = sfc uv+vis diff sw downward flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [nirbmui] standard_name = surface_upwelling_direct_nir_shortwave_flux_on_radiation_timestep long_name = sfc nir beam sw upward flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [nirdfui] standard_name = surface_upwelling_diffuse_nir_shortwave_flux_on_radiation_timestep long_name = sfc nir diff sw upward flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [visbmui] standard_name = surface_upwelling_direct_uv_and_vis_shortwave_flux_on_radiation_timestep long_name = sfc uv+vis beam sw upward flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [visdfui] standard_name = surface_upwelling_diffuse_uv_and_vis_shortwave_flux_on_radiation_timestep long_name = sfc uv+vis diff sw upward flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sfcdsw] standard_name = surface_downwelling_shortwave_flux_on_radiation_timestep long_name = total sky sfc downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sfcnsw] standard_name = surface_net_downwelling_shortwave_flux_on_radiation_timestep long_name = total sky sfc netsw flx into ground units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sfcdlw] standard_name = surface_downwelling_longwave_flux_on_radiation_timestep long_name = total sky sfc downward lw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sfculw] standard_name = surface_upwelling_longwave_flux_on_radiation_timestep long_name = total sky sfc upward lw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [rain_cpl] standard_name = cumulative_lwe_thickness_of_precipitation_amount_for_coupling long_name = total rain precipitation units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_stochastic_physics_perturbations .or. flag_for_chemistry_coupling .or. flag_for_global_cellular_automata .or. flag_for_land_coupling) @@ -2482,7 +2483,7 @@ standard_name = cumulative_lwe_thickness_of_convective_precipitation_amount_for_coupling long_name = total convective precipitation units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling) @@ -2490,7 +2491,7 @@ standard_name = cumulative_lwe_thickness_of_snow_amount_for_coupling long_name = total snow precipitation units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_stochastic_physics_perturbations .or. flag_for_chemistry_coupling .or. flag_for_global_cellular_automata .or. flag_for_land_coupling) @@ -2498,7 +2499,7 @@ standard_name = cumulative_surface_x_momentum_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc x momentum flux multiplied by timestep units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2506,7 +2507,7 @@ standard_name = cumulative_surface_y_momentum_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc y momentum flux multiplied by timestep units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2514,7 +2515,7 @@ standard_name = cumulative_surface_upward_sensible_heat_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc sensible heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2522,7 +2523,7 @@ standard_name = cumulative_surface_upward_latent_heat_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc latent heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2530,7 +2531,7 @@ standard_name = cumulative_surface_downwelling_longwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc downward lw flux mulitplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2538,7 +2539,7 @@ standard_name = cumulative_surface_downwelling_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc downward sw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2546,7 +2547,7 @@ standard_name = cumulative_surface_downwelling_direct_nir_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc nir beam downward sw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2554,7 +2555,7 @@ standard_name = cumulative_surface_downwelling_diffuse_nir_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc nir diff downward sw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2562,7 +2563,7 @@ standard_name = cumulative_surface_downwelling_direct_uv_and_vis_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc uv+vis beam dnwd sw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2570,7 +2571,7 @@ standard_name = cumulative_surface_downwelling_diffuse_uv_and_vis_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative sfc uv+vis diff dnwd sw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2578,7 +2579,7 @@ standard_name = cumulative_surface_net_downwelling_longwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative net downward lw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2586,7 +2587,7 @@ standard_name = cumulative_surface_net_downwelling_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative net downward sw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2594,7 +2595,7 @@ standard_name = cumulative_surface_net_downwelling_direct_nir_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative net nir beam downward sw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2602,7 +2603,7 @@ standard_name = cumulative_surface_net_downwellling_diffuse_nir_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative net nir diff downward sw flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2610,7 +2611,7 @@ standard_name = cumulative_surface_net_downwelling_direct_uv_and_vis_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative net uv+vis beam downward sw rad flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2618,7 +2619,7 @@ standard_name = cumulative_surface_net_downwelling_diffuse_uv_and_vis_shortwave_flux_for_coupling_multiplied_by_timestep long_name = cumulative net uv+vis diff downward sw rad flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2626,7 +2627,7 @@ standard_name = surface_x_momentum_flux_for_coupling long_name = instantaneous sfc x momentum flux units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2634,7 +2635,7 @@ standard_name = surface_y_momentum_flux_for_coupling long_name = instantaneous sfc y momentum flux units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2642,7 +2643,7 @@ standard_name = surface_upward_sensible_heat_flux_for_coupling long_name = instantaneous sfc sensible heat flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling) @@ -2650,7 +2651,7 @@ standard_name = surface_upward_latent_heat_flux_for_coupling long_name = instantaneous sfc latent heat flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling) @@ -2658,7 +2659,7 @@ standard_name = surface_downwelling_longwave_flux_for_coupling long_name = instantaneous sfc downward lw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2666,7 +2667,7 @@ standard_name = surface_downwelling_shortwave_flux_for_coupling long_name = instantaneous sfc downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2674,7 +2675,7 @@ standard_name = surface_downwelling_direct_nir_shortwave_flux_for_coupling long_name = instantaneous sfc nir beam downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2682,7 +2683,7 @@ standard_name = surface_downwelling_diffuse_nir_shortwave_flux_for_coupling long_name = instantaneous sfc nir diff downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2690,7 +2691,7 @@ standard_name = surface_downwelling_direct_uv_and_vis_shortwave_flux_for_coupling long_name = instantaneous sfc uv+vis beam downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2698,7 +2699,7 @@ standard_name = surface_downwelling_diffuse_uv_and_vis_shortwave_flux_for_coupling long_name = instantaneous sfc uv+vis diff downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2706,7 +2707,7 @@ standard_name = surface_net_downwelling_longwave_flux_for_coupling long_name = instantaneous net sfc downward lw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2714,7 +2715,7 @@ standard_name = surface_net_downwelling_shortwave_flux_for_coupling long_name = instantaneous net sfc downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling .or. flag_for_land_coupling) @@ -2722,7 +2723,7 @@ standard_name = surface_net_downwelling_direct_nir_shortwave_flux_for_coupling long_name = instantaneous net nir beam sfc downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2730,7 +2731,7 @@ standard_name = surface_net_downwelling_diffuse_nir_shortwave_flux_for_coupling long_name = instantaneous net nir diff sfc downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2738,7 +2739,7 @@ standard_name = surface_net_downwelling_direct_uv_and_vis_shortwave_flux_for_coupling long_name = instantaneous net uv+vis beam downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2746,7 +2747,7 @@ standard_name = surface_net_downwelling_diffuse_uv_and_vis_shortwave_flux_for_coupling long_name = instantaneous net uv+vis diff downward sw flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_land_coupling) @@ -2754,7 +2755,7 @@ standard_name = temperature_at_2m_for_coupling long_name = instantaneous T2m units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling) @@ -2762,7 +2763,7 @@ standard_name = specific_humidity_at_2m_for_coupling long_name = instantaneous Q2m units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling) @@ -2770,7 +2771,7 @@ standard_name = x_wind_at_10m_for_coupling long_name = instantaneous U10m units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_ocean_wave_coupling) @@ -2778,7 +2779,7 @@ standard_name = y_wind_at_10m_for_coupling long_name = instantaneous V10m units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_ocean_wave_coupling) @@ -2786,7 +2787,7 @@ standard_name = surface_skin_temperature_for_coupling long_name = instantaneous sfc temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling) @@ -2794,7 +2795,7 @@ standard_name = surface_air_pressure_for_coupling long_name = instantaneous sfc pressure units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_air_quality_coupling .or. flag_for_land_coupling) @@ -2802,7 +2803,7 @@ standard_name = surface_upwelling_longwave_flux_from_coupled_process long_name = surface upwelling LW flux for coupling units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2810,7 +2811,7 @@ standard_name = surface_x_momentum_flux_from_coupled_process long_name = sfc x momentum flux for coupling units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2818,7 +2819,7 @@ standard_name = surface_y_momentum_flux_from_coupled_process long_name = sfc y momentum flux for coupling units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2826,7 +2827,7 @@ standard_name = surface_upward_sensible_heat_flux_from_coupled_process long_name = sfc sensible heat flux input units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2834,7 +2835,7 @@ standard_name = surface_upward_latent_heat_flux_from_coupled_process long_name = sfc latent heat flux input for coupling units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -2842,7 +2843,7 @@ standard_name = surface_upwelling_longwave_flux_over_ocean_from_mediator long_name = surface upwelling LW flux over ocean for coupling units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes) @@ -2850,7 +2851,7 @@ standard_name = surface_x_momentum_flux_over_ocean_from_mediator long_name = sfc x momentum flux over ocean for coupling units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes) @@ -2858,7 +2859,7 @@ standard_name = surface_y_momentum_flux_over_ocean_from_mediator long_name = sfc y momentum flux over ocean for coupling units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes) @@ -2866,7 +2867,7 @@ standard_name = surface_upward_sensible_heat_flux_over_ocean_from_mediator long_name = sfc sensible heat flux input over ocean for coupling units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes) @@ -2874,7 +2875,7 @@ standard_name = surface_upward_latent_heat_flux_over_ocean_from_mediator long_name = sfc latent heat flux input over ocean for coupling units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .and. do_mediator_atmosphere_ocean_fluxes) @@ -2882,7 +2883,7 @@ standard_name = surface_snow_area_fraction_over_land_from_land long_name = surface snow area fraction over land for coupling units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2890,7 +2891,7 @@ standard_name = surface_specific_humidity_over_land_from_land long_name = surface air saturation specific humidity over land units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2898,7 +2899,7 @@ standard_name = surface_upward_sensible_heat_flux_over_land_from_land long_name = sfc sensible heat flux input over land for coupling units = K m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2906,7 +2907,7 @@ standard_name = surface_upward_latent_heat_flux_over_land_from_land long_name = sfc latent heat flux input over land for coupling units = kg kg-1 m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2914,7 +2915,7 @@ standard_name = surface_upward_potential_latent_heat_flux_over_land_from_land long_name = surface upward potential latent heat flux over land for coupling units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2922,7 +2923,7 @@ standard_name = temperature_at_2m_over_land_from_land long_name = 2 meter temperature over land for coupling units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2930,7 +2931,7 @@ standard_name = specific_humidity_at_2m_over_land_from_land long_name = 2 meter specific humidity over land for coupling units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2938,7 +2939,7 @@ standard_name = upward_heat_flux_in_soil_over_land_from_land long_name = soil heat flux over land for coupling units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2946,7 +2947,7 @@ standard_name = surface_runoff_flux_from_land long_name = surface runoff flux over land for coupling units = kg m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2954,7 +2955,7 @@ standard_name = subsurface_runoff_flux_from_land long_name = subsurface runoff flux over land for coupling units = kg m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2962,7 +2963,7 @@ standard_name = surface_drag_wind_speed_for_momentum_in_air_over_land_from_land long_name = momentum exchange coefficient over land for coupling units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2970,7 +2971,7 @@ standard_name = surface_drag_mass_flux_for_heat_and_moisture_in_air_over_land_from_land long_name = thermal exchange coefficient over land for coupling units = kg m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2978,7 +2979,7 @@ standard_name = function_of_surface_roughness_length_and_green_vegetation_fraction_from_land long_name = function of surface roughness length and green vegetation fraction units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_land_coupling .and. flag_for_one_way_land_coupling_to_atmosphere) @@ -2986,14 +2987,14 @@ standard_name = lwe_surface_snow_from_coupled_process long_name = sfc snow depth in meters over sea ice for coupling units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [slimskin_cpl] standard_name = area_type_from_coupled_process long_name = sea/land/ice mask input (=0/1/2) units = flag - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling) @@ -3001,7 +3002,7 @@ standard_name = instantaneous_tendency_of_specific_humidity_due_to_microphysics long_name = instantaneous_tendency_of_specific_humidity_due_to_microphysics units = kg kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_prognostic_updraft_area_fraction) @@ -3009,7 +3010,7 @@ standard_name = cellular_automata_area_fraction_for_deep_convection_from_coupled_process long_name = fraction of cellular automata for deep convection units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_cellular_automata) @@ -3017,7 +3018,7 @@ standard_name = cellular_automata_global_pattern_from_coupled_process long_name = cellular automata global pattern units = flag - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_cellular_automata) @@ -3025,14 +3026,14 @@ standard_name = physics_field_for_coupling long_name = physics_field_for_coupling units = m2 s-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [shum_wts] standard_name = shum_weights_from_coupled_process long_name = weights for stochastic shum perturbation units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_stochastic_shum_option) @@ -3040,7 +3041,7 @@ standard_name = sppt_weights_from_coupled_process long_name = weights for stochastic sppt perturbation units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_stochastic_physics_perturbations .or. flag_for_global_cellular_automata) @@ -3048,7 +3049,7 @@ standard_name = skeb_x_wind_weights_from_coupled_process long_name = weights for stochastic skeb perturbation of x wind units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_stochastic_skeb_option) @@ -3056,7 +3057,7 @@ standard_name = skeb_y_wind_weights_from_coupled_process long_name = weights for stochastic skeb perturbation of y wind units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_stochastic_skeb_option) @@ -3064,7 +3065,7 @@ standard_name = spp_weights_for_pbl_scheme long_name = spp weights for pbl scheme units = 1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_stochastically_perturbed_parameterizations) @@ -3072,7 +3073,7 @@ standard_name = spp_weights_for_surface_layer_scheme long_name = spp weights for surface layer scheme units = 1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_stochastically_perturbed_parameterizations) @@ -3080,7 +3081,7 @@ standard_name = spp_weights_for_microphysics_scheme long_name = spp weights for microphysics scheme units = 1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_stochastically_perturbed_parameterizations) @@ -3088,7 +3089,7 @@ standard_name = spp_weights_for_gravity_wave_drag_scheme long_name = spp weights for gravity wave drag scheme units = 1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_stochastically_perturbed_parameterizations) @@ -3096,7 +3097,7 @@ standard_name = spp_weights_for_radiation_scheme long_name = spp weights for radiation scheme units = 1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_stochastically_perturbed_parameterizations) @@ -3104,7 +3105,7 @@ standard_name = spp_weights_for_cu_deep_scheme long_name = spp weights for cu deep scheme units = 1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_stochastically_perturbed_parameterizations) @@ -3112,7 +3113,7 @@ standard_name = surface_stochastic_weights_from_coupled_process long_name = weights for stochastic surface physics perturbation units = 1 - dimensions = (horizontal_loop_extent,number_of_perturbed_land_surface_variables) + dimensions = (horizontal_dimension,number_of_perturbed_land_surface_variables) type = real kind = kind_phys active = (control_for_stochastic_land_surface_perturbation /= 0) @@ -3120,7 +3121,7 @@ standard_name = tendency_of_hygroscopic_aerosols_at_surface_adjacent_layer long_name = instantaneous water-friendly sfc aerosol source units = kg-1 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_microphysics_scheme == identifier_for_thompson_microphysics_scheme .and. flag_for_aerosol_physics) @@ -3128,7 +3129,7 @@ standard_name = tendency_of_nonhygroscopic_ice_nucleating_aerosols_at_surface_adjacent_layer long_name = instantaneous ice-friendly sfc aerosol source units = kg-1 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_microphysics_scheme == identifier_for_thompson_microphysics_scheme .and. flag_for_aerosol_physics) @@ -3136,7 +3137,7 @@ standard_name = ebu_smoke long_name = buffer of vertical fire emission units = various - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3144,7 +3145,7 @@ standard_name = extinction_coefficient_in_air_due_to_smoke long_name = extinction coefficient in air due to smoke units = various - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3152,7 +3153,7 @@ standard_name = extinction_coefficient_in_air_due_to_dust long_name = extinction coefficient in air due to dust units = various - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3160,7 +3161,7 @@ standard_name = chem3d_mynn_pbl_transport long_name = mynn pbl transport of smoke and dust units = various - dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_chemical_species_vertically_mixed) + dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_chemical_species_vertically_mixed) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3168,7 +3169,7 @@ standard_name = dry_deposition_velocity_mynn_pbl_transport long_name = dry deposition velocity by mynn pbl transport units = m s-1 - dimensions = (horizontal_loop_extent,number_of_chemical_species_deposited) + dimensions = (horizontal_dimension,number_of_chemical_species_deposited) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3176,7 +3177,7 @@ standard_name = conv_wet_deposition_smoke_dust long_name = convective wet removal of smoke and dust units = kg kg-1 - dimensions = (horizontal_loop_extent,number_of_chemical_species_vertically_mixed) + dimensions = (horizontal_dimension,number_of_chemical_species_vertically_mixed) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3184,7 +3185,7 @@ standard_name = mp_wet_deposition_smoke_dust long_name = large scale wet deposition of smoke and dust units = kg kg-1 - dimensions = (horizontal_loop_extent,number_of_chemical_species_vertically_mixed) + dimensions = (horizontal_dimension,number_of_chemical_species_vertically_mixed) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3192,7 +3193,7 @@ standard_name = dry_deposition_flux long_name = rrfs dry deposition flux units = ug m-2 - dimensions = (horizontal_loop_extent,number_of_chemical_species_deposited) + dimensions = (horizontal_dimension,number_of_chemical_species_deposited) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3200,7 +3201,7 @@ standard_name = minimum_fire_plume_sigma_pressure_level long_name = minimum model level of fire plumerise units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3208,7 +3209,7 @@ standard_name = maximum_fire_plume_sigma_pressure_level long_name = maximum model level of fire plumerise units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3216,7 +3217,7 @@ standard_name = mean_wind_speed_in_boundary_layer long_name = average wind speed within the boundary layer units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3224,7 +3225,7 @@ standard_name = atmosphere_boundary_layer_thickness_from_modified_parcel long_name = pbl height based on modified parcel method units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3232,7 +3233,7 @@ standard_name = hourly_wildfire_potential long_name = rrfs hourly fire weather potential units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3240,7 +3241,7 @@ standard_name = hourly_wildfire_potential_average long_name = rrfs hourly fire weather potential average units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (do_smoke_coupling) @@ -3248,7 +3249,7 @@ standard_name = surface_upward_sensible_heat_flux_for_chemistry_coupling long_name = instantaneous upward sensible heat flux for chemistry coupling units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_chemistry_coupling) @@ -3256,7 +3257,7 @@ standard_name = convective_cloud_condesate_after_rainout long_name = convective cloud condesate after rainout units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection) @@ -3264,7 +3265,7 @@ standard_name = ice_flux_due_to_large_scale_precipitation long_name = instantaneous 3D flux of ice from nonconvective precipitation units = kg m-2 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_chemistry_coupling) @@ -3272,7 +3273,7 @@ standard_name = liquid_flux_due_to_large_scale_precipitation long_name = instantaneous 3D flux of liquid water from nonconvective precipitation units = kg m-2 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_chemistry_coupling) @@ -3280,7 +3281,7 @@ standard_name = updated_tendency_of_air_temperature_due_to_longwave_heating_on_physics_timestep long_name = total sky longwave heating rate on physics time step units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_rrtmgp_radiation_scheme) @@ -3288,7 +3289,7 @@ standard_name = surface_skin_temperature_on_radiation_timestep long_name = surface skin temperature on radiation timestep units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_rrtmgp_radiation_scheme) @@ -3296,7 +3297,7 @@ standard_name = RRTMGP_jacobian_of_lw_flux_upward long_name = RRTMGP Jacobian upward longwave flux profile units = W m-2 K-1 - dimensions = (horizontal_loop_extent,vertical_interface_dimension) + dimensions = (horizontal_dimension,vertical_interface_dimension) type = real kind = kind_phys active = (flag_for_rrtmgp_radiation_scheme) @@ -3304,7 +3305,7 @@ standard_name = RRTMGP_lw_flux_profile_upward_allsky_on_radiation_timestep long_name = RRTMGP upward longwave all-sky flux profile units = W m-2 - dimensions = (horizontal_loop_extent,vertical_interface_dimension) + dimensions = (horizontal_dimension,vertical_interface_dimension) type = real kind = kind_phys active = (flag_for_rrtmgp_radiation_scheme) @@ -3312,7 +3313,7 @@ standard_name = RRTMGP_lw_flux_profile_downward_allsky_on_radiation_timestep long_name = RRTMGP downward longwave all-sky flux profile units = W m-2 - dimensions = (horizontal_loop_extent,vertical_interface_dimension) + dimensions = (horizontal_dimension,vertical_interface_dimension) type = real kind = kind_phys active = (flag_for_rrtmgp_radiation_scheme) @@ -3551,6 +3552,36 @@ units = count dimensions = () type = integer +[nchunks] + standard_name = ccpp_chunk_extent + long_name = number of chunks of array data used in run phase + units = count + dimensions = () + type = integer +[chunk_begin] + standard_name = horizontal_loop_begin_all_chunks + long_name = first index for horizontal loop extent in run phase + units = index + dimensions = (ccpp_chunk_extent) + type = integer +[chunk_begin(ccpp_chunk_number)] + standard_name = horizontal_loop_begin + long_name = first index for horizontal loop extent in run phase + units = index + dimensions = () + type = integer +[chunk_end] + standard_name = horizontal_loop_end_all_chunks + long_name = last index for horizontal loop extent in run phase + units = index + dimensions = (ccpp_chunk_extent) + type = integer +[chunk_end(ccpp_chunk_number)] + standard_name = horizontal_loop_end + long_name = last index for horizontal loop extent in run phase + units = index + dimensions = () + type = integer [tile_num] standard_name = index_of_cubed_sphere_tile long_name = tile number @@ -7627,77 +7658,77 @@ standard_name = cell_area long_name = area of the grid cell units = m2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dx] standard_name = characteristic_grid_lengthscale long_name = relative dx for the grid cell units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [xlat] standard_name = latitude long_name = latitude units = radian - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [xlon] standard_name = longitude long_name = longitude units = radian - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [coslat] standard_name = cosine_of_latitude long_name = cosine of latitude units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sinlat] standard_name = sine_of_latitude long_name = sine of latitude units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [xlat_d] standard_name = latitude_in_degree long_name = latitude in degree north units = degree_north - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [xlon_d] standard_name = longitude_in_degree long_name = longitude in degree east units = degree_east - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [jindx1_o3] standard_name = lower_latitude_index_of_ozone_forcing_for_interpolation long_name = interpolation low index for ozone units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (index_of_ozone_mixing_ratio_in_tracer_concentration_array>0) [jindx2_o3] standard_name = upper_latitude_index_of_ozone_forcing_for_interpolation long_name = interpolation high index for ozone units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (index_of_ozone_mixing_ratio_in_tracer_concentration_array>0) [ddy_o3] standard_name = latitude_interpolation_weight_for_ozone_forcing long_name = interpolation high index for ozone units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (index_of_ozone_mixing_ratio_in_tracer_concentration_array>0) @@ -7705,21 +7736,21 @@ standard_name = lower_latitude_index_of_stratospheric_water_vapor_forcing_for_interpolation long_name = interpolation low index for stratospheric water vapor units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_stratospheric_water_vapor_physics) [jindx2_h] standard_name = upper_latitude_index_of_stratospheric_water_vapor_forcing_for_interpolation long_name = interpolation high index for stratospheric water vapor units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_stratospheric_water_vapor_physics) [ddy_h] standard_name = latitude_interpolation_weight_for_stratospheric_water_vapor_forcing long_name = interpolation high index for stratospheric water vapor units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_stratospheric_water_vapor_physics) @@ -7727,21 +7758,21 @@ standard_name = lower_latitude_index_of_aerosol_forcing_for_interpolation long_name = interpolation low index for prescribed aerosols in the y direction units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_aerosol_input_MG_radiation) [jindx2_aer] standard_name = upper_latitude_index_of_aerosol_forcing_for_interpolation long_name = interpolation high index for prescribed aerosols in the y direction units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_aerosol_input_MG_radiation) [ddy_aer] standard_name = latitude_interpolation_weight_for_aerosol_forcing long_name = interpolation high index for prescribed aerosols in the y direction units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_aerosol_input_MG_radiation) @@ -7749,21 +7780,21 @@ standard_name = lower_longitude_index_of_aerosol_forcing_for_interpolation long_name = interpolation low index for prescribed aerosols in the x direction units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_aerosol_input_MG_radiation) [iindx2_aer] standard_name = upper_longitude_index_of_aerosol_forcing_for_interpolation long_name = interpolation high index for prescribed aerosols in the x direction units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_aerosol_input_MG_radiation) [ddx_aer] standard_name = longitude_interpolation_weight_for_aerosol_forcing long_name = interpolation high index for prescribed aerosols in the x direction units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_aerosol_input_MG_radiation) @@ -7771,21 +7802,21 @@ standard_name = lower_latitude_index_of_cloud_nuclei_forcing_for_interpolation long_name = interpolation low index for ice and cloud condensation nuclei in the y direction units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (control_for_ice_cloud_condensation_nuclei_forcing==1) [jindx2_ci] standard_name = upper_latitude_index_of_cloud_nuclei_forcing_for_interpolation long_name = interpolation high index for ice and cloud condensation nuclei in the y direction units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (control_for_ice_cloud_condensation_nuclei_forcing==1) [ddy_ci] standard_name = latitude_interpolation_weight_for_cloud_nuclei_forcing long_name = interpolation high index for ice and cloud condensation nuclei in the y direction units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_ice_cloud_condensation_nuclei_forcing==1) @@ -7793,21 +7824,21 @@ standard_name = lower_longitude_index_of_cloud_nuclei_forcing_for_interpolation long_name = interpolation low index for ice and cloud condensation nuclei in the x direction units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (control_for_ice_cloud_condensation_nuclei_forcing==1) [iindx2_ci] standard_name = upper_longitude_index_of_cloud_nuclei_forcing_for_interpolation long_name = interpolation high index for ice and cloud condensation nuclei in the x direction units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (control_for_ice_cloud_condensation_nuclei_forcing==1) [ddx_ci] standard_name = longitude_interpolation_weight_for_cloud_nuclei_forcing long_name = interpolation high index for ice and cloud condensation nuclei in the x direction units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_ice_cloud_condensation_nuclei_forcing==1) @@ -7815,21 +7846,21 @@ standard_name = lower_latitude_index_of_absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag_for_interpolation long_name = index1 for weight1 for tau NGWs units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_ugwp_version_1) [jindx2_tau] standard_name = upper_latitude_index_of_absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag_for_interpolation long_name = index2 for weight2 for tau NGWs units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_ugwp_version_1) [ddy_j1tau] standard_name = latitude_interpolation_weight_complement_for_absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag long_name = interpolation weight1 for tau NGWs units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1) @@ -7837,7 +7868,7 @@ standard_name = latitude_interpolation_weight_for_absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag long_name = interpolation weight2 for tau NGWs units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1) @@ -7855,56 +7886,56 @@ standard_name = random_number_seed_for_mcica_shortwave long_name = random seeds for sub-column cloud generators sw units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_lw_clouds_sub_grid_approximation == 2 .or. flag_for_sw_clouds_grid_approximation == 2) [icsdlw] standard_name = random_number_seed_for_mcica_longwave long_name = random seeds for sub-column cloud generators lw units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_lw_clouds_sub_grid_approximation == 2 .or. flag_for_sw_clouds_grid_approximation == 2) [rseeds] standard_name = random_number_seeds_from_host long_name = random number seeds from host units = none - dimensions = (horizontal_loop_extent, number_of_host_provided_random_number_streams) + dimensions = (horizontal_dimension, number_of_host_provided_random_number_streams) type = integer active = ((flag_for_lw_clouds_sub_grid_approximation == 2 .or. flag_for_sw_clouds_grid_approximation == 2) .and. do_host_provided_random_seeds) [tau_amf] standard_name = absolute_momentum_flux_due_to_nonorographic_gravity_wave_drag long_name = ngw_absolute_momentum_flux units = mixed - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ozpl] standard_name = ozone_forcing long_name = ozone forcing data units = mixed - dimensions = (horizontal_loop_extent,vertical_dimension_of_ozone_forcing_data,number_of_coefficients_in_ozone_data) + dimensions = (horizontal_dimension,vertical_dimension_of_ozone_forcing_data,number_of_coefficients_in_ozone_data) type = real kind = kind_phys [h2opl] standard_name = stratospheric_water_vapor_forcing long_name = water forcing data units = mixed - dimensions = (horizontal_loop_extent,vertical_dimension_of_h2o_forcing_data,number_of_coefficients_in_h2o_forcing_data) + dimensions = (horizontal_dimension,vertical_dimension_of_h2o_forcing_data,number_of_coefficients_in_h2o_forcing_data) type = real kind = kind_phys [hpbl] standard_name = atmosphere_boundary_layer_thickness long_name = pbl height units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ud_mf] standard_name = instantaneous_atmosphere_updraft_convective_mass_flux long_name = (updraft mass flux) * delt units = kg m-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = ( control_for_deep_convection_scheme .ge. 0 .or. control_for_shallow_convection_scheme .ge. 0 ) @@ -7912,28 +7943,28 @@ standard_name = ice_nucleation_number_from_climatology long_name = ice nucleation number in MG MP units = kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [ccn_nm] standard_name = tendency_of_activated_cloud_condensation_nuclei_from_climatology long_name = tendency of ccn activated number units = kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [aer_nm] standard_name = mass_mixing_ratio_of_aerosol_from_gocart_or_merra2 long_name = mass mixing ratio of aerosol from gocart or merra2 units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_aerosol_tracers_MG) + dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_aerosol_tracers_MG) type = real kind = kind_phys [aod_gf] standard_name = aerosol_optical_depth_for_grell_freitas_deep_convection long_name = aerosol optical depth used in Grell-Freitas Convective Parameterization units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection) @@ -7941,47 +7972,47 @@ standard_name = map_of_block_column_number_to_global_i_index long_name = map of local index ix to global index i for this block units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [jmap] standard_name = map_of_block_column_number_to_global_j_index long_name = map of local index ix to global index j for this block units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [rann] standard_name = random_number long_name = random number array (0-1) units = none - dimensions = (horizontal_loop_extent,number_of_random_numbers) + dimensions = (horizontal_dimension,number_of_random_numbers) type = real kind = kind_phys [acv] standard_name = cumulative_lwe_thickness_of_convective_precipitation_amount_between_sw_radiation_calls long_name = accumulated convective rainfall amount for cnvc90 only units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [acvb] standard_name = cumulative_min_vertical_index_at_cloud_base_between_sw_radiation_calls long_name = smallest cloud base vertical index encountered thus far units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [acvt] standard_name = cumulative_max_vertical_index_at_cloud_base_between_sw_radiation_calls long_name = largest cloud top vertical index encountered thus far units = index - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dtdtnp] standard_name = tendency_of_air_temperature_to_withold_from_sppt long_name = temp. change from physics that should not be perturbed by sppt units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_stochastic_physics_perturbations .or. flag_for_global_cellular_automata) @@ -7989,7 +8020,7 @@ standard_name = tendency_of_lwe_thickness_of_rain_amount_on_dynamics_timestep_for_coupling long_name = change in rain_cpl (coupling_type) units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling) @@ -7997,7 +8028,7 @@ standard_name = tendency_of_lwe_thickness_of_snowfall_amount_on_dynamics_timestep_for_coupling long_name = change in show_cpl (coupling_type) units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_surface_flux_coupling .or. flag_for_chemistry_coupling .or. flag_for_land_coupling) @@ -8005,7 +8036,7 @@ standard_name = atmosphere_updraft_convective_mass_flux_at_cloud_base_by_cloud_type long_name = cloud base mass flux for CS convection units = kg m-2 s-1 - dimensions = (horizontal_loop_extent,number_of_cloud_types_CS) + dimensions = (horizontal_dimension,number_of_cloud_types_CS) type = real kind = kind_phys active = (number_of_cloud_types_CS > 0 .and. flag_for_Chikira_Sugiyama_deep_convection) @@ -8013,7 +8044,7 @@ standard_name = surface_air_pressure_two_timesteps_back long_name = surface air pressure two timesteps back units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (index_of_surface_air_pressure_two_timesteps_back_in_xyz_dimensioned_tracer_array > 0) @@ -8021,7 +8052,7 @@ standard_name = surface_air_pressure_on_previous_timestep long_name = surface air pressure at previous timestep units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (index_of_surface_air_pressure_on_previous_timestep_in_xyz_dimensioned_restart_array > 0) @@ -8029,7 +8060,7 @@ standard_name = enhancement_to_wind_speed_at_surface_adjacent_layer_due_to_convection long_name = surface wind enhancement due to convection units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (index_of_enhancement_to_wind_speed_at_surface_adjacent_layer_due_to_convection_in_xy_dimensioned_restart_array > 0) @@ -8037,7 +8068,7 @@ standard_name = air_temperature_two_timesteps_back long_name = air temperature two timesteps back units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_air_temperature_two_timesteps_back_in_xyz_dimensioned_restart_array > 0) @@ -8045,7 +8076,7 @@ standard_name = specific_humidity_two_timesteps_back long_name = water vapor specific humidity two timesteps back units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_specific_humidity_two_timesteps_back_in_xyz_dimensioned_restart_array > 0) @@ -8053,7 +8084,7 @@ standard_name = air_temperature_on_previous_timestep_in_xyz_dimensioned_restart_array long_name = air temperature at previous timestep units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_air_temperature_on_previous_timestep_in_xyz_dimensioned_restart_array > 0) @@ -8061,7 +8092,7 @@ standard_name = specific_humidity_on_previous_timestep_in_xyz_dimensioned_restart_array long_name = water vapor specific humidity at previous timestep units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_specific_humidity_on_previous_timestep_in_xyz_dimensioned_restart_array > 0) @@ -8069,7 +8100,7 @@ standard_name = convective_cloud_condensate_mixing_ratio long_name = convective cloud water mixing ratio in the phy_f3d array units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_convective_cloud_condensate_mixing_ratio_in_xyz_dimensioned_restart_array > 0) @@ -8077,7 +8108,7 @@ standard_name = convective_cloud_area_fraction long_name = convective cloud cover in the phy_f3d array units = frac - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_convective_cloud_area_fraction_in_xyz_dimensioned_restart_array > 0) @@ -8085,7 +8116,7 @@ standard_name = upward_virtual_potential_temperature_flux long_name = upward kinematic buoyancy flux from the SHOC scheme units = K m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_upward_virtual_potential_temperature_flux_in_xyz_dimensioned_restart_array > 0) @@ -8093,7 +8124,7 @@ standard_name = atmosphere_heat_diffusivity_from_shoc long_name = diffusivity for heat from the SHOC scheme units = m2 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_atmosphere_heat_diffusivity_in_xyz_dimensioned_restart_array > 0) @@ -8101,7 +8132,7 @@ standard_name = subgrid_scale_cloud_fraction_from_shoc long_name = subgrid-scale cloud fraction from the SHOC scheme units = frac - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_subgrid_cloud_area_fracation_in_atmosphere_layer_in_xyz_dimensioned_restart_array > 0) @@ -8109,7 +8140,7 @@ standard_name = cloud_fraction_for_MG long_name = cloud fraction used by Morrison-Gettelman MP units = frac - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_cloud_area_fraction_in_atmosphere_layer_in_xyz_dimensioned_restart_array > 0) @@ -8117,7 +8148,7 @@ standard_name = effective_radius_of_stratiform_cloud_liquid_water_particle long_name = eff. radius of cloud liquid water particle in micrometer units = um - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_cloud_liquid_water_effective_radius_in_xyz_dimensioned_restart_array > 0) @@ -8125,7 +8156,7 @@ standard_name = effective_radius_of_stratiform_cloud_ice_particle long_name = eff. radius of cloud ice water particle in micrometer units = um - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_cloud_ice_effective_radius_in_xyz_dimensioned_restart_array > 0) @@ -8133,7 +8164,7 @@ standard_name = effective_radius_of_stratiform_cloud_rain_particle long_name = effective radius of cloud rain particle in micrometers units = um - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_rain_effective_radius_in_xyz_dimensioned_restart_array > 0) @@ -8141,7 +8172,7 @@ standard_name = effective_radius_of_stratiform_cloud_snow_particle long_name = effective radius of cloud snow particle in micrometers units = um - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_snow_effective_radius_in_xyz_dimensioned_restart_array > 0) @@ -8149,7 +8180,7 @@ standard_name = effective_radius_of_stratiform_cloud_graupel_particle long_name = eff. radius of cloud graupel particle in micrometer units = um - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (index_of_graupel_effective_radius_in_xyz_dimensioned_restart_array > 0) @@ -8157,7 +8188,7 @@ standard_name = tendency_of_air_temperature_due_to_nonphysics long_name = temperature tendency due to dynamics only units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection .or. control_for_deep_convection_scheme == identifier_for_new_tiedtke_deep_convection) @@ -8165,7 +8196,7 @@ standard_name = tendendy_of_specific_humidity_due_to_nonphysics long_name = moisture tendency due to dynamics only units = kg kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection .or. control_for_deep_convection_scheme == identifier_for_new_tiedtke_deep_convection) @@ -8173,7 +8204,7 @@ standard_name = air_temperature_on_previous_timestep long_name = temperature from previous time step units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection .or. control_for_deep_convection_scheme == identifier_for_new_tiedtke_deep_convection) @@ -8181,7 +8212,7 @@ standard_name = specific_humidity_on_previous_timestep long_name = moisture from previous time step units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection .or. control_for_deep_convection_scheme == identifier_for_new_tiedtke_deep_convection .or. control_for_deep_convection_scheme == identifer_for_scale_aware_mass_flux_deep_convection .or. control_for_shallow_convection_scheme == identifier_for_scale_aware_mass_flux_shallow_convection) @@ -8189,21 +8220,21 @@ standard_name = counter_for_grell_freitas_convection long_name = convective activity memory units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection) [cactiv_m] standard_name = counter_for_grell_freitas_mid_level_convection long_name = mid-level convective activity memory units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (control_for_deep_convection_scheme == identifier_for_grell_freitas_deep_convection .or. control_for_deep_convection_scheme == identifier_for_c3_deep_convection) [CLDFRA_BL] standard_name = subgrid_scale_cloud_area_fraction_in_atmosphere_layer long_name = subgrid cloud fraction from PBL scheme units = frac - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8211,7 +8242,7 @@ standard_name = subgrid_scale_cloud_liquid_water_mixing_ratio long_name = subgrid cloud water mixing ratio from PBL scheme units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8219,7 +8250,7 @@ standard_name = subgrid_scale_cloud_ice_mixing_ratio long_name = subgrid cloud ice mixing ratio from PBL scheme units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8227,7 +8258,7 @@ standard_name = turbulent_mixing_length long_name = mixing length in meters units = m - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8235,7 +8266,7 @@ standard_name = stability_function_for_heat long_name = stability function for heat units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8243,7 +8274,7 @@ standard_name = stability_function_for_momentum long_name = stability function for momentum units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8251,7 +8282,7 @@ standard_name = nonadvected_turbulent_kinetic_energy_multiplied_by_2 long_name = 2 x tke at mass points units = m2 s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8259,7 +8290,7 @@ standard_name = variance_of_air_temperature long_name = temperature fluctuation squared units = K2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8267,7 +8298,7 @@ standard_name = variance_of_specific_humidity long_name = water vapor fluctuation squared units = kg2 kg-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8275,7 +8306,7 @@ standard_name = covariance_of_air_temperature_and_specific_humidity long_name = covariance of temperature and moisture units = K kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -8283,7 +8314,7 @@ standard_name = surface_specific_humidity_for_MYJ_schemes long_name = surface air saturation specific humidity for MYJ schemes units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8291,7 +8322,7 @@ standard_name = air_potential_temperature_at_top_of_viscous_sublayer long_name = potential temperature at viscous sublayer top over water units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8299,7 +8330,7 @@ standard_name = specific_humidity_at_top_of_viscous_sublayer long_name = specific humidity at_viscous sublayer top over water units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8307,7 +8338,7 @@ standard_name = x_wind_at_top_of_viscous_sublayer long_name = u wind component at viscous sublayer top over water units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8315,7 +8346,7 @@ standard_name = y_wind_at_top_of_viscous_sublayer long_name = v wind component at viscous sublayer top over water units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8323,7 +8354,7 @@ standard_name = heat_exchange_coefficient_for_MYJ_schemes long_name = surface heat exchange_coefficient for MYJ schemes units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8331,7 +8362,7 @@ standard_name = momentum_exchange_coefficient_for_MYJ_schemes long_name = surface momentum exchange_coefficient for MYJ schemes units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8339,7 +8370,7 @@ standard_name = control_for_surface_layer_evaporation long_name = surface layer evaporation switch units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8347,7 +8378,7 @@ standard_name = surface_upward_specific_humidity_flux_for_mellor_yamada_janjic_surface_layer_scheme long_name = kinematic surface latent heat flux units = m s-1 kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8355,7 +8386,7 @@ standard_name = weight_for_momentum_at_top_of_viscous_sublayer long_name = weight for momentum at viscous layer top units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8363,7 +8394,7 @@ standard_name = weight_for_potental_temperature_at_top_of_viscous_sublayer long_name = weight for potental temperature at viscous layer top units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8371,7 +8402,7 @@ standard_name = weight_for_specific_humidity_at_top_of_viscous_sublayer long_name = weight for Specfic Humidity at viscous layer top units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_janjic_surface_layer_scheme .or. flag_for_mellor_yamada_janjic_pbl_scheme) @@ -8379,7 +8410,7 @@ standard_name = radar_derived_microphysics_temperature_tendency long_name = radar-derived microphysics temperature tendency units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_radar_derived_temperature_or_convection_suppression_intervals) + dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_radar_derived_temperature_or_convection_suppression_intervals) type = real kind = kind_phys active = (number_of_radar_derived_temperature_or_convection_suppression_intervals>0) @@ -8387,7 +8418,7 @@ standard_name = radar_derived_convection_suppression long_name = radar-derived convection suppression units = unitless - dimensions = (horizontal_loop_extent,number_of_radar_derived_temperature_or_convection_suppression_intervals) + dimensions = (horizontal_dimension,number_of_radar_derived_temperature_or_convection_suppression_intervals) type = real kind = kind_phys active = (number_of_radar_derived_temperature_or_convection_suppression_intervals>0 .and. flag_for_radar_derived_convection_suppression) @@ -8405,21 +8436,21 @@ standard_name = convective_cloud_area_fraction_between_sw_radiation_calls_from_cnvc90 long_name = fraction of convective cloud units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [cvt] standard_name = pressure_at_convective_cloud_top_between_sw_radiation_calls_from_cnvc90 long_name = convective cloud top pressure units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [cvb] standard_name = pressure_at_convective_cloud_base_between_sw_radiation_calls_from_cnvc90 long_name = convective cloud bottom pressure units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys @@ -8436,89 +8467,89 @@ standard_name = surface_sw_fluxes_assuming_total_and_clear_sky_on_radiation_timestep long_name = sw radiation fluxes at sfc units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = sfcfsw_type [sfcflw] standard_name = surface_lw_fluxes_assuming_total_and_clear_sky_on_radiation_timestep long_name = lw radiation fluxes at sfc units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = sfcflw_type [htrsw] standard_name = tendency_of_air_temperature_due_to_shortwave_heating_on_radiation_timestep long_name = total sky sw heating rate units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [htrlw] standard_name = tendency_of_air_temperature_due_to_longwave_heating_on_radiation_timestep long_name = total sky lw heating rate units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [sfalb] standard_name = surface_albedo_for_diffused_shortwave_on_radiation_timestep long_name = mean surface diffused sw albedo units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [coszen] standard_name = cosine_of_solar_zenith_angle_for_daytime_points_on_radiation_timestep long_name = mean cos of zenith angle over rad call period units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [coszdg] standard_name = cosine_of_solar_zenith_angle_on_radiation_timestep long_name = daytime mean cosz over rad call period units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tsflw] standard_name = air_temperature_at_surface_adjacent_layer_on_radiation_timestep long_name = surface air temp during lw calculation units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [semis] standard_name = surface_longwave_emissivity long_name = surface lw emissivity in fraction units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ext550] standard_name = aerosol_optical_depth_at_550nm long_name = 3d optical extinction for total aerosol species units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [swhc] standard_name = tendency_of_air_temperature_due_to_shortwave_heating_assuming_clear_sky_on_radiation_timestep long_name = clear sky sw heating rates units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [lwhc] standard_name = tendency_of_air_temperature_due_to_longwave_heating_assuming_clear_sky_on_radiation_timestep long_name = clear sky lw heating rates units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [lwhd] standard_name = tendency_of_air_temperature_due_to_integrated_dynamics_through_earths_atmosphere long_name = idea sky lw heating rates units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension,6) + dimensions = (horizontal_dimension,vertical_layer_dimension,6) type = real kind = kind_phys @@ -8535,54 +8566,54 @@ standard_name = cumulative_radiation_diagnostic long_name = time-accumulated 2D radiation-related diagnostic fields units = mixed - dimensions = (horizontal_loop_extent,number_of_diagnostics_variables_for_radiation) + dimensions = (horizontal_dimension,number_of_diagnostics_variables_for_radiation) type = real kind = kind_phys [topfsw] standard_name = sw_fluxes_top_atmosphere long_name = sw radiation fluxes at toa units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = topfsw_type [topflw] standard_name = lw_fluxes_top_atmosphere long_name = lw radiation fluxes at top units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = topflw_type [srunoff] standard_name = surface_runoff long_name = surface water runoff (from lsm) units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [evbsa] standard_name = cumulative_soil_upward_latent_heat_flux_multiplied_by_timestep long_name = cumulative soil upward latent heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [evcwa] standard_name = cumulative_canopy_upward_latent_heat_flu_multiplied_by_timestep long_name = cumulative canopy upward latent heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [snohfa] standard_name = cumulative_snow_freezing_rain_upward_latent_heat_flux_multiplied_by_timestep long_name = cumulative latent heat flux due to snow and frz rain multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [paha] standard_name = cumulative_precipitation_advected_heat_flux_multiplied_by_timestep long_name = cumulative precipitation advected heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -8590,224 +8621,224 @@ standard_name = cumulative_transpiration_flux_multiplied_by_timestep long_name = cumulative total plant transpiration rate multiplied by timestep units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sbsnoa] standard_name = cumulative_snow_deposition_sublimation_upward_latent_heat_flux_multiplied_by_timestep long_name = cumulative latent heat flux from snow depo/subl multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [snowca] standard_name = cumulative_surface_snow_area_fraction_multiplied_by_timestep long_name = cumulative surface snow area fraction multiplied by timestep units = s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sbsno] standard_name = snow_deposition_sublimation_upward_latent_heat_flux long_name = latent heat flux from snow depo/subl units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [evbs] standard_name = soil_upward_latent_heat_flux long_name = soil upward latent heat flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [evcw] standard_name = canopy_upward_latent_heat_flux long_name = canopy upward latent heat flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [trans] standard_name = transpiration_flux long_name = total plant transpiration rate units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [soilm] standard_name = soil_moisture_content long_name = soil moisture units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [snowmt_land] standard_name = surface_snow_melt_over_land long_name = snow melt during timestep over land units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [snowmt_ice] standard_name = surface_snow_melt_over_ice long_name = snow melt during timestep over ice units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tmpmin] standard_name = minimum_temperature_at_2m long_name = min temperature at 2m height units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tmpmax] standard_name = maximum_temperature_at_2m long_name = max temperature at 2m height units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dusfc] standard_name = cumulative_surface_x_momentum_flux_for_diag_multiplied_by_timestep long_name = cumulative sfc x momentum flux multiplied by timestep units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dvsfc] standard_name = cumulative_surface_y_momentum_flux_for_diag_multiplied_by_timestep long_name = cumulative sfc y momentum flux multiplied by timestep units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dtsfc] standard_name = cumulative_surface_upward_sensible_heat_flux_for_diag_multiplied_by_timestep long_name = cumulative sfc sensible heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dqsfc] standard_name = cumulative_surface_upward_latent_heat_flux_for_diag_multiplied_by_timestep long_name = cumulative sfc latent heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [totprcp] standard_name = accumulated_lwe_thickness_of_precipitation_amount long_name = accumulated total precipitation units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [totice] standard_name = accumulated_lwe_thickness_of_ice_amount long_name = accumulated ice precipitation units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [totsnw] standard_name = accumulated_lwe_thickness_of_snow_amount long_name = accumulated snow precipitation units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [totgrp] standard_name = accumulated_lwe_thickness_of_graupel_amount long_name = accumulated graupel precipitation units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [totprcpb] standard_name = accumulated_lwe_thickness_of_precipitation_amount_in_bucket long_name = accumulated total precipitation in bucket units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [toticeb] standard_name = accumulated_lwe_thickness_of_ice_amount_in_bucket long_name = accumulated ice precipitation in bucket units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [totsnwb] standard_name = accumulated_lwe_thickness_of_snow_amount_in_bucket long_name = accumulated snow precipitation in bucket units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [totgrpb] standard_name = accumulated_lwe_thickness_of_graupel_amount_in_bucket long_name = accumulated graupel precipitation in bucket units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [frzr] standard_name = cumulative_lwe_thickness_of_surface_freezing_rain_amount long_name = accumulated surface freezing rain units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [frzrb] standard_name = cumulative_lwe_thickness_of_surface_freezing_rain_amount_in_bucket long_name = accumulated surface freezing rain in bucket units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [frozr] standard_name = cumulative_lwe_thickness_of_surface_graupel_amount long_name = accumulated surface graupel units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [frozrb] standard_name = cumulative_lwe_thickness_of_surface_graupel_amount_in_bucket long_name = accumulated surface graupel in bucket units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tsnowp] standard_name = cumulative_lwe_thickness_of_surface_snow_amount long_name = accumulated surface snow units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tsnowpb] standard_name = cumulative_lwe_thickness_of_surface_snow_amount_in_bucket long_name = accumulated surface snow in bucket units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [rhonewsn1] standard_name = surface_frozen_precipitation_density long_name = density of precipitation ice units = kg m-3 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [train] standard_name = accumulated_change_of_air_temperature_due_to_FA_scheme long_name = accumulated change of air temperature due to FA MP scheme units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (control_for_microphysics_scheme == identifier_for_fer_hires_microphysics_scheme) @@ -8815,70 +8846,70 @@ standard_name = cumulative_surface_ground_heat_flux_multiplied_by_timestep long_name = cumulative groud conductive heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dlwsfc] standard_name = cumulative_surface_downwelling_longwave_flux_multiplied_by_timestep long_name = cumulative surface downwelling LW flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ulwsfc] standard_name = cumulative_surface_upwelling_longwave_flux_multiplied_by_timestep long_name = cumulative surface upwelling LW flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [suntim] standard_name = duration_of_sunshine long_name = sunshine duration time units = s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [runoff] standard_name = total_runoff long_name = total water runoff units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ep] standard_name = cumulative_surface_upward_potential_latent_heat_flux_multiplied_by_timestep long_name = cumulative surface upward potential latent heat flux multiplied by timestep units = W m-2 s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tecan] standard_name = total_evaporation_of_intercepted_water long_name = total evaporation of intercepted water units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tetran] standard_name = total_transpiration_rate long_name = total transpiration rate units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tedir] standard_name = total_soil_surface_evaporation_rate long_name = total soil surface evaporation rate units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [twa] standard_name = total_water_storage_in_aquifer long_name = total water storage in aquifer units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -8886,294 +8917,294 @@ standard_name = cumulative_cloud_work_function long_name = cumulative cloud work function (valid only with sas) units = m2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dugwd] standard_name = time_integral_of_x_stress_due_to_gravity_wave_drag long_name = vertically integrated u change by OGWD units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dvgwd] standard_name = time_integral_of_y_stress_due_to_gravity_wave_drag long_name = vertically integrated v change by OGWD units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [psmean] standard_name = cumulative_surface_pressure_multiplied_by_timestep long_name = cumulative surface pressure multiplied by timestep units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [cnvprcp] standard_name = cumulative_lwe_thickness_of_convective_precipitation_amount long_name = cumulative convective precipitation units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [cnvprcpb] standard_name = cumulative_lwe_thickness_of_convective_precipitation_amount_in_bucket long_name = cumulative convective precipitation in bucket units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [spfhmin] standard_name = minimum_specific_humidity_at_2m long_name = minimum specific humidity at 2m height units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [spfhmax] standard_name = maximum_specific_humidity_at_2m long_name = maximum specific humidity at 2m height units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [u10mmax] standard_name = maximum_x_wind_at_10m long_name = maximum x wind at 10 m units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [v10mmax] standard_name = maximum_y_wind_at_10m long_name = maximum y wind at 10 m units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [wind10mmax] standard_name = maximum_wind_at_10m long_name = maximum wind speed at 10 m units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [u10max] standard_name = maximum_u_wind_at_10m_over_maximum_hourly_time_interval long_name = maximum u wind at 10m over maximum hourly time interval units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [v10max] standard_name = maximum_v_wind_at_10m_over_maximum_hourly_time_interval long_name = maximum v wind at 10m over maximum hourly time interval units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [spd10max] standard_name = maximum_wind_at_10m_over_maximum_hourly_time_interval long_name = maximum wind at 10m over maximum hourly time interval units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [rain] standard_name = lwe_thickness_of_precipitation_amount_on_dynamics_timestep long_name = total rain at this time step units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [rainc] standard_name = lwe_thickness_of_convective_precipitation_amount_on_dynamics_timestep long_name = convective rain at this time step units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ice] standard_name = lwe_thickness_of_ice_amount_on_dynamics_timestep long_name = ice fall at this time step units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [snow] standard_name = lwe_thickness_of_snow_amount_on_dynamics_timestep long_name = snow fall at this time step units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [graupel] standard_name = lwe_thickness_of_graupel_amount_on_dynamics_timestep long_name = graupel fall at this time step units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [u10m] standard_name = x_wind_at_10m long_name = 10 meter u wind speed units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [v10m] standard_name = y_wind_at_10m long_name = 10 meter v wind speed units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dpt2m] standard_name = dewpoint_temperature_at_2m long_name = 2 meter dewpoint temperature units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zlvl] standard_name = height_above_ground_at_lowest_model_layer long_name = layer 1 height above ground (not MSL) units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [psurf] standard_name = surface_air_pressure_diag long_name = surface air pressure diagnostic units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [pwat] standard_name = column_precipitable_water long_name = precipitable water units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [t1] standard_name = air_temperature_at_lowest_model_layer_for_diag long_name = layer 1 temperature for diag units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [q1] standard_name = water_vapor_specific_humidity_at_lowest_model_layer_for_diag long_name = layer 1 specific humidity for diag units = kg kg-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [u1] standard_name = x_wind_at_lowest_model_layer_for_diag long_name = layer 1 x wind for diag units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [v1] standard_name = y_wind_at_lowest_model_layer_for_diag long_name = layer 1 y wind for diag units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [chh] standard_name = surface_drag_mass_flux_for_heat_and_moisture_in_air long_name = thermal exchange coefficient units = kg m-2 s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [cmm] standard_name = surface_drag_wind_speed_for_momentum_in_air long_name = momentum exchange coefficient units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dlwsfci] standard_name = surface_downwelling_longwave_flux long_name = surface downwelling longwave flux at current time units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ulwsfci] standard_name = surface_upwelling_longwave_flux long_name = surface upwelling longwave flux at current time units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dswsfci] standard_name = surface_downwelling_shortwave_flux long_name = surface downwelling shortwave flux at current time units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [nswsfci] standard_name = surface_net_downwelling_shortwave_flux long_name = surface net downwelling shortwave flux at current time units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [uswsfci] standard_name = surface_upwelling_shortwave_flux long_name = surface upwelling shortwave flux at current time units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dusfci] standard_name = instantaneous_surface_x_momentum_flux_for_diag long_name = instantaneous sfc x momentum flux multiplied by timestep units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dvsfci] standard_name = instantaneous_surface_y_momentum_flux_for_diag long_name = instantaneous sfc y momentum flux multiplied by timestep units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dtsfci] standard_name = instantaneous_surface_upward_sensible_heat_flux_for_diag long_name = instantaneous sfc sensible heat flux multiplied by timestep units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dqsfci] standard_name = instantaneous_surface_upward_latent_heat_flux_for_diag long_name = instantaneous sfc latent heat flux multiplied by timestep units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [gfluxi] standard_name = instantaneous_surface_ground_heat_flux long_name = instantaneous sfc ground heat flux units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [pahi] standard_name = instantaneous_total_precipitation_advected_heat long_name = instantaneous precipitation advected heat - total units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (control_for_land_surface_scheme == identifier_for_noahmp_land_surface_scheme) @@ -9181,35 +9212,35 @@ standard_name = instantaneous_surface_potential_evaporation long_name = instantaneous sfc potential evaporation units = W m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [smcwlt2] standard_name = volume_fraction_of_condensed_water_in_soil_at_wilting_point long_name = wilting point (volumetric) units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [smcref2] standard_name = threshold_volume_fraction_of_condensed_water_in_soil long_name = soil moisture threshold (volumetric) units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [sr] standard_name = ratio_of_snowfall_to_rainfall long_name = snow ratio: ratio of snow to total precipitation (explicit only) units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [wet1] standard_name = normalized_soil_wetness long_name = normalized soil wetness units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (.not. control_for_land_surface_scheme == identifier_for_ruc_land_surface_scheme) @@ -9217,42 +9248,42 @@ standard_name = dominant_rain_type long_name = dominant rain type units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tdomzr] standard_name = dominant_freezing_rain_type long_name = dominant freezing rain type units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tdomip] standard_name = dominant_sleet_type long_name = dominant sleet type units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tdoms] standard_name = dominant_snow_type long_name = dominant snow type units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zmtnblck] standard_name = level_of_dividing_streamline long_name = level of the dividing streamline units = none - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dtend] standard_name = cumulative_change_of_state_variables long_name = diagnostic tendencies for state variables units = mixed - dimensions = (horizontal_loop_extent,vertical_layer_dimension,cumulative_change_of_state_variables_outer_index_max) + dimensions = (horizontal_dimension,vertical_layer_dimension,cumulative_change_of_state_variables_outer_index_max) type = real kind = kind_phys active = (flag_for_diagnostics_3D) @@ -9260,56 +9291,56 @@ standard_name = maximum_reflectivity_at_1km_agl_over_maximum_hourly_time_interval long_name = maximum reflectivity at 1km agl over maximum hourly time interval units = dBZ - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [refdmax263k] standard_name = maximum_reflectivity_at_minus10c_over_maximum_hourly_time_interval long_name = maximum reflectivity at minus10c over maximum hourly time interval units = dBZ - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [t02max] standard_name = maximum_temperature_at_2m_over_maximum_hourly_time_interval long_name = maximum temperature at 2m over maximum hourly time interval units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [t02min] standard_name = minimum_temperature_at_2m_over_maximum_hourly_time_interval long_name = minumum temperature at 2m over maximum hourly time interval units = K - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [rh02max] standard_name = maximum_relative_humidity_at_2m_over_maximum_hourly_time_interval long_name = maximum relative humidity at 2m over maximum hourly time interval units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [rh02min] standard_name = minimum_relative_humidity_at_2m_over_maximum_hourly_time_interval long_name = minumum relative humidity at 2m over maximum hourly time interval units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [pratemax] standard_name = maximum_precipitation_rate_over_maximum_hourly_time_interval long_name = maximum precipitation rate over maximum hourly time interval units = mm h-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [upd_mf] standard_name = cumulative_atmosphere_updraft_convective_mass_flux long_name = cumulative updraft mass flux units = kg m-1 s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_tracer_diagnostics_3D) @@ -9317,7 +9348,7 @@ standard_name = cumulative_atmosphere_downdraft_convective_mass_flux long_name = cumulative downdraft mass flux units = kg m-1 s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_tracer_diagnostics_3D) @@ -9325,7 +9356,7 @@ standard_name = cumulative_atmosphere_detrainment_convective_mass_flux long_name = cumulative detrainment mass flux units = kg m-1 s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_tracer_diagnostics_3D) @@ -9333,7 +9364,7 @@ standard_name = ozone_tendency_due_to_production_and_loss_rate long_name = ozone tendency due to production and loss rate units = kg kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_tracer_diagnostics_3D .and. flag_for_nrl_2015_ozone_scheme) @@ -9341,7 +9372,7 @@ standard_name = ozone_tendency_due_to_ozone_mixing_ratio long_name = ozone tendency due to ozone mixing ratio units = kg kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_tracer_diagnostics_3D .and. flag_for_nrl_2015_ozone_scheme) @@ -9349,7 +9380,7 @@ standard_name = ozone_tendency_due_to_temperature long_name = ozone tendency due to temperature units = kg kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_tracer_diagnostics_3D .and. flag_for_nrl_2015_ozone_scheme) @@ -9357,7 +9388,7 @@ standard_name = ozone_tendency_due_to_overhead_ozone_column long_name = ozone tendency due to overhead ozone column units = kg kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_tracer_diagnostics_3D .and. flag_for_nrl_2015_ozone_scheme) @@ -9365,84 +9396,84 @@ standard_name = radar_reflectivity_10cm long_name = instantaneous refl_10cm units = dBZ - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [max_hail_diam_sfc] standard_name = max_hail_diameter_sfc long_name = instantaneous maximum hail diameter at lowest model level units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [dkt] standard_name = atmosphere_heat_diffusivity long_name = atmospheric heat diffusivity units = m2 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [dku] standard_name = atmosphere_momentum_diffusivity long_name = atmospheric momentum diffusivity units = m2 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [cldfra] standard_name = instantaneous_3d_cloud_fraction long_name = instantaneous 3D cloud fraction for all MPs units = frac - dimensions = (horizontal_loop_extent,adjusted_vertical_layer_dimension_for_radiation) + dimensions = (horizontal_dimension,adjusted_vertical_layer_dimension_for_radiation) type = real kind = kind_phys [cldfra2d] standard_name = max_in_column_cloud_fraction long_name = instantaneous 2D (max-in-column) cloud fraction units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [lwp_ex] standard_name = liq_water_path_from_microphysics long_name = total liquid water path from explicit microphysics units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [iwp_ex] standard_name = ice_water_path_from_microphysics long_name = total ice water path from explicit microphysics units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [lwp_fc] standard_name = liq_water_path_from_cloud_fraction long_name = total liquid water path from cloud fraction scheme units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [iwp_fc] standard_name = ice_water_path_from_cloud_fraction long_name = total ice water path from cloud fraction scheme units = kg m-2 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [total_albedo] standard_name = total_sky_albedo long_name = total sky albedo at toa units = frac - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [edmf_a] standard_name = emdf_updraft_area long_name = updraft area from mass flux scheme units = frac - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9450,7 +9481,7 @@ standard_name = emdf_updraft_vertical_velocity long_name = updraft vertical velocity from mass flux scheme units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9458,7 +9489,7 @@ standard_name = emdf_updraft_total_water long_name = updraft total water from mass flux scheme units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9466,7 +9497,7 @@ standard_name = emdf_updraft_theta_l long_name = updraft theta-l from mass flux scheme units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9474,7 +9505,7 @@ standard_name = emdf_updraft_entrainment_rate long_name = updraft entranment rate from mass flux scheme units = s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9482,7 +9513,7 @@ standard_name = emdf_updraft_cloud_water long_name = updraft cloud water from mass flux scheme units = kg kg-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9490,7 +9521,7 @@ standard_name = theta_subsidence_tendency long_name = updraft theta subsidence tendency units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9498,7 +9529,7 @@ standard_name = water_vapor_subsidence_tendency long_name = updraft water vapor subsidence tendency units = kg kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9506,7 +9537,7 @@ standard_name = theta_detrainment_tendency long_name = updraft theta detrainment tendency units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9514,7 +9545,7 @@ standard_name = water_vapor_detrainment_tendency long_name = updraft water vapor detrainment tendency units = kg kg-1 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. (control_for_additional_diagnostics_in_mellor_yamada_nakanishi_niino_pbl_scheme .ne. 0)) @@ -9522,7 +9553,7 @@ standard_name = total_time_rate_of_change_of_tke long_name = total tke tendency units = m2 s-3 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1) @@ -9530,7 +9561,7 @@ standard_name = tke_tendency_due_to_vertical_transport long_name = tke tendency due to vertical transport and diffusion units = m2 s-3 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1) @@ -9538,7 +9569,7 @@ standard_name = tke_tendency_due_to_shear long_name = tke tendency due to shear units = m2 s-3 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1) @@ -9546,7 +9577,7 @@ standard_name = tke_tendency_due_to_buoyancy long_name = tke tendency due to buoyancy production or consumption units = m2 s-3 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1) @@ -9554,7 +9585,7 @@ standard_name = tke_tendency_due_to_dissipation long_name = tke tendency due to the dissipation of tke units = m2 s-3 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme .and. control_for_tke_budget_output == 1) @@ -9562,7 +9593,7 @@ standard_name = maximum_width_of_plumes long_name = maximum width of plumes per grid column units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -9570,7 +9601,7 @@ standard_name = maximum_mass_flux long_name = maximum mass flux within a column units = m s-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -9578,7 +9609,7 @@ standard_name = height_of_tallest_plume_in_a_column long_name = height of tallest plume in a column units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -9586,20 +9617,20 @@ standard_name = k_level_of_highest_reaching_plume long_name = k-level of highest reaching plume units = count - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer [ktop_plume] standard_name = k_level_of_highest_plume long_name = k-level of highest plume units = count - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = integer active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) [exch_h] standard_name = atmosphere_heat_diffusivity_for_mynnedmf long_name = diffusivity for heat for MYNN PBL (defined for all mass levels) units = m2 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -9607,7 +9638,7 @@ standard_name = atmosphere_momentum_diffusivity_for_mynnedmf long_name = diffusivity for momentum for MYNN PBL (defined for all mass levels) units = m2 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_mellor_yamada_nakanishi_niino_pbl_scheme) @@ -9615,56 +9646,56 @@ standard_name = time_integral_of_height_of_mountain_blocking long_name = time integral of height of mountain blocking drag units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zlwb] standard_name = time_integral_of_height_of_low_level_wave_breaking long_name = time integral of height of drag due to low level wave breaking units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [zogw] standard_name = time_integral_of_height_of_launch_level_of_orographic_gravity_wave long_name = time integral of height of launch level of orographic gravity wave units = m - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tau_tofd] standard_name = time_integral_of_momentum_flux_due_to_turbulent_orographic_form_drag long_name = time integral of momentum flux due to TOFD units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tau_mtb] standard_name = time_integral_of_momentum_flux_due_to_mountain_blocking_drag long_name = time integral of momentum flux due to mountain blocking drag units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tau_ogw] standard_name = time_integral_of_momentum_flux_due_to_orographic_gravity_wave_drag long_name = time integral of momentum flux due to orographic gravity wave drag units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [tau_ngw] standard_name = time_integral_of_momentum_flux_due_to_nonstationary_gravity_wave long_name = time integral of momentum flux due to nonstationary gravity waves units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [du3dt_mtb] standard_name = time_integral_of_change_in_x_wind_due_to_mountain_blocking_drag long_name = time integral of change in x wind due to mountain blocking drag units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9672,7 +9703,7 @@ standard_name = time_integral_of_change_in_x_wind_due_to_orographic_gravity_wave_drag long_name = time integral of change in x wind due to orographic gw drag units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9680,7 +9711,7 @@ standard_name = cumulative_change_in_x_wind_due_to_mesoscale_orographic_gravity_wave_drag long_name = cumulative change in x wind due to mesoscale orographic gravity wave drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9688,7 +9719,7 @@ standard_name = cumulative_change_in_x_wind_due_to_blocking_drag long_name = cumulative change in x wind due to blocking drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9696,7 +9727,7 @@ standard_name = cumulative_change_in_x_wind_due_to_small_scale_gravity_wave_drag long_name = cumulative change in x wind due to small scale gravity wave drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9704,7 +9735,7 @@ standard_name = cumulative_change_in_x_wind_due_to_form_drag long_name = cumulative change in x wind due to form drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9712,7 +9743,7 @@ standard_name = time_integral_of_change_in_x_wind_due_to_turbulent_orographic_form_drag long_name = time integral of change in x wind due to TOFD units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9720,7 +9751,7 @@ standard_name = time_integral_of_change_in_x_wind_due_to_nonstationary_gravity_wave long_name = time integral of change in x wind due to NGW units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9728,7 +9759,7 @@ standard_name = cumulative_change_in_wind_speed_due_to_mesoscale_orographic_gravity_wave_drag long_name = cumulative change in wind speed due to mesoscale orographic gravity wave drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9736,7 +9767,7 @@ standard_name = cumulative_change_in_wind_speed_due_to_blocking_drag long_name = cumulative change in wind speed due to blocking drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9744,7 +9775,7 @@ standard_name = cumulative_change_in_wind_speed_due_to_small_scale_orographic_gravity_wave_drag long_name = cumulative change in wind speed due to small scale orographic gravity wave drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9752,7 +9783,7 @@ standard_name = cumulative_change_in_wind_speed_due_to_turbulent_orographic_form_drag long_name = cumulative change in wind speed due to turbulent orographic form drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9760,7 +9791,7 @@ standard_name = cumulative_change_in_x_wind_due_to_convective_gravity_wave_drag long_name = cumulative change in x wind due to convective gravity wave drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9768,7 +9799,7 @@ standard_name = cumulative_change_in_y_wind_due_to_convective_gravity_wave_drag long_name = cumulative change in y wind due to convective gravity wave drag units = m s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9776,7 +9807,7 @@ standard_name = cumulative_change_in_temperature_due_to_convective_gravity_wave_drag long_name = cumulative change in temperature due to convective gravity wave drag units = K - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -9784,35 +9815,35 @@ standard_name = tendency_of_x_wind_due_to_gravity_wave_drag long_name = zonal wind tendency due to all GWs units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [dvdt_gw] standard_name = tendency_of_y_wind_due_to_gravity_wave_drag long_name = meridional wind tendency due to all GWs units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [dtdt_gw] standard_name = tendency_of_air_temperature_due_to_gravity_wave_drag long_name = air temperature tendency due to all GWs units = K s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [kdis_gw] standard_name = atmosphere_momentum_diffusivity_due_to_gravity_wave_drag long_name = eddy mixing due to all GWs units = m2 s-1 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys [dudt_ogw] standard_name = tendency_of_x_wind_due_to_mesoscale_orographic_gravity_wave_drag long_name = x wind tendency from meso scale ogw units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9820,7 +9851,7 @@ standard_name = tendency_of_y_wind_due_to_mesoscale_orographic_gravity_wave_drag long_name = y wind tendency from meso scale ogw units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9828,7 +9859,7 @@ standard_name = vertically_integrated_x_momentum_flux_due_to_mesoscale_orographic_gravity_wave_drag long_name = integrated x momentum flux from meso scale ogw units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9836,7 +9867,7 @@ standard_name = vertically_integrated_y_momentum_flux_due_to_mesoscale_orographic_gravity_wave_drag long_name = integrated y momentum flux from meso scale ogw units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9844,7 +9875,7 @@ standard_name = tendency_of_x_wind_due_to_blocking_drag long_name = x wind tendency from blocking drag units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9852,7 +9883,7 @@ standard_name = tendency_of_y_wind_due_to_blocking_drag long_name = y wind tendency from blocking drag units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9860,7 +9891,7 @@ standard_name = vertically_integrated_x_momentum_flux_due_to_blocking_drag long_name = integrated x momentum flux from blocking drag units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9868,7 +9899,7 @@ standard_name = vertically_integrated_y_momentum_flux_due_to_blocking_drag long_name = integrated y momentum flux from blocking drag units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9876,7 +9907,7 @@ standard_name = cumulative_vertically_integrated_x_momentum_flux_due_to_mesoscale_orographic_gravity_wave_drag long_name = cumulative integrated x momentum flux from mesoscale orographic gravity wave drag units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9884,7 +9915,7 @@ standard_name = cumulative_vertically_integrated_y_momentum_flux_due_to_mesoscale_orographic_gravity_wave_drag long_name = cumulative integrated y momentum flux from mesoscale orographic gravity wave drag units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9892,7 +9923,7 @@ standard_name = cumulative_vertically_integrated_x_momentum_flux_due_to_blocking_drag long_name = cumulative integrated x momentum flux from blocking drag units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9900,7 +9931,7 @@ standard_name = cumulative_vertically_integrated_y_momentum_flux_due_to_blocking_drag long_name = cumulative integrated y momentum flux from blocking drag units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9908,7 +9939,7 @@ standard_name = cumulative_vertically_integrated_x_momentum_flux_due_to_small_scale_gravity_wave_drag long_name = cumulative integrated x momentum flux from small scale gravity wave drag units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9916,7 +9947,7 @@ standard_name = cumulative_vertically_integrated_y_momentum_flux_due_small_scale_gravity_wave_drag long_name = cumulative integrated y momentum flux from small scale gravity wave drag units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9924,7 +9955,7 @@ standard_name = cumulative_vertically_integrated_x_momentum_flux_due_to_form_drag long_name = cumulative integrated x momentum flux from form drag units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9932,7 +9963,7 @@ standard_name = cumulative_vertically_integrated_y_momentum_flux_due_to_form_drag long_name = cumulative integrated y momentum flux from form drag units = Pa s - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9940,7 +9971,7 @@ standard_name = tendency_of_x_wind_due_to_small_scale_gravity_wave_drag long_name = x wind tendency from small scale gwd units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9948,7 +9979,7 @@ standard_name = tendency_of_y_wind_due_to_small_scale_gravity_wave_drag long_name = y wind tendency from small scale gwd units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9956,7 +9987,7 @@ standard_name = vertically_integrated_x_momentum_flux_due_to_small_scale_gravity_wave_drag long_name = integrated x momentum flux from small scale gwd units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9964,7 +9995,7 @@ standard_name = vertically_integrated_y_momentum_flux_due_to_small_scale_gravity_wave_drag long_name = integrated y momentum flux from small scale gwd units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9972,7 +10003,7 @@ standard_name = tendency_of_x_wind_due_to_form_drag long_name = x wind tendency from form drag units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9980,7 +10011,7 @@ standard_name = tendency_of_y_wind_due_to_form_drag long_name = y wind tendency from form drag units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9988,7 +10019,7 @@ standard_name = vertically_integrated_x_momentum_flux_due_to_form_drag long_name = integrated x momentum flux from form drag units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -9996,7 +10027,7 @@ standard_name = vertically_integrated_y_momentum_flux_due_to_form_drag long_name = integrated y momentum flux from form drag units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys active = (flag_for_ugwp_version_1 .or. flag_for_unified_gravity_wave_physics_diagnostics) @@ -10004,7 +10035,7 @@ standard_name = time_integral_of_change_in_y_wind_due_to_nonstationary_gravity_wave long_name = time integral of change in y wind due to NGW units = m s-2 - dimensions = (horizontal_loop_extent,vertical_layer_dimension) + dimensions = (horizontal_dimension,vertical_layer_dimension) type = real kind = kind_phys active = (flag_for_unified_gravity_wave_physics_diagnostics) @@ -10012,7 +10043,7 @@ standard_name = extended_diagnostics_output_from_thompson_microphysics long_name = set of 3d arrays for extended diagnostics output from thompson microphysics units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_3d_diagnostic_output_arrays_from_thompson_microphysics) + dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_3d_diagnostic_output_arrays_from_thompson_microphysics) type = real kind = kind_phys active = (flag_for_extended_diagnostic_output_from_thompson_microphysics) @@ -10020,7 +10051,7 @@ standard_name = auxiliary_2d_arrays long_name = auxiliary 2d arrays to output (for debugging) units = none - dimensions = (horizontal_loop_extent,number_of_xyz_dimensioned_auxiliary_arrays) + dimensions = (horizontal_dimension,number_of_xy_dimensioned_auxiliary_arrays) type = real kind = kind_phys active = (number_of_xy_dimensioned_auxiliary_arrays > 0) @@ -10028,7 +10059,7 @@ standard_name = auxiliary_3d_arrays long_name = auxiliary 3d arrays to output (for debugging) units = none - dimensions = (horizontal_loop_extent,vertical_layer_dimension,number_of_xyz_dimensioned_auxiliary_arrays) + dimensions = (horizontal_dimension,vertical_layer_dimension,number_of_xyz_dimensioned_auxiliary_arrays) type = real kind = kind_phys active = (number_of_xyz_dimensioned_auxiliary_arrays > 0) @@ -10036,14 +10067,14 @@ standard_name = surface_air_pressure_from_previous_timestep long_name = surface air pressure from previous timestep units = Pa - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys [ltg1_max] standard_name = lightning_threat_index_1 long_name = lightning threat index 1 units = flashes min-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys intent = inout @@ -10052,7 +10083,7 @@ standard_name = lightning_threat_index_2 long_name = lightning threat index 2 units = flashes min-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys intent = inout @@ -10061,7 +10092,7 @@ standard_name = lightning_threat_index_3 long_name = lightning threat index 3 units = flashes min-1 - dimensions = (horizontal_loop_extent) + dimensions = (horizontal_dimension) type = real kind = kind_phys intent = inout diff --git a/scm/src/scm.F90 b/scm/src/scm.F90 index b6ac80d4a..e5aab8983 100644 --- a/scm/src/scm.F90 +++ b/scm/src/scm.F90 @@ -33,7 +33,7 @@ subroutine scm_main_sub() type(MPI_Comm) :: fcst_mpi_comm - integer :: i, j, kdt_rad, idtend, itrac + integer :: i, j, kdt_rad, idtend, itrac, n_tasks, n_threads real(kind=8) :: rinc(5) !(DAYS, HOURS, MINUTES, SECONDS, MILLISECONDS) integer :: jdat(1:8) @@ -48,6 +48,8 @@ subroutine scm_main_sub() error stop end if fcst_mpi_comm = MPI_COMM_WORLD + n_tasks = 1 + n_threads = 1 call get_config_nml(scm_state) @@ -82,7 +84,7 @@ subroutine scm_main_sub() call interpolate_forcing(scm_input_instance, scm_state, in_spinup) - call physics%create(scm_state%n_cols) + call physics%create(scm_state%n_cols, n_threads) !physics initialization section @@ -131,7 +133,7 @@ subroutine scm_main_sub() call GFS_suite_setup(physics%Model, physics%Statein, physics%Stateout, & physics%Sfcprop, physics%Coupling, physics%Grid, & physics%Tbd, physics%Cldprop, physics%Radtend, & - physics%Diag, physics%Interstitial, 1, 1, & + physics%Diag, physics%Interstitial, n_tasks, n_threads, & physics%Init_parm, scm_state%n_cols, scm_state%lon, & scm_state%lat, scm_state%area) @@ -175,6 +177,7 @@ subroutine scm_main_sub() end if cdata%blk_no = 1 + cdata%chunk_no = 1 cdata%thrd_no = 1 cdata%thrd_cnt = 1 @@ -414,9 +417,9 @@ subroutine scm_main_sub() write(*,*) "itt = ",scm_state%itt write(*,*) "model time (s) = ",scm_state%model_time if (scm_state%lsm_ics .or. scm_state%model_ics) then - write(*,*) "Bowen ratio: ",physics%Interstitial%dtsfc1(1)/physics%Interstitial%dqsfc1(1) - write(*,*) "sensible heat flux (W m-2): ",physics%Interstitial%dtsfc1(1) - write(*,*) "latent heat flux (W m-2): ",physics%Interstitial%dqsfc1(1) + write(*,*) "Bowen ratio: ",physics%Interstitial(1)%dtsfc1(1)/physics%Interstitial(1)%dqsfc1(1) + write(*,*) "sensible heat flux (W m-2): ",physics%Interstitial(1)%dtsfc1(1) + write(*,*) "latent heat flux (W m-2): ",physics%Interstitial(1)%dqsfc1(1) end if if (.not. in_spinup) then diff --git a/scm/src/scm_output.F90 b/scm/src/scm_output.F90 index b41347c19..faa4957be 100644 --- a/scm/src/scm_output.F90 +++ b/scm/src/scm_output.F90 @@ -90,7 +90,7 @@ subroutine output_init(scm_state, physics) CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="hor_dim_layer",LEN=scm_state%n_cols,DIMID=hor_dim_id),"nf90_def_dim(hor_dim_layer)") CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_layer",LEN=scm_state%n_levels,DIMID=vert_dim_id),"nf90_def_dim(vert_dim_layer)") CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_interface",LEN=scm_state%n_levels+1,DIMID=vert_dim_i_id),"nf90_def_dim(vert_dim_interface)") - CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_rad",LEN=physics%Interstitial%lmk,DIMID=vert_dim_rad_id),"nf90_def_dim(vert_dim_rad)") + CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_rad",LEN=physics%Interstitial(1)%lmk,DIMID=vert_dim_rad_id),"nf90_def_dim(vert_dim_rad)") CALL CHECK(NF90_DEF_DIM(NCID=ncid,NAME="vert_dim_soil",LEN=physics%Model%lsoil_lsm,DIMID=vert_dim_soil_id),"nf90_def_dim(vert_dim_soil)") !> - Define the dimension variables. @@ -600,29 +600,29 @@ subroutine output_append_interstitial_inst(ncid, scm_state, physics) type(scm_state_type), intent(in) :: scm_state type(physics_type), intent(in) :: physics - call NetCDF_put_var(ncid, "tau_u", physics%Interstitial%dusfc1(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "tau_v", physics%Interstitial%dvsfc1(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "tau_u", physics%Interstitial(1)%dusfc1(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "tau_v", physics%Interstitial(1)%dvsfc1(:), scm_state%itt_out) if (physics%model%imfdeepcnv >= 0 .or. physics%model%imfshalcnv >= 0) then call NetCDF_put_var(ncid, "upd_mf", physics%Tbd%ud_mf(:,:), scm_state%itt_out) end if - call NetCDF_put_var(ncid, "dwn_mf", physics%Interstitial%dd_mf(:,:), scm_state%itt_out) - call NetCDF_put_var(ncid, "det_mf", physics%Interstitial%dt_mf(:,:), scm_state%itt_out) - - call NetCDF_put_var(ncid, "sfc_up_lw_land", physics%Interstitial%adjsfculw_land(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_up_lw_ice", physics%Interstitial%adjsfculw_ice(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_up_lw_water", physics%Interstitial%adjsfculw_water(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_up_sw_dir_nir", physics%Interstitial%adjnirbmu(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_up_sw_dif_nir", physics%Interstitial%adjnirdfu(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_up_sw_dir_vis", physics%Interstitial%adjvisbmu(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_up_sw_dif_vis", physics%Interstitial%adjvisdfu(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_dwn_sw_dir_nir", physics%Interstitial%adjnirbmd(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_dwn_sw_dif_nir", physics%Interstitial%adjnirdfd(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_dwn_sw_dir_vis", physics%Interstitial%adjvisbmd(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "sfc_dwn_sw_dif_vis", physics%Interstitial%adjvisdfd(:), scm_state%itt_out) - - call NetCDF_put_var(ncid, "mp_prcp_inst", physics%Interstitial%prcpmp(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "dcnv_prcp_inst", physics%Interstitial%raincd(:), scm_state%itt_out) - call NetCDF_put_var(ncid, "scnv_prcp_inst", physics%Interstitial%raincs(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "dwn_mf", physics%Interstitial(1)%dd_mf(:,:), scm_state%itt_out) + call NetCDF_put_var(ncid, "det_mf", physics%Interstitial(1)%dt_mf(:,:), scm_state%itt_out) + + call NetCDF_put_var(ncid, "sfc_up_lw_land", physics%Interstitial(1)%adjsfculw_land(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_up_lw_ice", physics%Interstitial(1)%adjsfculw_ice(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_up_lw_water", physics%Interstitial(1)%adjsfculw_water(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_up_sw_dir_nir", physics%Interstitial(1)%adjnirbmu(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_up_sw_dif_nir", physics%Interstitial(1)%adjnirdfu(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_up_sw_dir_vis", physics%Interstitial(1)%adjvisbmu(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_up_sw_dif_vis", physics%Interstitial(1)%adjvisdfu(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_dwn_sw_dir_nir", physics%Interstitial(1)%adjnirbmd(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_dwn_sw_dif_nir", physics%Interstitial(1)%adjnirdfd(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_dwn_sw_dir_vis", physics%Interstitial(1)%adjvisbmd(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "sfc_dwn_sw_dif_vis", physics%Interstitial(1)%adjvisdfd(:), scm_state%itt_out) + + call NetCDF_put_var(ncid, "mp_prcp_inst", physics%Interstitial(1)%prcpmp(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "dcnv_prcp_inst", physics%Interstitial(1)%raincd(:), scm_state%itt_out) + call NetCDF_put_var(ncid, "scnv_prcp_inst", physics%Interstitial(1)%raincs(:), scm_state%itt_out) end subroutine output_append_interstitial_inst @@ -634,15 +634,15 @@ subroutine output_append_interstitial_rad(ncid, scm_state, physics) type(scm_state_type), intent(in) :: scm_state type(physics_type), intent(in) :: physics - call NetCDF_put_var(ncid, "rad_cloud_fraction", physics%Interstitial%clouds(:,:,1), scm_state%itt_rad) - call NetCDF_put_var(ncid, "rad_cloud_lwp", physics%Interstitial%clouds(:,:,2), scm_state%itt_rad) - call NetCDF_put_var(ncid, "rad_eff_rad_ql", physics%Interstitial%clouds(:,:,3), scm_state%itt_rad) - call NetCDF_put_var(ncid, "rad_cloud_iwp", physics%Interstitial%clouds(:,:,4), scm_state%itt_rad) - call NetCDF_put_var(ncid, "rad_eff_rad_qi", physics%Interstitial%clouds(:,:,5), scm_state%itt_rad) - call NetCDF_put_var(ncid, "rad_cloud_rwp", physics%Interstitial%clouds(:,:,6), scm_state%itt_rad) - call NetCDF_put_var(ncid, "rad_eff_rad_qr", physics%Interstitial%clouds(:,:,7), scm_state%itt_rad) - call NetCDF_put_var(ncid, "rad_cloud_swp", physics%Interstitial%clouds(:,:,8), scm_state%itt_rad) - call NetCDF_put_var(ncid, "rad_eff_rad_qs", physics%Interstitial%clouds(:,:,9), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_cloud_fraction", physics%Interstitial(1)%clouds(:,:,1), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_cloud_lwp", physics%Interstitial(1)%clouds(:,:,2), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_eff_rad_ql", physics%Interstitial(1)%clouds(:,:,3), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_cloud_iwp", physics%Interstitial(1)%clouds(:,:,4), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_eff_rad_qi", physics%Interstitial(1)%clouds(:,:,5), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_cloud_rwp", physics%Interstitial(1)%clouds(:,:,6), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_eff_rad_qr", physics%Interstitial(1)%clouds(:,:,7), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_cloud_swp", physics%Interstitial(1)%clouds(:,:,8), scm_state%itt_rad) + call NetCDF_put_var(ncid, "rad_eff_rad_qs", physics%Interstitial(1)%clouds(:,:,9), scm_state%itt_rad) end subroutine output_append_interstitial_rad diff --git a/scm/src/scm_setup.F90 b/scm/src/scm_setup.F90 index 811844dc0..b3603e88f 100644 --- a/scm/src/scm_setup.F90 +++ b/scm/src/scm_setup.F90 @@ -308,7 +308,7 @@ subroutine GFS_suite_setup (Model, Statein, Stateout, Sfcprop, type(GFS_cldprop_type), intent(inout) :: Cldprop type(GFS_radtend_type), intent(inout) :: Radtend type(GFS_diag_type), intent(inout) :: Diag - type(GFS_interstitial_type), intent(inout) :: Interstitial + type(GFS_interstitial_type), intent(inout) :: Interstitial(:) type(GFS_init_type), intent(in) :: Init_parm integer, intent(in) :: ntasks, nthreads, n_cols @@ -337,18 +337,23 @@ subroutine GFS_suite_setup (Model, Statein, Stateout, Sfcprop, !--- initialize DDTs - call Statein%create(n_cols, Model) - call Stateout%create(n_cols, Model) - call Sfcprop%create(n_cols, Model) - call Coupling%create(n_cols, Model) - call Grid%create(n_cols, Model) - call Tbd%create(n_cols, Model) - call Cldprop%create(n_cols, Model) - call Radtend%create(n_cols, Model) + call Statein%create(Model) + call Stateout%create(Model) + call Sfcprop%create(Model) + call Coupling%create(Model) + call Grid%create(Model) + call Tbd%create(Model) + call Cldprop%create(Model) + call Radtend%create(Model) !--- internal representation of diagnostics - call Diag%create(n_cols, Model) + call Diag%create(Model) !--- internal representation of interstitials for CCPP physics - call Interstitial%create(n_cols, Model) + if (nthreads == 1) then + call Interstitial(1)%create(n_cols, Model) + else + print *,' CCPP SCM is only set up to use one thread - shutting down' + error stop + end if !--- populate the grid components !call GFS_grid_populate (Grid(i), Init_parm%xlon, Init_parm%xlat, Init_parm%area) diff --git a/scm/src/scm_type_defs.F90 b/scm/src/scm_type_defs.F90 index 49a8c71da..23e1cc112 100644 --- a/scm/src/scm_type_defs.F90 +++ b/scm/src/scm_type_defs.F90 @@ -427,7 +427,7 @@ module scm_type_defs type(GFS_cldprop_type) :: Cldprop type(GFS_radtend_type) :: Radtend type(GFS_diag_type) :: Diag - type(GFS_interstitial_type) :: Interstitial + type(GFS_interstitial_type), allocatable :: Interstitial(:) type(GFS_init_type) :: Init_parm contains @@ -947,15 +947,17 @@ subroutine scm_reference_create(scm_reference, nlev) end subroutine scm_reference_create - subroutine physics_create(physics, n_columns) + subroutine physics_create(physics, n_columns, n_threads) class(physics_type) :: physics - integer, intent(in) :: n_columns + integer, intent(in) :: n_columns, n_threads real(kind=kind_phys) :: kind_phys_zero integer :: i integer, dimension(8) :: zeroes_8 - + + allocate(physics%Interstitial(n_threads)) + zeroes_8(:) = int_zero kind_phys_zero = real_zero @@ -1129,7 +1131,7 @@ subroutine physics_set(physics, scm_input, scm_state) call conditionally_set_var(scm_input%input_facwf, physics%Sfcprop%facwf(i), "facwf", .true., missing_var(11)) call conditionally_set_var(scm_input%input_vegfrac, physics%Sfcprop%vfrac(i), "vegfrac", .true., missing_var(12)) !GJF: is this needed anymore (not in FV3GFS_io)? - physics%Interstitial%sigmaf(i) = min(physics%Sfcprop%vfrac(i),0.01) + physics%Interstitial(1)%sigmaf(i) = min(physics%Sfcprop%vfrac(i),0.01) call conditionally_set_var(scm_input%input_canopy, physics%Sfcprop%canopy(i), "canopy", .true., missing_var(13)) call conditionally_set_var(scm_input%input_f10m, physics%Sfcprop%f10m(i), "f10m", .false., missing_var(14)) call conditionally_set_var(scm_input%input_t2m, physics%Sfcprop%t2m(i), "t2m", physics%Model%cplflx, missing_var(15)) diff --git a/scm/src/scm_type_defs.meta b/scm/src/scm_type_defs.meta index dce3cb400..0950d4568 100644 --- a/scm/src/scm_type_defs.meta +++ b/scm/src/scm_type_defs.meta @@ -66,12 +66,18 @@ units = DDT dimensions = () type = GFS_tbd_type -[Interstitial] +[Interstitial(ccpp_thread_number)] standard_name = GFS_interstitial_type_instance long_name = instance of derived type GFS_interstitial_type units = DDT dimensions = () type = GFS_interstitial_type +[Interstitial] + standard_name = GFS_interstitial_type_instance_all_threads + long_name = instance of derived type GFS_interstitial_type + units = DDT + dimensions = (number_of_openmp_threads) + type = GFS_interstitial_type ######################################################################## [ccpp-table-properties] diff --git a/scm/src/suite_info.py b/scm/src/suite_info.py index 494b5dffb..56de9bbcd 100755 --- a/scm/src/suite_info.py +++ b/scm/src/suite_info.py @@ -72,6 +72,7 @@ def timestep(self, value): suite_list.append(suite('SCM_GSD_v1', 'tracers_gsd.txt', 'input_GSD_v1.nml', 600.0, 600.0 , False)) suite_list.append(suite('SCM_RRFS_v1nssl', 'tracers_RRFS_v1nssl_nohail_noccn.txt', 'input_RRFS_v1nssl_nohailnoccn.nml', 600.0, 600.0 , False)) suite_list.append(suite('SCM_csawmg', 'tracers_csawmg.txt', 'input_csawmg.nml', 600.0, 1800.0, False)) +suite_list.append(suite('SCM_GFS_v16_debug', 'tracers_GFS_v16.txt', 'input_GFS_v16.nml', 600.0, 1800.0, False)) def main(): diff --git a/test/rt_test_cases.py b/test/rt_test_cases.py index 1660b48c9..2fba45bfb 100644 --- a/test/rt_test_cases.py +++ b/test/rt_test_cases.py @@ -56,6 +56,7 @@ {"case": "bomex", "suite": "SCM_RRFS_v1beta"}, \ {"case": "bomex", "suite": "SCM_RAP"}, \ {"case": "bomex", "suite": "SCM_GFS_v15p2"}, \ + {"case": "bomex", "suite": "SCM_GFS_v16_debug"}, \ {"case": "astex", "suite": "SCM_GFS_v17_p8"}, \ {"case": "astex", "suite": "SCM_HRRR"}, \ {"case": "astex", "suite": "SCM_RRFS_v1beta"}, \ From f85b6c72c5c1416d9b0420641d079d2ceb20f1c6 Mon Sep 17 00:00:00 2001 From: Grant Firl Date: Thu, 17 Oct 2024 15:22:56 -0400 Subject: [PATCH 2/5] add SDFs using GFS_Debug.F90 schemes --- ccpp/suites/suite_SCM_GFS_v16_debug.xml | 85 ++++++++++++++++++++++ ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml | 66 +++++++++++++++++ 2 files changed, 151 insertions(+) create mode 100644 ccpp/suites/suite_SCM_GFS_v16_debug.xml create mode 100644 ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml diff --git a/ccpp/suites/suite_SCM_GFS_v16_debug.xml b/ccpp/suites/suite_SCM_GFS_v16_debug.xml new file mode 100644 index 000000000..632eec067 --- /dev/null +++ b/ccpp/suites/suite_SCM_GFS_v16_debug.xml @@ -0,0 +1,85 @@ + + + + + + GFS_time_vary_pre + GFS_rrtmg_setup + GFS_rad_time_vary + GFS_phys_time_vary + + + + + GFS_suite_interstitial_rad_reset + GFS_rrtmg_pre + GFS_radiation_surface + rad_sw_pre + rrtmg_sw + rrtmg_sw_post + rrtmg_lw + rrtmg_lw_post + GFS_rrtmg_post + + + + + GFS_suite_interstitial_phys_reset + GFS_suite_stateout_reset + get_prs_fv3 + GFS_suite_interstitial_1 + GFS_surface_generic_pre + GFS_surface_composites_pre + dcyc2t3 + GFS_surface_composites_inter + GFS_suite_interstitial_2 + + + + sfc_diff + GFS_surface_loop_control_part1 + sfc_nst_pre + sfc_nst + sfc_nst_post + lsm_noah + sfc_sice + GFS_surface_loop_control_part2 + + + + GFS_surface_composites_post + sfc_diag + sfc_diag_post + GFS_surface_generic_post + GFS_PBL_generic_pre + satmedmfvdifq + GFS_PBL_generic_post + GFS_GWD_generic_pre + cires_ugwp + cires_ugwp_post + GFS_GWD_generic_post + GFS_suite_stateout_update + h2ophys + get_phi_fv3 + GFS_suite_interstitial_3 + GFS_DCNV_generic_pre + samfdeepcnv + GFS_DCNV_generic_post + GFS_SCNV_generic_pre + samfshalcnv + GFS_SCNV_generic_post + GFS_suite_interstitial_4 + cnvc90 + GFS_MP_generic_pre + gfdl_cloud_microphys + GFS_MP_generic_post + maximum_hourly_diagnostics + GFS_physics_post + GFS_diagtoscreen + GFS_interstitialtoscreen + GFS_checkland + GFS_checktracers + GFS_abort + + + diff --git a/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml b/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml new file mode 100644 index 000000000..11607b39e --- /dev/null +++ b/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml @@ -0,0 +1,66 @@ + + + + + + GFS_time_vary_pre + GFS_rrtmg_setup + GFS_rad_time_vary + GFS_phys_time_vary + + + + + GFS_suite_interstitial_rad_reset + GFS_rrtmg_pre + GFS_radiation_surface + rad_sw_pre + rrtmg_sw + rrtmg_sw_post + rrtmg_lw + rrtmg_lw_post + GFS_rrtmg_post + + + + + GFS_suite_interstitial_phys_reset + GFS_suite_stateout_reset + get_prs_fv3 + GFS_suite_interstitial_1 + GFS_surface_generic_pre + scm_sfc_flux_spec + dcyc2t3 + GFS_suite_interstitial_2 + GFS_PBL_generic_pre + satmedmfvdifq + GFS_PBL_generic_post + GFS_GWD_generic_pre + cires_ugwp + cires_ugwp_post + GFS_GWD_generic_post + GFS_suite_stateout_update + h2ophys + get_phi_fv3 + GFS_suite_interstitial_3 + GFS_DCNV_generic_pre + samfdeepcnv + GFS_DCNV_generic_post + GFS_SCNV_generic_pre + samfshalcnv + GFS_SCNV_generic_post + GFS_suite_interstitial_4 + cnvc90 + GFS_MP_generic_pre + gfdl_cloud_microphys + GFS_MP_generic_post + maximum_hourly_diagnostics + GFS_physics_post + GFS_diagtoscreen + GFS_interstitialtoscreen + GFS_checkland + GFS_checktracers + GFS_abort + + + From 8787b9b139e378204cc99db22214366d8e75a0b4 Mon Sep 17 00:00:00 2001 From: Grant Firl Date: Tue, 22 Oct 2024 13:01:56 -0400 Subject: [PATCH 3/5] add new debug suite to RT compilation --- .github/workflows/ci_run_scm_rts.yml | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/.github/workflows/ci_run_scm_rts.yml b/.github/workflows/ci_run_scm_rts.yml index b23c03422..2d91785e8 100644 --- a/.github/workflows/ci_run_scm_rts.yml +++ b/.github/workflows/ci_run_scm_rts.yml @@ -22,8 +22,8 @@ jobs: sp_ROOT: /home/runner/NCEPLIBS-sp w3emc_ROOT: /home/runner/myw3emc SCM_ROOT: /home/runner/work/ccpp-scm/ccpp-scm - suites: SCM_GFS_v15p2,SCM_GFS_v16,SCM_GFS_v17_p8,SCM_HRRR,SCM_RRFS_v1beta,SCM_RAP,SCM_WoFS_v0,SCM_HRRR_gf,SCM_GFS_v17_p8_ugwpv1,SCM_GFS_v16_RRTMGP - suites_ps: SCM_GFS_v15p2_ps,SCM_GFS_v16_ps,SCM_GFS_v17_p8_ps,SCM_HRRR_ps,SCM_RRFS_v1beta_ps,SCM_RAP_ps,SCM_WoFS_v0_ps,SCM_HRRR_gf_ps,SCM_GFS_v17_p8_ugwpv1_ps,SCM_GFS_v16_RRTMGP_ps + suites: SCM_GFS_v15p2,SCM_GFS_v16,SCM_GFS_v17_p8,SCM_HRRR,SCM_RRFS_v1beta,SCM_RAP,SCM_WoFS_v0,SCM_HRRR_gf,SCM_GFS_v17_p8_ugwpv1,SCM_GFS_v16_RRTMGP,SCM_GFS_v16_debug + suites_ps: SCM_GFS_v15p2_ps,SCM_GFS_v16_ps,SCM_GFS_v17_p8_ps,SCM_HRRR_ps,SCM_RRFS_v1beta_ps,SCM_RAP_ps,SCM_WoFS_v0_ps,SCM_HRRR_gf_ps,SCM_GFS_v17_p8_ugwpv1_ps,SCM_GFS_v16_RRTMGP_ps,SCM_GFS_v16_debug_ps dir_rt: /home/runner/work/ccpp-scm/ccpp-scm/test/artifact-${{matrix.build-type}} dir_bl: /home/runner/work/ccpp-scm/ccpp-scm/test/BL-${{matrix.build-type}} From 473ea75f909ea45378a630393aa18e1d3846c1ec Mon Sep 17 00:00:00 2001 From: Grant Firl Date: Tue, 22 Oct 2024 13:26:05 -0400 Subject: [PATCH 4/5] comment out GFS_abort scheme in new SDFs so that RTs can pass; we don't want a failing run (even if it is on purpose) because it will get flagged and fail CI --- ccpp/suites/suite_SCM_GFS_v16_debug.xml | 2 +- ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/ccpp/suites/suite_SCM_GFS_v16_debug.xml b/ccpp/suites/suite_SCM_GFS_v16_debug.xml index 632eec067..eb07d5a5a 100644 --- a/ccpp/suites/suite_SCM_GFS_v16_debug.xml +++ b/ccpp/suites/suite_SCM_GFS_v16_debug.xml @@ -79,7 +79,7 @@ GFS_interstitialtoscreen GFS_checkland GFS_checktracers - GFS_abort + diff --git a/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml b/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml index 11607b39e..ba443a816 100644 --- a/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml +++ b/ccpp/suites/suite_SCM_GFS_v16_debug_ps.xml @@ -60,7 +60,7 @@ GFS_interstitialtoscreen GFS_checkland GFS_checktracers - GFS_abort + From 0165ede8d9cb3268bfa966c5e52ab10004026c53 Mon Sep 17 00:00:00 2001 From: Grant Firl Date: Tue, 22 Oct 2024 14:29:18 -0400 Subject: [PATCH 5/5] update ccpp/physics after merge --- .gitmodules | 4 ++-- ccpp/physics | 2 +- 2 files changed, 3 insertions(+), 3 deletions(-) diff --git a/.gitmodules b/.gitmodules index e0d1393f1..dc0798c32 100644 --- a/.gitmodules +++ b/.gitmodules @@ -4,8 +4,8 @@ branch = main [submodule "ccpp-physics"] path = ccpp/physics - url = https://github.com/grantfirl/ccpp-physics - branch = ufs-dev-PR183 + url = https://github.com/NCAR/ccpp-physics + branch = main [submodule "CMakeModules"] path = CMakeModules url = https://github.com/noaa-emc/CMakeModules diff --git a/ccpp/physics b/ccpp/physics index 79ff8feab..128533e5e 160000 --- a/ccpp/physics +++ b/ccpp/physics @@ -1 +1 @@ -Subproject commit 79ff8feab0619601eb546ad41119779f5b82cc05 +Subproject commit 128533e5e1c3efe309d8782ab89ece40deab79b3