Accept SMILES with titles

[johnmay]

Firstly great work Scooter! Looks and works really well. Took me a while to work out but my SMILES strings initially weren't rendering because they had titles in them.

CN1C=NC2=C1C(=O)N(C(=O)N2C)C caffeine

Since CXSMILES is passed through in the title this would also be cut off.

CCOCCOCCO |Sg:n:3,4,5::ht| PEGn