-
Notifications
You must be signed in to change notification settings - Fork 0
/
Copy pathrandom.txt
151 lines (151 loc) · 56.8 KB
/
random.txt
1
2
3
4
5
6
7
8
9
10
11
12
13
14
15
16
17
18
19
20
21
22
23
24
25
26
27
28
29
30
31
32
33
34
35
36
37
38
39
40
41
42
43
44
45
46
47
48
49
50
51
52
53
54
55
56
57
58
59
60
61
62
63
64
65
66
67
68
69
70
71
72
73
74
75
76
77
78
79
80
81
82
83
84
85
86
87
88
89
90
91
92
93
94
95
96
97
98
99
100
101
102
103
104
105
106
107
108
109
110
111
112
113
114
115
116
117
118
119
120
121
122
123
124
125
126
127
128
129
130
131
132
133
134
135
136
137
138
139
140
141
142
143
144
145
146
147
148
149
150
151
ID CAS_No Chemical_Name Chemical_Name_Cirpy TSCA_Name VT_KR_NZ_Name Chemical_Name_Scifinder Chemical_Name_SMILECAS Chemical_Name_Reaxys Chemical_Name_OECD_QSAR Chemical_Name_Final Chemical_Name_Final_Source UVCB_TSCA UVCB_SciFinder UVCB_Final UVCB_Final_Source UVCB&Polymers Metals Organometallics Polymers Processes Mixtures Biological InChIKey_Dashboard_all InChIKey_Cirpy InChIKey_Dashboard InChIKey_Reaxys InChIKey_SMILES InChIKey_Scifinder InChIKey_Comparison InChIKey_Final InChIKey_Final_Source InChI_Dashboard InChI_Scifinder InChI_Cirpy InChI_Final InChI_Final_Source SMILES_OECD_QSAR SMILES_Cirpy SMILES_Pubchem SMILES_ClassyFire SMILES_Final SMILES_Final_Source Alternate_CAS_No Deleted_CAS_No Classyfired Pigments Trade_Name ClassyFired_new Fluoro Bromo Chloro Iodo
207994 890525-22-1 Propanoic acid, 3-hydroxy-2-(hydroxymethyl)-2-methyl-, polymer with 1,4-butanediol, 1,6-diisocyanatohexane, dimethyl carbonate, 1,2-ethanediamine, 1,6-hexanediol and 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane, polyethylene-polypropylene glycol mono-Bu ether-blocked Propanoic acid, 3-hydroxy-2-(hydroxymethyl)-2-methyl-, polymer with 1,4-butanediol, 1,6-diisocyanatohexane, dimethyl carbonate, 1,2-ethanediamine, 1,6-hexanediol and 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane, polyethylene-polypropylene glycol mono-Bu ether-blocked Propanoic acid, 3-hydroxy-2-(hydroxymethyl)-2-methyl-, polymer with 1,4-butanediol, 1,6-diisocyanatohexane, dimethyl carbonate, 1,2-ethanediamine, 1,6-hexanediol and 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane, polyethylene-polypropylene glycol mono-Bu ether-blocked US TSCA 0 0 1 US TSCA 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
31169 1312024-58-0 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)-, polymer with N1-(2-aminoethyl)-1,2-ethanediamine, α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl) and 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis[oxirane], reaction products with glycidyl Ph ether and glycidyl o-tolyl ether 1,2-Ethanediamine, N1,N2-bis(2-aminoethyl)-, polymer with N1-(2-aminoethyl)-1,2-ethanediamine, α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl) and 2,2'-[(1-methylethylidene)bis(4,1-phenyleneoxymethylene)]bis[oxirane], reaction products with glycidyl Ph ether and glycidyl o-tolyl ether SciFinder 0 1 1 SciFinder 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
157556 68308-40-7 Tannins, compds. with 4-[(4-aminophenyl)(4-amino-2,5-cyclohexadien-1-ylidene)methyl]-2-methylbenzenamine Tannins, compds. with 4-[(4-aminophenyl)(4-amino-2,5-cyclohexadien-1-ylidene)methyl]-2-methylbenzenamine Tannins, compds. with 4-[(4-aminophenyl)(4-amino-2,5-cyclohexadien-1-ylidene)methyl]-2-methylbenzenamine Tannins, compds. with 4-[(4-aminophenyl)(4-amino-2,5-cyclohexadien-1-ylidene)methyl]-2-methylbenzenamine US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 NIKFYOSELWJIOF-UHFFFAOYSA-N NIKFYOSELWJIOF-UHFFFAOYSA-N OECD QSAR Cl.Cc1cc(ccc1N)C(c1ccc(N)cc1)=C1C=CC(=N)C=C1 Cl.Cc1cc(ccc1N)C(c2ccc(N)cc2)=C3C=CC(=N)C=C3 Cl.Cc1cc(ccc1N)C(=C1C=CC(=N)C=C1)c1ccc(N)cc1 Cl.Cc1cc(ccc1N)C(c1ccc(N)cc1)=C1C=CC(=N)C=C1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
51577 162353-77-7 Acid chlorides, coco, reaction products with keratin hydrolyzates, compds. with triethanolamine Acid chlorides, coco, reaction products with keratin hydrolyzates, compds. with triethanolamine SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
234713 99247-63-9 2-Propenoic acid, polymer with 2-methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid monosodium salt and α-(2-methyl-1-oxo-2-propenyl)-ω-hydroxypoly(oxy-1,2-ethanediyl) (9CI) 2-Propenoic acid, polymer with 2-methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid monosodium salt and α-(2-methyl-1-oxo-2-propenyl)-ω-hydroxypoly(oxy-1,2-ethanediyl) (9CI) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
184412 75543-79-2 1-Octadecanol, 9,9(or 10,10)-bis(hydroxymethyl)- 1-Octadecanol, 9,9(or 10,10)-bis(hydroxymethyl)- SciFinder 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
212382 90530-11-3 2-Propanone, reaction products with phenol, distn. residues 2-Propanone, reaction products with phenol, distn. residues SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
4387 103069-97-2 Linseed oil, reaction products with p-tert-butylphenol-formaldehyde polymer, rosin and tung oil Linseed oil, reaction products with p-tert-butylphenol-formaldehyde polymer, rosin and tung oil SciFinder 0 1 1 SciFinder 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
208706 89957-54-0 Arisaema dracontium, ext. Arisaema dracontium, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
220354 93572-99-7 Dodecanoic acid, reaction products with diethylenetriamine Dodecanoic acid, reaction products with diethylenetriamine SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
177505 72245-07-9 Fatty acids, soya, epoxidized, Me esters, reaction products with 2-[(C12-14-alkyloxy)methyl]oxirane and triethylenetetramine Fatty acids, soya, epoxidized, Me esters, reaction products with [((C=12-14)-alkyloxy)methyl]oxirane and triethylenetetramine Fatty acids, soya, epoxidized, Me esters, reaction products with 2-[(C12-14-alkyloxy)methyl]oxirane and triethylenetetramine Fatty acids, soya, epoxidized, Me esters, reaction products with 2-[(C12-14-alkyloxy)methyl]oxirane and triethylenetetramine US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
199292 84961-91-1 1,2-Ethanediamine, N-(2-aminoethyl)-N'-[2-[(2-aminoethyl)amino]ethyl]-, phosphonomethylated, partially reduced 1,2-Ethanediamine, N-(2-aminoethyl)-N'-[2-[(2-aminoethyl)amino]ethyl]-, phosphonomethylated, partially reduced SciFinder 0 1 1 SciFinder 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0
9858 108737-88-8 2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with 2-hydroxyethyl 2-propenoate 2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with 2-hydroxyethyl 2-propenoate SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
103604 390748-41-1 Nitriles, rosin Nitriles, rosin Nitriles, rosin Nitriles, rosin US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
163515 68648-16-8 Fatty acids, tall-oil, polymd., oxidized Fatty acids, tall-oil, polymd., oxidized Fatty acids, tall oil polymd., oxidized Fatty acids, tall-oil, polymd., oxidized Fatty acids, tall-oil, polymd., oxidized US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
2731 101794-70-1 Amines, N-C12-22-alkyltrimethylenedi-, compds. with oxidized petroleum paraffin oils Amines, N-C12-22-alkyltrimethylenedi-, compds. with oxidized petroleum paraffin oils SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
157563 68308-48-5 Amines, tallow alkyl, ethoxylated, phosphates Amines, tallow alkyl, ethoxylated, phosphates Amines, tallow alkyl, ethoxylated, phosphates Amines, tallow alkyl, ethoxylated, phosphates Amines, tallow alkyl, ethoxylated, phosphates Amines, tallow alkyl, ethoxylated, phosphates US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 VFQPWNXHFBNUNK-UHFFFAOYSA-N VFQPWNXHFBNUNK-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCCCCCCCCNCCOCCOCCOCCOCCOP(O)(O)=O CCCCCCCCCCCCCCCCCCNCCOCCOCCOCCOCCOP(O)(O)=O CCCCCCCCCCCCCCCCCCNCCOCCOCCOCCOCCOP(O)(O)=O OECD QSAR 0 0 1 0 0 1 0 0 0 0
209989 90106-62-0 Scopolia japonica, ext. Scopolia japonica, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
214547 91080-77-2 Quaternary ammonium compounds, C14-18-alkylethyldimethyl, salts with 4-chloro-3,5-dimethylphenol Quaternary ammonium compounds, C14-18-alkylethyldimethyl, salts with 4-chloro-3,5-dimethylphenol SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 1 0
219176 93028-59-2 Fatty acids, coco, sulfo, disodium salts Fatty acids, coco, sulfo, disodium salts SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
232924 97808-33-8 Fatty acids, rape-oil, C7-9-alkyl esters, epoxidized, reaction products with acrylic acid Fatty acids, rape-oil, C7-9-alkyl esters, epoxidized, reaction products with acrylic acid SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
116109 50985-38-1 Poly(oxy-1,2-ethanediyl), α-(4-hydroxybutyl)-ω-hydroxy- Poly(oxy-1,2-ethanediyl), α-(4-hydroxybutyl)-ω-hydroxy- VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
162731 68605-66-3 Fatty acids, tall-oil, polymers with ethylene glycol, fumaric acid, glycerol, pentaerythritol, phthalic anhydride and sorbitol Fatty acids, tall-oil, polymers with ethylene glycol, fumaric acid, glycerol, pentaerythritol, phthalic anhydride and sorbitol Fatty acids, tall oil polymers with ethylene glycol, fumaric acid, glycerol, pentaerythritol, phthalic anhydride and sorbitol Fatty acids, tall-oil, polymers with ethylene glycol, fumaric acid, glycerol, pentaerythritol, phthalic anhydride and sorbitol Fatty acids, tall-oil, polymers with ethylene glycol, fumaric acid, glycerol, pentaerythritol, phthalic anhydride and sorbitol US TSCA 0 0 1 US TSCA 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
86607 29350-42-3 Boric acid (H3BO3), polymer with 1,3-benzenediol Boric acid (H3BO3), polymer with 1,3-benzenediol SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
6880 105179-69-9 Benzene, ethenyl-, polymer with 1,2-butadiene Benzene, ethenyl-, polymer with 1,2-butadiene SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
210170 90131-82-1 Urtica pilulifera, ext. Urtica pilulifera, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
19060 120145-69-9 2-Propenoic acid, 2-methyl-, C10-20-branched and linear alkyl esters, polymers with Me methacrylate and vinylpyrrolidone 2-Propenoic acid, 2-methyl-, C10-20-branched and linear alkyl esters, polymers with Me methacrylate and vinylpyrrolidone VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
194074 83271-53-8 Oxirane, 2-methyl-, polymer with oxirane, carboxymethyl octadecyl ether Oxirane, 2-methyl-, polymer with oxirane, carboxymethyl octadecyl ether SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
173265 71022-38-3 1,3-Isobenzofurandione, polymer with N-(2-aminoethyl)-1,2-ethanediamine 1,3-Isobenzofurandione, polymer with N-(2-aminoethyl)-1,2-ethanediamine VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
113215 480424-86-0 9,9-Didodecylfluorene-2,7-diboronic acid 9,9-Didodecylfluorene-2,7-diboronic acid Dashboard 0 0 1 From Name 0 0 0 0 0 0 0 MLGWUNIPUPZNEE-UHFFFAOYSA-N MLGWUNIPUPZNEE-UHFFFAOYSA-N MLGWUNIPUPZNEE-UHFFFAOYSA-N Dashboard InChI=1S/C37H60B2O4/c1-3-5-7-9-11-13-15-17-19-21-27-37(28-22-20-18-16-14-12-10-8-6-4-2)35-29-31(38(40)41)23-25-33(35)34-26-24-32(39(42)43)30-36(34)37/h23-26,29-30,40-43H,3-22,27-28H2,1-2H3 InChI=1S/C37H60B2O4/c1-3-5-7-9-11-13-15-17-19-21-27-37(28-22-20-18-16-14-12-10-8-6-4-2)35-29-31(38(40)41)23-25-33(35)34-26-24-32(39(42)43)30-36(34)37/h23-26,29-30,40-43H,3-22,27-28H2,1-2H3 Dashboard CCCCCCCCCCCCC1(CCCCCCCCCCCC)C2=C(C=CC(=C2)B(O)O)C2=C1C=C(C=C2)B(O)O CCCCCCCCCCCCC1(CCCCCCCCCCCC)C2=C(C=CC(=C2)B(O)O)C2=C1C=C(C=C2)B(O)O ClassyFire 0 0 1 0 0 1 0 0 0 0
167087 68956-38-7 Fatty acids, tall-oil, polymers with glycerol, linseed oil, isophthalic acid, pentaerythritol, tall oil and TDI Fatty acids, tall-oil, polymers with glycerol, linseed oil, isophthalic acid, pentaerythritol, tall oil and TDI Fatty acids, tall oil polymers with glycerol, linseed oil, isophthalic acid, pentaerythritol, tall oil and TDI Fatty acids, tall-oil, polymers with glycerol, linseed oil, isophthalic acid, pentaerythritol, tall oil and TDI Fatty acids, tall-oil, polymers with glycerol, linseed oil, isophthalic acid, pentaerythritol, tall oil and TDI US TSCA 0 0 1 US TSCA 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
117215 51473-95-1 Poly(oxy-1,2-ethanediyl), α-sulfo-ω-[(9Z)-9-octadecen-1-yloxy]-, ammonium salt (1:1) Poly(oxy-1,2-ethanediyl), ?-sulfo-?-(9-octadecenyloxy)-, ammonium salt, (Z)- Poly(oxy-1,2-ethanediyl), α-sulfo-ω-[(9Z)-9-octadecen-1-yloxy]-, ammonium salt (1:1) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
202736 85566-95-6 2-Propenoic acid, 2-methyl-, C8-11-isoalkyl esters 2-Propenoic acid, 2-methyl-, C8-11-isoalkyl esters SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
160078 68476-04-0 Fatty acids, montan-wax, ethoxylated Fatty acids, montan-wax, ethoxylated Fatty acids, montan-wax, ethoxylated Fatty acids, montan-wax, ethoxylated Fatty acids, montan wax, ethoxylated;Fatty acids, montan-wax, ethoxylated Fatty acids, montan-wax, ethoxylated US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 BBVZWBGLROFBGD-UHFFFAOYSA-N BBVZWBGLROFBGD-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCCOCCOCCOCCOCCO CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCCOCCOCCOCCOCCO CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OCCOCCOCCOCCOCCO OECD QSAR 0 0 1 0 0 1 0 0 0 0
40034 141959-39-9 Soybean oil, reaction products with polypropylene glycol ether with sucrose Soybean oil, reaction products with polypropylene glycol ether with sucrose Soybean oil, reaction products with polypropylene glycol ether with sucrose Soybean oil, reaction products with polypropylene glycol ether with sucrose US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 1 0 0 0 0 0 0 0 0 0 0
217743 92201-56-4 Cinnamomum burmanni, ext. Cinnamomum burmanni, ext.;Cinnamomum burmanni, extracts Cinnamomum burmanni, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
160927 68515-04-8 Asphalt, sapon. products with lignin and rosin, potassium sodium salts Asphalt, sapon. products with lignin and rosin, potassium sodium salts Asphalt, sapon. products with lignin and rosin, potassium sodium salts Asphalt, sapon. products with lignin and rosin, potassium sodium salts Asphalt, sapon. products with lignin and rosin, potassium sodium salts US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
210628 90218-64-7 Benzenesulfonic acid, methyl-, mono-C15-36-branched alkyl derivs., sodium salts Benzenesulfonic acid, methyl-, mono-C15-36-branched alkyl derivs., sodium salts VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
162851 68606-97-3 Oils, peppermint, terpene-free Oils, peppermint, terpene-free Oils, peppermint, terpene-free Oils, peppermint, terpene-free Oils, peppermint, terpene-free Oils, peppermint, terpene-free US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
232868 97766-43-3 Sulfonic acids, alkane(C=20-24) hydroxy and alkene(C=20-24), sodium salts Sulfonic acids, alkane(C=20-24) hydroxy and alkene(C=20-24), sodium salts VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
167528 68987-40-6 Benzene, di-C10-14-alkyl derivs., distn. residues Benzene, di-C10-14-alkyl derivs., distn. residues Benzene, dialkyl(C=10-14) derivs., distn. residues Benzene, di-C10-14-alkyl derivs., distn. residues Benzene, di-C10-14-alkyl derivatives, distillation residues;Benzene, di-C10-14-alkyl derivs., distn. residues Benzene, di-C10-14-alkyl derivs., distn. residues US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 LVYZEGXWMAKHQM-UHFFFAOYSA-N LVYZEGXWMAKHQM-UHFFFAOYSA-N OECD QSAR CCCCCCCCCCc1ccc(CCCCCCCCCC)cc1 CCCCCCCCCCc1ccc(CCCCCCCCCC)cc1 CCCCCCCCCCC1=CC=C(CCCCCCCCCC)C=C1 CCCCCCCCCCc1ccc(CCCCCCCCCC)cc1 OECD QSAR 0 0 1 0 0 1 0 0 0 0
62127 189460-09-1 1,6-Hexanediamine polymer with azacyclotridecan-2-one, hexahydro-2H-azepin-2-one, ethylene glycol and hexanedioic acid 1,6-Hexanediamine polymer with azacyclotridecan-2-one, hexahydro-2H-azepin-2-one, ethylene glycol and hexanedioic acid VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
214919 912451-95-7 1,3-Benzenedicarboxylic acid, polymer with butyl 2-propenoate, ethenylbenzene, 2-ethyl-2-(hydroxymethyl)-1,3-propanediol, 2,5-furandione, 1,6-hexanediol, 2-hydroxyethyl 2-methyl-2-propenoate, methyl 2-methyl-2-propenoate and 2-methyl-2-propenoic acid, 2-hydroxy-3-[(1-oxoneodecyl)oxy]propyl ester (9CI) 1,3-Benzenedicarboxylic acid, polymer with butyl 2-propenoate, ethenylbenzene, 2-ethyl-2-(hydroxymethyl)-1,3-propanediol, 2,5-furandione, 1,6-hexanediol, 2-hydroxyethyl 2-methyl-2-propenoate, methyl 2-methyl-2-propenoate and 2-methyl-2-propenoic acid, 2-hydroxy-3-[(1-oxoneodecyl)oxy]propyl ester (9CI) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
122635 54034-09-2 2-Propenoic acid, polymer with 1,1-dimethylethyl 2-propenoate and ethenyl acetate (9CI) 2-Propenoic acid, polymer with 1,1-dimethylethyl 2-propenoate and ethenyl acetate (9CI) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
15869 116580-54-2 Dextrin, isooctadecanoate Dextrin, isooctadecanoate VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
210455 90193-67-2 Brominated diphenyl ethers Benzene, 1,1'-oxybis-, bromo derivs. Brominated diphenyl ethers Dashboard 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 1 0 0
162648 68604-79-5 Fatty acids, corn-oil, compds. with triethanolamine Fatty acids, corn-oil, compds. with triethanolamine Fatty acids, corn-oil compds. with triethanolamine Fatty acids, corn-oil, compds. with triethanolamine Fatty acids, corn-oil, compds. with triethanolamine US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
114696 500574-15-2 Fatty acids, C18-unsatd., dimers, bis[2-[[2,2-bis[[(1-oxo-2-propenyl)oxy]methyl]butoxy]methyl]-2-[[(1-oxo-2-propenyl)oxy]methyl]butyl] ester Fatty acids, C18-unsatd., dimers, bis[2-[[2,2-bis[[(1-oxo-2-propenyl)oxy]methyl]butoxy]methyl]-2-[[(1-oxo-2-propenyl)oxy]methyl]butyl] ester VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
158255 68389-84-4 Linseed oil, polymer with isophthalic acid, pentaerythritol and 3a,4,7,7a-tetrahydro-1,3-isobenzofurandione Linseed oil, polymer with isophthalic acid, pentaerythritol and 3a,4,7,7a-tetrahydro-1,3-isobenzofurandione Linseed oil polymer with isophthalic acid, pentaerythritol and 3a,4,7,7a-tetrahydro-1,3-isobenzofurandione Linseed oil, polymer with isophthalic acid, pentaerythritol and 3a,4,7,7a-tetrahydro-1,3-isobenzofurandione Linseed oil, polymer with isophthalic acid, pentaerythritol and 3a,4,7,7a-tetrahydro-1,3-isobenzofurandione US TSCA 0 0 1 US TSCA 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
113543 485802-04-8 Tetrahydro-cyclobuta[1,2-c:3,4-c']difurantetrone polymer with 2,2'-dimethyl [1,1'-biphenyl]-4,4'-diamine Tetrahydro-cyclobuta[1,2-c:3,4-c']difurantetrone polymer with 2,2'-dimethyl [1,1'-biphenyl]-4,4'-diamine VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
20402 120989-68-6 2-Propenenitrile, polymer with ethenylbenzene, reaction products with 1-(1-isocyanato-1-methylethyl)-3-(1-methylethenyl)benzene and polyethylene-polypropylene glycol ether with glycerol (3:1) 2-Propenenitrile, polymer with ethenylbenzene, reaction products with 1-(1-isocyanato-1-methylethyl)-3-(1-methylethenyl)benzene and polyethylene-polypropylene glycol ether with glycerol (3:1) 2-Propenenitrile, polymer with ethenylbenzene, reaction products with 1-(1-isocyanato-1-methylethyl)-3-(1-methylethenyl)benzene and polyethylene-polypropylene glycol ether with glycerol (3:1) VT_KR_NZ 0 0 1 From Name 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
160042 68475-67-2 Amines, C12-16-alkyl, compds. with bis(6-methylheptyl) hydrogen phosphate Amines, C12-16-alkyl, compds. with bis(6-methylheptyl) hydrogen phosphate Amines, C12-16-alkyl, compds. with bis(6-methylheptyl) hydrogen phosphate Amines, C12-16-alkyl, compds. with bis(6-methylheptyl) hydrogen phosphate US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
49223 159034-88-5 Amides, coco, propoxylated Amides, coco, propoxylated SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
172318 7084-33-5 Xanthylium, 9-(2-carboxyethyl)-3,6-bis(dimethylamino)-, chloride, compd. with zinc chloride (ZnCl2) (9CI) Xanthylium, 9-(2-carboxyethyl)-3,6-bis(dimethylamino)-, chloride, compd. with zinc chloride (ZnCl2) (9CI) SciFinder 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
165840 68917-47-5 Oils, spike, acetylated, terpene-free Oils, spike, acetylated, terpene-free Oils, spike, acetylated, terpene free;Oils, spike, acetylated, terpene-free Oils, spike, acetylated, terpene-free US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
59867 182697-62-7 Formaldehyde polymer with (chloromethyl)oxirane and methylphenol, 4-cyclohexene-1,2-dicarboxylate 2-propenoate Formaldehyde polymer with (chloromethyl)oxirane and methylphenol, 4-cyclohexene-1,2-dicarboxylate 2-propenoate VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 1 0
209497 90046-07-4 Kat, ext. Kat, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
228454 94552-43-9 Serine, reaction products with malonic acid, oxidized glycerol and propylene glycol Serine, reaction products with malonic acid, oxidized glycerol and propylene glycol SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
81096 265997-94-2 Tar acids, coal, crude, reactions products with 1,1'-methylenebis[4-isocyanatobenzene] Tar acids, coal, crude, reactions products with 1,1'-methylenebis[4-isocyanatobenzene] Tar acids, coal, crude, reactions products with 1,1'-methylenebis[4-isocyanatobenzene] US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
204531 86088-82-6 Brain, hypothalamus, ext. Brain, hypothalamus, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
228312 94481-48-8 Benzenesulfonic acid, 2(or 5)-azido-5(or 2)-[2-(4-azidophenyl)ethenyl]-, monosulfo deriv., disodium salt (9CI) Benzenesulfonic acid, 2(or 5)-azido-5(or 2)-[2-(4-azidophenyl)ethenyl]-, monosulfo deriv., disodium salt (9CI) SciFinder 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
166913 68954-45-0 Bis(2-methylpropyl) hexanedioate Hexanedioic acid, di-C4-13-branched alkyl esters Hexanedioic acid, di-C4-13-branched alkyl esters Hexanedioic acid, di-C4-13-branched alkyl esters Hexanedioic acid, di-C4-13-branched alkyl esters US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 RDOFJDLLWVCMRU-UHFFFAOYSA-N RDOFJDLLWVCMRU-UHFFFAOYSA-N Cirpy InChI=1S/C14H26O4/c1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h11-12H,5-10H2,1-4H3 InChI=1S/C14H26O4/c1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h11-12H,5-10H2,1-4H3 Cirpy CC(C)COC(=O)CCCCC(=O)OCC(C)C CC(C)COC(=O)CCCCC(=O)OCC(C)C ClassyFire 0 0 1 0 0 1 0 0 0 0
167100 68956-51-4 butanedioic acid; 2-ethylhexan-1-ol; hexanedioic acid; methanol; 8-methylnonanoic acid; pentanedioic acid Hexanedioic acid, mixed esters with 2-ethyl-1-hexanol, glutaric acid, isodecanol, methanol and succinic acid Hexanedioic acid mixed esters with 2-ethyl-1-hexanol, glutaric acid, isodecanol, methanol and succinic acid Hexanedioic acid, mixed esters with 2-ethyl-1-hexanol, glutaric acid, isodecanol, methanol and succinic acid Hexanedioic acid, mixed esters with 2-ethyl-1-hexanol, glutaric acid, isodecanol, methanol and succinic acid Hexanedioic acid, mixed esters with 2-ethyl-1-hexanol, glutaric acid, isodecanol, methanol and succinic acid US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 QWBGNIDGNGBPNV-UHFFFAOYSA-N QWBGNIDGNGBPNV-UHFFFAOYSA-N Cirpy InChI=1S/C10H20O2.C8H18O.C6H10O4.C5H8O4.C4H6O4.CH4O/c1-9(2)7-5-3-4-6-8-10(11)12;1-3-5-6-8(4-2)7-9;7-5(8)3-1-2-4-6(9)10;6-4(7)2-1-3-5(8)9;5-3(6)1-2-4(7)8;1-2/h9H,3-8H2,1-2H3,(H,11,12);8-9H,3-7H2,1-2H3;1-4H2,(H,7,8)(H,9,10);1-3H2,(H,6,7)(H,8,9);1-2H2,(H,5,6)(H,7,8);2H,1H3 InChI=1S/C10H20O2.C8H18O.C6H10O4.C5H8O4.C4H6O4.CH4O/c1-9(2)7-5-3-4-6-8-10(11)12;1-3-5-6-8(4-2)7-9;7-5(8)3-1-2-4-6(9)10;6-4(7)2-1-3-5(8)9;5-3(6)1-2-4(7)8;1-2/h9H,3-8H2,1-2H3,(H,11,12);8-9H,3-7H2,1-2H3;1-4H2,(H,7,8)(H,9,10);1-3H2,(H,6,7)(H,8,9);1-2H2,(H,5,6)(H,7,8);2H,1H3 Cirpy CO.OC(=O)CCC(O)=O.CCCCC(CC)CO.OC(=O)CCCC(O)=O.OC(=O)CCCCC(O)=O.CC(C)CCCCCCC(O)=O CO.OC(=O)CCC(O)=O.CCCCC(CC)CO.OC(=O)CCCC(O)=O.OC(=O)CCCCC(O)=O.CC(C)CCCCCCC(O)=O ClassyFire 0 0 1 0 0 1 0 0 0 0
174318 71412-04-9 1-Naphthalenesulfonic acid, 4(or 5)-amino- (9CI) 1-Naphthalenesulfonic acid, 4(or 5)-amino- (9CI) SciFinder 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
209999 90106-72-2 Sedum telephium, ext. Sedum telephium, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
50625 160965-44-6 Resin acids and Rosin acids, esters with glycerol and pentaerythritol, polymers with formaldehyde, petroleum resins and 4-(1,1,3,3-tetramethylbutyl)phenol Resin acids and Rosin acids, esters with glycerol and pentaerythritol, polymers with formaldehyde, petroleum resins and 4-(1,1,3,3-tetramethylbutyl)phenol SciFinder 0 1 1 SciFinder 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
141892 63228-49-9 2-Propenoic acid, methyl ester, polymer with N-(methoxymethyl)-2-propenamide (9CI) 2-Propenoic acid, methyl ester, polymer with N-(methoxymethyl)-2-propenamide (9CI) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
84651 28432-43-1 2-Propenoic acid, 2-methyl-, 2-hydroxypropyl ester, polymer with ethyl 2-propenoate and methyl 2-methyl-2-propenoate 2-Propenoic acid, 2-methyl-, 2-hydroxypropyl ester, polymer with ethyl 2-propenoate and methyl 2-methyl-2-propenoate SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
231167 97105-01-6 L-Glutamic acid, sodium salt (1:1), polymer with L-alanine and L-tyrosine L-Glutamic acid, sodium salt (1:1), polymer with L-alanine and L-tyrosine SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
199250 84961-49-9 Curcuma zedoaria, ext. Curcuma zedoaria, ext.;Curcuma zedoaria, extract Curcuma zedoaria, ext. VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
18505 1198157-91-3 2-Propenoic acid, 2-methyl-, butyl ester, polymer with 2-oxiranylmethyl 2-methyl-2-propenoate, hydrogen 4-cyclohexene-1,2-dicarboxylate 2-methyl-2-propenoate 2-Propenoic acid, 2-methyl-, butyl ester, polymer with 2-oxiranylmethyl 2-methyl-2-propenoate, hydrogen 4-cyclohexene-1,2-dicarboxylate 2-methyl-2-propenoate SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
192784 82229-37-6 Soybean oil, polymd., polymer with adipic acid, neopentyl glycol, phthalic anhydride and trimethylolpropane Soybean oil, polymd., polymer with adipic acid, neopentyl glycol, phthalic anhydride and trimethylolpropane Soybean oil, polymd., polymer with adipic acid, neopentyl glycol, phthalic anhydride and trimethylolpropane Soybean oil, polymd., polymer with adipic acid, neopentyl glycol, phthalic anhydride and trimethylolpropane Soybean oil, polymd., polymer with adipic acid, neopentyl glycol, phthalic anhydride and trimethylolpropane US TSCA 0 0 1 US TSCA 0 0 0 1 1 0 1 0 0 0 0 0 0 0 0 0 0
17371 118685-20-4 Copper, [29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]-, [(2-chloroethyl)amino]sulfonyl sulfo derivs., lithium salts Copper, [29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32]-, [(2-chloroethyl)amino]sulfonyl sulfo derivs., lithium salts SciFinder 0 1 1 SciFinder 0 0 1 0 1 1 0 0 0 0 0 0 0 0 0 1 0
39620 141241-92-1 2-Propenoic acid, 2-methyl-, polymer with oxirane and 2-propenoic acid (9CI) 2-Propenoic acid, 2-methyl-, polymer with oxirane and 2-propenoic acid (9CI) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
88984 30520-32-2 Acrylic acid, polymer with acrylamide, isobutyl acrylate and styrene (8CI) Acrylic acid, polymer with acrylamide, isobutyl acrylate and styrene (8CI) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
232409 97659-49-9 Alopecurus pratensis, ext. Alopecurus pratensis, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
89649 308075-33-4 Silicoaluminophosphate zeolites Silicoaluminophosphate zeolites SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
165083 68891-57-6 Starch, reaction products with epichlorohydrin, ester with thioperoxydicarbonic acid ([(HO)C(S)]2S2) Starch, reaction products with epichlorohydrin, ester with thioperoxydicarbonic acid ([(HO)C(S)]2S2) Starch, reaction products with epichlorohydrin, ester with thioperoxydicarbonic acid ([(HO)C(S)]2S2) US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 1 0 0 0 0 0 0 0 0 1 0
190624 8023-80-1 Oils, scotch broom Oils, scotch broom Oils, broom Oils, broom;Oils, scotch broom Oils, scotch broom US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
108612 42262-66-8 2-Propenoic acid, polymer with methyl 2-propenoate, sodium salt 2-Propenoic acid polymer with methyl 2-propenoate, sodium salt 2-Propenoic acid, polymer with methyl 2-propenoate, sodium salt 2-Propenoic acid, polymer with methyl 2-propenoate, sodium salt Dashboard 0 0 1 From Name 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
50429 160828-77-3 3-(4-Sulfobutyl)-2-[[3-carboxymethyl-5-[(3-ethyl 2(3H)-benzothiazolylidene)ethylidene]-4-oxo-2-thiazolinylidene]methylbenzothiazolium, hydroxide, inner salt compd. with N,N-diethylethanamine (1:1) 3-(4-Sulfobutyl)-2-[[3-carboxymethyl-5-[(3-ethyl 2(3H)-benzothiazolylidene)ethylidene]-4-oxo-2-thiazolinylidene]methylbenzothiazolium, hydroxide, inner salt compd. with N,N-diethylethanamine (1:1) VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
148563 66070-86-8 Fatty acids, tall-oil, polymers with phthalic anhydride and trimethylolpropane Fatty acids, tall-oil, polymers with phthalic anhydride and trimethylolpropane Fatty acids, tall oil polymers with phthalic anhydride and trimethylolpropane Fatty acids, tall-oil, polymers with phthalic anhydride and trimethylolpropane Fatty acids, tall-oil, polymers with phthalic anhydride and trimethylolpropane US TSCA 0 0 1 US TSCA 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
52644 1643921-86-1 2,6-Naphthalenedicarboxylic acid, 2,6-dimethyl ester, polymer with 1,3-benzenedicarboxylic acid, 1,4-benzenedicarboxylic acid, decanedioic acid, 1,3-diisocyanatomethylbenzene, 2,2-dimethyl-1,3-propanediol, 1,2-ethanediol, 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoic acid, 1,3-isobenzofurandione, 1,1'-methylenebis[isocyanatobenzene] and α,α'-[(1-methylethylidene)di-4,1-phenylene]bis[ω-hydroxypoly(oxy-1,2-ethanediyl)], compd. with N,N-diethylethanamine 2,6-Naphthalenedicarboxylic acid, 2,6-dimethyl ester, polymer with 1,3-benzenedicarboxylic acid, 1,4-benzenedicarboxylic acid, decanedioic acid, 1,3-diisocyanatomethylbenzene, 2,2-dimethyl-1,3-propanediol, 1,2-ethanediol, 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoic acid, 1,3-isobenzofurandione, 1,1'-methylenebis[isocyanatobenzene] and α,α'-[(1-methylethylidene)di-4,1-phenylene]bis[ω-hydroxypoly(oxy-1,2-ethanediyl)], compd. with N,N-diethylethanamine SciFinder 0 1 1 SciFinder 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
16930 118086-72-9 1,2,3-Propanetriol, polymer with oxirane, block 1,2,3-Propanetriol, polymer with oxirane, block SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
107044 412008-17-4 Octadecanoic acid, 2-ethylhexyl ester, mixt. with 2-propenoic acid homopolymer sodium salt and .alpha.-tridecyl-.omega.-hydroxypoly(oxy-1,2-ethanediyl) Octadecanoic acid, 2-ethylhexyl ester, mixt. with 2-propenoic acid homopolymer sodium salt and .alpha.-tridecyl-.omega.-hydroxypoly(oxy-1,2-ethanediyl) VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
87187 29630-51-1 2-Propenoic acid, 2-methyl-, 2-hydroxy-3-sulfopropyl ester, sodium salt (1:1), homopolymer 2-Propenoic acid, 2-methyl-, 2-hydroxy-3-sulfopropyl ester, sodium salt (1:1), homopolymer SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
161188 68526-29-4 Fatty acids, tall oil polymers with benzoic acid, glycerol, isophthalic acid and tall oil rosin Fatty acids, tall oil polymers with benzoic acid, glycerol, isophthalic acid and tall oil rosin VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
17980 1192496-10-8 Ethanol, 2-(dibutylamino)-, compds. with polyethylene glycol mono-C10-16-alkyl ethers phosphates Ethanol, 2-(dibutylamino)-, compds. with polyethylene glycol mono-C10-16-alkyl ethers phosphates SciFinder 0 1 1 SciFinder 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
271 100085-71-0 Sulfonic acids, C12-18-alkane, tolyl esters Sulfonic acids, C12-18-alkane, tolyl esters SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
203048 85631-56-7 Titanium, iso-Pr alc. 1-octanol complexes Titanium, iso-Pr alc. 1-octanol complexes Titanium, iso-Pr alc. 1-octanol complexes Titanium, iso-Pr alc. 1-octanol complexes US TSCA 0 0 1 US TSCA 0 0 1 0 0 1 0 0 0 0 0 0 0 0 0 0 0
14377 1143665-71-7 2,5-Furandione, dihydro-3-[3-(trimethoxysilyl)propyl]-, polymer with dimethoxydimethylsilane, 1,1'-(dimethoxysilylene)bis[benzene], trimethoxymethylsilane and (trimethoxysilyl)benzene 2,5-Furandione, dihydro-3-[3-(trimethoxysilyl)propyl]-, polymer with dimethoxydimethylsilane, 1,1'-(dimethoxysilylene)bis[benzene], trimethoxymethylsilane and (trimethoxysilyl)benzene SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
220130 934557-66-1 6,6'-(9H-Fluorene-9,9-diyl)di(naphthalen-2-ol) 6,6'-(9H-Fluoren-9-ylidene)bis-2-naphthalenol 6,6'-(9H-Fluorene-9,9-diyl)di(naphthalen-2-ol) Dashboard 0 0 1 From Name 0 0 0 0 0 0 0 DYOPVXMHYSXHNG-UHFFFAOYSA-N DYOPVXMHYSXHNG-UHFFFAOYSA-N DYOPVXMHYSXHNG-UHFFFAOYSA-N Dashboard InChI=1S/C33H22O2/c34-27-15-11-21-17-25(13-9-23(21)19-27)33(26-14-10-24-20-28(35)16-12-22(24)18-26)31-7-3-1-5-29(31)30-6-2-4-8-32(30)33/h1-20,34-35H InChI=1S/C33H22O2/c34-27-15-11-21-17-25(13-9-23(21)19-27)33(26-14-10-24-20-28(35)16-12-22(24)18-26)31-7-3-1-5-29(31)30-6-2-4-8-32(30)33/h1-20,34-35H Dashboard OC1=CC2=C(C=C1)C=C(C=C2)C1(C2=CC=CC=C2C2=CC=CC=C12)C1=CC2=C(C=C1)C=C(O)C=C2 OC1=CC2=C(C=C1)C=C(C=C2)C1(C2=CC=CC=C2C2=CC=CC=C12)C1=CC2=C(C=C1)C=C(O)C=C2 ClassyFire 0 0 1 0 0 1 0 0 0 0
51935 163149-22-2 Benzene, diethenyl-, polymer with ethenylbenzene and α-(2-methyl-1-oxo-2-propenyl)-ω-hydroxypoly(oxy-1,2-ethanediyl) (9CI) Benzene, diethenyl-, polymer with ethenylbenzene and α-(2-methyl-1-oxo-2-propenyl)-ω-hydroxypoly(oxy-1,2-ethanediyl) (9CI) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
7872 106232-99-9 Linseed oil, polymer with ethylene glycol, glycerol, phthalic anhydride, rosin and tung oil Linseed oil, polymer with ethylene glycol, glycerol, phthalic anhydride, rosin and tung oil SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
233369 97952-81-3 Benzenesulfonic acid, 5-amino-2-[(4-aminophenyl)amino]-, diazotized, coupled with 1-naphthalenol and 5,5'-[oxybis[(5-hydroxy-3,1-phenylene)oxy]]bis[1,3-benzenediol], sodium salts Benzenesulfonic acid, 5-amino-2-[(4-aminophenyl)amino]-, diazotized, coupled with 1-naphthalenol and 5,5'-[oxybis[(5-hydroxy-3,1-phenylene)oxy]]bis[1,3-benzenediol], sodium salts SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
210465 90193-77-4 1,2-Benzenedicarboxylic acid di(C=5-7)-branched alkyl esters, (C=6)-rich 1,2-Benzenedicarboxylic acid di(C=5-7)-branched alkyl esters, (C=6)-rich VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
173607 7114-03-6 Benzenaminium, 4-[[4-(dimethylamino)phenyl][4-(dimethyliminio)-2,5-cyclohexadien-1-ylidene]methyl]-N-ethyl-N,N-dimethyl-, bromide chloride, compd. with zinc chloride (ZnCl2) 4-[[4-(dimethylamino)phenyl][4-(dimethyliminio)cyclohexa-2,5-dien-1-ylidene]methyl]-N-ethyl-N,N-dimethylanilinium bromide chloride, compound with zinc chloride;4-{[4-(dimethylamino)phenyl][4-(dimethyliminio)cyclohexa-2,5-dien-1-ylidene]methyl}-N-ethyl-N,N-dimethylanilinium bromide chloride - dichlorozinc (1:1) Benzenaminium, 4-[[4-(dimethylamino)phenyl][4-(dimethyliminio)-2,5-cyclohexadien-1-ylidene]methyl]-N-ethyl-N,N-dimethyl-, bromide chloride, compd. with zinc chloride (ZnCl2) VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 RRKSQWOQZFIQKW-UHFFFAOYSA-J RRKSQWOQZFIQKW-UHFFFAOYSA-J OECD QSAR [Cl-].[Br-].Cl[Zn]Cl.CC[N+](C)(C)c1ccc(cc1)C(c1ccc(cc1)N(C)C)=C1C=CC(C=C1)=[N+](C)C Cl-].[Cl-].[Cl-].[Zn++].[Br-].CC[N+](C)(C)c1ccc(cc1)[C+](c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C [Cl-].[Br-].Cl[Zn]Cl.CC[N+](C)(C)c1ccc(cc1)C(=C1C=CC(C=C1)=[N+](C)C)c1ccc(cc1)N(C)C [Cl-].[Br-].Cl[Zn]Cl.CC[N+](C)(C)c1ccc(cc1)C(c1ccc(cc1)N(C)C)=C1C=CC(C=C1)=[N+](C)C OECD QSAR 0 0 1 0 0 1 0 0 0 0
203029 85631-36-3 Fatty acids, C14-22, reaction products with acetic acid and ammonia-1,2-dichloroethane reaction product triethylenetetramine fraction Fatty acids, C14-22, reaction products with acetic acid and ammonia-1,2-dichloroethane reaction product triethylenetetramine fraction SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 1 0
100656 372515-64-5 Fats and Glyceridic oils, Moringa oleifera seed Fats and Glyceridic oils, Moringa oleifera seed SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0
11677 11108-72-8 Silicon alloy, base, Si,Fe,Zr (ferrozirconium) Silicon alloy, base, Si,Fe,Zr (ferrozirconium) SciFinder 0 0 1 From Name 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
175843 71799-57-0 1-Propanamine, 3-(hexyloxy)-, branched, phosphates 1-Propanamine, 3-(hexyloxy)-, branched, phosphates 1-Propanamine, 3-(hexyloxy)-, branched, phosphates 1-Propanamine, 3-(hexyloxy)-, branched, phosphates US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
25930 125025-87-8 Formaldehyde, reaction products with C30-40-alkylphenol and triethylenetetramine Formaldehyde, reaction products with C30-40-alkylphenol and triethylenetetramine Formaldehyde, reaction products with C30-40-alkylphenol and triethylenetetramine Formaldehyde, reaction products with C30-40-alkylphenol and triethylenetetramine US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
218894 92908-26-4 1,6-Octadiene, 7-methyl-3-methylene-, acid-hydrated, citronellol fractions 1,6-Octadiene, 7-methyl-3-methylene-, acid-hydrated, citronellol fractions 1,6-Octadiene, 7-methyl-3-methylene-, acid-hydrated, citronellol fractions SMILECAS 0 0 1 From Name 0 0 0 0 1 0 0 QMVPMAAFGQKVCJ-UHFFFAOYSA-N QMVPMAAFGQKVCJ-UHFFFAOYSA-N OECD QSAR CC(CCO)CCC=C(C)C CC(CCO)CCC=C(C)C CC(CCO)CCC=C(C)C CC(CCO)CCC=C(C)C OECD QSAR 0 0 1 0 0 1 0 0 0 0
39991 1418737-23-1 Amines, polyethylenepoly-, reaction products with phthalic anhydride and succinic anhydride monopolyisobutylene derivs. Amines, polyethylenepoly-, reaction products with phthalic anhydride and succinic anhydride monopolyisobutylene derivs. SciFinder 0 1 1 SciFinder 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
200872 85186-63-6 Amines, C10-14-branched and linear alkyl, [2,4-dihydro-4-[(2-hydroxy-4-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)]chromate(1-) Amines, C10-14-branched and linear alkyl, [2,4-dihydro-4-[(2-hydroxy-4-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)]chromate(1-) Amines, C10-14-branched and linear alkyl, [2,4-dihydro-4-[(2-hydroxy-4-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)]chromate(1-) VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
61205 186708-60-1 Siloxanes and Silicones, di-Me, 3-hydroxypropyl group-terminated, ethoxylated polymers with 5-amino-1,3,3-trimethylcyclohexanemethanamine, .alpha.-hydro-.omega.-hydroxypoly(oxy-1,4-butanediyl), 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane and polyethylene glycol Siloxanes and Silicones, di-Me, 3-hydroxypropyl group-terminated, ethoxylated polymers with 5-amino-1,3,3-trimethylcyclohexanemethanamine, .alpha.-hydro-.omega.-hydroxypoly(oxy-1,4-butanediyl), 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane and polyethylene glycol Siloxanes and Silicones, di-Me, 3-hydroxypropyl group-terminated, ethoxylated polymers with 5-amino-1,3,3-trimethylcyclohexanemethanamine, .alpha.-hydro-.omega.-hydroxypoly(oxy-1,4-butanediyl), 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane and polyethylene glycol US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
41225 1436-34-6 2-Butyloxirane 1,2-epoxyhexane Oxirane, butyl- 1,2-epoxyhexane;2-butyloxirane;Oxirane, butyl- 1,2-epoxyhexane VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 0 0 WHNBDXQTMPYBAT-UHFFFAOYSA-N WHNBDXQTMPYBAT-UHFFFAOYSA-N WHNBDXQTMPYBAT-UHFFFAOYSA-N Cirpy InChI=1S/C6H12O/c1-2-3-4-6-5-7-6/h6H,2-5H2,1H3 InChI=1S/C6H12O/c1-2-3-4-6-5-7-6/h6H,2-5H2,1H3 Cirpy CCCCC1CO1 CCCCC1CO1 CCCCC1CO1 QSAR 0 0 1 0 0 1 0 0 0 0
213667 90990-20-8 Fatty acids, C14-18 and C18-unsatd., Bu esters Fatty acids, C14-18 and C18-unsatd., Bu esters SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
4711 103369-26-2 1,3-Isobenzofurandione, polymer with ethenylbenzene, 2,5-furandione, (1-methylethenyl)benzene, 2,2'-oxybis[ethanol] and 1,2-propanediol (9CI) 1,3-Isobenzofurandione, polymer with ethenylbenzene, 2,5-furandione, (1-methylethenyl)benzene, 2,2'-oxybis[ethanol] and 1,2-propanediol (9CI) SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
26383 125328-40-7 Amines, N-canola-oil alkyltrimethylenedi-, dioleates Amines, N-canola-oil alkyltrimethylenedi-, dioleates Amines, N-canola-oil alkyltrimethylenedi-, dioleates SMILECAS 0 0 1 From Name 0 0 0 0 0 1 0 QIJYMNCBEMDMMY-UHFFFAOYSA-N QIJYMNCBEMDMMY-UHFFFAOYSA-N OECD QSAR CCCCCCCC=CCCCCCCCC([O-])=O.CCCCCCCCC=CCCCCCCCC[N+H2]CCC[N+H3].CCCCCCCCC=CCCCCCCCC([O-])=O CCCCCCCC=CCCCCCCCC([O-])=O.CCCCCCCCC=CCCCCCCCC([O-])=O.CCCCCCCCC=CCCCCCCCC[NH2+]CCC[NH3+] CCCCCCCC=CCCCCCCCC([O-])=O.CCCCCCCCC=CCCCCCCCC[N+H2]CCC[N+H3].CCCCCCCCC=CCCCCCCCC([O-])=O OECD QSAR 0 0 1 0 0 1 0 0 0 0
152653 67892-08-4 Gliomastix murorum Gliomastix murorum Gliomastix murorum US TSCA 0 0 1 US TSCA 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
231554 97358-82-2 Phosphoric acid, C12-15-branched and linear alkyl esters, compds. with triethanolamine Phosphoric acid, C12-15-branched and linear alkyl esters, compds. with triethanolamine SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
46702 154099-20-4 2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with methyl 2-methyl-2-propenoate and tridecyl 2-methyl-2-propenoate 2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with methyl 2-methyl-2-propenoate and tridecyl 2-methyl-2-propenoate SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
4647 103331-90-4 1,3,5-Triazine-2,4,6-triamine, N,N',N''-tris(methoxymethyl)-, N,N',N''-tris[(C9-13-alkyloxy)methyl] derivs. 1,3,5-Triazine-2,4,6-triamine, N,N',N''-tris(methoxymethyl)-, N,N',N''-tris[(C9-13-alkyloxy)methyl] derivs. SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
64056 195306-88-8 Carbamic acid, (phosphonomethyl)-, C-(9H-fluoren-9-ylmethyl) ester N-Fmoc-1-aminomethylphosphonic acid; N-Fmoc-1-aminomethylphosphoric acid; Fmoc-GlyP(OH)-OH; [[[(9-fluorenylmethoxy)carbonyl]amino]methyl]phosphonic acid Carbamic acid, (phosphonomethyl)-, C-(9H-fluoren-9-ylmethyl) ester VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 0 0 RBBDDRURGRYWKC-UHFFFAOYSA-N RBBDDRURGRYWKC-UHFFFAOYSA-N Reaxys O[P](O)(=O)CNC(=O)OCC1c2ccccc2c3ccccc13 OP(O)(=O)CNC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12 O[P](O)(=O)CNC(=O)OCC1c2ccccc2c3ccccc13 Cirpy 0 0 1 0 0 1 0 0 0 0
68609 212793-36-7 Amines, dicoco alkyl, reaction products with ditallow alkyl amines and 1-hexadecene-maleic anhydride-polyethylene glycol allyl Me ether-1-tetradecene polymer Amines, dicoco alkyl, reaction products with ditallow alkyl amines and 1-hexadecene-maleic anhydride-polyethylene glycol allyl Me ether-1-tetradecene polymer Amines, dicoco alkyl, reaction products with ditallow alkyl amines and 1-hexadecene-maleic anhydride-polyethylene glycol allyl Me ether-1-tetradecene polymer Amines, dicoco alkyl, reaction products with ditallow alkyl amines and 1-hexadecene-maleic anhydride-polyethylene glycol allyl Me ether-1-tetradecene polymer US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
80102 26221-23-8 Benzoic acid, p-hydroxy-, m-chlorophenyl ester, acetate, polyesters Benzoic acid, p-hydroxy-, m-chlorophenyl ester, acetate, polyesters VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 1 0
4155 102980-00-7 Siloxanes and Silicones, Me hydrogen, reaction products with oleyl alc. Siloxanes and Silicones, Me hydrogen, reaction products with oleyl alc. SciFinder 0 1 1 SciFinder 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
208867 89997-79-5 Clover, Trifolium repens, ext. Clover, Trifolium repens, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
162765 68606-02-0 Fatty acids, vegetable-oil, polymers with acrylonitrile, allyl alc., Me methacrylate and styrene Fatty acids, vegetable-oil, polymers with acrylonitrile, allyl alc., Me methacrylate and styrene Fatty acids, vegetable-oil, polymers with acrylonitrile, allyl alc., Me methacrylate and styrene Fatty acids, vegetable-oil, polymers with acrylonitrile, allyl alc., Me methacrylate and styrene Fatty acids, vegetable-oil, polymers with acrylonitrile, allyl alc., Me methacrylate and styrene US TSCA 0 0 1 US TSCA 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
160991 68515-71-9 Ethanol, 2,2'-iminobis-, N-[3-(C8-12-alkyloxy)propyl] derivs. Ethanol, 2,2'-iminobis-, N-[3-(C8-12-alkyloxy)propyl] derivs. Ethanol, 2,2'-iminobis-, N-[3-(C8-12-alkyloxy)propyl] derivs. US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
976 100403-16-5 Aromatic hydrocarbons, chloro, toluene chlorination byproducts Aromatic hydrocarbons, chloro, toluene chlorination byproducts SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 1 0
155174 68122-68-9 Soybean oil, polymer with diethylene glycol, dipentaerythritol, pentaerythritol and phthalic anhydride Soybean oil, polymer with diethylene glycol, dipentaerythritol, pentaerythritol and phthalic anhydride Soybean oil polymer with diethylene glycol, dipentaerythritol, pentaerythritol and phthalic anhydride Soybean oil, polymer with diethylene glycol, dipentaerythritol, pentaerythritol and phthalic anhydride Soybean oil, polymer with diethylene glycol, dipentaerythritol, pentaerythritol and phthalic anhydride US TSCA 0 0 1 US TSCA 0 0 0 1 0 0 1 0 0 0 0 0 0 0 0 0 0
229365 95193-80-9 Ethene, chlorinated, distn. lights Ethene, chlorinated, distn. lights SciFinder 0 1 1 SciFinder 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 1 0
20697 121212-39-3 2-Propenoic acid, ethyl ester, polymer with diethenylbenzene, 2-ethenylpyridine and methyl 2-propenoate, reaction products with N1-(3-aminopropyl)-N1-methyl-1,3-propanediamine and N1,N1-dimethyl-1,3-propanediamine 2-Propenoic acid, ethyl ester, polymer with diethenylbenzene, 2-ethenylpyridine and methyl 2-propenoate, reaction products with N1-(3-aminopropyl)-N1-methyl-1,3-propanediamine and N1,N1-dimethyl-1,3-propanediamine 2-Propenoic acid, ethyl ester, polymer with diethenylbenzene, 2-ethenylpyridine and methyl 2-propenoate, reaction products with N-(3-aminopropyl)-N-methyl-1,3-propanediamine and N,N-dimethyl-1,3-propanediamine;2-Propenoic acid, ethyl ester, polymer with diethenylbenzene, 2-ethenylpyridine and methyl 2-propenoate, reaction products with N1-(3-aminopropyl)-N1-methyl-1,3-propanediamine and N1,N1-dimethyl-1,3-propanediamine 2-Propenoic acid, ethyl ester, polymer with diethenylbenzene, 2-ethenylpyridine and methyl 2-propenoate, reaction products with N1-(3-aminopropyl)-N1-methyl-1,3-propanediamine and N1,N1-dimethyl-1,3-propanediamine US TSCA 0 0 1 US TSCA 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
215990 91723-42-1 Helianthemum canadense, ext. Helianthemum canadense, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
184265 75444-69-8 (C16-22)-Alkyldimethylamine Amines, C16-22-alkyldimethyl Amines, alkyl (C=16-22) dimethyl Amines, C16-22-alkyldimethyl Amines, C16-22-alkyldimethyl Amines, C16-22-alkyldimethyl US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 NHLUVTZJQOJKCC-UHFFFAOYSA-N NAPSCFZYZVSQHF-UHFFFAOYSA-N NHLUVTZJQOJKCC-UHFFFAOYSA-N Cirpy InChI=1S/C18H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h4-18H2,1-3H3 InChI=1S/C18H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h4-18H2,1-3H3 Cirpy CCCCCCCCCCCCCCCCCCN(C)C CCCCCCCCCCCCCCCCN(C)C CCCCCCCCCCCCCCCCCCN(C)C QSAR 0 0 1 0 0 1 0 0 0 0
3307 102242-50-2 Alcohols, (C=12-24)-unsatd., distn. Residues Alcohols, (C=12-24)-unsatd., distn. Residues VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
209478 90045-88-8 Ipomoea orizabensis, ext. Ipomoea orizabensis, ext. SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
181676 73905-20-1 Pexalyn A 500 (9CI) Pexalyn A 500 (9CI) SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
74895 242812-79-9 Poly(oxy-1,2-ethanediyl), α-hydro-ω-hydroxy-, reaction products with aluminum chloride hydroxide (AlCl(OH)2) Poly(oxy-1,2-ethanediyl), α-hydro-ω-hydroxy-, reaction products with aluminum chloride hydroxide (AlCl(OH)2) SciFinder 0 1 1 SciFinder 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
157683 68309-76-2 Soybean oil, polymer with glycerol, isophthalic acid, terephthalic acid and trimethylolpropane Soybean oil, polymer with glycerol, isophthalic acid, terephthalic acid and trimethylolpropane Soybean oil polymer with glycerol, isophthalic acid, terephthalic acid and trimethylolpropane Soybean oil, polymer with glycerol, isophthalic acid, terephthalic acid and trimethylolpropane Soybean oil, polymer with glycerol, isophthalic acid, terephthalic acid and trimethylolpropane US TSCA 0 0 1 US TSCA 0 0 0 1 0 0 1 0 0 0 0 0 0 0 0 0 0
173917 71243-88-4 Platinate(2-), tetrachloro-, hydrogen (1:2), (SP-4-1)-, reaction products with low-boiling heptene hydroformylation products mercaptoacetates Platinate(2-), tetrachloro-, hydrogen (1:2), (SP-4-1)-, reaction products with low-boiling heptene hydroformylation products mercaptoacetates Platinate(2-), tetrachloro-, hydrogen (1:2), (SP-4-1)-, reaction products with low-boiling heptene hydroformylation products mercaptoacetates Platinate(2-), tetrachloro-, hydrogen (1:2), (SP-4-1)-, reaction products with low-boiling heptene hydroformylation products mercaptoacetates US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 1 0
231420 97281-45-3 Phosphatidylcholines, egg, hydrogenated Phosphatidylcholines, egg, hydrogenated VT_KR_NZ 0 0 1 From Name 0 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0
220872 93763-86-1 Schiff bases, alkyl(C=12-18)idene Me Schiff bases, alkyl(C=12-18)idene Me VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
151196 67674-12-8 Residual oils (petroleum), oxidized, compds. with triethanolamine Residual oils (petroleum), oxidized, compds. with triethanolamine Residual oils (petroleum), oxidized, compds. with triethanolamine Residual oils (petroleum), oxidized, compds. with triethanolamine US TSCA 0 0 1 US TSCA 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
35395 1353091-50-5 Iron oxide (Fe2O3), mixed with silica, calcined Iron oxide (Fe2O3), mixed with silica, calcined SciFinder 0 1 1 SciFinder 0 1 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0
37612 138009-59-3 Rubber, natural, epoxidized Rubber, natural, epoxidized Natural rubber, epoxidized Rubber, natural, epoxidized Rubber, natural, epoxidized US TSCA 0 0 1 US TSCA 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0 0
166102 68920-22-9 Fatty acids, C8-10, triesters with trimethylolethane Fatty acids, C8-10, triesters with trimethylolethane Fatty acids, (C=8-10), triesters with trimethylolethane Fatty acids, C8-10, triesters with trimethylolethane Fatty acids, C8-10, triesters with trimethylolethane US TSCA 0 0 1 US TSCA 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0
188429 78456-92-5 Polyrane (9CI) Polyrane (9CI) SciFinder 0 1 1 SciFinder 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0 0
3762 1027088-83-0 2-Propenoic acid, 2-methyl-, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester, polymer with rel-(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl 2-methyl-2-propenoate 2-Propenoic acid, 2-methyl-, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester, polymer with rel-(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl 2-methyl-2-propenoate SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 1 0 0 0
117451 515844-98-1 Sulfurous acid, sodium salt (1:1), polymer with 5-amino-1,3,3-trimethylcyclohexanemethanamine, 2-butene-1,4-diol, 1,6-diisocyanatohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane, 2-methyloxirane and 2-methyloxirane polymer with oxirane ether with 1,2,3-propanetriol (3:1), polyethylene-polypropylene glycol mono-Bu ether-blocked Sulfurous acid, sodium salt (1:1), polymer with 5-amino-1,3,3-trimethylcyclohexanemethanamine, 2-butene-1,4-diol, 1,6-diisocyanatohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane, 2-methyloxirane and 2-methyloxirane polymer with oxirane ether with 1,2,3-propanetriol (3:1), polyethylene-polypropylene glycol mono-Bu ether-blocked Sulfurous acid, sodium salt (1:1), polymer with 5-amino-1,3,3-trimethylcyclohexanemethanamine, 2-butene-1,4-diol, 1,6-diisocyanatohexane, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane, 2-methyloxirane and 2-methyloxirane polymer with oxirane ether with 1,2,3-propanetriol (3:1), polyethylene-polypropylene glycol mono-Bu ether-blocked US TSCA 0 0 1 US TSCA 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
16943 118106-10-8 Dodecanedioic acid, polymer with 11-aminoundecanoic acid, nonanedioic acid and piperazine Dodecanedioic acid, polymer with 11-aminoundecanoic acid, nonanedioic acid and piperazine SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
218187 92457-01-7 Gardenia jasminoides, ext. Gardenia jasminoides, ext.;Gardenia jasminoides, extract Gardenia jasminoides, ext. VT_KR_NZ 0 0 1 From Name 0 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0
124715 550365-42-9 (Z)-Dimethyl 2-butenedioate polymer with ethenyl acetate, ethenyl neononanoate and 3-methylbutyl tris(1-methylethyl)silyl (2Z)-2-butenedioate (Z)-Dimethyl 2-butenedioate polymer with ethenyl acetate, ethenyl neononanoate and 3-methylbutyl tris(1-methylethyl)silyl (2Z)-2-butenedioate VT_KR_NZ 0 0 1 From Name 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
5325 103818-78-6 Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, monohydrochloride, reaction products with aniline Benzenamine, 4-[(4-aminophenyl)(4-imino-2,5-cyclohexadien-1-ylidene)methyl]-2-methyl-, monohydrochloride, reaction products with aniline SciFinder 0 1 1 SciFinder 0 0 0 0 1 1 0 0 0 0 0 0 0 0 0 0 0
1533 100801-70-5 Plastics, wastes, pyrolyzed, pitch residue fraction Plastics, wastes, pyrolyzed, pitch residue fraction VT_KR_NZ 0 0 1 From Name 0 0 0 1 1 1 0 0 0 0 0 0 0 0 0 0 0
59010 1802295-96-0 2-Propen-1-aminium, N,N-dimethyl-N-2-propen-1-yl-, chloride (1:1), polymer with 2-methylenebutanedioic acid, 2-propenamide and 2-propenoic acid 2-Propen-1-aminium, N,N-dimethyl-N-2-propen-1-yl-, chloride (1:1), polymer with 2-methylenebutanedioic acid, 2-propenamide and 2-propenoic acid SciFinder 0 1 1 SciFinder 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0 0 0
178346 725232-63-3 2-Propenoic acid, 2-methyl-, methyl ester, polymer with butyl 2-propenoate, ethenylbenzene, 2-hydroxyethyl 2-propenoate and 2-propenoic acid, compd. with 2-(dimethylamino)ethanol 2-Propenoic acid, 2-methyl-, methyl ester, polymer with butyl 2-propenoate, ethenylbenzene, 2-hydroxyethyl 2-propenoate and 2-propenoic acid, compd. with 2-(dimethylamino)ethanol SciFinder 0 1 1 SciFinder 0 0 0 1 0 1 0 0 0 0 0 0 0 0 0 0 0
231403 97281-28-2 Fatty acids, olive-oil, C8-15-alkyl esters Fatty acids, olive-oil, C8-15-alkyl esters SciFinder 0 1 1 SciFinder 0 0 0 0 0 1 0 0 0 0 0 0 0 0 0 0 0